From b5c4a783a969479463908fe02f7784b76d619c13 Mon Sep 17 00:00:00 2001
From: estherdev03
Date: Sun, 20 Apr 2025 06:59:32 -0600
Subject: [PATCH] Finish admin dashboard and update sql
---
controllers/category.js | 47 +
controllers/history.js | 90 +
controllers/product.js | 301 +
controllers/recommendation.js | 53 +
controllers/review.js | 302 +
controllers/search.js | 164 +
controllers/user.js | 365 +
index.js | 56 +
node_modules/.bin/mime | 16 +
node_modules/.bin/mime.cmd | 17 +
node_modules/.bin/mime.ps1 | 28 +
node_modules/.bin/nodemon | 16 +
node_modules/.bin/nodemon.cmd | 17 +
node_modules/.bin/nodemon.ps1 | 28 +
node_modules/.bin/nodetouch | 16 +
node_modules/.bin/nodetouch.cmd | 17 +
node_modules/.bin/nodetouch.ps1 | 28 +
node_modules/.bin/semver | 16 +
node_modules/.bin/semver.cmd | 17 +
node_modules/.bin/semver.ps1 | 28 +
node_modules/.package-lock.json | 1558 +++
node_modules/accepts/HISTORY.md | 243 +
node_modules/accepts/LICENSE | 23 +
node_modules/accepts/README.md | 140 +
node_modules/accepts/index.js | 238 +
node_modules/accepts/package.json | 47 +
node_modules/anymatch/LICENSE | 15 +
node_modules/anymatch/README.md | 87 +
node_modules/anymatch/index.d.ts | 20 +
node_modules/anymatch/index.js | 104 +
node_modules/anymatch/package.json | 48 +
node_modules/array-flatten/LICENSE | 21 +
node_modules/array-flatten/README.md | 43 +
node_modules/array-flatten/array-flatten.js | 64 +
node_modules/array-flatten/package.json | 39 +
node_modules/aws-ssl-profiles/LICENSE | 19 +
node_modules/aws-ssl-profiles/README.md | 146 +
.../aws-ssl-profiles/lib/@types/profiles.d.ts | 4 +
.../aws-ssl-profiles/lib/@types/profiles.js | 2 +
node_modules/aws-ssl-profiles/lib/index.d.ts | 8 +
node_modules/aws-ssl-profiles/lib/index.js | 13 +
.../lib/profiles/ca/defaults.d.ts | 9 +
.../lib/profiles/ca/defaults.js | 2888 ++++++
.../lib/profiles/ca/proxies.d.ts | 8 +
.../lib/profiles/ca/proxies.js | 111 +
node_modules/aws-ssl-profiles/package.json | 52 +
.../balanced-match/.github/FUNDING.yml | 2 +
node_modules/balanced-match/LICENSE.md | 21 +
node_modules/balanced-match/README.md | 97 +
node_modules/balanced-match/index.js | 62 +
node_modules/balanced-match/package.json | 48 +
node_modules/bignumber.js/CHANGELOG.md | 266 +
node_modules/bignumber.js/LICENCE | 23 +
node_modules/bignumber.js/README.md | 268 +
node_modules/bignumber.js/bignumber.d.ts | 1829 ++++
node_modules/bignumber.js/bignumber.js | 2902 ++++++
node_modules/bignumber.js/bignumber.min.js | 1 +
.../bignumber.js/bignumber.min.js.map | 1 +
node_modules/bignumber.js/bignumber.mjs | 2888 ++++++
node_modules/bignumber.js/doc/API.html | 2237 +++++
node_modules/bignumber.js/package.json | 40 +
.../binary-extensions/binary-extensions.json | 263 +
.../binary-extensions.json.d.ts | 3 +
node_modules/binary-extensions/index.d.ts | 14 +
node_modules/binary-extensions/index.js | 1 +
node_modules/binary-extensions/license | 10 +
node_modules/binary-extensions/package.json | 40 +
node_modules/binary-extensions/readme.md | 25 +
node_modules/body-parser/HISTORY.md | 672 ++
node_modules/body-parser/LICENSE | 23 +
node_modules/body-parser/README.md | 476 +
node_modules/body-parser/SECURITY.md | 25 +
node_modules/body-parser/index.js | 156 +
node_modules/body-parser/lib/read.js | 205 +
node_modules/body-parser/lib/types/json.js | 247 +
node_modules/body-parser/lib/types/raw.js | 101 +
node_modules/body-parser/lib/types/text.js | 121 +
.../body-parser/lib/types/urlencoded.js | 307 +
node_modules/body-parser/package.json | 56 +
node_modules/brace-expansion/LICENSE | 21 +
node_modules/brace-expansion/README.md | 129 +
node_modules/brace-expansion/index.js | 201 +
node_modules/brace-expansion/package.json | 47 +
node_modules/braces/LICENSE | 21 +
node_modules/braces/README.md | 586 ++
node_modules/braces/index.js | 170 +
node_modules/braces/lib/compile.js | 60 +
node_modules/braces/lib/constants.js | 57 +
node_modules/braces/lib/expand.js | 113 +
node_modules/braces/lib/parse.js | 331 +
node_modules/braces/lib/stringify.js | 32 +
node_modules/braces/lib/utils.js | 122 +
node_modules/braces/package.json | 77 +
.../buffer-equal-constant-time/.npmignore | 2 +
.../buffer-equal-constant-time/.travis.yml | 4 +
.../buffer-equal-constant-time/LICENSE.txt | 12 +
.../buffer-equal-constant-time/README.md | 50 +
.../buffer-equal-constant-time/index.js | 41 +
.../buffer-equal-constant-time/package.json | 21 +
.../buffer-equal-constant-time/test.js | 42 +
node_modules/bytes/History.md | 97 +
node_modules/bytes/LICENSE | 23 +
node_modules/bytes/Readme.md | 152 +
node_modules/bytes/index.js | 170 +
node_modules/bytes/package.json | 42 +
.../call-bind-apply-helpers/.eslintrc | 16 +
.../.github/FUNDING.yml | 12 +
node_modules/call-bind-apply-helpers/.nycrc | 9 +
.../call-bind-apply-helpers/CHANGELOG.md | 23 +
node_modules/call-bind-apply-helpers/LICENSE | 21 +
.../call-bind-apply-helpers/README.md | 62 +
.../call-bind-apply-helpers/actualApply.d.ts | 1 +
.../call-bind-apply-helpers/actualApply.js | 10 +
.../call-bind-apply-helpers/applyBind.d.ts | 19 +
.../call-bind-apply-helpers/applyBind.js | 10 +
.../functionApply.d.ts | 1 +
.../call-bind-apply-helpers/functionApply.js | 4 +
.../call-bind-apply-helpers/functionCall.d.ts | 1 +
.../call-bind-apply-helpers/functionCall.js | 4 +
.../call-bind-apply-helpers/index.d.ts | 46 +
node_modules/call-bind-apply-helpers/index.js | 15 +
.../call-bind-apply-helpers/package.json | 85 +
.../call-bind-apply-helpers/reflectApply.d.ts | 3 +
.../call-bind-apply-helpers/reflectApply.js | 4 +
.../call-bind-apply-helpers/test/index.js | 63 +
.../call-bind-apply-helpers/tsconfig.json | 9 +
node_modules/call-bound/.eslintrc | 13 +
node_modules/call-bound/.github/FUNDING.yml | 12 +
node_modules/call-bound/.nycrc | 9 +
node_modules/call-bound/CHANGELOG.md | 34 +
node_modules/call-bound/LICENSE | 21 +
node_modules/call-bound/README.md | 53 +
node_modules/call-bound/index.d.ts | 13 +
node_modules/call-bound/index.js | 18 +
node_modules/call-bound/package.json | 99 +
node_modules/call-bound/test/index.js | 54 +
node_modules/call-bound/tsconfig.json | 9 +
node_modules/chokidar/LICENSE | 21 +
node_modules/chokidar/README.md | 308 +
node_modules/chokidar/index.js | 973 ++
node_modules/chokidar/lib/constants.js | 66 +
node_modules/chokidar/lib/fsevents-handler.js | 526 +
node_modules/chokidar/lib/nodefs-handler.js | 654 ++
node_modules/chokidar/package.json | 70 +
node_modules/chokidar/types/index.d.ts | 192 +
node_modules/concat-map/.travis.yml | 4 +
node_modules/concat-map/LICENSE | 18 +
node_modules/concat-map/README.markdown | 62 +
node_modules/concat-map/example/map.js | 6 +
node_modules/concat-map/index.js | 13 +
node_modules/concat-map/package.json | 43 +
node_modules/concat-map/test/map.js | 39 +
node_modules/content-disposition/HISTORY.md | 60 +
node_modules/content-disposition/LICENSE | 22 +
node_modules/content-disposition/README.md | 142 +
node_modules/content-disposition/index.js | 458 +
node_modules/content-disposition/package.json | 44 +
node_modules/content-type/HISTORY.md | 29 +
node_modules/content-type/LICENSE | 22 +
node_modules/content-type/README.md | 94 +
node_modules/content-type/index.js | 225 +
node_modules/content-type/package.json | 42 +
node_modules/cookie-signature/.npmignore | 4 +
node_modules/cookie-signature/History.md | 38 +
node_modules/cookie-signature/Readme.md | 42 +
node_modules/cookie-signature/index.js | 51 +
node_modules/cookie-signature/package.json | 18 +
node_modules/cookie/LICENSE | 24 +
node_modules/cookie/README.md | 317 +
node_modules/cookie/SECURITY.md | 25 +
node_modules/cookie/index.js | 334 +
node_modules/cookie/package.json | 44 +
node_modules/core-util-is/LICENSE | 19 +
node_modules/core-util-is/README.md | 3 +
node_modules/core-util-is/lib/util.js | 107 +
node_modules/core-util-is/package.json | 38 +
node_modules/cors/CONTRIBUTING.md | 33 +
node_modules/cors/HISTORY.md | 58 +
node_modules/cors/LICENSE | 22 +
node_modules/cors/README.md | 243 +
node_modules/cors/lib/index.js | 238 +
node_modules/cors/package.json | 41 +
node_modules/crypto/README.md | 7 +
node_modules/crypto/package.json | 19 +
node_modules/debug/.coveralls.yml | 1 +
node_modules/debug/.eslintrc | 11 +
node_modules/debug/.npmignore | 9 +
node_modules/debug/.travis.yml | 14 +
node_modules/debug/CHANGELOG.md | 362 +
node_modules/debug/LICENSE | 19 +
node_modules/debug/Makefile | 50 +
node_modules/debug/README.md | 312 +
node_modules/debug/component.json | 19 +
node_modules/debug/karma.conf.js | 70 +
node_modules/debug/node.js | 1 +
node_modules/debug/package.json | 49 +
node_modules/debug/src/browser.js | 185 +
node_modules/debug/src/debug.js | 202 +
node_modules/debug/src/index.js | 10 +
node_modules/debug/src/inspector-log.js | 15 +
node_modules/debug/src/node.js | 248 +
node_modules/denque/CHANGELOG.md | 29 +
node_modules/denque/LICENSE | 201 +
node_modules/denque/README.md | 77 +
node_modules/denque/index.d.ts | 47 +
node_modules/denque/index.js | 481 +
node_modules/denque/package.json | 58 +
node_modules/depd/History.md | 103 +
node_modules/depd/LICENSE | 22 +
node_modules/depd/Readme.md | 280 +
node_modules/depd/index.js | 538 ++
node_modules/depd/lib/browser/index.js | 77 +
node_modules/depd/package.json | 45 +
node_modules/destroy/LICENSE | 23 +
node_modules/destroy/README.md | 63 +
node_modules/destroy/index.js | 209 +
node_modules/destroy/package.json | 48 +
node_modules/dotenv/CHANGELOG.md | 488 +
node_modules/dotenv/LICENSE | 23 +
node_modules/dotenv/README-es.md | 448 +
node_modules/dotenv/README.md | 651 ++
node_modules/dotenv/config.d.ts | 1 +
node_modules/dotenv/config.js | 9 +
node_modules/dotenv/lib/cli-options.js | 11 +
node_modules/dotenv/lib/env-options.js | 24 +
node_modules/dotenv/lib/main.d.ts | 153 +
node_modules/dotenv/lib/main.js | 361 +
node_modules/dotenv/package.json | 61 +
node_modules/dunder-proto/.eslintrc | 5 +
node_modules/dunder-proto/.github/FUNDING.yml | 12 +
node_modules/dunder-proto/.nycrc | 13 +
node_modules/dunder-proto/CHANGELOG.md | 24 +
node_modules/dunder-proto/LICENSE | 21 +
node_modules/dunder-proto/README.md | 54 +
node_modules/dunder-proto/get.d.ts | 5 +
node_modules/dunder-proto/get.js | 30 +
node_modules/dunder-proto/package.json | 76 +
node_modules/dunder-proto/set.d.ts | 5 +
node_modules/dunder-proto/set.js | 35 +
node_modules/dunder-proto/test/get.js | 34 +
node_modules/dunder-proto/test/index.js | 4 +
node_modules/dunder-proto/test/set.js | 50 +
node_modules/dunder-proto/tsconfig.json | 9 +
node_modules/ecdsa-sig-formatter/CODEOWNERS | 1 +
node_modules/ecdsa-sig-formatter/LICENSE | 201 +
node_modules/ecdsa-sig-formatter/README.md | 65 +
node_modules/ecdsa-sig-formatter/package.json | 46 +
.../src/ecdsa-sig-formatter.d.ts | 17 +
.../src/ecdsa-sig-formatter.js | 187 +
.../src/param-bytes-for-alg.js | 23 +
node_modules/ee-first/LICENSE | 22 +
node_modules/ee-first/README.md | 80 +
node_modules/ee-first/index.js | 95 +
node_modules/ee-first/package.json | 29 +
node_modules/encodeurl/LICENSE | 22 +
node_modules/encodeurl/README.md | 109 +
node_modules/encodeurl/index.js | 60 +
node_modules/encodeurl/package.json | 40 +
node_modules/es-define-property/.eslintrc | 13 +
.../es-define-property/.github/FUNDING.yml | 12 +
node_modules/es-define-property/.nycrc | 9 +
node_modules/es-define-property/CHANGELOG.md | 29 +
node_modules/es-define-property/LICENSE | 21 +
node_modules/es-define-property/README.md | 49 +
node_modules/es-define-property/index.d.ts | 3 +
node_modules/es-define-property/index.js | 14 +
node_modules/es-define-property/package.json | 81 +
node_modules/es-define-property/test/index.js | 56 +
node_modules/es-define-property/tsconfig.json | 10 +
node_modules/es-errors/.eslintrc | 5 +
node_modules/es-errors/.github/FUNDING.yml | 12 +
node_modules/es-errors/CHANGELOG.md | 40 +
node_modules/es-errors/LICENSE | 21 +
node_modules/es-errors/README.md | 55 +
node_modules/es-errors/eval.d.ts | 3 +
node_modules/es-errors/eval.js | 4 +
node_modules/es-errors/index.d.ts | 3 +
node_modules/es-errors/index.js | 4 +
node_modules/es-errors/package.json | 80 +
node_modules/es-errors/range.d.ts | 3 +
node_modules/es-errors/range.js | 4 +
node_modules/es-errors/ref.d.ts | 3 +
node_modules/es-errors/ref.js | 4 +
node_modules/es-errors/syntax.d.ts | 3 +
node_modules/es-errors/syntax.js | 4 +
node_modules/es-errors/test/index.js | 19 +
node_modules/es-errors/tsconfig.json | 49 +
node_modules/es-errors/type.d.ts | 3 +
node_modules/es-errors/type.js | 4 +
node_modules/es-errors/uri.d.ts | 3 +
node_modules/es-errors/uri.js | 4 +
node_modules/es-object-atoms/.eslintrc | 16 +
.../es-object-atoms/.github/FUNDING.yml | 12 +
node_modules/es-object-atoms/CHANGELOG.md | 37 +
node_modules/es-object-atoms/LICENSE | 21 +
node_modules/es-object-atoms/README.md | 63 +
.../RequireObjectCoercible.d.ts | 3 +
.../es-object-atoms/RequireObjectCoercible.js | 11 +
node_modules/es-object-atoms/ToObject.d.ts | 7 +
node_modules/es-object-atoms/ToObject.js | 10 +
node_modules/es-object-atoms/index.d.ts | 3 +
node_modules/es-object-atoms/index.js | 4 +
node_modules/es-object-atoms/isObject.d.ts | 3 +
node_modules/es-object-atoms/isObject.js | 6 +
node_modules/es-object-atoms/package.json | 80 +
node_modules/es-object-atoms/test/index.js | 38 +
node_modules/es-object-atoms/tsconfig.json | 6 +
node_modules/escape-html/LICENSE | 24 +
node_modules/escape-html/Readme.md | 43 +
node_modules/escape-html/index.js | 78 +
node_modules/escape-html/package.json | 24 +
node_modules/etag/HISTORY.md | 83 +
node_modules/etag/LICENSE | 22 +
node_modules/etag/README.md | 159 +
node_modules/etag/index.js | 131 +
node_modules/etag/package.json | 47 +
node_modules/express/History.md | 3656 +++++++
node_modules/express/LICENSE | 24 +
node_modules/express/Readme.md | 260 +
node_modules/express/index.js | 11 +
node_modules/express/lib/application.js | 661 ++
node_modules/express/lib/express.js | 116 +
node_modules/express/lib/middleware/init.js | 43 +
node_modules/express/lib/middleware/query.js | 47 +
node_modules/express/lib/request.js | 525 +
node_modules/express/lib/response.js | 1179 +++
node_modules/express/lib/router/index.js | 673 ++
node_modules/express/lib/router/layer.js | 181 +
node_modules/express/lib/router/route.js | 230 +
node_modules/express/lib/utils.js | 303 +
node_modules/express/lib/view.js | 182 +
node_modules/express/package.json | 102 +
node_modules/fill-range/LICENSE | 21 +
node_modules/fill-range/README.md | 237 +
node_modules/fill-range/index.js | 248 +
node_modules/fill-range/package.json | 74 +
node_modules/finalhandler/HISTORY.md | 210 +
node_modules/finalhandler/LICENSE | 22 +
node_modules/finalhandler/README.md | 147 +
node_modules/finalhandler/SECURITY.md | 25 +
node_modules/finalhandler/index.js | 341 +
node_modules/finalhandler/package.json | 47 +
node_modules/forwarded/HISTORY.md | 21 +
node_modules/forwarded/LICENSE | 22 +
node_modules/forwarded/README.md | 57 +
node_modules/forwarded/index.js | 90 +
node_modules/forwarded/package.json | 45 +
node_modules/fresh/HISTORY.md | 70 +
node_modules/fresh/LICENSE | 23 +
node_modules/fresh/README.md | 119 +
node_modules/fresh/index.js | 137 +
node_modules/fresh/package.json | 46 +
node_modules/function-bind/.eslintrc | 21 +
.../function-bind/.github/FUNDING.yml | 12 +
.../function-bind/.github/SECURITY.md | 3 +
node_modules/function-bind/.nycrc | 13 +
node_modules/function-bind/CHANGELOG.md | 136 +
node_modules/function-bind/LICENSE | 20 +
node_modules/function-bind/README.md | 46 +
node_modules/function-bind/implementation.js | 84 +
node_modules/function-bind/index.js | 5 +
node_modules/function-bind/package.json | 87 +
node_modules/function-bind/test/.eslintrc | 9 +
node_modules/function-bind/test/index.js | 252 +
node_modules/generate-function/.travis.yml | 3 +
node_modules/generate-function/LICENSE | 21 +
node_modules/generate-function/README.md | 89 +
node_modules/generate-function/example.js | 27 +
node_modules/generate-function/index.js | 181 +
node_modules/generate-function/package.json | 32 +
node_modules/generate-function/test.js | 49 +
node_modules/get-intrinsic/.eslintrc | 38 +
.../get-intrinsic/.github/FUNDING.yml | 12 +
node_modules/get-intrinsic/.nycrc | 9 +
node_modules/get-intrinsic/CHANGELOG.md | 178 +
node_modules/get-intrinsic/LICENSE | 21 +
node_modules/get-intrinsic/README.md | 71 +
node_modules/get-intrinsic/index.js | 377 +
node_modules/get-intrinsic/package.json | 97 +
.../get-intrinsic/test/GetIntrinsic.js | 274 +
node_modules/get-proto/.eslintrc | 10 +
node_modules/get-proto/.github/FUNDING.yml | 12 +
node_modules/get-proto/.nycrc | 9 +
node_modules/get-proto/CHANGELOG.md | 21 +
node_modules/get-proto/LICENSE | 21 +
.../get-proto/Object.getPrototypeOf.d.ts | 5 +
.../get-proto/Object.getPrototypeOf.js | 6 +
node_modules/get-proto/README.md | 50 +
.../get-proto/Reflect.getPrototypeOf.d.ts | 3 +
.../get-proto/Reflect.getPrototypeOf.js | 4 +
node_modules/get-proto/index.d.ts | 5 +
node_modules/get-proto/index.js | 27 +
node_modules/get-proto/package.json | 81 +
node_modules/get-proto/test/index.js | 68 +
node_modules/get-proto/tsconfig.json | 9 +
node_modules/glob-parent/CHANGELOG.md | 110 +
node_modules/glob-parent/LICENSE | 15 +
node_modules/glob-parent/README.md | 137 +
node_modules/glob-parent/index.js | 42 +
node_modules/glob-parent/package.json | 48 +
node_modules/gopd/.eslintrc | 16 +
node_modules/gopd/.github/FUNDING.yml | 12 +
node_modules/gopd/CHANGELOG.md | 45 +
node_modules/gopd/LICENSE | 21 +
node_modules/gopd/README.md | 40 +
node_modules/gopd/gOPD.d.ts | 1 +
node_modules/gopd/gOPD.js | 4 +
node_modules/gopd/index.d.ts | 5 +
node_modules/gopd/index.js | 15 +
node_modules/gopd/package.json | 77 +
node_modules/gopd/test/index.js | 36 +
node_modules/gopd/tsconfig.json | 9 +
node_modules/has-flag/index.js | 8 +
node_modules/has-flag/license | 9 +
node_modules/has-flag/package.json | 44 +
node_modules/has-flag/readme.md | 70 +
node_modules/has-symbols/.eslintrc | 11 +
node_modules/has-symbols/.github/FUNDING.yml | 12 +
node_modules/has-symbols/.nycrc | 9 +
node_modules/has-symbols/CHANGELOG.md | 91 +
node_modules/has-symbols/LICENSE | 21 +
node_modules/has-symbols/README.md | 46 +
node_modules/has-symbols/index.d.ts | 3 +
node_modules/has-symbols/index.js | 14 +
node_modules/has-symbols/package.json | 111 +
node_modules/has-symbols/shams.d.ts | 3 +
node_modules/has-symbols/shams.js | 45 +
node_modules/has-symbols/test/index.js | 22 +
.../has-symbols/test/shams/core-js.js | 29 +
.../test/shams/get-own-property-symbols.js | 29 +
node_modules/has-symbols/test/tests.js | 58 +
node_modules/has-symbols/tsconfig.json | 10 +
node_modules/hasown/.eslintrc | 5 +
node_modules/hasown/.github/FUNDING.yml | 12 +
node_modules/hasown/.nycrc | 13 +
node_modules/hasown/CHANGELOG.md | 40 +
node_modules/hasown/LICENSE | 21 +
node_modules/hasown/README.md | 40 +
node_modules/hasown/index.d.ts | 3 +
node_modules/hasown/index.js | 8 +
node_modules/hasown/package.json | 92 +
node_modules/hasown/tsconfig.json | 6 +
node_modules/http-errors/HISTORY.md | 180 +
node_modules/http-errors/LICENSE | 23 +
node_modules/http-errors/README.md | 169 +
node_modules/http-errors/index.js | 289 +
node_modules/http-errors/package.json | 50 +
node_modules/iconv-lite/Changelog.md | 162 +
node_modules/iconv-lite/LICENSE | 21 +
node_modules/iconv-lite/README.md | 156 +
.../iconv-lite/encodings/dbcs-codec.js | 555 ++
.../iconv-lite/encodings/dbcs-data.js | 176 +
node_modules/iconv-lite/encodings/index.js | 22 +
node_modules/iconv-lite/encodings/internal.js | 188 +
.../iconv-lite/encodings/sbcs-codec.js | 72 +
.../encodings/sbcs-data-generated.js | 451 +
.../iconv-lite/encodings/sbcs-data.js | 174 +
.../encodings/tables/big5-added.json | 122 +
.../iconv-lite/encodings/tables/cp936.json | 264 +
.../iconv-lite/encodings/tables/cp949.json | 273 +
.../iconv-lite/encodings/tables/cp950.json | 177 +
.../iconv-lite/encodings/tables/eucjp.json | 182 +
.../encodings/tables/gb18030-ranges.json | 1 +
.../encodings/tables/gbk-added.json | 55 +
.../iconv-lite/encodings/tables/shiftjis.json | 125 +
node_modules/iconv-lite/encodings/utf16.js | 177 +
node_modules/iconv-lite/encodings/utf7.js | 290 +
node_modules/iconv-lite/lib/bom-handling.js | 52 +
node_modules/iconv-lite/lib/extend-node.js | 217 +
node_modules/iconv-lite/lib/index.d.ts | 24 +
node_modules/iconv-lite/lib/index.js | 153 +
node_modules/iconv-lite/lib/streams.js | 121 +
node_modules/iconv-lite/package.json | 46 +
node_modules/ignore-by-default/LICENSE | 14 +
node_modules/ignore-by-default/README.md | 26 +
node_modules/ignore-by-default/index.js | 12 +
node_modules/ignore-by-default/package.json | 34 +
node_modules/inherits/LICENSE | 16 +
node_modules/inherits/README.md | 42 +
node_modules/inherits/inherits.js | 9 +
node_modules/inherits/inherits_browser.js | 27 +
node_modules/inherits/package.json | 29 +
node_modules/ipaddr.js/LICENSE | 19 +
node_modules/ipaddr.js/README.md | 233 +
node_modules/ipaddr.js/ipaddr.min.js | 1 +
node_modules/ipaddr.js/lib/ipaddr.js | 673 ++
node_modules/ipaddr.js/lib/ipaddr.js.d.ts | 68 +
node_modules/ipaddr.js/package.json | 35 +
node_modules/is-binary-path/index.d.ts | 17 +
node_modules/is-binary-path/index.js | 7 +
node_modules/is-binary-path/license | 9 +
node_modules/is-binary-path/package.json | 40 +
node_modules/is-binary-path/readme.md | 34 +
node_modules/is-extglob/LICENSE | 21 +
node_modules/is-extglob/README.md | 107 +
node_modules/is-extglob/index.js | 20 +
node_modules/is-extglob/package.json | 69 +
node_modules/is-glob/LICENSE | 21 +
node_modules/is-glob/README.md | 206 +
node_modules/is-glob/index.js | 150 +
node_modules/is-glob/package.json | 81 +
node_modules/is-number/LICENSE | 21 +
node_modules/is-number/README.md | 187 +
node_modules/is-number/index.js | 18 +
node_modules/is-number/package.json | 82 +
node_modules/is-property/.npmignore | 17 +
node_modules/is-property/LICENSE | 22 +
node_modules/is-property/README.md | 28 +
node_modules/is-property/is-property.js | 5 +
node_modules/is-property/package.json | 36 +
node_modules/isarray/.npmignore | 1 +
node_modules/isarray/.travis.yml | 4 +
node_modules/isarray/Makefile | 6 +
node_modules/isarray/README.md | 60 +
node_modules/isarray/component.json | 19 +
node_modules/isarray/index.js | 5 +
node_modules/isarray/package.json | 45 +
node_modules/isarray/test.js | 20 +
node_modules/jsonwebtoken/LICENSE | 21 +
node_modules/jsonwebtoken/README.md | 396 +
node_modules/jsonwebtoken/decode.js | 30 +
node_modules/jsonwebtoken/index.js | 8 +
.../jsonwebtoken/lib/JsonWebTokenError.js | 14 +
.../jsonwebtoken/lib/NotBeforeError.js | 13 +
.../jsonwebtoken/lib/TokenExpiredError.js | 13 +
.../lib/asymmetricKeyDetailsSupported.js | 3 +
node_modules/jsonwebtoken/lib/psSupported.js | 3 +
.../lib/rsaPssKeyDetailsSupported.js | 3 +
node_modules/jsonwebtoken/lib/timespan.js | 18 +
.../jsonwebtoken/lib/validateAsymmetricKey.js | 66 +
.../jsonwebtoken/node_modules/ms/index.js | 162 +
.../jsonwebtoken/node_modules/ms/license.md | 21 +
.../jsonwebtoken/node_modules/ms/package.json | 38 +
.../jsonwebtoken/node_modules/ms/readme.md | 59 +
node_modules/jsonwebtoken/package.json | 71 +
node_modules/jsonwebtoken/sign.js | 253 +
node_modules/jsonwebtoken/verify.js | 263 +
node_modules/jwa/LICENSE | 17 +
node_modules/jwa/README.md | 150 +
node_modules/jwa/index.js | 252 +
node_modules/jwa/package.json | 37 +
node_modules/jws/CHANGELOG.md | 34 +
node_modules/jws/LICENSE | 17 +
node_modules/jws/index.js | 22 +
node_modules/jws/lib/data-stream.js | 55 +
node_modules/jws/lib/sign-stream.js | 78 +
node_modules/jws/lib/tostring.js | 10 +
node_modules/jws/lib/verify-stream.js | 120 +
node_modules/jws/package.json | 34 +
node_modules/jws/readme.md | 255 +
node_modules/lodash.includes/LICENSE | 47 +
node_modules/lodash.includes/README.md | 18 +
node_modules/lodash.includes/index.js | 745 ++
node_modules/lodash.includes/package.json | 17 +
node_modules/lodash.isboolean/LICENSE | 22 +
node_modules/lodash.isboolean/README.md | 18 +
node_modules/lodash.isboolean/index.js | 70 +
node_modules/lodash.isboolean/package.json | 17 +
node_modules/lodash.isinteger/LICENSE | 47 +
node_modules/lodash.isinteger/README.md | 18 +
node_modules/lodash.isinteger/index.js | 265 +
node_modules/lodash.isinteger/package.json | 17 +
node_modules/lodash.isnumber/LICENSE | 22 +
node_modules/lodash.isnumber/README.md | 18 +
node_modules/lodash.isnumber/index.js | 79 +
node_modules/lodash.isnumber/package.json | 17 +
node_modules/lodash.isplainobject/LICENSE | 47 +
node_modules/lodash.isplainobject/README.md | 18 +
node_modules/lodash.isplainobject/index.js | 139 +
.../lodash.isplainobject/package.json | 17 +
node_modules/lodash.isstring/LICENSE | 22 +
node_modules/lodash.isstring/README.md | 18 +
node_modules/lodash.isstring/index.js | 95 +
node_modules/lodash.isstring/package.json | 17 +
node_modules/lodash.once/LICENSE | 47 +
node_modules/lodash.once/README.md | 18 +
node_modules/lodash.once/index.js | 294 +
node_modules/lodash.once/package.json | 17 +
node_modules/long/LICENSE | 202 +
node_modules/long/README.md | 280 +
node_modules/long/index.d.ts | 2 +
node_modules/long/index.js | 1467 +++
node_modules/long/package.json | 50 +
node_modules/long/umd/index.d.ts | 457 +
node_modules/long/umd/index.js | 1432 +++
node_modules/long/umd/package.json | 3 +
node_modules/lru-cache/LICENSE | 15 +
node_modules/lru-cache/README.md | 1117 +++
node_modules/lru-cache/index.d.ts | 869 ++
node_modules/lru-cache/index.js | 1227 +++
node_modules/lru-cache/index.mjs | 1227 +++
node_modules/lru-cache/package.json | 96 +
node_modules/lru.min/LICENSE | 21 +
node_modules/lru.min/README.md | 384 +
node_modules/lru.min/browser/lru.min.js | 1 +
node_modules/lru.min/lib/index.d.ts | 38 +
node_modules/lru.min/lib/index.js | 228 +
node_modules/lru.min/lib/index.mjs | 206 +
node_modules/lru.min/package.json | 89 +
node_modules/math-intrinsics/.eslintrc | 16 +
.../math-intrinsics/.github/FUNDING.yml | 12 +
node_modules/math-intrinsics/CHANGELOG.md | 24 +
node_modules/math-intrinsics/LICENSE | 21 +
node_modules/math-intrinsics/README.md | 50 +
node_modules/math-intrinsics/abs.d.ts | 1 +
node_modules/math-intrinsics/abs.js | 4 +
.../constants/maxArrayLength.d.ts | 3 +
.../constants/maxArrayLength.js | 4 +
.../constants/maxSafeInteger.d.ts | 3 +
.../constants/maxSafeInteger.js | 5 +
.../math-intrinsics/constants/maxValue.d.ts | 3 +
.../math-intrinsics/constants/maxValue.js | 5 +
node_modules/math-intrinsics/floor.d.ts | 1 +
node_modules/math-intrinsics/floor.js | 4 +
node_modules/math-intrinsics/isFinite.d.ts | 3 +
node_modules/math-intrinsics/isFinite.js | 12 +
node_modules/math-intrinsics/isInteger.d.ts | 3 +
node_modules/math-intrinsics/isInteger.js | 16 +
node_modules/math-intrinsics/isNaN.d.ts | 1 +
node_modules/math-intrinsics/isNaN.js | 6 +
.../math-intrinsics/isNegativeZero.d.ts | 3 +
.../math-intrinsics/isNegativeZero.js | 6 +
node_modules/math-intrinsics/max.d.ts | 1 +
node_modules/math-intrinsics/max.js | 4 +
node_modules/math-intrinsics/min.d.ts | 1 +
node_modules/math-intrinsics/min.js | 4 +
node_modules/math-intrinsics/mod.d.ts | 3 +
node_modules/math-intrinsics/mod.js | 9 +
node_modules/math-intrinsics/package.json | 86 +
node_modules/math-intrinsics/pow.d.ts | 1 +
node_modules/math-intrinsics/pow.js | 4 +
node_modules/math-intrinsics/round.d.ts | 1 +
node_modules/math-intrinsics/round.js | 4 +
node_modules/math-intrinsics/sign.d.ts | 3 +
node_modules/math-intrinsics/sign.js | 11 +
node_modules/math-intrinsics/test/index.js | 192 +
node_modules/math-intrinsics/tsconfig.json | 3 +
node_modules/media-typer/HISTORY.md | 22 +
node_modules/media-typer/LICENSE | 22 +
node_modules/media-typer/README.md | 81 +
node_modules/media-typer/index.js | 270 +
node_modules/media-typer/package.json | 26 +
node_modules/merge-descriptors/HISTORY.md | 21 +
node_modules/merge-descriptors/LICENSE | 23 +
node_modules/merge-descriptors/README.md | 49 +
node_modules/merge-descriptors/index.js | 60 +
node_modules/merge-descriptors/package.json | 39 +
node_modules/methods/HISTORY.md | 29 +
node_modules/methods/LICENSE | 24 +
node_modules/methods/README.md | 51 +
node_modules/methods/index.js | 69 +
node_modules/methods/package.json | 36 +
node_modules/mime-db/HISTORY.md | 507 +
node_modules/mime-db/LICENSE | 23 +
node_modules/mime-db/README.md | 100 +
node_modules/mime-db/db.json | 8519 +++++++++++++++++
node_modules/mime-db/index.js | 12 +
node_modules/mime-db/package.json | 60 +
node_modules/mime-types/HISTORY.md | 397 +
node_modules/mime-types/LICENSE | 23 +
node_modules/mime-types/README.md | 113 +
node_modules/mime-types/index.js | 188 +
node_modules/mime-types/package.json | 44 +
node_modules/mime/.npmignore | 0
node_modules/mime/CHANGELOG.md | 164 +
node_modules/mime/LICENSE | 21 +
node_modules/mime/README.md | 90 +
node_modules/mime/cli.js | 8 +
node_modules/mime/mime.js | 108 +
node_modules/mime/package.json | 44 +
node_modules/mime/src/build.js | 53 +
node_modules/mime/src/test.js | 60 +
node_modules/mime/types.json | 1 +
node_modules/minimatch/LICENSE | 15 +
node_modules/minimatch/README.md | 230 +
node_modules/minimatch/minimatch.js | 947 ++
node_modules/minimatch/package.json | 33 +
node_modules/ms/index.js | 152 +
node_modules/ms/license.md | 21 +
node_modules/ms/package.json | 37 +
node_modules/ms/readme.md | 51 +
node_modules/mysql/Changes.md | 569 ++
node_modules/mysql/License | 19 +
node_modules/mysql/Readme.md | 1548 +++
node_modules/mysql/index.js | 161 +
node_modules/mysql/lib/Connection.js | 529 +
node_modules/mysql/lib/ConnectionConfig.js | 209 +
node_modules/mysql/lib/Pool.js | 294 +
node_modules/mysql/lib/PoolCluster.js | 288 +
node_modules/mysql/lib/PoolConfig.js | 32 +
node_modules/mysql/lib/PoolConnection.js | 65 +
node_modules/mysql/lib/PoolNamespace.js | 136 +
node_modules/mysql/lib/PoolSelector.js | 31 +
node_modules/mysql/lib/protocol/Auth.js | 168 +
node_modules/mysql/lib/protocol/BufferList.js | 25 +
.../mysql/lib/protocol/PacketHeader.js | 5 +
.../mysql/lib/protocol/PacketWriter.js | 211 +
node_modules/mysql/lib/protocol/Parser.js | 491 +
node_modules/mysql/lib/protocol/Protocol.js | 463 +
node_modules/mysql/lib/protocol/ResultSet.js | 7 +
node_modules/mysql/lib/protocol/SqlString.js | 1 +
node_modules/mysql/lib/protocol/Timer.js | 33 +
.../mysql/lib/protocol/constants/charsets.js | 262 +
.../mysql/lib/protocol/constants/client.js | 26 +
.../mysql/lib/protocol/constants/errors.js | 2476 +++++
.../lib/protocol/constants/field_flags.js | 18 +
.../lib/protocol/constants/server_status.js | 39 +
.../lib/protocol/constants/ssl_profiles.js | 1480 +++
.../mysql/lib/protocol/constants/types.js | 72 +
.../packets/AuthSwitchRequestPacket.js | 20 +
.../packets/AuthSwitchResponsePacket.js | 14 +
.../packets/ClientAuthenticationPacket.js | 54 +
.../protocol/packets/ComChangeUserPacket.js | 26 +
.../lib/protocol/packets/ComPingPacket.js | 12 +
.../lib/protocol/packets/ComQueryPacket.js | 15 +
.../lib/protocol/packets/ComQuitPacket.js | 12 +
.../protocol/packets/ComStatisticsPacket.js | 12 +
.../mysql/lib/protocol/packets/EmptyPacket.js | 9 +
.../mysql/lib/protocol/packets/EofPacket.js | 25 +
.../mysql/lib/protocol/packets/ErrorPacket.js | 35 +
.../mysql/lib/protocol/packets/Field.js | 26 +
.../mysql/lib/protocol/packets/FieldPacket.js | 93 +
.../packets/HandshakeInitializationPacket.js | 103 +
.../protocol/packets/LocalDataFilePacket.js | 15 +
.../packets/LocalInfileRequestPacket.js | 21 +
.../mysql/lib/protocol/packets/OkPacket.js | 44 +
.../lib/protocol/packets/OldPasswordPacket.js | 14 +
.../protocol/packets/ResultSetHeaderPacket.js | 14 +
.../lib/protocol/packets/RowDataPacket.js | 130 +
.../lib/protocol/packets/SSLRequestPacket.js | 27 +
.../lib/protocol/packets/StatisticsPacket.js | 20 +
.../protocol/packets/UseOldPasswordPacket.js | 14 +
.../mysql/lib/protocol/packets/index.js | 23 +
.../lib/protocol/sequences/ChangeUser.js | 67 +
.../mysql/lib/protocol/sequences/Handshake.js | 126 +
.../mysql/lib/protocol/sequences/Ping.js | 19 +
.../mysql/lib/protocol/sequences/Query.js | 228 +
.../mysql/lib/protocol/sequences/Quit.js | 40 +
.../mysql/lib/protocol/sequences/Sequence.js | 125 +
.../lib/protocol/sequences/Statistics.js | 30 +
.../mysql/lib/protocol/sequences/index.js | 7 +
.../mysql/node_modules/safe-buffer/LICENSE | 21 +
.../mysql/node_modules/safe-buffer/README.md | 584 ++
.../mysql/node_modules/safe-buffer/index.d.ts | 187 +
.../mysql/node_modules/safe-buffer/index.js | 62 +
.../node_modules/safe-buffer/package.json | 37 +
.../mysql/node_modules/sqlstring/HISTORY.md | 43 +
.../mysql/node_modules/sqlstring/LICENSE | 19 +
.../mysql/node_modules/sqlstring/README.md | 206 +
.../mysql/node_modules/sqlstring/index.js | 1 +
.../node_modules/sqlstring/lib/SqlString.js | 237 +
.../mysql/node_modules/sqlstring/package.json | 47 +
node_modules/mysql/package.json | 46 +
node_modules/mysql2/License | 19 +
node_modules/mysql2/README.md | 114 +
node_modules/mysql2/index.d.ts | 1 +
node_modules/mysql2/index.js | 77 +
node_modules/mysql2/lib/auth_41.js | 95 +
.../lib/auth_plugins/caching_sha2_password.js | 106 +
.../lib/auth_plugins/caching_sha2_password.md | 18 +
node_modules/mysql2/lib/auth_plugins/index.js | 8 +
.../lib/auth_plugins/mysql_clear_password.js | 17 +
.../lib/auth_plugins/mysql_native_password.js | 32 +
.../lib/auth_plugins/sha256_password.js | 60 +
node_modules/mysql2/lib/base/connection.js | 945 ++
node_modules/mysql2/lib/base/pool.js | 233 +
.../mysql2/lib/base/pool_connection.js | 63 +
.../mysql2/lib/commands/auth_switch.js | 108 +
.../mysql2/lib/commands/binlog_dump.js | 109 +
.../mysql2/lib/commands/change_user.js | 66 +
.../mysql2/lib/commands/client_handshake.js | 239 +
.../mysql2/lib/commands/close_statement.js | 18 +
node_modules/mysql2/lib/commands/command.js | 55 +
node_modules/mysql2/lib/commands/execute.js | 107 +
node_modules/mysql2/lib/commands/index.js | 27 +
node_modules/mysql2/lib/commands/ping.js | 36 +
node_modules/mysql2/lib/commands/prepare.js | 143 +
node_modules/mysql2/lib/commands/query.js | 323 +
node_modules/mysql2/lib/commands/quit.js | 29 +
.../mysql2/lib/commands/register_slave.js | 27 +
.../mysql2/lib/commands/server_handshake.js | 197 +
.../mysql2/lib/compressed_protocol.js | 127 +
node_modules/mysql2/lib/connection.js | 12 +
node_modules/mysql2/lib/connection_config.js | 284 +
.../mysql2/lib/constants/charset_encodings.js | 316 +
node_modules/mysql2/lib/constants/charsets.js | 317 +
node_modules/mysql2/lib/constants/client.js | 39 +
node_modules/mysql2/lib/constants/commands.js | 36 +
node_modules/mysql2/lib/constants/cursor.js | 8 +
.../mysql2/lib/constants/encoding_charset.js | 49 +
node_modules/mysql2/lib/constants/errors.js | 3968 ++++++++
.../mysql2/lib/constants/field_flags.js | 20 +
.../mysql2/lib/constants/server_status.js | 44 +
.../mysql2/lib/constants/session_track.js | 11 +
.../mysql2/lib/constants/ssl_profiles.js | 11 +
node_modules/mysql2/lib/constants/types.js | 65 +
node_modules/mysql2/lib/create_connection.js | 10 +
node_modules/mysql2/lib/create_pool.js | 10 +
.../mysql2/lib/create_pool_cluster.js | 9 +
node_modules/mysql2/lib/helpers.js | 87 +
node_modules/mysql2/lib/packet_parser.js | 195 +
.../mysql2/lib/packets/auth_next_factor.js | 35 +
.../mysql2/lib/packets/auth_switch_request.js | 38 +
.../packets/auth_switch_request_more_data.js | 33 +
.../lib/packets/auth_switch_response.js | 30 +
node_modules/mysql2/lib/packets/binary_row.js | 95 +
.../mysql2/lib/packets/binlog_dump.js | 33 +
.../lib/packets/binlog_query_statusvars.js | 115 +
.../mysql2/lib/packets/change_user.js | 97 +
.../mysql2/lib/packets/close_statement.js | 21 +
.../mysql2/lib/packets/column_definition.js | 290 +
node_modules/mysql2/lib/packets/execute.js | 212 +
node_modules/mysql2/lib/packets/handshake.js | 112 +
.../mysql2/lib/packets/handshake_response.js | 145 +
node_modules/mysql2/lib/packets/index.js | 152 +
node_modules/mysql2/lib/packets/packet.js | 931 ++
.../mysql2/lib/packets/prepare_statement.js | 27 +
.../lib/packets/prepared_statement_header.js | 16 +
node_modules/mysql2/lib/packets/query.js | 27 +
.../mysql2/lib/packets/register_slave.js | 46 +
.../mysql2/lib/packets/resultset_header.js | 119 +
.../mysql2/lib/packets/ssl_request.js | 25 +
node_modules/mysql2/lib/packets/text_row.js | 47 +
.../mysql2/lib/parsers/binary_parser.js | 229 +
.../mysql2/lib/parsers/parser_cache.js | 66 +
node_modules/mysql2/lib/parsers/string.js | 50 +
.../mysql2/lib/parsers/text_parser.js | 212 +
node_modules/mysql2/lib/pool.js | 12 +
node_modules/mysql2/lib/pool_cluster.js | 365 +
node_modules/mysql2/lib/pool_config.js | 30 +
node_modules/mysql2/lib/pool_connection.js | 12 +
node_modules/mysql2/lib/promise/connection.js | 222 +
.../mysql2/lib/promise/inherit_events.js | 27 +
.../mysql2/lib/promise/make_done_cb.js | 19 +
node_modules/mysql2/lib/promise/pool.js | 112 +
.../mysql2/lib/promise/pool_connection.js | 19 +
.../lib/promise/prepared_statement_info.js | 32 +
node_modules/mysql2/lib/results_stream.js | 38 +
node_modules/mysql2/lib/server.js | 37 +
.../iconv-lite/.github/dependabot.yml | 11 +
.../iconv-lite/.idea/codeStyles/Project.xml | 47 +
.../.idea/codeStyles/codeStyleConfig.xml | 5 +
.../iconv-lite/.idea/iconv-lite.iml | 12 +
.../inspectionProfiles/Project_Default.xml | 6 +
.../node_modules/iconv-lite/.idea/modules.xml | 8 +
.../node_modules/iconv-lite/.idea/vcs.xml | 6 +
.../node_modules/iconv-lite/Changelog.md | 212 +
.../mysql2/node_modules/iconv-lite/LICENSE | 21 +
.../mysql2/node_modules/iconv-lite/README.md | 130 +
.../iconv-lite/encodings/dbcs-codec.js | 597 ++
.../iconv-lite/encodings/dbcs-data.js | 188 +
.../iconv-lite/encodings/index.js | 23 +
.../iconv-lite/encodings/internal.js | 198 +
.../iconv-lite/encodings/sbcs-codec.js | 72 +
.../encodings/sbcs-data-generated.js | 451 +
.../iconv-lite/encodings/sbcs-data.js | 179 +
.../encodings/tables/big5-added.json | 122 +
.../iconv-lite/encodings/tables/cp936.json | 264 +
.../iconv-lite/encodings/tables/cp949.json | 273 +
.../iconv-lite/encodings/tables/cp950.json | 177 +
.../iconv-lite/encodings/tables/eucjp.json | 182 +
.../encodings/tables/gb18030-ranges.json | 1 +
.../encodings/tables/gbk-added.json | 56 +
.../iconv-lite/encodings/tables/shiftjis.json | 125 +
.../iconv-lite/encodings/utf16.js | 197 +
.../iconv-lite/encodings/utf32.js | 319 +
.../node_modules/iconv-lite/encodings/utf7.js | 290 +
.../iconv-lite/lib/bom-handling.js | 52 +
.../node_modules/iconv-lite/lib/index.d.ts | 41 +
.../node_modules/iconv-lite/lib/index.js | 180 +
.../node_modules/iconv-lite/lib/streams.js | 109 +
.../node_modules/iconv-lite/package.json | 44 +
node_modules/mysql2/package.json | 91 +
node_modules/mysql2/promise.d.ts | 131 +
node_modules/mysql2/promise.js | 201 +
node_modules/mysql2/typings/mysql/LICENSE.txt | 15 +
node_modules/mysql2/typings/mysql/index.d.ts | 95 +
node_modules/mysql2/typings/mysql/info.txt | 1 +
.../mysql2/typings/mysql/lib/Auth.d.ts | 30 +
.../mysql2/typings/mysql/lib/Connection.d.ts | 434 +
.../mysql2/typings/mysql/lib/Pool.d.ts | 69 +
.../mysql2/typings/mysql/lib/PoolCluster.d.ts | 90 +
.../typings/mysql/lib/PoolConnection.d.ts | 10 +
.../mysql2/typings/mysql/lib/Server.d.ts | 11 +
.../lib/constants/CharsetToEncoding.d.ts | 8 +
.../typings/mysql/lib/constants/Charsets.d.ts | 326 +
.../typings/mysql/lib/constants/Types.d.ts | 70 +
.../typings/mysql/lib/constants/index.d.ts | 5 +
.../mysql/lib/parsers/ParserCache.d.ts | 4 +
.../typings/mysql/lib/parsers/index.d.ts | 18 +
.../typings/mysql/lib/parsers/typeCast.d.ts | 54 +
.../mysql/lib/protocol/packets/Field.d.ts | 10 +
.../lib/protocol/packets/FieldPacket.d.ts | 27 +
.../mysql/lib/protocol/packets/OkPacket.d.ts | 23 +
.../lib/protocol/packets/ProcedurePacket.d.ts | 13 +
.../lib/protocol/packets/ResultSetHeader.d.ts | 18 +
.../lib/protocol/packets/RowDataPacket.d.ts | 9 +
.../mysql/lib/protocol/packets/index.d.ts | 28 +
.../packets/params/ErrorPacketParams.d.ts | 6 +
.../packets/params/OkPacketParams.d.ts | 9 +
.../protocol/sequences/ExecutableBase.d.ts | 40 +
.../mysql/lib/protocol/sequences/Prepare.d.ts | 69 +
.../mysql/lib/protocol/sequences/Query.d.ts | 170 +
.../lib/protocol/sequences/QueryableBase.d.ts | 40 +
.../lib/protocol/sequences/Sequence.d.ts | 5 +
.../sequences/promise/ExecutableBase.d.ts | 21 +
.../sequences/promise/QueryableBase.d.ts | 21 +
node_modules/named-placeholders/LICENSE | 21 +
node_modules/named-placeholders/README.md | 29 +
node_modules/named-placeholders/index.js | 179 +
node_modules/named-placeholders/package.json | 32 +
node_modules/negotiator/HISTORY.md | 108 +
node_modules/negotiator/LICENSE | 24 +
node_modules/negotiator/README.md | 203 +
node_modules/negotiator/index.js | 82 +
node_modules/negotiator/lib/charset.js | 169 +
node_modules/negotiator/lib/encoding.js | 184 +
node_modules/negotiator/lib/language.js | 179 +
node_modules/negotiator/lib/mediaType.js | 294 +
node_modules/negotiator/package.json | 42 +
node_modules/nodemailer/.gitattributes | 6 +
node_modules/nodemailer/.ncurc.js | 11 +
node_modules/nodemailer/.prettierrc.js | 8 +
node_modules/nodemailer/CHANGELOG.md | 841 ++
node_modules/nodemailer/CODE_OF_CONDUCT.md | 76 +
node_modules/nodemailer/LICENSE | 16 +
node_modules/nodemailer/README.md | 86 +
node_modules/nodemailer/SECURITY.txt | 22 +
.../nodemailer/lib/addressparser/index.js | 327 +
node_modules/nodemailer/lib/base64/index.js | 142 +
node_modules/nodemailer/lib/dkim/index.js | 251 +
.../nodemailer/lib/dkim/message-parser.js | 155 +
.../nodemailer/lib/dkim/relaxed-body.js | 154 +
node_modules/nodemailer/lib/dkim/sign.js | 117 +
node_modules/nodemailer/lib/fetch/cookies.js | 281 +
node_modules/nodemailer/lib/fetch/index.js | 274 +
.../nodemailer/lib/json-transport/index.js | 82 +
.../nodemailer/lib/mail-composer/index.js | 565 ++
node_modules/nodemailer/lib/mailer/index.js | 429 +
.../nodemailer/lib/mailer/mail-message.js | 315 +
.../nodemailer/lib/mime-funcs/index.js | 625 ++
.../nodemailer/lib/mime-funcs/mime-types.js | 2104 ++++
.../nodemailer/lib/mime-node/index.js | 1314 +++
.../nodemailer/lib/mime-node/last-newline.js | 33 +
.../nodemailer/lib/mime-node/le-unix.js | 43 +
.../nodemailer/lib/mime-node/le-windows.js | 52 +
node_modules/nodemailer/lib/nodemailer.js | 150 +
node_modules/nodemailer/lib/punycode/index.js | 460 +
node_modules/nodemailer/lib/qp/index.js | 219 +
.../lib/sendmail-transport/index.js | 210 +
.../nodemailer/lib/ses-transport/index.js | 349 +
node_modules/nodemailer/lib/shared/index.js | 688 ++
.../lib/smtp-connection/data-stream.js | 108 +
.../lib/smtp-connection/http-proxy-client.js | 143 +
.../nodemailer/lib/smtp-connection/index.js | 1836 ++++
.../nodemailer/lib/smtp-pool/index.js | 648 ++
.../nodemailer/lib/smtp-pool/pool-resource.js | 253 +
.../nodemailer/lib/smtp-transport/index.js | 416 +
.../nodemailer/lib/stream-transport/index.js | 135 +
.../nodemailer/lib/well-known/index.js | 47 +
.../nodemailer/lib/well-known/services.json | 370 +
node_modules/nodemailer/lib/xoauth2/index.js | 376 +
node_modules/nodemailer/package.json | 43 +
node_modules/nodemon/.prettierrc.json | 3 +
node_modules/nodemon/LICENSE | 21 +
node_modules/nodemon/README.md | 448 +
node_modules/nodemon/bin/nodemon.js | 16 +
node_modules/nodemon/bin/windows-kill.exe | Bin 0 -> 80384 bytes
node_modules/nodemon/doc/cli/authors.txt | 8 +
node_modules/nodemon/doc/cli/config.txt | 44 +
node_modules/nodemon/doc/cli/help.txt | 29 +
node_modules/nodemon/doc/cli/logo.txt | 20 +
node_modules/nodemon/doc/cli/options.txt | 36 +
node_modules/nodemon/doc/cli/topics.txt | 8 +
node_modules/nodemon/doc/cli/usage.txt | 3 +
node_modules/nodemon/doc/cli/whoami.txt | 9 +
node_modules/nodemon/index.d.ts | 125 +
node_modules/nodemon/jsconfig.json | 7 +
node_modules/nodemon/lib/cli/index.js | 49 +
node_modules/nodemon/lib/cli/parse.js | 230 +
node_modules/nodemon/lib/config/command.js | 43 +
node_modules/nodemon/lib/config/defaults.js | 34 +
node_modules/nodemon/lib/config/exec.js | 234 +
node_modules/nodemon/lib/config/index.js | 93 +
node_modules/nodemon/lib/config/load.js | 225 +
node_modules/nodemon/lib/help/index.js | 27 +
node_modules/nodemon/lib/index.js | 1 +
node_modules/nodemon/lib/monitor/index.js | 4 +
node_modules/nodemon/lib/monitor/match.js | 287 +
node_modules/nodemon/lib/monitor/run.js | 562 ++
node_modules/nodemon/lib/monitor/signals.js | 34 +
node_modules/nodemon/lib/monitor/watch.js | 244 +
node_modules/nodemon/lib/nodemon.js | 317 +
node_modules/nodemon/lib/rules/add.js | 89 +
node_modules/nodemon/lib/rules/index.js | 53 +
node_modules/nodemon/lib/rules/parse.js | 43 +
node_modules/nodemon/lib/spawn.js | 74 +
node_modules/nodemon/lib/utils/bus.js | 44 +
node_modules/nodemon/lib/utils/clone.js | 40 +
node_modules/nodemon/lib/utils/colour.js | 26 +
node_modules/nodemon/lib/utils/index.js | 103 +
node_modules/nodemon/lib/utils/log.js | 82 +
node_modules/nodemon/lib/utils/merge.js | 47 +
node_modules/nodemon/lib/version.js | 100 +
.../nodemon/node_modules/debug/LICENSE | 20 +
.../nodemon/node_modules/debug/README.md | 481 +
.../nodemon/node_modules/debug/package.json | 65 +
.../nodemon/node_modules/debug/src/browser.js | 272 +
.../nodemon/node_modules/debug/src/common.js | 292 +
.../nodemon/node_modules/debug/src/index.js | 10 +
.../nodemon/node_modules/debug/src/node.js | 263 +
node_modules/nodemon/node_modules/ms/index.js | 162 +
.../nodemon/node_modules/ms/license.md | 21 +
.../nodemon/node_modules/ms/package.json | 38 +
.../nodemon/node_modules/ms/readme.md | 59 +
node_modules/nodemon/package.json | 75 +
node_modules/normalize-path/LICENSE | 21 +
node_modules/normalize-path/README.md | 127 +
node_modules/normalize-path/index.js | 35 +
node_modules/normalize-path/package.json | 77 +
node_modules/object-assign/index.js | 90 +
node_modules/object-assign/license | 21 +
node_modules/object-assign/package.json | 42 +
node_modules/object-assign/readme.md | 61 +
node_modules/object-inspect/.eslintrc | 53 +
.../object-inspect/.github/FUNDING.yml | 12 +
node_modules/object-inspect/.nycrc | 13 +
node_modules/object-inspect/CHANGELOG.md | 416 +
node_modules/object-inspect/LICENSE | 21 +
node_modules/object-inspect/example/all.js | 23 +
.../object-inspect/example/circular.js | 6 +
node_modules/object-inspect/example/fn.js | 5 +
.../object-inspect/example/inspect.js | 10 +
node_modules/object-inspect/index.js | 541 ++
.../object-inspect/package-support.json | 20 +
node_modules/object-inspect/package.json | 104 +
node_modules/object-inspect/readme.markdown | 84 +
node_modules/object-inspect/test-core-js.js | 26 +
node_modules/object-inspect/test/bigint.js | 58 +
.../object-inspect/test/browser/dom.js | 15 +
node_modules/object-inspect/test/circular.js | 16 +
node_modules/object-inspect/test/deep.js | 12 +
node_modules/object-inspect/test/element.js | 53 +
node_modules/object-inspect/test/err.js | 48 +
node_modules/object-inspect/test/fakes.js | 29 +
node_modules/object-inspect/test/fn.js | 76 +
node_modules/object-inspect/test/global.js | 17 +
node_modules/object-inspect/test/has.js | 15 +
node_modules/object-inspect/test/holes.js | 15 +
.../object-inspect/test/indent-option.js | 271 +
node_modules/object-inspect/test/inspect.js | 139 +
node_modules/object-inspect/test/lowbyte.js | 12 +
node_modules/object-inspect/test/number.js | 58 +
.../object-inspect/test/quoteStyle.js | 26 +
.../object-inspect/test/toStringTag.js | 40 +
node_modules/object-inspect/test/undef.js | 12 +
node_modules/object-inspect/test/values.js | 211 +
node_modules/object-inspect/util.inspect.js | 1 +
node_modules/on-finished/HISTORY.md | 98 +
node_modules/on-finished/LICENSE | 23 +
node_modules/on-finished/README.md | 162 +
node_modules/on-finished/index.js | 234 +
node_modules/on-finished/package.json | 39 +
node_modules/parseurl/HISTORY.md | 58 +
node_modules/parseurl/LICENSE | 24 +
node_modules/parseurl/README.md | 133 +
node_modules/parseurl/index.js | 158 +
node_modules/parseurl/package.json | 40 +
node_modules/path-to-regexp/LICENSE | 21 +
node_modules/path-to-regexp/Readme.md | 35 +
node_modules/path-to-regexp/index.js | 156 +
node_modules/path-to-regexp/package.json | 30 +
node_modules/picomatch/CHANGELOG.md | 136 +
node_modules/picomatch/LICENSE | 21 +
node_modules/picomatch/README.md | 708 ++
node_modules/picomatch/index.js | 3 +
node_modules/picomatch/lib/constants.js | 179 +
node_modules/picomatch/lib/parse.js | 1091 +++
node_modules/picomatch/lib/picomatch.js | 342 +
node_modules/picomatch/lib/scan.js | 391 +
node_modules/picomatch/lib/utils.js | 64 +
node_modules/picomatch/package.json | 81 +
node_modules/process-nextick-args/index.js | 45 +
node_modules/process-nextick-args/license.md | 19 +
.../process-nextick-args/package.json | 25 +
node_modules/process-nextick-args/readme.md | 18 +
node_modules/proxy-addr/HISTORY.md | 161 +
node_modules/proxy-addr/LICENSE | 22 +
node_modules/proxy-addr/README.md | 139 +
node_modules/proxy-addr/index.js | 327 +
node_modules/proxy-addr/package.json | 47 +
node_modules/pstree.remy/.travis.yml | 8 +
node_modules/pstree.remy/LICENSE | 7 +
node_modules/pstree.remy/README.md | 26 +
node_modules/pstree.remy/lib/index.js | 37 +
node_modules/pstree.remy/lib/tree.js | 37 +
node_modules/pstree.remy/lib/utils.js | 53 +
node_modules/pstree.remy/package.json | 33 +
.../pstree.remy/tests/fixtures/index.js | 13 +
node_modules/pstree.remy/tests/fixtures/out1 | 10 +
node_modules/pstree.remy/tests/fixtures/out2 | 29 +
node_modules/pstree.remy/tests/index.test.js | 51 +
node_modules/qs/.editorconfig | 46 +
node_modules/qs/.eslintrc | 38 +
node_modules/qs/.github/FUNDING.yml | 12 +
node_modules/qs/.nycrc | 13 +
node_modules/qs/CHANGELOG.md | 600 ++
node_modules/qs/LICENSE.md | 29 +
node_modules/qs/README.md | 709 ++
node_modules/qs/dist/qs.js | 90 +
node_modules/qs/lib/formats.js | 23 +
node_modules/qs/lib/index.js | 11 +
node_modules/qs/lib/parse.js | 296 +
node_modules/qs/lib/stringify.js | 351 +
node_modules/qs/lib/utils.js | 265 +
node_modules/qs/package.json | 91 +
node_modules/qs/test/empty-keys-cases.js | 267 +
node_modules/qs/test/parse.js | 1170 +++
node_modules/qs/test/stringify.js | 1298 +++
node_modules/qs/test/utils.js | 136 +
node_modules/range-parser/HISTORY.md | 56 +
node_modules/range-parser/LICENSE | 23 +
node_modules/range-parser/README.md | 84 +
node_modules/range-parser/index.js | 162 +
node_modules/range-parser/package.json | 44 +
node_modules/raw-body/HISTORY.md | 308 +
node_modules/raw-body/LICENSE | 22 +
node_modules/raw-body/README.md | 223 +
node_modules/raw-body/SECURITY.md | 24 +
node_modules/raw-body/index.d.ts | 87 +
node_modules/raw-body/index.js | 336 +
node_modules/raw-body/package.json | 49 +
node_modules/readable-stream/.travis.yml | 34 +
node_modules/readable-stream/CONTRIBUTING.md | 38 +
node_modules/readable-stream/GOVERNANCE.md | 136 +
node_modules/readable-stream/LICENSE | 47 +
node_modules/readable-stream/README.md | 58 +
.../doc/wg-meetings/2015-01-30.md | 60 +
.../readable-stream/duplex-browser.js | 1 +
node_modules/readable-stream/duplex.js | 1 +
.../readable-stream/lib/_stream_duplex.js | 131 +
.../lib/_stream_passthrough.js | 47 +
.../readable-stream/lib/_stream_readable.js | 1019 ++
.../readable-stream/lib/_stream_transform.js | 214 +
.../readable-stream/lib/_stream_writable.js | 687 ++
.../lib/internal/streams/BufferList.js | 79 +
.../lib/internal/streams/destroy.js | 74 +
.../lib/internal/streams/stream-browser.js | 1 +
.../lib/internal/streams/stream.js | 1 +
.../node_modules/safe-buffer/LICENSE | 21 +
.../node_modules/safe-buffer/README.md | 584 ++
.../node_modules/safe-buffer/index.d.ts | 187 +
.../node_modules/safe-buffer/index.js | 62 +
.../node_modules/safe-buffer/package.json | 37 +
node_modules/readable-stream/package.json | 52 +
node_modules/readable-stream/passthrough.js | 1 +
.../readable-stream/readable-browser.js | 7 +
node_modules/readable-stream/readable.js | 19 +
node_modules/readable-stream/transform.js | 1 +
.../readable-stream/writable-browser.js | 1 +
node_modules/readable-stream/writable.js | 8 +
node_modules/readdirp/LICENSE | 21 +
node_modules/readdirp/README.md | 122 +
node_modules/readdirp/index.d.ts | 43 +
node_modules/readdirp/index.js | 287 +
node_modules/readdirp/package.json | 122 +
node_modules/safe-buffer/LICENSE | 21 +
node_modules/safe-buffer/README.md | 584 ++
node_modules/safe-buffer/index.d.ts | 187 +
node_modules/safe-buffer/index.js | 65 +
node_modules/safe-buffer/package.json | 51 +
node_modules/safer-buffer/LICENSE | 21 +
node_modules/safer-buffer/Porting-Buffer.md | 268 +
node_modules/safer-buffer/Readme.md | 156 +
node_modules/safer-buffer/dangerous.js | 58 +
node_modules/safer-buffer/package.json | 34 +
node_modules/safer-buffer/safer.js | 77 +
node_modules/safer-buffer/tests.js | 406 +
node_modules/semver/LICENSE | 15 +
node_modules/semver/README.md | 664 ++
node_modules/semver/bin/semver.js | 189 +
node_modules/semver/classes/comparator.js | 141 +
node_modules/semver/classes/index.js | 5 +
node_modules/semver/classes/range.js | 554 ++
node_modules/semver/classes/semver.js | 318 +
node_modules/semver/functions/clean.js | 6 +
node_modules/semver/functions/cmp.js | 52 +
node_modules/semver/functions/coerce.js | 60 +
.../semver/functions/compare-build.js | 7 +
.../semver/functions/compare-loose.js | 3 +
node_modules/semver/functions/compare.js | 5 +
node_modules/semver/functions/diff.js | 58 +
node_modules/semver/functions/eq.js | 3 +
node_modules/semver/functions/gt.js | 3 +
node_modules/semver/functions/gte.js | 3 +
node_modules/semver/functions/inc.js | 19 +
node_modules/semver/functions/lt.js | 3 +
node_modules/semver/functions/lte.js | 3 +
node_modules/semver/functions/major.js | 3 +
node_modules/semver/functions/minor.js | 3 +
node_modules/semver/functions/neq.js | 3 +
node_modules/semver/functions/parse.js | 16 +
node_modules/semver/functions/patch.js | 3 +
node_modules/semver/functions/prerelease.js | 6 +
node_modules/semver/functions/rcompare.js | 3 +
node_modules/semver/functions/rsort.js | 3 +
node_modules/semver/functions/satisfies.js | 10 +
node_modules/semver/functions/sort.js | 3 +
node_modules/semver/functions/valid.js | 6 +
node_modules/semver/index.js | 89 +
node_modules/semver/internal/constants.js | 35 +
node_modules/semver/internal/debug.js | 9 +
node_modules/semver/internal/identifiers.js | 23 +
node_modules/semver/internal/lrucache.js | 40 +
node_modules/semver/internal/parse-options.js | 15 +
node_modules/semver/internal/re.js | 219 +
node_modules/semver/package.json | 78 +
node_modules/semver/preload.js | 2 +
node_modules/semver/range.bnf | 16 +
node_modules/semver/ranges/gtr.js | 4 +
node_modules/semver/ranges/intersects.js | 7 +
node_modules/semver/ranges/ltr.js | 4 +
node_modules/semver/ranges/max-satisfying.js | 25 +
node_modules/semver/ranges/min-satisfying.js | 24 +
node_modules/semver/ranges/min-version.js | 61 +
node_modules/semver/ranges/outside.js | 80 +
node_modules/semver/ranges/simplify.js | 47 +
node_modules/semver/ranges/subset.js | 247 +
node_modules/semver/ranges/to-comparators.js | 8 +
node_modules/semver/ranges/valid.js | 11 +
node_modules/send/HISTORY.md | 526 +
node_modules/send/LICENSE | 23 +
node_modules/send/README.md | 327 +
node_modules/send/SECURITY.md | 24 +
node_modules/send/index.js | 1142 +++
.../send/node_modules/encodeurl/HISTORY.md | 14 +
.../send/node_modules/encodeurl/LICENSE | 22 +
.../send/node_modules/encodeurl/README.md | 128 +
.../send/node_modules/encodeurl/index.js | 60 +
.../send/node_modules/encodeurl/package.json | 40 +
node_modules/send/node_modules/ms/index.js | 162 +
node_modules/send/node_modules/ms/license.md | 21 +
.../send/node_modules/ms/package.json | 38 +
node_modules/send/node_modules/ms/readme.md | 59 +
node_modules/send/package.json | 62 +
node_modules/seq-queue/.jshintrc | 19 +
node_modules/seq-queue/.npmignore | 3 +
node_modules/seq-queue/AUTHORS | 1 +
node_modules/seq-queue/LICENSE | 22 +
node_modules/seq-queue/Makefile | 9 +
node_modules/seq-queue/README.md | 75 +
node_modules/seq-queue/index.js | 1 +
node_modules/seq-queue/lib/.npmignore | 0
node_modules/seq-queue/lib/seq-queue.js | 199 +
node_modules/seq-queue/package.json | 17 +
node_modules/seq-queue/test/seq-queue-test.js | 307 +
node_modules/serve-static/HISTORY.md | 487 +
node_modules/serve-static/LICENSE | 25 +
node_modules/serve-static/README.md | 257 +
node_modules/serve-static/index.js | 209 +
node_modules/serve-static/package.json | 42 +
node_modules/setprototypeof/LICENSE | 13 +
node_modules/setprototypeof/README.md | 31 +
node_modules/setprototypeof/index.d.ts | 2 +
node_modules/setprototypeof/index.js | 17 +
node_modules/setprototypeof/package.json | 38 +
node_modules/setprototypeof/test/index.js | 24 +
node_modules/side-channel-list/.editorconfig | 9 +
node_modules/side-channel-list/.eslintrc | 11 +
.../side-channel-list/.github/FUNDING.yml | 12 +
node_modules/side-channel-list/.nycrc | 13 +
node_modules/side-channel-list/CHANGELOG.md | 15 +
node_modules/side-channel-list/LICENSE | 21 +
node_modules/side-channel-list/README.md | 62 +
node_modules/side-channel-list/index.d.ts | 13 +
node_modules/side-channel-list/index.js | 113 +
node_modules/side-channel-list/list.d.ts | 14 +
node_modules/side-channel-list/package.json | 77 +
node_modules/side-channel-list/test/index.js | 104 +
node_modules/side-channel-list/tsconfig.json | 9 +
node_modules/side-channel-map/.editorconfig | 9 +
node_modules/side-channel-map/.eslintrc | 11 +
.../side-channel-map/.github/FUNDING.yml | 12 +
node_modules/side-channel-map/.nycrc | 13 +
node_modules/side-channel-map/CHANGELOG.md | 22 +
node_modules/side-channel-map/LICENSE | 21 +
node_modules/side-channel-map/README.md | 62 +
node_modules/side-channel-map/index.d.ts | 15 +
node_modules/side-channel-map/index.js | 68 +
node_modules/side-channel-map/package.json | 80 +
node_modules/side-channel-map/test/index.js | 114 +
node_modules/side-channel-map/tsconfig.json | 9 +
.../side-channel-weakmap/.editorconfig | 9 +
node_modules/side-channel-weakmap/.eslintrc | 12 +
.../side-channel-weakmap/.github/FUNDING.yml | 12 +
node_modules/side-channel-weakmap/.nycrc | 13 +
.../side-channel-weakmap/CHANGELOG.md | 28 +
node_modules/side-channel-weakmap/LICENSE | 21 +
node_modules/side-channel-weakmap/README.md | 62 +
node_modules/side-channel-weakmap/index.d.ts | 15 +
node_modules/side-channel-weakmap/index.js | 84 +
.../side-channel-weakmap/package.json | 87 +
.../side-channel-weakmap/test/index.js | 114 +
.../side-channel-weakmap/tsconfig.json | 9 +
node_modules/side-channel/.editorconfig | 9 +
node_modules/side-channel/.eslintrc | 12 +
node_modules/side-channel/.github/FUNDING.yml | 12 +
node_modules/side-channel/.nycrc | 13 +
node_modules/side-channel/CHANGELOG.md | 110 +
node_modules/side-channel/LICENSE | 21 +
node_modules/side-channel/README.md | 61 +
node_modules/side-channel/index.d.ts | 14 +
node_modules/side-channel/index.js | 43 +
node_modules/side-channel/package.json | 85 +
node_modules/side-channel/test/index.js | 104 +
node_modules/side-channel/tsconfig.json | 9 +
node_modules/simple-update-notifier/LICENSE | 21 +
node_modules/simple-update-notifier/README.md | 82 +
.../simple-update-notifier/build/index.d.ts | 13 +
.../simple-update-notifier/build/index.js | 210 +
.../simple-update-notifier/package.json | 100 +
.../src/borderedText.ts | 12 +
.../simple-update-notifier/src/cache.spec.ts | 17 +
.../simple-update-notifier/src/cache.ts | 44 +
.../src/getDistVersion.spec.ts | 35 +
.../src/getDistVersion.ts | 29 +
.../src/hasNewVersion.spec.ts | 82 +
.../src/hasNewVersion.ts | 40 +
.../simple-update-notifier/src/index.spec.ts | 27 +
.../simple-update-notifier/src/index.ts | 34 +
.../simple-update-notifier/src/isNpmOrYarn.ts | 12 +
.../simple-update-notifier/src/types.ts | 8 +
node_modules/sqlstring/HISTORY.md | 53 +
node_modules/sqlstring/LICENSE | 19 +
node_modules/sqlstring/README.md | 205 +
node_modules/sqlstring/index.js | 1 +
node_modules/sqlstring/lib/SqlString.js | 237 +
node_modules/sqlstring/package.json | 47 +
node_modules/statuses/HISTORY.md | 82 +
node_modules/statuses/LICENSE | 23 +
node_modules/statuses/README.md | 136 +
node_modules/statuses/codes.json | 65 +
node_modules/statuses/index.js | 146 +
node_modules/statuses/package.json | 49 +
node_modules/string_decoder/.travis.yml | 50 +
node_modules/string_decoder/LICENSE | 48 +
node_modules/string_decoder/README.md | 47 +
.../string_decoder/lib/string_decoder.js | 296 +
.../node_modules/safe-buffer/LICENSE | 21 +
.../node_modules/safe-buffer/README.md | 584 ++
.../node_modules/safe-buffer/index.d.ts | 187 +
.../node_modules/safe-buffer/index.js | 62 +
.../node_modules/safe-buffer/package.json | 37 +
node_modules/string_decoder/package.json | 31 +
node_modules/supports-color/browser.js | 5 +
node_modules/supports-color/index.js | 131 +
node_modules/supports-color/license | 9 +
node_modules/supports-color/package.json | 53 +
node_modules/supports-color/readme.md | 66 +
node_modules/to-regex-range/LICENSE | 21 +
node_modules/to-regex-range/README.md | 305 +
node_modules/to-regex-range/index.js | 288 +
node_modules/to-regex-range/package.json | 88 +
node_modules/toidentifier/HISTORY.md | 9 +
node_modules/toidentifier/LICENSE | 21 +
node_modules/toidentifier/README.md | 61 +
node_modules/toidentifier/index.js | 32 +
node_modules/toidentifier/package.json | 38 +
node_modules/touch/LICENSE | 15 +
node_modules/touch/README.md | 52 +
node_modules/touch/bin/nodetouch.js | 112 +
node_modules/touch/index.js | 224 +
node_modules/touch/package.json | 25 +
node_modules/type-is/HISTORY.md | 259 +
node_modules/type-is/LICENSE | 23 +
node_modules/type-is/README.md | 170 +
node_modules/type-is/index.js | 266 +
node_modules/type-is/package.json | 45 +
.../undefsafe/.github/workflows/release.yml | 25 +
node_modules/undefsafe/.jscsrc | 13 +
node_modules/undefsafe/.jshintrc | 16 +
node_modules/undefsafe/.travis.yml | 18 +
node_modules/undefsafe/LICENSE | 22 +
node_modules/undefsafe/README.md | 63 +
node_modules/undefsafe/example.js | 14 +
node_modules/undefsafe/lib/undefsafe.js | 125 +
node_modules/undefsafe/package.json | 34 +
node_modules/unpipe/HISTORY.md | 4 +
node_modules/unpipe/LICENSE | 22 +
node_modules/unpipe/README.md | 43 +
node_modules/unpipe/index.js | 69 +
node_modules/unpipe/package.json | 27 +
node_modules/util-deprecate/History.md | 16 +
node_modules/util-deprecate/LICENSE | 24 +
node_modules/util-deprecate/README.md | 53 +
node_modules/util-deprecate/browser.js | 67 +
node_modules/util-deprecate/node.js | 6 +
node_modules/util-deprecate/package.json | 27 +
node_modules/utils-merge/.npmignore | 9 +
node_modules/utils-merge/LICENSE | 20 +
node_modules/utils-merge/README.md | 34 +
node_modules/utils-merge/index.js | 23 +
node_modules/utils-merge/package.json | 40 +
node_modules/vary/HISTORY.md | 39 +
node_modules/vary/LICENSE | 22 +
node_modules/vary/README.md | 101 +
node_modules/vary/index.js | 149 +
node_modules/vary/package.json | 43 +
package-lock.json | 1592 +++
package.json | 28 +
routes/category.js | 14 +
routes/history.js | 14 +
routes/product.js | 33 +
routes/recommendation.js | 8 +
routes/review.js | 9 +
routes/search.js | 14 +
routes/user.js | 47 +
utils/database.js | 10 +
utils/helper.js | 48 +
utils/mail.js | 12 +
1420 files changed, 182156 insertions(+)
create mode 100644 controllers/category.js
create mode 100644 controllers/history.js
create mode 100644 controllers/product.js
create mode 100644 controllers/recommendation.js
create mode 100644 controllers/review.js
create mode 100644 controllers/search.js
create mode 100644 controllers/user.js
create mode 100644 index.js
create mode 100644 node_modules/.bin/mime
create mode 100644 node_modules/.bin/mime.cmd
create mode 100644 node_modules/.bin/mime.ps1
create mode 100644 node_modules/.bin/nodemon
create mode 100644 node_modules/.bin/nodemon.cmd
create mode 100644 node_modules/.bin/nodemon.ps1
create mode 100644 node_modules/.bin/nodetouch
create mode 100644 node_modules/.bin/nodetouch.cmd
create mode 100644 node_modules/.bin/nodetouch.ps1
create mode 100644 node_modules/.bin/semver
create mode 100644 node_modules/.bin/semver.cmd
create mode 100644 node_modules/.bin/semver.ps1
create mode 100644 node_modules/.package-lock.json
create mode 100644 node_modules/accepts/HISTORY.md
create mode 100644 node_modules/accepts/LICENSE
create mode 100644 node_modules/accepts/README.md
create mode 100644 node_modules/accepts/index.js
create mode 100644 node_modules/accepts/package.json
create mode 100644 node_modules/anymatch/LICENSE
create mode 100644 node_modules/anymatch/README.md
create mode 100644 node_modules/anymatch/index.d.ts
create mode 100644 node_modules/anymatch/index.js
create mode 100644 node_modules/anymatch/package.json
create mode 100644 node_modules/array-flatten/LICENSE
create mode 100644 node_modules/array-flatten/README.md
create mode 100644 node_modules/array-flatten/array-flatten.js
create mode 100644 node_modules/array-flatten/package.json
create mode 100644 node_modules/aws-ssl-profiles/LICENSE
create mode 100644 node_modules/aws-ssl-profiles/README.md
create mode 100644 node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts
create mode 100644 node_modules/aws-ssl-profiles/lib/@types/profiles.js
create mode 100644 node_modules/aws-ssl-profiles/lib/index.d.ts
create mode 100644 node_modules/aws-ssl-profiles/lib/index.js
create mode 100644 node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts
create mode 100644 node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js
create mode 100644 node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts
create mode 100644 node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js
create mode 100644 node_modules/aws-ssl-profiles/package.json
create mode 100644 node_modules/balanced-match/.github/FUNDING.yml
create mode 100644 node_modules/balanced-match/LICENSE.md
create mode 100644 node_modules/balanced-match/README.md
create mode 100644 node_modules/balanced-match/index.js
create mode 100644 node_modules/balanced-match/package.json
create mode 100644 node_modules/bignumber.js/CHANGELOG.md
create mode 100644 node_modules/bignumber.js/LICENCE
create mode 100644 node_modules/bignumber.js/README.md
create mode 100644 node_modules/bignumber.js/bignumber.d.ts
create mode 100644 node_modules/bignumber.js/bignumber.js
create mode 100644 node_modules/bignumber.js/bignumber.min.js
create mode 100644 node_modules/bignumber.js/bignumber.min.js.map
create mode 100644 node_modules/bignumber.js/bignumber.mjs
create mode 100644 node_modules/bignumber.js/doc/API.html
create mode 100644 node_modules/bignumber.js/package.json
create mode 100644 node_modules/binary-extensions/binary-extensions.json
create mode 100644 node_modules/binary-extensions/binary-extensions.json.d.ts
create mode 100644 node_modules/binary-extensions/index.d.ts
create mode 100644 node_modules/binary-extensions/index.js
create mode 100644 node_modules/binary-extensions/license
create mode 100644 node_modules/binary-extensions/package.json
create mode 100644 node_modules/binary-extensions/readme.md
create mode 100644 node_modules/body-parser/HISTORY.md
create mode 100644 node_modules/body-parser/LICENSE
create mode 100644 node_modules/body-parser/README.md
create mode 100644 node_modules/body-parser/SECURITY.md
create mode 100644 node_modules/body-parser/index.js
create mode 100644 node_modules/body-parser/lib/read.js
create mode 100644 node_modules/body-parser/lib/types/json.js
create mode 100644 node_modules/body-parser/lib/types/raw.js
create mode 100644 node_modules/body-parser/lib/types/text.js
create mode 100644 node_modules/body-parser/lib/types/urlencoded.js
create mode 100644 node_modules/body-parser/package.json
create mode 100644 node_modules/brace-expansion/LICENSE
create mode 100644 node_modules/brace-expansion/README.md
create mode 100644 node_modules/brace-expansion/index.js
create mode 100644 node_modules/brace-expansion/package.json
create mode 100644 node_modules/braces/LICENSE
create mode 100644 node_modules/braces/README.md
create mode 100644 node_modules/braces/index.js
create mode 100644 node_modules/braces/lib/compile.js
create mode 100644 node_modules/braces/lib/constants.js
create mode 100644 node_modules/braces/lib/expand.js
create mode 100644 node_modules/braces/lib/parse.js
create mode 100644 node_modules/braces/lib/stringify.js
create mode 100644 node_modules/braces/lib/utils.js
create mode 100644 node_modules/braces/package.json
create mode 100644 node_modules/buffer-equal-constant-time/.npmignore
create mode 100644 node_modules/buffer-equal-constant-time/.travis.yml
create mode 100644 node_modules/buffer-equal-constant-time/LICENSE.txt
create mode 100644 node_modules/buffer-equal-constant-time/README.md
create mode 100644 node_modules/buffer-equal-constant-time/index.js
create mode 100644 node_modules/buffer-equal-constant-time/package.json
create mode 100644 node_modules/buffer-equal-constant-time/test.js
create mode 100644 node_modules/bytes/History.md
create mode 100644 node_modules/bytes/LICENSE
create mode 100644 node_modules/bytes/Readme.md
create mode 100644 node_modules/bytes/index.js
create mode 100644 node_modules/bytes/package.json
create mode 100644 node_modules/call-bind-apply-helpers/.eslintrc
create mode 100644 node_modules/call-bind-apply-helpers/.github/FUNDING.yml
create mode 100644 node_modules/call-bind-apply-helpers/.nycrc
create mode 100644 node_modules/call-bind-apply-helpers/CHANGELOG.md
create mode 100644 node_modules/call-bind-apply-helpers/LICENSE
create mode 100644 node_modules/call-bind-apply-helpers/README.md
create mode 100644 node_modules/call-bind-apply-helpers/actualApply.d.ts
create mode 100644 node_modules/call-bind-apply-helpers/actualApply.js
create mode 100644 node_modules/call-bind-apply-helpers/applyBind.d.ts
create mode 100644 node_modules/call-bind-apply-helpers/applyBind.js
create mode 100644 node_modules/call-bind-apply-helpers/functionApply.d.ts
create mode 100644 node_modules/call-bind-apply-helpers/functionApply.js
create mode 100644 node_modules/call-bind-apply-helpers/functionCall.d.ts
create mode 100644 node_modules/call-bind-apply-helpers/functionCall.js
create mode 100644 node_modules/call-bind-apply-helpers/index.d.ts
create mode 100644 node_modules/call-bind-apply-helpers/index.js
create mode 100644 node_modules/call-bind-apply-helpers/package.json
create mode 100644 node_modules/call-bind-apply-helpers/reflectApply.d.ts
create mode 100644 node_modules/call-bind-apply-helpers/reflectApply.js
create mode 100644 node_modules/call-bind-apply-helpers/test/index.js
create mode 100644 node_modules/call-bind-apply-helpers/tsconfig.json
create mode 100644 node_modules/call-bound/.eslintrc
create mode 100644 node_modules/call-bound/.github/FUNDING.yml
create mode 100644 node_modules/call-bound/.nycrc
create mode 100644 node_modules/call-bound/CHANGELOG.md
create mode 100644 node_modules/call-bound/LICENSE
create mode 100644 node_modules/call-bound/README.md
create mode 100644 node_modules/call-bound/index.d.ts
create mode 100644 node_modules/call-bound/index.js
create mode 100644 node_modules/call-bound/package.json
create mode 100644 node_modules/call-bound/test/index.js
create mode 100644 node_modules/call-bound/tsconfig.json
create mode 100644 node_modules/chokidar/LICENSE
create mode 100644 node_modules/chokidar/README.md
create mode 100644 node_modules/chokidar/index.js
create mode 100644 node_modules/chokidar/lib/constants.js
create mode 100644 node_modules/chokidar/lib/fsevents-handler.js
create mode 100644 node_modules/chokidar/lib/nodefs-handler.js
create mode 100644 node_modules/chokidar/package.json
create mode 100644 node_modules/chokidar/types/index.d.ts
create mode 100644 node_modules/concat-map/.travis.yml
create mode 100644 node_modules/concat-map/LICENSE
create mode 100644 node_modules/concat-map/README.markdown
create mode 100644 node_modules/concat-map/example/map.js
create mode 100644 node_modules/concat-map/index.js
create mode 100644 node_modules/concat-map/package.json
create mode 100644 node_modules/concat-map/test/map.js
create mode 100644 node_modules/content-disposition/HISTORY.md
create mode 100644 node_modules/content-disposition/LICENSE
create mode 100644 node_modules/content-disposition/README.md
create mode 100644 node_modules/content-disposition/index.js
create mode 100644 node_modules/content-disposition/package.json
create mode 100644 node_modules/content-type/HISTORY.md
create mode 100644 node_modules/content-type/LICENSE
create mode 100644 node_modules/content-type/README.md
create mode 100644 node_modules/content-type/index.js
create mode 100644 node_modules/content-type/package.json
create mode 100644 node_modules/cookie-signature/.npmignore
create mode 100644 node_modules/cookie-signature/History.md
create mode 100644 node_modules/cookie-signature/Readme.md
create mode 100644 node_modules/cookie-signature/index.js
create mode 100644 node_modules/cookie-signature/package.json
create mode 100644 node_modules/cookie/LICENSE
create mode 100644 node_modules/cookie/README.md
create mode 100644 node_modules/cookie/SECURITY.md
create mode 100644 node_modules/cookie/index.js
create mode 100644 node_modules/cookie/package.json
create mode 100644 node_modules/core-util-is/LICENSE
create mode 100644 node_modules/core-util-is/README.md
create mode 100644 node_modules/core-util-is/lib/util.js
create mode 100644 node_modules/core-util-is/package.json
create mode 100644 node_modules/cors/CONTRIBUTING.md
create mode 100644 node_modules/cors/HISTORY.md
create mode 100644 node_modules/cors/LICENSE
create mode 100644 node_modules/cors/README.md
create mode 100644 node_modules/cors/lib/index.js
create mode 100644 node_modules/cors/package.json
create mode 100644 node_modules/crypto/README.md
create mode 100644 node_modules/crypto/package.json
create mode 100644 node_modules/debug/.coveralls.yml
create mode 100644 node_modules/debug/.eslintrc
create mode 100644 node_modules/debug/.npmignore
create mode 100644 node_modules/debug/.travis.yml
create mode 100644 node_modules/debug/CHANGELOG.md
create mode 100644 node_modules/debug/LICENSE
create mode 100644 node_modules/debug/Makefile
create mode 100644 node_modules/debug/README.md
create mode 100644 node_modules/debug/component.json
create mode 100644 node_modules/debug/karma.conf.js
create mode 100644 node_modules/debug/node.js
create mode 100644 node_modules/debug/package.json
create mode 100644 node_modules/debug/src/browser.js
create mode 100644 node_modules/debug/src/debug.js
create mode 100644 node_modules/debug/src/index.js
create mode 100644 node_modules/debug/src/inspector-log.js
create mode 100644 node_modules/debug/src/node.js
create mode 100644 node_modules/denque/CHANGELOG.md
create mode 100644 node_modules/denque/LICENSE
create mode 100644 node_modules/denque/README.md
create mode 100644 node_modules/denque/index.d.ts
create mode 100644 node_modules/denque/index.js
create mode 100644 node_modules/denque/package.json
create mode 100644 node_modules/depd/History.md
create mode 100644 node_modules/depd/LICENSE
create mode 100644 node_modules/depd/Readme.md
create mode 100644 node_modules/depd/index.js
create mode 100644 node_modules/depd/lib/browser/index.js
create mode 100644 node_modules/depd/package.json
create mode 100644 node_modules/destroy/LICENSE
create mode 100644 node_modules/destroy/README.md
create mode 100644 node_modules/destroy/index.js
create mode 100644 node_modules/destroy/package.json
create mode 100644 node_modules/dotenv/CHANGELOG.md
create mode 100644 node_modules/dotenv/LICENSE
create mode 100644 node_modules/dotenv/README-es.md
create mode 100644 node_modules/dotenv/README.md
create mode 100644 node_modules/dotenv/config.d.ts
create mode 100644 node_modules/dotenv/config.js
create mode 100644 node_modules/dotenv/lib/cli-options.js
create mode 100644 node_modules/dotenv/lib/env-options.js
create mode 100644 node_modules/dotenv/lib/main.d.ts
create mode 100644 node_modules/dotenv/lib/main.js
create mode 100644 node_modules/dotenv/package.json
create mode 100644 node_modules/dunder-proto/.eslintrc
create mode 100644 node_modules/dunder-proto/.github/FUNDING.yml
create mode 100644 node_modules/dunder-proto/.nycrc
create mode 100644 node_modules/dunder-proto/CHANGELOG.md
create mode 100644 node_modules/dunder-proto/LICENSE
create mode 100644 node_modules/dunder-proto/README.md
create mode 100644 node_modules/dunder-proto/get.d.ts
create mode 100644 node_modules/dunder-proto/get.js
create mode 100644 node_modules/dunder-proto/package.json
create mode 100644 node_modules/dunder-proto/set.d.ts
create mode 100644 node_modules/dunder-proto/set.js
create mode 100644 node_modules/dunder-proto/test/get.js
create mode 100644 node_modules/dunder-proto/test/index.js
create mode 100644 node_modules/dunder-proto/test/set.js
create mode 100644 node_modules/dunder-proto/tsconfig.json
create mode 100644 node_modules/ecdsa-sig-formatter/CODEOWNERS
create mode 100644 node_modules/ecdsa-sig-formatter/LICENSE
create mode 100644 node_modules/ecdsa-sig-formatter/README.md
create mode 100644 node_modules/ecdsa-sig-formatter/package.json
create mode 100644 node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts
create mode 100644 node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.js
create mode 100644 node_modules/ecdsa-sig-formatter/src/param-bytes-for-alg.js
create mode 100644 node_modules/ee-first/LICENSE
create mode 100644 node_modules/ee-first/README.md
create mode 100644 node_modules/ee-first/index.js
create mode 100644 node_modules/ee-first/package.json
create mode 100644 node_modules/encodeurl/LICENSE
create mode 100644 node_modules/encodeurl/README.md
create mode 100644 node_modules/encodeurl/index.js
create mode 100644 node_modules/encodeurl/package.json
create mode 100644 node_modules/es-define-property/.eslintrc
create mode 100644 node_modules/es-define-property/.github/FUNDING.yml
create mode 100644 node_modules/es-define-property/.nycrc
create mode 100644 node_modules/es-define-property/CHANGELOG.md
create mode 100644 node_modules/es-define-property/LICENSE
create mode 100644 node_modules/es-define-property/README.md
create mode 100644 node_modules/es-define-property/index.d.ts
create mode 100644 node_modules/es-define-property/index.js
create mode 100644 node_modules/es-define-property/package.json
create mode 100644 node_modules/es-define-property/test/index.js
create mode 100644 node_modules/es-define-property/tsconfig.json
create mode 100644 node_modules/es-errors/.eslintrc
create mode 100644 node_modules/es-errors/.github/FUNDING.yml
create mode 100644 node_modules/es-errors/CHANGELOG.md
create mode 100644 node_modules/es-errors/LICENSE
create mode 100644 node_modules/es-errors/README.md
create mode 100644 node_modules/es-errors/eval.d.ts
create mode 100644 node_modules/es-errors/eval.js
create mode 100644 node_modules/es-errors/index.d.ts
create mode 100644 node_modules/es-errors/index.js
create mode 100644 node_modules/es-errors/package.json
create mode 100644 node_modules/es-errors/range.d.ts
create mode 100644 node_modules/es-errors/range.js
create mode 100644 node_modules/es-errors/ref.d.ts
create mode 100644 node_modules/es-errors/ref.js
create mode 100644 node_modules/es-errors/syntax.d.ts
create mode 100644 node_modules/es-errors/syntax.js
create mode 100644 node_modules/es-errors/test/index.js
create mode 100644 node_modules/es-errors/tsconfig.json
create mode 100644 node_modules/es-errors/type.d.ts
create mode 100644 node_modules/es-errors/type.js
create mode 100644 node_modules/es-errors/uri.d.ts
create mode 100644 node_modules/es-errors/uri.js
create mode 100644 node_modules/es-object-atoms/.eslintrc
create mode 100644 node_modules/es-object-atoms/.github/FUNDING.yml
create mode 100644 node_modules/es-object-atoms/CHANGELOG.md
create mode 100644 node_modules/es-object-atoms/LICENSE
create mode 100644 node_modules/es-object-atoms/README.md
create mode 100644 node_modules/es-object-atoms/RequireObjectCoercible.d.ts
create mode 100644 node_modules/es-object-atoms/RequireObjectCoercible.js
create mode 100644 node_modules/es-object-atoms/ToObject.d.ts
create mode 100644 node_modules/es-object-atoms/ToObject.js
create mode 100644 node_modules/es-object-atoms/index.d.ts
create mode 100644 node_modules/es-object-atoms/index.js
create mode 100644 node_modules/es-object-atoms/isObject.d.ts
create mode 100644 node_modules/es-object-atoms/isObject.js
create mode 100644 node_modules/es-object-atoms/package.json
create mode 100644 node_modules/es-object-atoms/test/index.js
create mode 100644 node_modules/es-object-atoms/tsconfig.json
create mode 100644 node_modules/escape-html/LICENSE
create mode 100644 node_modules/escape-html/Readme.md
create mode 100644 node_modules/escape-html/index.js
create mode 100644 node_modules/escape-html/package.json
create mode 100644 node_modules/etag/HISTORY.md
create mode 100644 node_modules/etag/LICENSE
create mode 100644 node_modules/etag/README.md
create mode 100644 node_modules/etag/index.js
create mode 100644 node_modules/etag/package.json
create mode 100644 node_modules/express/History.md
create mode 100644 node_modules/express/LICENSE
create mode 100644 node_modules/express/Readme.md
create mode 100644 node_modules/express/index.js
create mode 100644 node_modules/express/lib/application.js
create mode 100644 node_modules/express/lib/express.js
create mode 100644 node_modules/express/lib/middleware/init.js
create mode 100644 node_modules/express/lib/middleware/query.js
create mode 100644 node_modules/express/lib/request.js
create mode 100644 node_modules/express/lib/response.js
create mode 100644 node_modules/express/lib/router/index.js
create mode 100644 node_modules/express/lib/router/layer.js
create mode 100644 node_modules/express/lib/router/route.js
create mode 100644 node_modules/express/lib/utils.js
create mode 100644 node_modules/express/lib/view.js
create mode 100644 node_modules/express/package.json
create mode 100644 node_modules/fill-range/LICENSE
create mode 100644 node_modules/fill-range/README.md
create mode 100644 node_modules/fill-range/index.js
create mode 100644 node_modules/fill-range/package.json
create mode 100644 node_modules/finalhandler/HISTORY.md
create mode 100644 node_modules/finalhandler/LICENSE
create mode 100644 node_modules/finalhandler/README.md
create mode 100644 node_modules/finalhandler/SECURITY.md
create mode 100644 node_modules/finalhandler/index.js
create mode 100644 node_modules/finalhandler/package.json
create mode 100644 node_modules/forwarded/HISTORY.md
create mode 100644 node_modules/forwarded/LICENSE
create mode 100644 node_modules/forwarded/README.md
create mode 100644 node_modules/forwarded/index.js
create mode 100644 node_modules/forwarded/package.json
create mode 100644 node_modules/fresh/HISTORY.md
create mode 100644 node_modules/fresh/LICENSE
create mode 100644 node_modules/fresh/README.md
create mode 100644 node_modules/fresh/index.js
create mode 100644 node_modules/fresh/package.json
create mode 100644 node_modules/function-bind/.eslintrc
create mode 100644 node_modules/function-bind/.github/FUNDING.yml
create mode 100644 node_modules/function-bind/.github/SECURITY.md
create mode 100644 node_modules/function-bind/.nycrc
create mode 100644 node_modules/function-bind/CHANGELOG.md
create mode 100644 node_modules/function-bind/LICENSE
create mode 100644 node_modules/function-bind/README.md
create mode 100644 node_modules/function-bind/implementation.js
create mode 100644 node_modules/function-bind/index.js
create mode 100644 node_modules/function-bind/package.json
create mode 100644 node_modules/function-bind/test/.eslintrc
create mode 100644 node_modules/function-bind/test/index.js
create mode 100644 node_modules/generate-function/.travis.yml
create mode 100644 node_modules/generate-function/LICENSE
create mode 100644 node_modules/generate-function/README.md
create mode 100644 node_modules/generate-function/example.js
create mode 100644 node_modules/generate-function/index.js
create mode 100644 node_modules/generate-function/package.json
create mode 100644 node_modules/generate-function/test.js
create mode 100644 node_modules/get-intrinsic/.eslintrc
create mode 100644 node_modules/get-intrinsic/.github/FUNDING.yml
create mode 100644 node_modules/get-intrinsic/.nycrc
create mode 100644 node_modules/get-intrinsic/CHANGELOG.md
create mode 100644 node_modules/get-intrinsic/LICENSE
create mode 100644 node_modules/get-intrinsic/README.md
create mode 100644 node_modules/get-intrinsic/index.js
create mode 100644 node_modules/get-intrinsic/package.json
create mode 100644 node_modules/get-intrinsic/test/GetIntrinsic.js
create mode 100644 node_modules/get-proto/.eslintrc
create mode 100644 node_modules/get-proto/.github/FUNDING.yml
create mode 100644 node_modules/get-proto/.nycrc
create mode 100644 node_modules/get-proto/CHANGELOG.md
create mode 100644 node_modules/get-proto/LICENSE
create mode 100644 node_modules/get-proto/Object.getPrototypeOf.d.ts
create mode 100644 node_modules/get-proto/Object.getPrototypeOf.js
create mode 100644 node_modules/get-proto/README.md
create mode 100644 node_modules/get-proto/Reflect.getPrototypeOf.d.ts
create mode 100644 node_modules/get-proto/Reflect.getPrototypeOf.js
create mode 100644 node_modules/get-proto/index.d.ts
create mode 100644 node_modules/get-proto/index.js
create mode 100644 node_modules/get-proto/package.json
create mode 100644 node_modules/get-proto/test/index.js
create mode 100644 node_modules/get-proto/tsconfig.json
create mode 100644 node_modules/glob-parent/CHANGELOG.md
create mode 100644 node_modules/glob-parent/LICENSE
create mode 100644 node_modules/glob-parent/README.md
create mode 100644 node_modules/glob-parent/index.js
create mode 100644 node_modules/glob-parent/package.json
create mode 100644 node_modules/gopd/.eslintrc
create mode 100644 node_modules/gopd/.github/FUNDING.yml
create mode 100644 node_modules/gopd/CHANGELOG.md
create mode 100644 node_modules/gopd/LICENSE
create mode 100644 node_modules/gopd/README.md
create mode 100644 node_modules/gopd/gOPD.d.ts
create mode 100644 node_modules/gopd/gOPD.js
create mode 100644 node_modules/gopd/index.d.ts
create mode 100644 node_modules/gopd/index.js
create mode 100644 node_modules/gopd/package.json
create mode 100644 node_modules/gopd/test/index.js
create mode 100644 node_modules/gopd/tsconfig.json
create mode 100644 node_modules/has-flag/index.js
create mode 100644 node_modules/has-flag/license
create mode 100644 node_modules/has-flag/package.json
create mode 100644 node_modules/has-flag/readme.md
create mode 100644 node_modules/has-symbols/.eslintrc
create mode 100644 node_modules/has-symbols/.github/FUNDING.yml
create mode 100644 node_modules/has-symbols/.nycrc
create mode 100644 node_modules/has-symbols/CHANGELOG.md
create mode 100644 node_modules/has-symbols/LICENSE
create mode 100644 node_modules/has-symbols/README.md
create mode 100644 node_modules/has-symbols/index.d.ts
create mode 100644 node_modules/has-symbols/index.js
create mode 100644 node_modules/has-symbols/package.json
create mode 100644 node_modules/has-symbols/shams.d.ts
create mode 100644 node_modules/has-symbols/shams.js
create mode 100644 node_modules/has-symbols/test/index.js
create mode 100644 node_modules/has-symbols/test/shams/core-js.js
create mode 100644 node_modules/has-symbols/test/shams/get-own-property-symbols.js
create mode 100644 node_modules/has-symbols/test/tests.js
create mode 100644 node_modules/has-symbols/tsconfig.json
create mode 100644 node_modules/hasown/.eslintrc
create mode 100644 node_modules/hasown/.github/FUNDING.yml
create mode 100644 node_modules/hasown/.nycrc
create mode 100644 node_modules/hasown/CHANGELOG.md
create mode 100644 node_modules/hasown/LICENSE
create mode 100644 node_modules/hasown/README.md
create mode 100644 node_modules/hasown/index.d.ts
create mode 100644 node_modules/hasown/index.js
create mode 100644 node_modules/hasown/package.json
create mode 100644 node_modules/hasown/tsconfig.json
create mode 100644 node_modules/http-errors/HISTORY.md
create mode 100644 node_modules/http-errors/LICENSE
create mode 100644 node_modules/http-errors/README.md
create mode 100644 node_modules/http-errors/index.js
create mode 100644 node_modules/http-errors/package.json
create mode 100644 node_modules/iconv-lite/Changelog.md
create mode 100644 node_modules/iconv-lite/LICENSE
create mode 100644 node_modules/iconv-lite/README.md
create mode 100644 node_modules/iconv-lite/encodings/dbcs-codec.js
create mode 100644 node_modules/iconv-lite/encodings/dbcs-data.js
create mode 100644 node_modules/iconv-lite/encodings/index.js
create mode 100644 node_modules/iconv-lite/encodings/internal.js
create mode 100644 node_modules/iconv-lite/encodings/sbcs-codec.js
create mode 100644 node_modules/iconv-lite/encodings/sbcs-data-generated.js
create mode 100644 node_modules/iconv-lite/encodings/sbcs-data.js
create mode 100644 node_modules/iconv-lite/encodings/tables/big5-added.json
create mode 100644 node_modules/iconv-lite/encodings/tables/cp936.json
create mode 100644 node_modules/iconv-lite/encodings/tables/cp949.json
create mode 100644 node_modules/iconv-lite/encodings/tables/cp950.json
create mode 100644 node_modules/iconv-lite/encodings/tables/eucjp.json
create mode 100644 node_modules/iconv-lite/encodings/tables/gb18030-ranges.json
create mode 100644 node_modules/iconv-lite/encodings/tables/gbk-added.json
create mode 100644 node_modules/iconv-lite/encodings/tables/shiftjis.json
create mode 100644 node_modules/iconv-lite/encodings/utf16.js
create mode 100644 node_modules/iconv-lite/encodings/utf7.js
create mode 100644 node_modules/iconv-lite/lib/bom-handling.js
create mode 100644 node_modules/iconv-lite/lib/extend-node.js
create mode 100644 node_modules/iconv-lite/lib/index.d.ts
create mode 100644 node_modules/iconv-lite/lib/index.js
create mode 100644 node_modules/iconv-lite/lib/streams.js
create mode 100644 node_modules/iconv-lite/package.json
create mode 100644 node_modules/ignore-by-default/LICENSE
create mode 100644 node_modules/ignore-by-default/README.md
create mode 100644 node_modules/ignore-by-default/index.js
create mode 100644 node_modules/ignore-by-default/package.json
create mode 100644 node_modules/inherits/LICENSE
create mode 100644 node_modules/inherits/README.md
create mode 100644 node_modules/inherits/inherits.js
create mode 100644 node_modules/inherits/inherits_browser.js
create mode 100644 node_modules/inherits/package.json
create mode 100644 node_modules/ipaddr.js/LICENSE
create mode 100644 node_modules/ipaddr.js/README.md
create mode 100644 node_modules/ipaddr.js/ipaddr.min.js
create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js
create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js.d.ts
create mode 100644 node_modules/ipaddr.js/package.json
create mode 100644 node_modules/is-binary-path/index.d.ts
create mode 100644 node_modules/is-binary-path/index.js
create mode 100644 node_modules/is-binary-path/license
create mode 100644 node_modules/is-binary-path/package.json
create mode 100644 node_modules/is-binary-path/readme.md
create mode 100644 node_modules/is-extglob/LICENSE
create mode 100644 node_modules/is-extglob/README.md
create mode 100644 node_modules/is-extglob/index.js
create mode 100644 node_modules/is-extglob/package.json
create mode 100644 node_modules/is-glob/LICENSE
create mode 100644 node_modules/is-glob/README.md
create mode 100644 node_modules/is-glob/index.js
create mode 100644 node_modules/is-glob/package.json
create mode 100644 node_modules/is-number/LICENSE
create mode 100644 node_modules/is-number/README.md
create mode 100644 node_modules/is-number/index.js
create mode 100644 node_modules/is-number/package.json
create mode 100644 node_modules/is-property/.npmignore
create mode 100644 node_modules/is-property/LICENSE
create mode 100644 node_modules/is-property/README.md
create mode 100644 node_modules/is-property/is-property.js
create mode 100644 node_modules/is-property/package.json
create mode 100644 node_modules/isarray/.npmignore
create mode 100644 node_modules/isarray/.travis.yml
create mode 100644 node_modules/isarray/Makefile
create mode 100644 node_modules/isarray/README.md
create mode 100644 node_modules/isarray/component.json
create mode 100644 node_modules/isarray/index.js
create mode 100644 node_modules/isarray/package.json
create mode 100644 node_modules/isarray/test.js
create mode 100644 node_modules/jsonwebtoken/LICENSE
create mode 100644 node_modules/jsonwebtoken/README.md
create mode 100644 node_modules/jsonwebtoken/decode.js
create mode 100644 node_modules/jsonwebtoken/index.js
create mode 100644 node_modules/jsonwebtoken/lib/JsonWebTokenError.js
create mode 100644 node_modules/jsonwebtoken/lib/NotBeforeError.js
create mode 100644 node_modules/jsonwebtoken/lib/TokenExpiredError.js
create mode 100644 node_modules/jsonwebtoken/lib/asymmetricKeyDetailsSupported.js
create mode 100644 node_modules/jsonwebtoken/lib/psSupported.js
create mode 100644 node_modules/jsonwebtoken/lib/rsaPssKeyDetailsSupported.js
create mode 100644 node_modules/jsonwebtoken/lib/timespan.js
create mode 100644 node_modules/jsonwebtoken/lib/validateAsymmetricKey.js
create mode 100644 node_modules/jsonwebtoken/node_modules/ms/index.js
create mode 100644 node_modules/jsonwebtoken/node_modules/ms/license.md
create mode 100644 node_modules/jsonwebtoken/node_modules/ms/package.json
create mode 100644 node_modules/jsonwebtoken/node_modules/ms/readme.md
create mode 100644 node_modules/jsonwebtoken/package.json
create mode 100644 node_modules/jsonwebtoken/sign.js
create mode 100644 node_modules/jsonwebtoken/verify.js
create mode 100644 node_modules/jwa/LICENSE
create mode 100644 node_modules/jwa/README.md
create mode 100644 node_modules/jwa/index.js
create mode 100644 node_modules/jwa/package.json
create mode 100644 node_modules/jws/CHANGELOG.md
create mode 100644 node_modules/jws/LICENSE
create mode 100644 node_modules/jws/index.js
create mode 100644 node_modules/jws/lib/data-stream.js
create mode 100644 node_modules/jws/lib/sign-stream.js
create mode 100644 node_modules/jws/lib/tostring.js
create mode 100644 node_modules/jws/lib/verify-stream.js
create mode 100644 node_modules/jws/package.json
create mode 100644 node_modules/jws/readme.md
create mode 100644 node_modules/lodash.includes/LICENSE
create mode 100644 node_modules/lodash.includes/README.md
create mode 100644 node_modules/lodash.includes/index.js
create mode 100644 node_modules/lodash.includes/package.json
create mode 100644 node_modules/lodash.isboolean/LICENSE
create mode 100644 node_modules/lodash.isboolean/README.md
create mode 100644 node_modules/lodash.isboolean/index.js
create mode 100644 node_modules/lodash.isboolean/package.json
create mode 100644 node_modules/lodash.isinteger/LICENSE
create mode 100644 node_modules/lodash.isinteger/README.md
create mode 100644 node_modules/lodash.isinteger/index.js
create mode 100644 node_modules/lodash.isinteger/package.json
create mode 100644 node_modules/lodash.isnumber/LICENSE
create mode 100644 node_modules/lodash.isnumber/README.md
create mode 100644 node_modules/lodash.isnumber/index.js
create mode 100644 node_modules/lodash.isnumber/package.json
create mode 100644 node_modules/lodash.isplainobject/LICENSE
create mode 100644 node_modules/lodash.isplainobject/README.md
create mode 100644 node_modules/lodash.isplainobject/index.js
create mode 100644 node_modules/lodash.isplainobject/package.json
create mode 100644 node_modules/lodash.isstring/LICENSE
create mode 100644 node_modules/lodash.isstring/README.md
create mode 100644 node_modules/lodash.isstring/index.js
create mode 100644 node_modules/lodash.isstring/package.json
create mode 100644 node_modules/lodash.once/LICENSE
create mode 100644 node_modules/lodash.once/README.md
create mode 100644 node_modules/lodash.once/index.js
create mode 100644 node_modules/lodash.once/package.json
create mode 100644 node_modules/long/LICENSE
create mode 100644 node_modules/long/README.md
create mode 100644 node_modules/long/index.d.ts
create mode 100644 node_modules/long/index.js
create mode 100644 node_modules/long/package.json
create mode 100644 node_modules/long/umd/index.d.ts
create mode 100644 node_modules/long/umd/index.js
create mode 100644 node_modules/long/umd/package.json
create mode 100644 node_modules/lru-cache/LICENSE
create mode 100644 node_modules/lru-cache/README.md
create mode 100644 node_modules/lru-cache/index.d.ts
create mode 100644 node_modules/lru-cache/index.js
create mode 100644 node_modules/lru-cache/index.mjs
create mode 100644 node_modules/lru-cache/package.json
create mode 100644 node_modules/lru.min/LICENSE
create mode 100644 node_modules/lru.min/README.md
create mode 100644 node_modules/lru.min/browser/lru.min.js
create mode 100644 node_modules/lru.min/lib/index.d.ts
create mode 100644 node_modules/lru.min/lib/index.js
create mode 100644 node_modules/lru.min/lib/index.mjs
create mode 100644 node_modules/lru.min/package.json
create mode 100644 node_modules/math-intrinsics/.eslintrc
create mode 100644 node_modules/math-intrinsics/.github/FUNDING.yml
create mode 100644 node_modules/math-intrinsics/CHANGELOG.md
create mode 100644 node_modules/math-intrinsics/LICENSE
create mode 100644 node_modules/math-intrinsics/README.md
create mode 100644 node_modules/math-intrinsics/abs.d.ts
create mode 100644 node_modules/math-intrinsics/abs.js
create mode 100644 node_modules/math-intrinsics/constants/maxArrayLength.d.ts
create mode 100644 node_modules/math-intrinsics/constants/maxArrayLength.js
create mode 100644 node_modules/math-intrinsics/constants/maxSafeInteger.d.ts
create mode 100644 node_modules/math-intrinsics/constants/maxSafeInteger.js
create mode 100644 node_modules/math-intrinsics/constants/maxValue.d.ts
create mode 100644 node_modules/math-intrinsics/constants/maxValue.js
create mode 100644 node_modules/math-intrinsics/floor.d.ts
create mode 100644 node_modules/math-intrinsics/floor.js
create mode 100644 node_modules/math-intrinsics/isFinite.d.ts
create mode 100644 node_modules/math-intrinsics/isFinite.js
create mode 100644 node_modules/math-intrinsics/isInteger.d.ts
create mode 100644 node_modules/math-intrinsics/isInteger.js
create mode 100644 node_modules/math-intrinsics/isNaN.d.ts
create mode 100644 node_modules/math-intrinsics/isNaN.js
create mode 100644 node_modules/math-intrinsics/isNegativeZero.d.ts
create mode 100644 node_modules/math-intrinsics/isNegativeZero.js
create mode 100644 node_modules/math-intrinsics/max.d.ts
create mode 100644 node_modules/math-intrinsics/max.js
create mode 100644 node_modules/math-intrinsics/min.d.ts
create mode 100644 node_modules/math-intrinsics/min.js
create mode 100644 node_modules/math-intrinsics/mod.d.ts
create mode 100644 node_modules/math-intrinsics/mod.js
create mode 100644 node_modules/math-intrinsics/package.json
create mode 100644 node_modules/math-intrinsics/pow.d.ts
create mode 100644 node_modules/math-intrinsics/pow.js
create mode 100644 node_modules/math-intrinsics/round.d.ts
create mode 100644 node_modules/math-intrinsics/round.js
create mode 100644 node_modules/math-intrinsics/sign.d.ts
create mode 100644 node_modules/math-intrinsics/sign.js
create mode 100644 node_modules/math-intrinsics/test/index.js
create mode 100644 node_modules/math-intrinsics/tsconfig.json
create mode 100644 node_modules/media-typer/HISTORY.md
create mode 100644 node_modules/media-typer/LICENSE
create mode 100644 node_modules/media-typer/README.md
create mode 100644 node_modules/media-typer/index.js
create mode 100644 node_modules/media-typer/package.json
create mode 100644 node_modules/merge-descriptors/HISTORY.md
create mode 100644 node_modules/merge-descriptors/LICENSE
create mode 100644 node_modules/merge-descriptors/README.md
create mode 100644 node_modules/merge-descriptors/index.js
create mode 100644 node_modules/merge-descriptors/package.json
create mode 100644 node_modules/methods/HISTORY.md
create mode 100644 node_modules/methods/LICENSE
create mode 100644 node_modules/methods/README.md
create mode 100644 node_modules/methods/index.js
create mode 100644 node_modules/methods/package.json
create mode 100644 node_modules/mime-db/HISTORY.md
create mode 100644 node_modules/mime-db/LICENSE
create mode 100644 node_modules/mime-db/README.md
create mode 100644 node_modules/mime-db/db.json
create mode 100644 node_modules/mime-db/index.js
create mode 100644 node_modules/mime-db/package.json
create mode 100644 node_modules/mime-types/HISTORY.md
create mode 100644 node_modules/mime-types/LICENSE
create mode 100644 node_modules/mime-types/README.md
create mode 100644 node_modules/mime-types/index.js
create mode 100644 node_modules/mime-types/package.json
create mode 100644 node_modules/mime/.npmignore
create mode 100644 node_modules/mime/CHANGELOG.md
create mode 100644 node_modules/mime/LICENSE
create mode 100644 node_modules/mime/README.md
create mode 100644 node_modules/mime/cli.js
create mode 100644 node_modules/mime/mime.js
create mode 100644 node_modules/mime/package.json
create mode 100644 node_modules/mime/src/build.js
create mode 100644 node_modules/mime/src/test.js
create mode 100644 node_modules/mime/types.json
create mode 100644 node_modules/minimatch/LICENSE
create mode 100644 node_modules/minimatch/README.md
create mode 100644 node_modules/minimatch/minimatch.js
create mode 100644 node_modules/minimatch/package.json
create mode 100644 node_modules/ms/index.js
create mode 100644 node_modules/ms/license.md
create mode 100644 node_modules/ms/package.json
create mode 100644 node_modules/ms/readme.md
create mode 100644 node_modules/mysql/Changes.md
create mode 100644 node_modules/mysql/License
create mode 100644 node_modules/mysql/Readme.md
create mode 100644 node_modules/mysql/index.js
create mode 100644 node_modules/mysql/lib/Connection.js
create mode 100644 node_modules/mysql/lib/ConnectionConfig.js
create mode 100644 node_modules/mysql/lib/Pool.js
create mode 100644 node_modules/mysql/lib/PoolCluster.js
create mode 100644 node_modules/mysql/lib/PoolConfig.js
create mode 100644 node_modules/mysql/lib/PoolConnection.js
create mode 100644 node_modules/mysql/lib/PoolNamespace.js
create mode 100644 node_modules/mysql/lib/PoolSelector.js
create mode 100644 node_modules/mysql/lib/protocol/Auth.js
create mode 100644 node_modules/mysql/lib/protocol/BufferList.js
create mode 100644 node_modules/mysql/lib/protocol/PacketHeader.js
create mode 100644 node_modules/mysql/lib/protocol/PacketWriter.js
create mode 100644 node_modules/mysql/lib/protocol/Parser.js
create mode 100644 node_modules/mysql/lib/protocol/Protocol.js
create mode 100644 node_modules/mysql/lib/protocol/ResultSet.js
create mode 100644 node_modules/mysql/lib/protocol/SqlString.js
create mode 100644 node_modules/mysql/lib/protocol/Timer.js
create mode 100644 node_modules/mysql/lib/protocol/constants/charsets.js
create mode 100644 node_modules/mysql/lib/protocol/constants/client.js
create mode 100644 node_modules/mysql/lib/protocol/constants/errors.js
create mode 100644 node_modules/mysql/lib/protocol/constants/field_flags.js
create mode 100644 node_modules/mysql/lib/protocol/constants/server_status.js
create mode 100644 node_modules/mysql/lib/protocol/constants/ssl_profiles.js
create mode 100644 node_modules/mysql/lib/protocol/constants/types.js
create mode 100644 node_modules/mysql/lib/protocol/packets/AuthSwitchRequestPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/AuthSwitchResponsePacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ClientAuthenticationPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ComChangeUserPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ComPingPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ComQueryPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ComQuitPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ComStatisticsPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/EmptyPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/EofPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ErrorPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/Field.js
create mode 100644 node_modules/mysql/lib/protocol/packets/FieldPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/HandshakeInitializationPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/LocalDataFilePacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/LocalInfileRequestPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/OkPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/OldPasswordPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/ResultSetHeaderPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/RowDataPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/SSLRequestPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/StatisticsPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/UseOldPasswordPacket.js
create mode 100644 node_modules/mysql/lib/protocol/packets/index.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/ChangeUser.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/Handshake.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/Ping.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/Query.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/Quit.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/Sequence.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/Statistics.js
create mode 100644 node_modules/mysql/lib/protocol/sequences/index.js
create mode 100644 node_modules/mysql/node_modules/safe-buffer/LICENSE
create mode 100644 node_modules/mysql/node_modules/safe-buffer/README.md
create mode 100644 node_modules/mysql/node_modules/safe-buffer/index.d.ts
create mode 100644 node_modules/mysql/node_modules/safe-buffer/index.js
create mode 100644 node_modules/mysql/node_modules/safe-buffer/package.json
create mode 100644 node_modules/mysql/node_modules/sqlstring/HISTORY.md
create mode 100644 node_modules/mysql/node_modules/sqlstring/LICENSE
create mode 100644 node_modules/mysql/node_modules/sqlstring/README.md
create mode 100644 node_modules/mysql/node_modules/sqlstring/index.js
create mode 100644 node_modules/mysql/node_modules/sqlstring/lib/SqlString.js
create mode 100644 node_modules/mysql/node_modules/sqlstring/package.json
create mode 100644 node_modules/mysql/package.json
create mode 100644 node_modules/mysql2/License
create mode 100644 node_modules/mysql2/README.md
create mode 100644 node_modules/mysql2/index.d.ts
create mode 100644 node_modules/mysql2/index.js
create mode 100644 node_modules/mysql2/lib/auth_41.js
create mode 100644 node_modules/mysql2/lib/auth_plugins/caching_sha2_password.js
create mode 100644 node_modules/mysql2/lib/auth_plugins/caching_sha2_password.md
create mode 100644 node_modules/mysql2/lib/auth_plugins/index.js
create mode 100644 node_modules/mysql2/lib/auth_plugins/mysql_clear_password.js
create mode 100644 node_modules/mysql2/lib/auth_plugins/mysql_native_password.js
create mode 100644 node_modules/mysql2/lib/auth_plugins/sha256_password.js
create mode 100644 node_modules/mysql2/lib/base/connection.js
create mode 100644 node_modules/mysql2/lib/base/pool.js
create mode 100644 node_modules/mysql2/lib/base/pool_connection.js
create mode 100644 node_modules/mysql2/lib/commands/auth_switch.js
create mode 100644 node_modules/mysql2/lib/commands/binlog_dump.js
create mode 100644 node_modules/mysql2/lib/commands/change_user.js
create mode 100644 node_modules/mysql2/lib/commands/client_handshake.js
create mode 100644 node_modules/mysql2/lib/commands/close_statement.js
create mode 100644 node_modules/mysql2/lib/commands/command.js
create mode 100644 node_modules/mysql2/lib/commands/execute.js
create mode 100644 node_modules/mysql2/lib/commands/index.js
create mode 100644 node_modules/mysql2/lib/commands/ping.js
create mode 100644 node_modules/mysql2/lib/commands/prepare.js
create mode 100644 node_modules/mysql2/lib/commands/query.js
create mode 100644 node_modules/mysql2/lib/commands/quit.js
create mode 100644 node_modules/mysql2/lib/commands/register_slave.js
create mode 100644 node_modules/mysql2/lib/commands/server_handshake.js
create mode 100644 node_modules/mysql2/lib/compressed_protocol.js
create mode 100644 node_modules/mysql2/lib/connection.js
create mode 100644 node_modules/mysql2/lib/connection_config.js
create mode 100644 node_modules/mysql2/lib/constants/charset_encodings.js
create mode 100644 node_modules/mysql2/lib/constants/charsets.js
create mode 100644 node_modules/mysql2/lib/constants/client.js
create mode 100644 node_modules/mysql2/lib/constants/commands.js
create mode 100644 node_modules/mysql2/lib/constants/cursor.js
create mode 100644 node_modules/mysql2/lib/constants/encoding_charset.js
create mode 100644 node_modules/mysql2/lib/constants/errors.js
create mode 100644 node_modules/mysql2/lib/constants/field_flags.js
create mode 100644 node_modules/mysql2/lib/constants/server_status.js
create mode 100644 node_modules/mysql2/lib/constants/session_track.js
create mode 100644 node_modules/mysql2/lib/constants/ssl_profiles.js
create mode 100644 node_modules/mysql2/lib/constants/types.js
create mode 100644 node_modules/mysql2/lib/create_connection.js
create mode 100644 node_modules/mysql2/lib/create_pool.js
create mode 100644 node_modules/mysql2/lib/create_pool_cluster.js
create mode 100644 node_modules/mysql2/lib/helpers.js
create mode 100644 node_modules/mysql2/lib/packet_parser.js
create mode 100644 node_modules/mysql2/lib/packets/auth_next_factor.js
create mode 100644 node_modules/mysql2/lib/packets/auth_switch_request.js
create mode 100644 node_modules/mysql2/lib/packets/auth_switch_request_more_data.js
create mode 100644 node_modules/mysql2/lib/packets/auth_switch_response.js
create mode 100644 node_modules/mysql2/lib/packets/binary_row.js
create mode 100644 node_modules/mysql2/lib/packets/binlog_dump.js
create mode 100644 node_modules/mysql2/lib/packets/binlog_query_statusvars.js
create mode 100644 node_modules/mysql2/lib/packets/change_user.js
create mode 100644 node_modules/mysql2/lib/packets/close_statement.js
create mode 100644 node_modules/mysql2/lib/packets/column_definition.js
create mode 100644 node_modules/mysql2/lib/packets/execute.js
create mode 100644 node_modules/mysql2/lib/packets/handshake.js
create mode 100644 node_modules/mysql2/lib/packets/handshake_response.js
create mode 100644 node_modules/mysql2/lib/packets/index.js
create mode 100644 node_modules/mysql2/lib/packets/packet.js
create mode 100644 node_modules/mysql2/lib/packets/prepare_statement.js
create mode 100644 node_modules/mysql2/lib/packets/prepared_statement_header.js
create mode 100644 node_modules/mysql2/lib/packets/query.js
create mode 100644 node_modules/mysql2/lib/packets/register_slave.js
create mode 100644 node_modules/mysql2/lib/packets/resultset_header.js
create mode 100644 node_modules/mysql2/lib/packets/ssl_request.js
create mode 100644 node_modules/mysql2/lib/packets/text_row.js
create mode 100644 node_modules/mysql2/lib/parsers/binary_parser.js
create mode 100644 node_modules/mysql2/lib/parsers/parser_cache.js
create mode 100644 node_modules/mysql2/lib/parsers/string.js
create mode 100644 node_modules/mysql2/lib/parsers/text_parser.js
create mode 100644 node_modules/mysql2/lib/pool.js
create mode 100644 node_modules/mysql2/lib/pool_cluster.js
create mode 100644 node_modules/mysql2/lib/pool_config.js
create mode 100644 node_modules/mysql2/lib/pool_connection.js
create mode 100644 node_modules/mysql2/lib/promise/connection.js
create mode 100644 node_modules/mysql2/lib/promise/inherit_events.js
create mode 100644 node_modules/mysql2/lib/promise/make_done_cb.js
create mode 100644 node_modules/mysql2/lib/promise/pool.js
create mode 100644 node_modules/mysql2/lib/promise/pool_connection.js
create mode 100644 node_modules/mysql2/lib/promise/prepared_statement_info.js
create mode 100644 node_modules/mysql2/lib/results_stream.js
create mode 100644 node_modules/mysql2/lib/server.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.github/dependabot.yml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.idea/codeStyles/Project.xml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.idea/codeStyles/codeStyleConfig.xml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.idea/iconv-lite.iml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.idea/inspectionProfiles/Project_Default.xml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.idea/modules.xml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/.idea/vcs.xml
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/Changelog.md
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/LICENSE
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/README.md
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/dbcs-codec.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/dbcs-data.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/index.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/internal.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/sbcs-codec.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/sbcs-data-generated.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/sbcs-data.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/big5-added.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/cp936.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/cp949.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/cp950.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/eucjp.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/gb18030-ranges.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/gbk-added.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/tables/shiftjis.json
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/utf16.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/utf32.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/encodings/utf7.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/lib/bom-handling.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/lib/index.d.ts
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/lib/index.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/lib/streams.js
create mode 100644 node_modules/mysql2/node_modules/iconv-lite/package.json
create mode 100644 node_modules/mysql2/package.json
create mode 100644 node_modules/mysql2/promise.d.ts
create mode 100644 node_modules/mysql2/promise.js
create mode 100644 node_modules/mysql2/typings/mysql/LICENSE.txt
create mode 100644 node_modules/mysql2/typings/mysql/index.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/info.txt
create mode 100644 node_modules/mysql2/typings/mysql/lib/Auth.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/Connection.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/Pool.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/PoolCluster.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/PoolConnection.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/Server.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/constants/CharsetToEncoding.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/constants/Charsets.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/constants/Types.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/constants/index.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/parsers/ParserCache.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/parsers/index.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/parsers/typeCast.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/Field.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/FieldPacket.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/OkPacket.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/ProcedurePacket.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/ResultSetHeader.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/RowDataPacket.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/index.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/params/ErrorPacketParams.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/packets/params/OkPacketParams.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/ExecutableBase.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/Prepare.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/Query.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/QueryableBase.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/Sequence.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/promise/ExecutableBase.d.ts
create mode 100644 node_modules/mysql2/typings/mysql/lib/protocol/sequences/promise/QueryableBase.d.ts
create mode 100644 node_modules/named-placeholders/LICENSE
create mode 100644 node_modules/named-placeholders/README.md
create mode 100644 node_modules/named-placeholders/index.js
create mode 100644 node_modules/named-placeholders/package.json
create mode 100644 node_modules/negotiator/HISTORY.md
create mode 100644 node_modules/negotiator/LICENSE
create mode 100644 node_modules/negotiator/README.md
create mode 100644 node_modules/negotiator/index.js
create mode 100644 node_modules/negotiator/lib/charset.js
create mode 100644 node_modules/negotiator/lib/encoding.js
create mode 100644 node_modules/negotiator/lib/language.js
create mode 100644 node_modules/negotiator/lib/mediaType.js
create mode 100644 node_modules/negotiator/package.json
create mode 100644 node_modules/nodemailer/.gitattributes
create mode 100644 node_modules/nodemailer/.ncurc.js
create mode 100644 node_modules/nodemailer/.prettierrc.js
create mode 100644 node_modules/nodemailer/CHANGELOG.md
create mode 100644 node_modules/nodemailer/CODE_OF_CONDUCT.md
create mode 100644 node_modules/nodemailer/LICENSE
create mode 100644 node_modules/nodemailer/README.md
create mode 100644 node_modules/nodemailer/SECURITY.txt
create mode 100644 node_modules/nodemailer/lib/addressparser/index.js
create mode 100644 node_modules/nodemailer/lib/base64/index.js
create mode 100644 node_modules/nodemailer/lib/dkim/index.js
create mode 100644 node_modules/nodemailer/lib/dkim/message-parser.js
create mode 100644 node_modules/nodemailer/lib/dkim/relaxed-body.js
create mode 100644 node_modules/nodemailer/lib/dkim/sign.js
create mode 100644 node_modules/nodemailer/lib/fetch/cookies.js
create mode 100644 node_modules/nodemailer/lib/fetch/index.js
create mode 100644 node_modules/nodemailer/lib/json-transport/index.js
create mode 100644 node_modules/nodemailer/lib/mail-composer/index.js
create mode 100644 node_modules/nodemailer/lib/mailer/index.js
create mode 100644 node_modules/nodemailer/lib/mailer/mail-message.js
create mode 100644 node_modules/nodemailer/lib/mime-funcs/index.js
create mode 100644 node_modules/nodemailer/lib/mime-funcs/mime-types.js
create mode 100644 node_modules/nodemailer/lib/mime-node/index.js
create mode 100644 node_modules/nodemailer/lib/mime-node/last-newline.js
create mode 100644 node_modules/nodemailer/lib/mime-node/le-unix.js
create mode 100644 node_modules/nodemailer/lib/mime-node/le-windows.js
create mode 100644 node_modules/nodemailer/lib/nodemailer.js
create mode 100644 node_modules/nodemailer/lib/punycode/index.js
create mode 100644 node_modules/nodemailer/lib/qp/index.js
create mode 100644 node_modules/nodemailer/lib/sendmail-transport/index.js
create mode 100644 node_modules/nodemailer/lib/ses-transport/index.js
create mode 100644 node_modules/nodemailer/lib/shared/index.js
create mode 100644 node_modules/nodemailer/lib/smtp-connection/data-stream.js
create mode 100644 node_modules/nodemailer/lib/smtp-connection/http-proxy-client.js
create mode 100644 node_modules/nodemailer/lib/smtp-connection/index.js
create mode 100644 node_modules/nodemailer/lib/smtp-pool/index.js
create mode 100644 node_modules/nodemailer/lib/smtp-pool/pool-resource.js
create mode 100644 node_modules/nodemailer/lib/smtp-transport/index.js
create mode 100644 node_modules/nodemailer/lib/stream-transport/index.js
create mode 100644 node_modules/nodemailer/lib/well-known/index.js
create mode 100644 node_modules/nodemailer/lib/well-known/services.json
create mode 100644 node_modules/nodemailer/lib/xoauth2/index.js
create mode 100644 node_modules/nodemailer/package.json
create mode 100644 node_modules/nodemon/.prettierrc.json
create mode 100644 node_modules/nodemon/LICENSE
create mode 100644 node_modules/nodemon/README.md
create mode 100644 node_modules/nodemon/bin/nodemon.js
create mode 100644 node_modules/nodemon/bin/windows-kill.exe
create mode 100644 node_modules/nodemon/doc/cli/authors.txt
create mode 100644 node_modules/nodemon/doc/cli/config.txt
create mode 100644 node_modules/nodemon/doc/cli/help.txt
create mode 100644 node_modules/nodemon/doc/cli/logo.txt
create mode 100644 node_modules/nodemon/doc/cli/options.txt
create mode 100644 node_modules/nodemon/doc/cli/topics.txt
create mode 100644 node_modules/nodemon/doc/cli/usage.txt
create mode 100644 node_modules/nodemon/doc/cli/whoami.txt
create mode 100644 node_modules/nodemon/index.d.ts
create mode 100644 node_modules/nodemon/jsconfig.json
create mode 100644 node_modules/nodemon/lib/cli/index.js
create mode 100644 node_modules/nodemon/lib/cli/parse.js
create mode 100644 node_modules/nodemon/lib/config/command.js
create mode 100644 node_modules/nodemon/lib/config/defaults.js
create mode 100644 node_modules/nodemon/lib/config/exec.js
create mode 100644 node_modules/nodemon/lib/config/index.js
create mode 100644 node_modules/nodemon/lib/config/load.js
create mode 100644 node_modules/nodemon/lib/help/index.js
create mode 100644 node_modules/nodemon/lib/index.js
create mode 100644 node_modules/nodemon/lib/monitor/index.js
create mode 100644 node_modules/nodemon/lib/monitor/match.js
create mode 100644 node_modules/nodemon/lib/monitor/run.js
create mode 100644 node_modules/nodemon/lib/monitor/signals.js
create mode 100644 node_modules/nodemon/lib/monitor/watch.js
create mode 100644 node_modules/nodemon/lib/nodemon.js
create mode 100644 node_modules/nodemon/lib/rules/add.js
create mode 100644 node_modules/nodemon/lib/rules/index.js
create mode 100644 node_modules/nodemon/lib/rules/parse.js
create mode 100644 node_modules/nodemon/lib/spawn.js
create mode 100644 node_modules/nodemon/lib/utils/bus.js
create mode 100644 node_modules/nodemon/lib/utils/clone.js
create mode 100644 node_modules/nodemon/lib/utils/colour.js
create mode 100644 node_modules/nodemon/lib/utils/index.js
create mode 100644 node_modules/nodemon/lib/utils/log.js
create mode 100644 node_modules/nodemon/lib/utils/merge.js
create mode 100644 node_modules/nodemon/lib/version.js
create mode 100644 node_modules/nodemon/node_modules/debug/LICENSE
create mode 100644 node_modules/nodemon/node_modules/debug/README.md
create mode 100644 node_modules/nodemon/node_modules/debug/package.json
create mode 100644 node_modules/nodemon/node_modules/debug/src/browser.js
create mode 100644 node_modules/nodemon/node_modules/debug/src/common.js
create mode 100644 node_modules/nodemon/node_modules/debug/src/index.js
create mode 100644 node_modules/nodemon/node_modules/debug/src/node.js
create mode 100644 node_modules/nodemon/node_modules/ms/index.js
create mode 100644 node_modules/nodemon/node_modules/ms/license.md
create mode 100644 node_modules/nodemon/node_modules/ms/package.json
create mode 100644 node_modules/nodemon/node_modules/ms/readme.md
create mode 100644 node_modules/nodemon/package.json
create mode 100644 node_modules/normalize-path/LICENSE
create mode 100644 node_modules/normalize-path/README.md
create mode 100644 node_modules/normalize-path/index.js
create mode 100644 node_modules/normalize-path/package.json
create mode 100644 node_modules/object-assign/index.js
create mode 100644 node_modules/object-assign/license
create mode 100644 node_modules/object-assign/package.json
create mode 100644 node_modules/object-assign/readme.md
create mode 100644 node_modules/object-inspect/.eslintrc
create mode 100644 node_modules/object-inspect/.github/FUNDING.yml
create mode 100644 node_modules/object-inspect/.nycrc
create mode 100644 node_modules/object-inspect/CHANGELOG.md
create mode 100644 node_modules/object-inspect/LICENSE
create mode 100644 node_modules/object-inspect/example/all.js
create mode 100644 node_modules/object-inspect/example/circular.js
create mode 100644 node_modules/object-inspect/example/fn.js
create mode 100644 node_modules/object-inspect/example/inspect.js
create mode 100644 node_modules/object-inspect/index.js
create mode 100644 node_modules/object-inspect/package-support.json
create mode 100644 node_modules/object-inspect/package.json
create mode 100644 node_modules/object-inspect/readme.markdown
create mode 100644 node_modules/object-inspect/test-core-js.js
create mode 100644 node_modules/object-inspect/test/bigint.js
create mode 100644 node_modules/object-inspect/test/browser/dom.js
create mode 100644 node_modules/object-inspect/test/circular.js
create mode 100644 node_modules/object-inspect/test/deep.js
create mode 100644 node_modules/object-inspect/test/element.js
create mode 100644 node_modules/object-inspect/test/err.js
create mode 100644 node_modules/object-inspect/test/fakes.js
create mode 100644 node_modules/object-inspect/test/fn.js
create mode 100644 node_modules/object-inspect/test/global.js
create mode 100644 node_modules/object-inspect/test/has.js
create mode 100644 node_modules/object-inspect/test/holes.js
create mode 100644 node_modules/object-inspect/test/indent-option.js
create mode 100644 node_modules/object-inspect/test/inspect.js
create mode 100644 node_modules/object-inspect/test/lowbyte.js
create mode 100644 node_modules/object-inspect/test/number.js
create mode 100644 node_modules/object-inspect/test/quoteStyle.js
create mode 100644 node_modules/object-inspect/test/toStringTag.js
create mode 100644 node_modules/object-inspect/test/undef.js
create mode 100644 node_modules/object-inspect/test/values.js
create mode 100644 node_modules/object-inspect/util.inspect.js
create mode 100644 node_modules/on-finished/HISTORY.md
create mode 100644 node_modules/on-finished/LICENSE
create mode 100644 node_modules/on-finished/README.md
create mode 100644 node_modules/on-finished/index.js
create mode 100644 node_modules/on-finished/package.json
create mode 100644 node_modules/parseurl/HISTORY.md
create mode 100644 node_modules/parseurl/LICENSE
create mode 100644 node_modules/parseurl/README.md
create mode 100644 node_modules/parseurl/index.js
create mode 100644 node_modules/parseurl/package.json
create mode 100644 node_modules/path-to-regexp/LICENSE
create mode 100644 node_modules/path-to-regexp/Readme.md
create mode 100644 node_modules/path-to-regexp/index.js
create mode 100644 node_modules/path-to-regexp/package.json
create mode 100644 node_modules/picomatch/CHANGELOG.md
create mode 100644 node_modules/picomatch/LICENSE
create mode 100644 node_modules/picomatch/README.md
create mode 100644 node_modules/picomatch/index.js
create mode 100644 node_modules/picomatch/lib/constants.js
create mode 100644 node_modules/picomatch/lib/parse.js
create mode 100644 node_modules/picomatch/lib/picomatch.js
create mode 100644 node_modules/picomatch/lib/scan.js
create mode 100644 node_modules/picomatch/lib/utils.js
create mode 100644 node_modules/picomatch/package.json
create mode 100644 node_modules/process-nextick-args/index.js
create mode 100644 node_modules/process-nextick-args/license.md
create mode 100644 node_modules/process-nextick-args/package.json
create mode 100644 node_modules/process-nextick-args/readme.md
create mode 100644 node_modules/proxy-addr/HISTORY.md
create mode 100644 node_modules/proxy-addr/LICENSE
create mode 100644 node_modules/proxy-addr/README.md
create mode 100644 node_modules/proxy-addr/index.js
create mode 100644 node_modules/proxy-addr/package.json
create mode 100644 node_modules/pstree.remy/.travis.yml
create mode 100644 node_modules/pstree.remy/LICENSE
create mode 100644 node_modules/pstree.remy/README.md
create mode 100644 node_modules/pstree.remy/lib/index.js
create mode 100644 node_modules/pstree.remy/lib/tree.js
create mode 100644 node_modules/pstree.remy/lib/utils.js
create mode 100644 node_modules/pstree.remy/package.json
create mode 100644 node_modules/pstree.remy/tests/fixtures/index.js
create mode 100644 node_modules/pstree.remy/tests/fixtures/out1
create mode 100644 node_modules/pstree.remy/tests/fixtures/out2
create mode 100644 node_modules/pstree.remy/tests/index.test.js
create mode 100644 node_modules/qs/.editorconfig
create mode 100644 node_modules/qs/.eslintrc
create mode 100644 node_modules/qs/.github/FUNDING.yml
create mode 100644 node_modules/qs/.nycrc
create mode 100644 node_modules/qs/CHANGELOG.md
create mode 100644 node_modules/qs/LICENSE.md
create mode 100644 node_modules/qs/README.md
create mode 100644 node_modules/qs/dist/qs.js
create mode 100644 node_modules/qs/lib/formats.js
create mode 100644 node_modules/qs/lib/index.js
create mode 100644 node_modules/qs/lib/parse.js
create mode 100644 node_modules/qs/lib/stringify.js
create mode 100644 node_modules/qs/lib/utils.js
create mode 100644 node_modules/qs/package.json
create mode 100644 node_modules/qs/test/empty-keys-cases.js
create mode 100644 node_modules/qs/test/parse.js
create mode 100644 node_modules/qs/test/stringify.js
create mode 100644 node_modules/qs/test/utils.js
create mode 100644 node_modules/range-parser/HISTORY.md
create mode 100644 node_modules/range-parser/LICENSE
create mode 100644 node_modules/range-parser/README.md
create mode 100644 node_modules/range-parser/index.js
create mode 100644 node_modules/range-parser/package.json
create mode 100644 node_modules/raw-body/HISTORY.md
create mode 100644 node_modules/raw-body/LICENSE
create mode 100644 node_modules/raw-body/README.md
create mode 100644 node_modules/raw-body/SECURITY.md
create mode 100644 node_modules/raw-body/index.d.ts
create mode 100644 node_modules/raw-body/index.js
create mode 100644 node_modules/raw-body/package.json
create mode 100644 node_modules/readable-stream/.travis.yml
create mode 100644 node_modules/readable-stream/CONTRIBUTING.md
create mode 100644 node_modules/readable-stream/GOVERNANCE.md
create mode 100644 node_modules/readable-stream/LICENSE
create mode 100644 node_modules/readable-stream/README.md
create mode 100644 node_modules/readable-stream/doc/wg-meetings/2015-01-30.md
create mode 100644 node_modules/readable-stream/duplex-browser.js
create mode 100644 node_modules/readable-stream/duplex.js
create mode 100644 node_modules/readable-stream/lib/_stream_duplex.js
create mode 100644 node_modules/readable-stream/lib/_stream_passthrough.js
create mode 100644 node_modules/readable-stream/lib/_stream_readable.js
create mode 100644 node_modules/readable-stream/lib/_stream_transform.js
create mode 100644 node_modules/readable-stream/lib/_stream_writable.js
create mode 100644 node_modules/readable-stream/lib/internal/streams/BufferList.js
create mode 100644 node_modules/readable-stream/lib/internal/streams/destroy.js
create mode 100644 node_modules/readable-stream/lib/internal/streams/stream-browser.js
create mode 100644 node_modules/readable-stream/lib/internal/streams/stream.js
create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/LICENSE
create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/README.md
create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/index.d.ts
create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/index.js
create mode 100644 node_modules/readable-stream/node_modules/safe-buffer/package.json
create mode 100644 node_modules/readable-stream/package.json
create mode 100644 node_modules/readable-stream/passthrough.js
create mode 100644 node_modules/readable-stream/readable-browser.js
create mode 100644 node_modules/readable-stream/readable.js
create mode 100644 node_modules/readable-stream/transform.js
create mode 100644 node_modules/readable-stream/writable-browser.js
create mode 100644 node_modules/readable-stream/writable.js
create mode 100644 node_modules/readdirp/LICENSE
create mode 100644 node_modules/readdirp/README.md
create mode 100644 node_modules/readdirp/index.d.ts
create mode 100644 node_modules/readdirp/index.js
create mode 100644 node_modules/readdirp/package.json
create mode 100644 node_modules/safe-buffer/LICENSE
create mode 100644 node_modules/safe-buffer/README.md
create mode 100644 node_modules/safe-buffer/index.d.ts
create mode 100644 node_modules/safe-buffer/index.js
create mode 100644 node_modules/safe-buffer/package.json
create mode 100644 node_modules/safer-buffer/LICENSE
create mode 100644 node_modules/safer-buffer/Porting-Buffer.md
create mode 100644 node_modules/safer-buffer/Readme.md
create mode 100644 node_modules/safer-buffer/dangerous.js
create mode 100644 node_modules/safer-buffer/package.json
create mode 100644 node_modules/safer-buffer/safer.js
create mode 100644 node_modules/safer-buffer/tests.js
create mode 100644 node_modules/semver/LICENSE
create mode 100644 node_modules/semver/README.md
create mode 100644 node_modules/semver/bin/semver.js
create mode 100644 node_modules/semver/classes/comparator.js
create mode 100644 node_modules/semver/classes/index.js
create mode 100644 node_modules/semver/classes/range.js
create mode 100644 node_modules/semver/classes/semver.js
create mode 100644 node_modules/semver/functions/clean.js
create mode 100644 node_modules/semver/functions/cmp.js
create mode 100644 node_modules/semver/functions/coerce.js
create mode 100644 node_modules/semver/functions/compare-build.js
create mode 100644 node_modules/semver/functions/compare-loose.js
create mode 100644 node_modules/semver/functions/compare.js
create mode 100644 node_modules/semver/functions/diff.js
create mode 100644 node_modules/semver/functions/eq.js
create mode 100644 node_modules/semver/functions/gt.js
create mode 100644 node_modules/semver/functions/gte.js
create mode 100644 node_modules/semver/functions/inc.js
create mode 100644 node_modules/semver/functions/lt.js
create mode 100644 node_modules/semver/functions/lte.js
create mode 100644 node_modules/semver/functions/major.js
create mode 100644 node_modules/semver/functions/minor.js
create mode 100644 node_modules/semver/functions/neq.js
create mode 100644 node_modules/semver/functions/parse.js
create mode 100644 node_modules/semver/functions/patch.js
create mode 100644 node_modules/semver/functions/prerelease.js
create mode 100644 node_modules/semver/functions/rcompare.js
create mode 100644 node_modules/semver/functions/rsort.js
create mode 100644 node_modules/semver/functions/satisfies.js
create mode 100644 node_modules/semver/functions/sort.js
create mode 100644 node_modules/semver/functions/valid.js
create mode 100644 node_modules/semver/index.js
create mode 100644 node_modules/semver/internal/constants.js
create mode 100644 node_modules/semver/internal/debug.js
create mode 100644 node_modules/semver/internal/identifiers.js
create mode 100644 node_modules/semver/internal/lrucache.js
create mode 100644 node_modules/semver/internal/parse-options.js
create mode 100644 node_modules/semver/internal/re.js
create mode 100644 node_modules/semver/package.json
create mode 100644 node_modules/semver/preload.js
create mode 100644 node_modules/semver/range.bnf
create mode 100644 node_modules/semver/ranges/gtr.js
create mode 100644 node_modules/semver/ranges/intersects.js
create mode 100644 node_modules/semver/ranges/ltr.js
create mode 100644 node_modules/semver/ranges/max-satisfying.js
create mode 100644 node_modules/semver/ranges/min-satisfying.js
create mode 100644 node_modules/semver/ranges/min-version.js
create mode 100644 node_modules/semver/ranges/outside.js
create mode 100644 node_modules/semver/ranges/simplify.js
create mode 100644 node_modules/semver/ranges/subset.js
create mode 100644 node_modules/semver/ranges/to-comparators.js
create mode 100644 node_modules/semver/ranges/valid.js
create mode 100644 node_modules/send/HISTORY.md
create mode 100644 node_modules/send/LICENSE
create mode 100644 node_modules/send/README.md
create mode 100644 node_modules/send/SECURITY.md
create mode 100644 node_modules/send/index.js
create mode 100644 node_modules/send/node_modules/encodeurl/HISTORY.md
create mode 100644 node_modules/send/node_modules/encodeurl/LICENSE
create mode 100644 node_modules/send/node_modules/encodeurl/README.md
create mode 100644 node_modules/send/node_modules/encodeurl/index.js
create mode 100644 node_modules/send/node_modules/encodeurl/package.json
create mode 100644 node_modules/send/node_modules/ms/index.js
create mode 100644 node_modules/send/node_modules/ms/license.md
create mode 100644 node_modules/send/node_modules/ms/package.json
create mode 100644 node_modules/send/node_modules/ms/readme.md
create mode 100644 node_modules/send/package.json
create mode 100644 node_modules/seq-queue/.jshintrc
create mode 100644 node_modules/seq-queue/.npmignore
create mode 100644 node_modules/seq-queue/AUTHORS
create mode 100644 node_modules/seq-queue/LICENSE
create mode 100644 node_modules/seq-queue/Makefile
create mode 100644 node_modules/seq-queue/README.md
create mode 100644 node_modules/seq-queue/index.js
create mode 100644 node_modules/seq-queue/lib/.npmignore
create mode 100644 node_modules/seq-queue/lib/seq-queue.js
create mode 100644 node_modules/seq-queue/package.json
create mode 100644 node_modules/seq-queue/test/seq-queue-test.js
create mode 100644 node_modules/serve-static/HISTORY.md
create mode 100644 node_modules/serve-static/LICENSE
create mode 100644 node_modules/serve-static/README.md
create mode 100644 node_modules/serve-static/index.js
create mode 100644 node_modules/serve-static/package.json
create mode 100644 node_modules/setprototypeof/LICENSE
create mode 100644 node_modules/setprototypeof/README.md
create mode 100644 node_modules/setprototypeof/index.d.ts
create mode 100644 node_modules/setprototypeof/index.js
create mode 100644 node_modules/setprototypeof/package.json
create mode 100644 node_modules/setprototypeof/test/index.js
create mode 100644 node_modules/side-channel-list/.editorconfig
create mode 100644 node_modules/side-channel-list/.eslintrc
create mode 100644 node_modules/side-channel-list/.github/FUNDING.yml
create mode 100644 node_modules/side-channel-list/.nycrc
create mode 100644 node_modules/side-channel-list/CHANGELOG.md
create mode 100644 node_modules/side-channel-list/LICENSE
create mode 100644 node_modules/side-channel-list/README.md
create mode 100644 node_modules/side-channel-list/index.d.ts
create mode 100644 node_modules/side-channel-list/index.js
create mode 100644 node_modules/side-channel-list/list.d.ts
create mode 100644 node_modules/side-channel-list/package.json
create mode 100644 node_modules/side-channel-list/test/index.js
create mode 100644 node_modules/side-channel-list/tsconfig.json
create mode 100644 node_modules/side-channel-map/.editorconfig
create mode 100644 node_modules/side-channel-map/.eslintrc
create mode 100644 node_modules/side-channel-map/.github/FUNDING.yml
create mode 100644 node_modules/side-channel-map/.nycrc
create mode 100644 node_modules/side-channel-map/CHANGELOG.md
create mode 100644 node_modules/side-channel-map/LICENSE
create mode 100644 node_modules/side-channel-map/README.md
create mode 100644 node_modules/side-channel-map/index.d.ts
create mode 100644 node_modules/side-channel-map/index.js
create mode 100644 node_modules/side-channel-map/package.json
create mode 100644 node_modules/side-channel-map/test/index.js
create mode 100644 node_modules/side-channel-map/tsconfig.json
create mode 100644 node_modules/side-channel-weakmap/.editorconfig
create mode 100644 node_modules/side-channel-weakmap/.eslintrc
create mode 100644 node_modules/side-channel-weakmap/.github/FUNDING.yml
create mode 100644 node_modules/side-channel-weakmap/.nycrc
create mode 100644 node_modules/side-channel-weakmap/CHANGELOG.md
create mode 100644 node_modules/side-channel-weakmap/LICENSE
create mode 100644 node_modules/side-channel-weakmap/README.md
create mode 100644 node_modules/side-channel-weakmap/index.d.ts
create mode 100644 node_modules/side-channel-weakmap/index.js
create mode 100644 node_modules/side-channel-weakmap/package.json
create mode 100644 node_modules/side-channel-weakmap/test/index.js
create mode 100644 node_modules/side-channel-weakmap/tsconfig.json
create mode 100644 node_modules/side-channel/.editorconfig
create mode 100644 node_modules/side-channel/.eslintrc
create mode 100644 node_modules/side-channel/.github/FUNDING.yml
create mode 100644 node_modules/side-channel/.nycrc
create mode 100644 node_modules/side-channel/CHANGELOG.md
create mode 100644 node_modules/side-channel/LICENSE
create mode 100644 node_modules/side-channel/README.md
create mode 100644 node_modules/side-channel/index.d.ts
create mode 100644 node_modules/side-channel/index.js
create mode 100644 node_modules/side-channel/package.json
create mode 100644 node_modules/side-channel/test/index.js
create mode 100644 node_modules/side-channel/tsconfig.json
create mode 100644 node_modules/simple-update-notifier/LICENSE
create mode 100644 node_modules/simple-update-notifier/README.md
create mode 100644 node_modules/simple-update-notifier/build/index.d.ts
create mode 100644 node_modules/simple-update-notifier/build/index.js
create mode 100644 node_modules/simple-update-notifier/package.json
create mode 100644 node_modules/simple-update-notifier/src/borderedText.ts
create mode 100644 node_modules/simple-update-notifier/src/cache.spec.ts
create mode 100644 node_modules/simple-update-notifier/src/cache.ts
create mode 100644 node_modules/simple-update-notifier/src/getDistVersion.spec.ts
create mode 100644 node_modules/simple-update-notifier/src/getDistVersion.ts
create mode 100644 node_modules/simple-update-notifier/src/hasNewVersion.spec.ts
create mode 100644 node_modules/simple-update-notifier/src/hasNewVersion.ts
create mode 100644 node_modules/simple-update-notifier/src/index.spec.ts
create mode 100644 node_modules/simple-update-notifier/src/index.ts
create mode 100644 node_modules/simple-update-notifier/src/isNpmOrYarn.ts
create mode 100644 node_modules/simple-update-notifier/src/types.ts
create mode 100644 node_modules/sqlstring/HISTORY.md
create mode 100644 node_modules/sqlstring/LICENSE
create mode 100644 node_modules/sqlstring/README.md
create mode 100644 node_modules/sqlstring/index.js
create mode 100644 node_modules/sqlstring/lib/SqlString.js
create mode 100644 node_modules/sqlstring/package.json
create mode 100644 node_modules/statuses/HISTORY.md
create mode 100644 node_modules/statuses/LICENSE
create mode 100644 node_modules/statuses/README.md
create mode 100644 node_modules/statuses/codes.json
create mode 100644 node_modules/statuses/index.js
create mode 100644 node_modules/statuses/package.json
create mode 100644 node_modules/string_decoder/.travis.yml
create mode 100644 node_modules/string_decoder/LICENSE
create mode 100644 node_modules/string_decoder/README.md
create mode 100644 node_modules/string_decoder/lib/string_decoder.js
create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/LICENSE
create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/README.md
create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/index.d.ts
create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/index.js
create mode 100644 node_modules/string_decoder/node_modules/safe-buffer/package.json
create mode 100644 node_modules/string_decoder/package.json
create mode 100644 node_modules/supports-color/browser.js
create mode 100644 node_modules/supports-color/index.js
create mode 100644 node_modules/supports-color/license
create mode 100644 node_modules/supports-color/package.json
create mode 100644 node_modules/supports-color/readme.md
create mode 100644 node_modules/to-regex-range/LICENSE
create mode 100644 node_modules/to-regex-range/README.md
create mode 100644 node_modules/to-regex-range/index.js
create mode 100644 node_modules/to-regex-range/package.json
create mode 100644 node_modules/toidentifier/HISTORY.md
create mode 100644 node_modules/toidentifier/LICENSE
create mode 100644 node_modules/toidentifier/README.md
create mode 100644 node_modules/toidentifier/index.js
create mode 100644 node_modules/toidentifier/package.json
create mode 100644 node_modules/touch/LICENSE
create mode 100644 node_modules/touch/README.md
create mode 100644 node_modules/touch/bin/nodetouch.js
create mode 100644 node_modules/touch/index.js
create mode 100644 node_modules/touch/package.json
create mode 100644 node_modules/type-is/HISTORY.md
create mode 100644 node_modules/type-is/LICENSE
create mode 100644 node_modules/type-is/README.md
create mode 100644 node_modules/type-is/index.js
create mode 100644 node_modules/type-is/package.json
create mode 100644 node_modules/undefsafe/.github/workflows/release.yml
create mode 100644 node_modules/undefsafe/.jscsrc
create mode 100644 node_modules/undefsafe/.jshintrc
create mode 100644 node_modules/undefsafe/.travis.yml
create mode 100644 node_modules/undefsafe/LICENSE
create mode 100644 node_modules/undefsafe/README.md
create mode 100644 node_modules/undefsafe/example.js
create mode 100644 node_modules/undefsafe/lib/undefsafe.js
create mode 100644 node_modules/undefsafe/package.json
create mode 100644 node_modules/unpipe/HISTORY.md
create mode 100644 node_modules/unpipe/LICENSE
create mode 100644 node_modules/unpipe/README.md
create mode 100644 node_modules/unpipe/index.js
create mode 100644 node_modules/unpipe/package.json
create mode 100644 node_modules/util-deprecate/History.md
create mode 100644 node_modules/util-deprecate/LICENSE
create mode 100644 node_modules/util-deprecate/README.md
create mode 100644 node_modules/util-deprecate/browser.js
create mode 100644 node_modules/util-deprecate/node.js
create mode 100644 node_modules/util-deprecate/package.json
create mode 100644 node_modules/utils-merge/.npmignore
create mode 100644 node_modules/utils-merge/LICENSE
create mode 100644 node_modules/utils-merge/README.md
create mode 100644 node_modules/utils-merge/index.js
create mode 100644 node_modules/utils-merge/package.json
create mode 100644 node_modules/vary/HISTORY.md
create mode 100644 node_modules/vary/LICENSE
create mode 100644 node_modules/vary/README.md
create mode 100644 node_modules/vary/index.js
create mode 100644 node_modules/vary/package.json
create mode 100644 package-lock.json
create mode 100644 package.json
create mode 100644 routes/category.js
create mode 100644 routes/history.js
create mode 100644 routes/product.js
create mode 100644 routes/recommendation.js
create mode 100644 routes/review.js
create mode 100644 routes/search.js
create mode 100644 routes/user.js
create mode 100644 utils/database.js
create mode 100644 utils/helper.js
create mode 100644 utils/mail.js
diff --git a/controllers/category.js b/controllers/category.js
new file mode 100644
index 0000000..90cbd94
--- /dev/null
+++ b/controllers/category.js
@@ -0,0 +1,47 @@
+const db = require("../utils/database");
+
+exports.getAllCategoriesWithPagination = async (req, res) => {
+ const limit = +req.query?.limit;
+ const page = +req.query?.page;
+ const offset = (page - 1) * limit;
+ try {
+ const [data, _] = await db.execute(
+ "SELECT * FROM Category C ORDER BY C.CategoryID ASC LIMIT ? OFFSET ?",
+ [limit.toString(), offset.toString()]
+ );
+
+ const [result] = await db.execute("SELECT COUNT(*) AS count FROM Category");
+ const { count: total } = result[0];
+ return res.json({ data, total });
+ } catch (error) {
+ res.json({ error: "Cannot fetch categories from database!" });
+ }
+};
+
+exports.addCategory = async (req, res) => {
+ const { name } = req.body;
+
+ try {
+ const [result] = await db.execute(
+ "INSERT INTO Category (Name) VALUES (?)",
+ [name]
+ );
+ res.json({ message: "Adding new category successfully!" });
+ } catch (error) {
+ res.json({ error: "Cannot add new category!" });
+ }
+};
+
+exports.removeCategory = async (req, res) => {
+ const { id } = req.params;
+
+ try {
+ const [result] = await db.execute(
+ `DELETE FROM Category WHERE CategoryID = ?`,
+ [id]
+ );
+ res.json({ message: "Delete category successfully!" });
+ } catch (error) {
+ res.json({ error: "Cannot remove category from database!" });
+ }
+};
diff --git a/controllers/history.js b/controllers/history.js
new file mode 100644
index 0000000..1c85042
--- /dev/null
+++ b/controllers/history.js
@@ -0,0 +1,90 @@
+const db = require("../utils/database");
+
+exports.HistoryByUserId = async (req, res) => {
+ const { id } = req.body;
+ try {
+ const [data] = await db.execute(
+ `
+ WITH RankedImages AS (
+ SELECT
+ P.ProductID,
+ P.Name AS ProductName,
+ P.Price,
+ P.Date AS DateUploaded,
+ U.Name AS SellerName,
+ I.URL AS ProductImage,
+ C.Name AS Category,
+ ROW_NUMBER() OVER (PARTITION BY P.ProductID ORDER BY I.URL) AS RowNum
+ FROM Product P
+ JOIN Image_URL I ON P.ProductID = I.ProductID
+ JOIN User U ON P.UserID = U.UserID
+ JOIN Category C ON P.CategoryID = C.CategoryID
+ JOIN History H ON H.ProductID = P.ProductID
+ WHERE H.UserID = ?
+ )
+ SELECT
+ ProductID,
+ ProductName,
+ Price,
+ DateUploaded,
+ SellerName,
+ ProductImage,
+ Category
+ FROM RankedImages
+ WHERE RowNum = 1;
+ `,
+ [id],
+ );
+
+ res.json({
+ success: true,
+ message: "Products fetched successfully",
+ data,
+ });
+ } catch (error) {
+ console.error("Error finding products:", error);
+ return res.status(500).json({
+ found: false,
+ error: "Database error occurred",
+ });
+ }
+};
+
+exports.AddHistory = async (req, res) => {
+ const { userID, productID } = req.body;
+ console.log(userID);
+ try {
+ // Use parameterized query to prevent SQL injection
+ const [result] = await db.execute(
+ `INSERT INTO History (UserID, ProductID) VALUES (?, ?)`,
+ [userID, productID],
+ );
+
+ res.json({
+ success: true,
+ message: "Product added to history successfully",
+ });
+ } catch (error) {
+ console.error("Error adding favorite product:", error);
+ return res.json({ error: "Could not add favorite product" });
+ }
+};
+
+exports.DelHistory = async (req, res) => {
+ const { userID, productID } = req.body;
+ console.log(userID);
+ try {
+ // Use parameterized query to prevent SQL injection
+ const [result] = await db.execute(`DELETE FROM History WHERE UserID=?`, [
+ userID,
+ ]);
+
+ res.json({
+ success: true,
+ message: "Product deleted from History successfully",
+ });
+ } catch (error) {
+ console.error("Error adding favorite product:", error);
+ return res.json({ error: "Could not add favorite product" });
+ }
+};
diff --git a/controllers/product.js b/controllers/product.js
new file mode 100644
index 0000000..a606fa2
--- /dev/null
+++ b/controllers/product.js
@@ -0,0 +1,301 @@
+const db = require("../utils/database");
+
+exports.addProduct = async (req, res) => {
+ const { userID, name, price, qty, description, category, images } = req.body;
+
+ try {
+ const [result] = await db.execute(
+ `INSERT INTO Product (Name, Price, StockQuantity, UserID, Description, CategoryID) VALUES (?, ?, ?, ?, ?, ?)`,
+ [name, price, qty, userID, description, category]
+ );
+
+ const productID = result.insertId;
+ if (images && images.length > 0) {
+ const imageInsertPromises = images.map((imagePath) =>
+ db.execute(`INSERT INTO Image_URL (URL, ProductID) VALUES (?, ?)`, [
+ imagePath,
+ productID,
+ ])
+ );
+
+ await Promise.all(imageInsertPromises); //perallel
+ }
+
+ res.json({
+ success: true,
+ message: "Product and images added successfully",
+ });
+ } catch (error) {
+ console.error("Error adding product or images:", error);
+ console.log(error);
+ return res.json({ error: "Could not add product or images" });
+ }
+};
+
+exports.addFavorite = async (req, res) => {
+ const { userID, productID } = req.body;
+ console.log(userID);
+ try {
+ // Use parameterized query to prevent SQL injection
+ const [result] = await db.execute(
+ `INSERT INTO Favorites (UserID, ProductID) VALUES (?, ?)`,
+ [userID, productID]
+ );
+
+ res.json({
+ success: true,
+ message: "Product added to favorites successfully",
+ });
+ } catch (error) {
+ console.error("Error adding favorite product:", error);
+ return res.json({ error: "Could not add favorite product" });
+ }
+};
+
+exports.removeFavorite = async (req, res) => {
+ const { userID, productID } = req.body;
+ console.log(userID);
+ try {
+ // Use parameterized query to prevent SQL injection
+ const [result] = await db.execute(
+ `DELETE FROM Favorites WHERE UserID = ? AND ProductID = ?`,
+ [userID, productID]
+ );
+
+ res.json({
+ success: true,
+ message: "Product removed from favorites successfully",
+ });
+ } catch (error) {
+ console.error("Error removing favorite product:", error);
+ return res.json({ error: "Could not remove favorite product" });
+ }
+};
+
+exports.getFavorites = async (req, res) => {
+ const { userID } = req.body;
+
+ try {
+ const [favorites] = await db.execute(
+ `
+ SELECT
+ p.ProductID,
+ p.Name,
+ p.Description,
+ p.Price,
+ p.CategoryID,
+ p.UserID,
+ p.Date,
+ u.Name AS SellerName,
+ MIN(i.URL) AS image_url
+ FROM Favorites f
+ JOIN Product p ON f.ProductID = p.ProductID
+ JOIN User u ON p.UserID = u.UserID
+ LEFT JOIN Image_URL i ON p.ProductID = i.ProductID
+ WHERE f.UserID = ?
+ GROUP BY
+ p.ProductID,
+ p.Name,
+ p.Description,
+ p.Price,
+ p.CategoryID,
+ p.UserID,
+ p.Date,
+ u.Name;
+ `,
+ [userID]
+ );
+
+ res.json({
+ success: true,
+ favorites: favorites,
+ });
+ } catch (error) {
+ console.error("Error retrieving favorites:", error);
+ res.status(500).json({ error: "Could not retrieve favorite products" });
+ }
+};
+
+// Get all products along with their image URLs
+exports.getAllProducts = async (req, res) => {
+ try {
+ const [data, fields] = await db.execute(`
+ SELECT
+ P.ProductID,
+ P.Name AS ProductName,
+ P.Price,
+ P.Date AS DateUploaded,
+ U.Name AS SellerName,
+ MIN(I.URL) AS ProductImage,
+ C.Name AS Category
+FROM Product P
+JOIN Image_URL I ON P.ProductID = I.ProductID
+JOIN User U ON P.UserID = U.UserID
+JOIN Category C ON P.CategoryID = C.CategoryID
+GROUP BY
+ P.ProductID,
+ P.Name,
+ P.Price,
+ P.Date,
+ U.Name,
+ C.Name;
+ `);
+
+ res.json({
+ success: true,
+ message: "Products fetched successfully",
+ data,
+ });
+ } catch (error) {
+ console.error("Error finding products:", error);
+ return res.status(500).json({
+ found: false,
+ error: "Database error occurred",
+ });
+ }
+};
+
+exports.getProductById = async (req, res) => {
+ const { id } = req.params;
+ console.log("Received Product ID:", id);
+
+ try {
+ const [data] = await db.execute(
+ `
+ SELECT p.*,U.Name AS SellerName,U.Email as SellerEmail,U.Phone as SellerPhone, i.URL AS image_url
+ FROM Product p
+ LEFT JOIN Image_URL i ON p.ProductID = i.ProductID
+ JOIN User U ON p.UserID = U.UserID
+ WHERE p.ProductID = ?
+ `,
+ [id]
+ );
+
+ // Log raw data for debugging
+ console.log("Raw Database Result:", data);
+
+ if (data.length === 0) {
+ console.log("No product found with ID:", id);
+ return res.status(404).json({
+ success: false,
+ message: "Product not found",
+ });
+ }
+
+ // Collect all image URLs
+ const images = data
+ .map((row) => row.image_url)
+ .filter((url) => url !== null);
+
+ // Create product object with all details from first row and collected images
+ const product = {
+ ...data[0], // Base product details
+ images: images, // Collected image URLs
+ };
+
+ // Log processed product for debugging
+ console.log("Processed Product:", product);
+
+ res.json({
+ success: true,
+ message: "Product fetched successfully",
+ data: product,
+ });
+ } catch (error) {
+ console.error("Full Error Details:", error);
+ return res.status(500).json({
+ success: false,
+ message: "Database error occurred",
+ error: error.message,
+ });
+ }
+};
+
+exports.getProductWithPagination = async (req, res) => {
+ const limit = +req.query.limit;
+ const page = +req.query.page;
+
+ const offset = (page - 1) * limit;
+
+ try {
+ const [data, fields] = await db.execute(
+ `
+ SELECT
+ P.ProductID,
+ P.Name AS ProductName,
+ P.Price,
+ P.Date AS DateUploaded,
+ U.Name AS SellerName,
+ MIN(I.URL) AS ProductImage,
+ C.Name AS Category
+ FROM Product P
+ LEFT JOIN Image_URL I ON P.ProductID = I.ProductID
+ LEFT JOIN User U ON P.UserID = U.UserID
+ LEFT JOIN Category C ON P.CategoryID = C.CategoryID
+ GROUP BY
+ P.ProductID,
+ P.Name,
+ P.Price,
+ P.Date,
+ U.Name,
+ C.Name
+ ORDER BY P.ProductID ASC
+ LIMIT ? OFFSET ?
+ `,
+ [limit.toString(), offset.toString()]
+ );
+
+ const [result] = await db.execute(
+ `SELECT COUNT(*) AS totalProd FROM Product`
+ );
+ const { totalProd } = result[0];
+
+ return res.json({ totalProd, products: data });
+ } catch (error) {
+ res.json({ error: "Error fetching products!" });
+ }
+};
+
+exports.removeProduct = async (req, res) => {
+ const { id } = req.params;
+
+ try {
+ const [result] = await db.execute(
+ `DELETE FROM Product WHERE ProductID = ?`,
+ [id]
+ );
+ res.json({ message: "Delete product successfully!" });
+ } catch (error) {
+ res.json({ error: "Cannot remove product from database!" });
+ }
+};
+
+// db_con.query(
+// "SELECT ProductID FROM product WHERE ProductID = ?",
+// [productID],
+// (err, results) => {
+// if (err) {
+// console.error("Error checking product:", err);
+// return res.json({ error: "Database error" });
+// }
+
+// if (results.length === 0) {
+// return res.json({ error: "Product does not exist" });
+// }
+// },
+// );
+
+// db_con.query(
+// "INSERT INTO Favorites (UserID, ProductID) VALUES (?, ?)",
+// [userID, productID],
+// (err, result) => {
+// if (err) {
+// console.error("Error adding favorite product:", err);
+// return res.json({ error: "Could not add favorite product" });
+// }
+// res.json({
+// success: true,
+// message: "Product added to favorites successfully",
+// });
+// },
+// );
diff --git a/controllers/recommendation.js b/controllers/recommendation.js
new file mode 100644
index 0000000..63c9516
--- /dev/null
+++ b/controllers/recommendation.js
@@ -0,0 +1,53 @@
+const db = require("../utils/database");
+
+// TODO: Get the recommondaed product given the userID
+exports.RecommondationByUserId = async (req, res) => {
+ const { id } = req.body;
+ try {
+ const [data, fields] = await db.execute(
+ `
+ WITH RankedImages AS (
+ SELECT
+ P.ProductID,
+ P.Name AS ProductName,
+ P.Price,
+ P.Date AS DateUploaded,
+ U.Name AS SellerName,
+ I.URL AS ProductImage,
+ C.Name AS Category,
+ ROW_NUMBER() OVER (PARTITION BY P.ProductID ORDER BY I.URL) AS RowNum
+ FROM Product P
+ JOIN Image_URL I ON P.ProductID = I.ProductID
+ JOIN User U ON P.UserID = U.UserID
+ JOIN Category C ON P.CategoryID = C.CategoryID
+ JOIN Recommendation R ON P.ProductID = R.RecommendedProductID
+ WHERE R.UserID = ?
+ )
+ SELECT
+ ProductID,
+ ProductName,
+ Price,
+ DateUploaded,
+ SellerName,
+ ProductImage,
+ Category
+ FROM RankedImages
+ WHERE RowNum = 1;
+ `,
+ [id],
+ );
+
+ console.log(data);
+ res.json({
+ success: true,
+ message: "Products fetched successfully",
+ data,
+ });
+ } catch (error) {
+ console.error("Error finding products:", error);
+ return res.status(500).json({
+ found: false,
+ error: "Database error occurred",
+ });
+ }
+};
diff --git a/controllers/review.js b/controllers/review.js
new file mode 100644
index 0000000..e792409
--- /dev/null
+++ b/controllers/review.js
@@ -0,0 +1,302 @@
+const db = require("../utils/database");
+
+/**
+ * Get reviews for a specific product
+ * Returns both reviews for the product and reviews by the product owner for other products
+ */
+exports.getReviews = async (req, res) => {
+ const { id } = req.params;
+ console.log("Received Product ID:", id);
+
+ try {
+ // First query: Get reviews for this specific product
+ const [productReviews] = await db.execute(
+ `SELECT
+ R.ReviewID,
+ R.UserID,
+ R.ProductID,
+ R.Comment,
+ R.Rating,
+ R.Date AS ReviewDate,
+ U.Name AS ReviewerName,
+ P.Name AS ProductName,
+ 'product' AS ReviewType
+ FROM Review R
+ JOIN User U ON R.UserID = U.UserID
+ JOIN Product P ON R.ProductID = P.ProductID
+ WHERE R.ProductID = ?`,
+ [id],
+ );
+
+ // // Second query: Get reviews written by the product owner for other products
+ // const [sellerReviews] = await db.execute(
+ // `SELECT
+ // R.ReviewID,
+ // R.UserID,
+ // R.ProductID,
+ // R.Comment,
+ // R.Rating,
+ // R.Date AS ReviewDate,
+ // U.Name AS ReviewerName,
+ // P.Name AS ProductName,
+ // 'seller' AS ReviewType
+ // FROM Review R
+ // JOIN User U ON R.UserID = U.UserID
+ // JOIN Product P ON R.ProductID = P.ProductID
+ // WHERE R.UserID = (
+ // SELECT UserID
+ // FROM Product
+ // WHERE ProductID = ?
+ // )
+ // AND R.ProductID != ?`,
+ // [id, id],
+ // );
+
+ // Combine the results
+ const combinedReviews = [...productReviews];
+
+ // Log data for debugging
+ console.log("Combined Reviews:", combinedReviews);
+
+ res.json({
+ success: true,
+ message: "Reviews fetched successfully",
+ data: combinedReviews,
+ });
+ } catch (error) {
+ console.error("Full Error Details:", error);
+ return res.status(500).json({
+ success: false,
+ message: "Database error occurred",
+ error: error.message,
+ });
+ }
+};
+
+/**
+ * Submit a new review for a product
+ */
+exports.submitReview = async (req, res) => {
+ const { productId, userId, rating, comment } = req.body;
+
+ // Validate required fields
+ if (!productId || !userId || !rating || !comment) {
+ return res.status(400).json({
+ success: false,
+ message: "Missing required fields",
+ });
+ }
+
+ // Validate rating is between 1 and 5
+ if (rating < 1 || rating > 5) {
+ return res.status(400).json({
+ success: false,
+ message: "Rating must be between 1 and 5",
+ });
+ }
+
+ try {
+ // Check if user has already reviewed this product
+ const [existingReview] = await db.execute(
+ `SELECT ReviewID FROM Review WHERE ProductID = ? AND UserID = ?`,
+ [productId, userId],
+ );
+
+ if (existingReview.length > 0) {
+ return res.status(400).json({
+ success: false,
+ message: "You have already reviewed this product",
+ });
+ }
+
+ // Check if user is trying to review their own product
+ const [productOwner] = await db.execute(
+ `SELECT UserID FROM Product WHERE ProductID = ?`,
+ [productId],
+ );
+
+ if (productOwner.length > 0 && productOwner[0].UserID === userId) {
+ return res.status(400).json({
+ success: false,
+ message: "You cannot review your own product",
+ });
+ }
+
+ // Insert the review into the database
+ const [result] = await db.execute(
+ `INSERT INTO Review (
+ ProductID,
+ UserID,
+ Rating,
+ Comment,
+ Date
+ ) VALUES (?, ?, ?, ?, NOW())`,
+ [productId, userId, rating, comment],
+ );
+
+ // Get the inserted review id
+ const reviewId = result.insertId;
+
+ // Fetch the newly created review to return to client
+ const [newReview] = await db.execute(
+ `SELECT
+ R.ReviewID,
+ R.ProductID,
+ R.UserID,
+ R.Rating,
+ R.Comment,
+ R.Date AS ReviewDate,
+ U.Name AS ReviewerName,
+ P.Name AS ProductName
+ FROM Review R
+ JOIN User U ON R.UserID = U.UserID
+ JOIN Product P ON R.ProductID = P.ProductID
+ WHERE R.ReviewID = ?`,
+ [reviewId],
+ );
+
+ res.status(201).json({
+ success: true, // Fixed from false to true
+ message: "Review submitted successfully",
+ data: newReview[0],
+ });
+ } catch (error) {
+ console.error("Error submitting review:", error);
+ return res.status(500).json({
+ success: false,
+ message: "Database error occurred",
+ error: error.message,
+ });
+ }
+};
+
+// /**
+// * Update an existing review
+// */
+// exports.updateReview = async (req, res) => {
+// const { reviewId } = req.params;
+// const { rating, comment } = req.body;
+// const userId = req.body.userId; // Assuming you have middleware that validates the user
+
+// // Validate required fields
+// if (!reviewId || !rating || !comment) {
+// return res.status(400).json({
+// success: false,
+// message: "Missing required fields",
+// });
+// }
+
+// // Validate rating is between 1 and 5
+// if (rating < 1 || rating > 5) {
+// return res.status(400).json({
+// success: false,
+// message: "Rating must be between 1 and 5",
+// });
+// }
+
+// try {
+// // Check if review exists and belongs to the user
+// const [existingReview] = await db.execute(
+// `SELECT ReviewID, UserID FROM Review WHERE ReviewID = ?`,
+// [reviewId],
+// );
+
+// if (existingReview.length === 0) {
+// return res.status(404).json({
+// success: false,
+// message: "Review not found",
+// });
+// }
+
+// if (existingReview[0].UserID !== userId) {
+// return res.status(403).json({
+// success: false,
+// message: "You can only update your own reviews",
+// });
+// }
+
+// // Update the review
+// await db.execute(
+// `UPDATE Review
+// SET Rating = ?, Comment = ?, Date = NOW()
+// WHERE ReviewID = ?`,
+// [rating, comment, reviewId],
+// );
+
+// // Fetch the updated review
+// const [updatedReview] = await db.execute(
+// `SELECT
+// R.ReviewID,
+// R.ProductID,
+// R.UserID,
+// R.Rating,
+// R.Comment,
+// R.Date AS ReviewDate,
+// U.Name AS ReviewerName,
+// P.Name AS ProductName
+// FROM Review R
+// JOIN User U ON R.UserID = U.UserID
+// JOIN Product P ON R.ProductID = P.ProductID
+// WHERE R.ReviewID = ?`,
+// [reviewId],
+// );
+
+// res.json({
+// success: true,
+// message: "Review updated successfully",
+// data: updatedReview[0],
+// });
+// } catch (error) {
+// console.error("Error updating review:", error);
+// return res.status(500).json({
+// success: false,
+// message: "Database error occurred",
+// error: error.message,
+// });
+// }
+// };
+
+// /**
+// * Delete a review
+// */
+// exports.deleteReview = async (req, res) => {
+// const { reviewId } = req.params;
+// const userId = req.body.userId; // Assuming you have middleware that validates the user
+
+// try {
+// // Check if review exists and belongs to the user
+// const [existingReview] = await db.execute(
+// `SELECT ReviewID, UserID FROM Review WHERE ReviewID = ?`,
+// [reviewId],
+// );
+
+// if (existingReview.length === 0) {
+// return res.status(404).json({
+// success: false,
+// message: "Review not found",
+// });
+// }
+
+// if (existingReview[0].UserID !== userId) {
+// return res.status(403).json({
+// success: false,
+// message: "You can only delete your own reviews",
+// });
+// }
+
+// // Delete the review
+// await db.execute(`DELETE FROM Review WHERE ReviewID = ?`, [reviewId]);
+
+// res.json({
+// success: true,
+// message: "Review deleted successfully",
+// });
+// } catch (error) {
+// console.error("Error deleting review:", error);
+// return res.status(500).json({
+// success: false,
+// message: "Database error occurred",
+// error: error.message,
+// });
+// }
+// };
diff --git a/controllers/search.js b/controllers/search.js
new file mode 100644
index 0000000..ba6700c
--- /dev/null
+++ b/controllers/search.js
@@ -0,0 +1,164 @@
+const db = require("../utils/database");
+
+exports.searchProductsByName = async (req, res) => {
+ const { name } = req.query;
+
+ if (name.length === 0) {
+ console.log("Searching for products with no name", name);
+ }
+
+ console.log("Searching for products with name:", name);
+
+ try {
+ // Modify SQL to return all products when no search term is provided
+ const sql = `
+ SELECT p.*, i.URL as image
+ FROM Product p
+ LEFT JOIN Image_URL i ON p.ProductID = i.ProductID
+ ${name ? "WHERE p.Name LIKE ?" : ""}
+ ORDER BY p.ProductID
+ `;
+
+ const params = name ? [`%${name}%`] : [];
+ console.log("Executing SQL:", sql);
+ console.log("With parameters:", params);
+
+ const [data] = await db.execute(sql, params);
+
+ console.log("Raw Database Result:", data);
+
+ if (data.length === 0) {
+ console.log("No products found matching:", name);
+ return res.status(404).json({
+ success: false,
+ message: "No products found matching your search",
+ });
+ }
+
+ // Group products by ProductID to handle multiple images per product
+ const productsMap = new Map();
+
+ data.forEach((row) => {
+ if (!productsMap.has(row.ProductID)) {
+ const product = {
+ ProductID: row.ProductID,
+ Name: row.Name,
+ Description: row.Description,
+ Price: row.Price,
+ images: row.image,
+ };
+ productsMap.set(row.ProductID, product);
+ } else if (row.image_url) {
+ productsMap.get(row.ProductID).images.push(row.image_url);
+ }
+ });
+
+ const products = Array.from(productsMap.values());
+
+ console.log("Processed Products:", products);
+
+ res.json({
+ success: true,
+ message: "Products fetched successfully",
+ data: products,
+ count: products.length,
+ });
+ } catch (error) {
+ console.error("Database Error:", error);
+ return res.status(500).json({
+ success: false,
+ message: "Database error occurred",
+ error: error.message || "Unknown database error",
+ });
+ }
+};
+
+// exports.searchProductsByName = async (req, res) => {
+// const { name } = req.query;
+
+// // Add better validation and error handling
+// if (!name || typeof name !== "string") {
+// return res.status(400).json({
+// success: false,
+// message: "Valid search term is required",
+// });
+// }
+
+// console.log("Searching for products with name:", name);
+
+// try {
+// // Log the SQL query and parameters for debugging
+// const sql = `
+// SELECT p.*, i.URL AS image_url
+// FROM Product p
+// LEFT JOIN Image_URL i ON p.ProductID = i.ProductID
+// WHERE p.Name LIKE ?
+// `;
+// const params = [`%${name}%`];
+// console.log("Executing SQL:", sql);
+// console.log("With parameters:", params);
+
+// const [data] = await db.execute(sql, params);
+
+// // Log raw data for debugging
+// console.log("Raw Database Result:", data);
+
+// if (data.length === 0) {
+// console.log("No products found matching:", name);
+// return res.status(404).json({
+// success: false,
+// message: "No products found matching your search",
+// });
+// }
+
+// // Group products by ProductID to handle multiple images per product
+// const productsMap = new Map();
+
+// data.forEach((row) => {
+// if (!productsMap.has(row.ProductID)) {
+// // Create a clean object without circular references
+// const product = {
+// ProductID: row.ProductID,
+// Name: row.Name,
+// Description: row.Description,
+// Price: row.Price,
+// // Add any other product fields you need
+// images: row.image_url ? [row.image_url] : [],
+// };
+// productsMap.set(row.ProductID, product);
+// } else if (row.image_url) {
+// // Add additional image to existing product
+// productsMap.get(row.ProductID).images.push(row.image_url);
+// }
+// });
+
+// // Convert map to array of products
+// const products = Array.from(productsMap.values());
+
+// // Log processed products for debugging
+// console.log("Processed Products:", products);
+
+// res.json({
+// success: true,
+// message: "Products fetched successfully",
+// data: products,
+// count: products.length,
+// });
+// } catch (error) {
+// // Enhanced error logging
+// console.error("Database Error Details:", {
+// message: error.message,
+// code: error.code,
+// errno: error.errno,
+// sqlState: error.sqlState,
+// sqlMessage: error.sqlMessage,
+// sql: error.sql,
+// });
+
+// return res.status(500).json({
+// success: false,
+// message: "Database error occurred",
+// error: error.message || "Unknown database error",
+// });
+// }
+// };
diff --git a/controllers/user.js b/controllers/user.js
new file mode 100644
index 0000000..37c5b06
--- /dev/null
+++ b/controllers/user.js
@@ -0,0 +1,365 @@
+const crypto = require("crypto");
+const db = require("../utils/database");
+const { sendVerificationEmail } = require("../utils/helper");
+
+exports.sendVerificationCode = async (req, res) => {
+ const { email } = req.body;
+
+ if (!email) {
+ return res.status(400).json({ error: "Email is required" });
+ }
+
+ try {
+ // Generate a random 6-digit code
+ const verificationCode = crypto.randomInt(100000, 999999).toString();
+ console.log(
+ `Generated verification code for ${email}: ${verificationCode}`
+ );
+
+ // Check if email already exists in verification table
+ const [results, fields] = await db.execute(
+ "SELECT * FROM AuthVerification WHERE Email = ?",
+ [email]
+ );
+
+ if (results.length > 0) {
+ // Update existing record
+ const [result] = await db.execute(
+ `UPDATE AuthVerification SET VerificationCode = ?, Authenticated = FALSE, Date = CURRENT_TIMESTAMP
+ WHERE Email = ?`,
+ [verificationCode, email]
+ );
+
+ // Send email and respond
+ await sendVerificationEmail(email, verificationCode);
+ res.json({ success: true, message: "Verification code sent" });
+ } else {
+ // Insert new record
+ const [result] = await db.execute(
+ "INSERT INTO AuthVerification (Email, VerificationCode, Authenticated) VALUES (?, ?, FALSE)",
+ [email, verificationCode]
+ );
+ // Send email and respond
+ await sendVerificationEmail(email, verificationCode);
+ res.json({ success: true, message: "Verification code sent" });
+ }
+ } catch (error) {
+ console.error("Error:", error);
+ res.status(500).json({ error: "Server error" });
+ }
+};
+
+exports.verifyCode = async (req, res) => {
+ const { email, code } = req.body;
+
+ if (!email || !code) {
+ return res.status(400).json({ error: "Email and code are required" });
+ }
+
+ console.log(`Attempting to verify code for ${email}: ${code}`);
+
+ try {
+ // Check verification code
+ const [results, fields] = await db.execute(
+ "SELECT * FROM AuthVerification WHERE Email = ? AND VerificationCode = ? AND Authenticated = 0 AND Date > DATE_SUB(NOW(), INTERVAL 15 MINUTE)",
+ [email, code]
+ );
+ if (results.length === 0) {
+ console.log(`Invalid or expired verification code for email ${email}`);
+ return res
+ .status(400)
+ .json({ error: "Invalid or expired verification code" });
+ }
+
+ const userId = results[0].UserID;
+
+ // Mark as authenticated
+ const [result] = await db.execute(
+ "UPDATE AuthVerification SET Authenticated = TRUE WHERE Email = ?",
+ [email]
+ );
+ res.json({
+ success: true,
+ message: "Verification successful",
+ userId,
+ });
+ } catch (error) {
+ console.log("Error: ", error);
+ res.status(500).json({ error: "Database error!" });
+ }
+};
+
+exports.completeSignUp = async (req, res) => {
+ const data = req.body;
+
+ try {
+ const [results, fields] = await db.execute(
+ `SELECT * FROM AuthVerification WHERE Email = ? AND Authenticated = 1;`,
+ [data.email]
+ );
+
+ if (results.length === 0) {
+ return res.status(400).json({ error: "Email not verified" });
+ }
+
+ // Create the user
+ const [createResult] = await db.execute(
+ `INSERT INTO User (Name, Email, UCID, Password, Phone, Address)
+ VALUES ('${data.name}', '${data.email}', '${data.UCID}', '${data.password}', '${data.phone}', '${data.address}')`
+ );
+
+ // Insert role using the user's ID
+ const [insertResult] = await db.execute(
+ `INSERT INTO UserRole (UserID, Client, Admin)
+ VALUES (LAST_INSERT_ID(), ${data.client || true}, ${
+ data.admin || false
+ })`
+ );
+
+ // Delete verification record
+ const [deleteResult] = await db.execute(
+ `DELETE FROM AuthVerification WHERE Email = '${data.email}'`
+ );
+
+ res.json({
+ success: true,
+ message: "User registration completed successfully",
+ name: data.name,
+ email: data.email,
+ UCID: data.UCID,
+ });
+ } catch (error) {
+ console.log("Error: ", error);
+ res.status(500).json({ error: "Database error!" });
+ }
+};
+
+exports.doLogin = async (req, res) => {
+ const { email, password } = req.body;
+
+ // Input validation
+ if (!email || !password) {
+ return res.status(400).json({
+ found: false,
+ error: "Email and password are required",
+ });
+ }
+
+ try {
+ // Query to find user with matching email
+ const query = "SELECT * FROM User WHERE email = ?";
+ const [data, fields] = await db.execute(query, [email]);
+
+ // Check if user was found
+ if (data && data.length > 0) {
+ const user = data[0];
+
+ // Verify password match
+ if (user.Password === password) {
+ // Consider using bcrypt for secure password comparison
+ // Return user data without password
+ return res.json({
+ found: true,
+ userID: user.UserID,
+ name: user.Name,
+ email: user.Email,
+ UCID: user.UCID,
+ phone: user.Phone,
+ address: user.Address,
+ });
+ } else {
+ // Password doesn't match
+ return res.json({
+ found: false,
+ error: "Invalid email or password",
+ });
+ }
+ } else {
+ // User not found
+ return res.json({
+ found: false,
+ error: "Invalid email or password",
+ });
+ }
+ } catch (error) {
+ console.error("Error logging in:", error);
+ return res.status(500).json({
+ found: false,
+ error: "Database error occurred",
+ });
+ }
+};
+
+exports.getAllUser = async (req, res) => {
+ try {
+ const [users, fields] = await db.execute("SELECT * FROM User;");
+ res.json({ Users: users });
+ } catch (error) {
+ console.error("Errors: ", error);
+ return res.status(500).json({ error: "\nCould not fetch users!" });
+ }
+};
+
+exports.findUserByEmail = async (req, res) => {
+ const { email } = req.body;
+
+ // Input validation
+ if (!email) {
+ return res.status(400).json({
+ found: false,
+ error: "Email is required",
+ });
+ }
+
+ try {
+ // Query to find user with matching email and password
+ const query = "SELECT * FROM User WHERE email = ?";
+ const [data, fields] = await db.execute(query, [email]);
+
+ // Check if user was found
+ if (data && data.length > 0) {
+ console.log(data);
+ const user = data[0];
+
+ // Return all user data except password
+ return res.json({
+ found: true,
+ userID: user.UserID,
+ name: user.Name,
+ email: user.Email,
+ UCID: user.UCID,
+ phone: user.Phone,
+ address: user.Address,
+ password: user.Password,
+ // Include any other fields your user might have
+ // Make sure the field names match exactly with your database column names
+ });
+ } else {
+ // User not found or invalid credentials
+ return res.json({
+ found: false,
+ error: "Invalid email or password",
+ });
+ }
+ } catch (error) {
+ console.error("Error finding user:", error);
+ return res.status(500).json({
+ found: false,
+ error: "Database error occurred",
+ });
+ }
+};
+
+exports.updateUser = async (req, res) => {
+ try {
+ const userId = req.body?.userId;
+ const name = req.body?.name;
+ const email = req.body?.email;
+ const phone = req.body?.phone;
+ const UCID = req.body?.UCID;
+ const address = req.body?.address;
+ const password = req.body?.password;
+ if (!userId) {
+ return res.status(400).json({ error: "User ID is required" });
+ }
+
+ // Build updateData manually
+ const updateData = {};
+ if (name) updateData.name = name;
+ if (email) updateData.email = email;
+ if (phone) updateData.phone = phone;
+ if (UCID) updateData.UCID = UCID;
+ if (address) updateData.address = address;
+ if (password) updateData.password = password;
+ if (Object.keys(updateData).length === 0) {
+ return res.status(400).json({ error: "No valid fields to update" });
+ }
+
+ const updateFields = [];
+ const values = [];
+
+ Object.entries(updateData).forEach(([key, value]) => {
+ updateFields.push(`${key} = ?`);
+ values.push(value);
+ });
+
+ values.push(userId);
+
+ const query = `UPDATE User SET ${updateFields.join(", ")} WHERE userId = ?`;
+ const [updateResult] = await db.execute(query, values);
+
+ if (updateResult.affectedRows === 0) {
+ return res.status(404).json({ error: "User not found" });
+ }
+
+ res.json({ success: true, message: "User updated successfully" });
+ } catch (error) {
+ console.error("Error updating user:", error);
+ return res.status(500).json({ error: "Could not update user" });
+ }
+};
+
+exports.deleteUser = async (req, res) => {
+ const { userId } = req.body;
+
+ if (!userId) {
+ return res.status(400).json({ error: "User ID is required" });
+ }
+
+ try {
+ // Delete from UserRole first (assuming foreign key constraint)
+ const [result1] = await db.execute(
+ "DELETE FROM UserRole WHERE UserID = ?",
+ [userId]
+ );
+
+ // Then delete from User table
+ const [result2] = await db.execute("DELETE FROM User WHERE UserID = ?", [
+ userId,
+ ]);
+
+ if (result2.affectedRows === 0) {
+ return res.status(404).json({ error: "User not found" });
+ }
+
+ res.json({ success: true, message: "User deleted successfully" });
+ } catch (error) {
+ console.error("Error: ", error);
+ return res.status(500).json({ error: "Could not delete user!" });
+ }
+};
+
+exports.getUsersWithPagination = async (req, res) => {
+ const limit = +req.query.limit;
+ const page = +req.query.page;
+
+ const offset = (page - 1) * limit;
+ try {
+ const [users, fields] = await db.execute(
+ "SELECT * FROM User LIMIT ? OFFSET ?",
+ [limit.toString(), offset.toString()]
+ );
+
+ const [result] = await db.execute("SELECT COUNT(*) AS count FROM User");
+ const { count: total } = result[0];
+
+ res.json({ users, total });
+ } catch (error) {
+ console.error("Errors: ", error);
+ return res.status(500).json({ error: "\nCould not fetch users!" });
+ }
+};
+
+exports.isAdmin = async (req, res) => {
+ const { id } = req.params;
+ try {
+ const [result] = await db.execute(
+ "SELECT R.Admin FROM marketplace.userrole R WHERE R.UserID = ?",
+ [id]
+ );
+ const { Admin } = result[0];
+ res.json({ isAdmin: Admin });
+ } catch (error) {
+ res.json({ error: "Cannot verify admin status!" });
+ }
+};
diff --git a/index.js b/index.js
new file mode 100644
index 0000000..5ba3b27
--- /dev/null
+++ b/index.js
@@ -0,0 +1,56 @@
+const express = require("express");
+const cors = require("cors");
+
+const db = require("./utils/database");
+
+const userRouter = require("./routes/user");
+const productRouter = require("./routes/product");
+const searchRouter = require("./routes/search");
+const recommendedRouter = require("./routes/recommendation");
+const history = require("./routes/history");
+const review = require("./routes/review");
+const categoryRouter = require("./routes/category");
+
+const { generateEmailTransporter } = require("./utils/mail");
+const {
+ cleanupExpiredCodes,
+ checkDatabaseConnection,
+} = require("./utils/helper");
+
+const app = express();
+
+app.use(cors());
+app.use(express.json());
+
+// Configure email transporter for Zoho
+const transporter = generateEmailTransporter();
+// Test the email connection
+transporter
+ .verify()
+ .then(() => {
+ console.log("Email connection successful!");
+ })
+ .catch((error) => {
+ console.error("Email connection failed:", error);
+ });
+
+checkDatabaseConnection(db);
+
+//Routes
+app.use("/api/user", userRouter);
+app.use("/api/product", productRouter);
+app.use("/api/search", searchRouter);
+app.use("/api/engine", recommendedRouter);
+app.use("/api/history", history);
+app.use("/api/review", review);
+app.use("/api/category", categoryRouter);
+
+// Set up a scheduler to run cleanup every hour
+clean_up_time = 30 * 60 * 1000;
+setInterval(cleanupExpiredCodes, clean_up_time);
+
+app.listen(3030, () => {
+ console.log(`Running Backend on http://localhost:3030/`);
+ console.log(`Send verification code: POST /send-verification`);
+ console.log(`Verify code: POST /verify-code`);
+});
diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime
new file mode 100644
index 0000000..7751de3
--- /dev/null
+++ b/node_modules/.bin/mime
@@ -0,0 +1,16 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*)
+ if command -v cygpath > /dev/null 2>&1; then
+ basedir=`cygpath -w "$basedir"`
+ fi
+ ;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../mime/cli.js" "$@"
+else
+ exec node "$basedir/../mime/cli.js" "$@"
+fi
diff --git a/node_modules/.bin/mime.cmd b/node_modules/.bin/mime.cmd
new file mode 100644
index 0000000..54491f1
--- /dev/null
+++ b/node_modules/.bin/mime.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\mime\cli.js" %*
diff --git a/node_modules/.bin/mime.ps1 b/node_modules/.bin/mime.ps1
new file mode 100644
index 0000000..2222f40
--- /dev/null
+++ b/node_modules/.bin/mime.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../mime/cli.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../mime/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../mime/cli.js" $args
+ } else {
+ & "node$exe" "$basedir/../mime/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/node_modules/.bin/nodemon b/node_modules/.bin/nodemon
new file mode 100644
index 0000000..c477a18
--- /dev/null
+++ b/node_modules/.bin/nodemon
@@ -0,0 +1,16 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*)
+ if command -v cygpath > /dev/null 2>&1; then
+ basedir=`cygpath -w "$basedir"`
+ fi
+ ;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../nodemon/bin/nodemon.js" "$@"
+else
+ exec node "$basedir/../nodemon/bin/nodemon.js" "$@"
+fi
diff --git a/node_modules/.bin/nodemon.cmd b/node_modules/.bin/nodemon.cmd
new file mode 100644
index 0000000..55acf8a
--- /dev/null
+++ b/node_modules/.bin/nodemon.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\nodemon\bin\nodemon.js" %*
diff --git a/node_modules/.bin/nodemon.ps1 b/node_modules/.bin/nodemon.ps1
new file mode 100644
index 0000000..d4e3f5d
--- /dev/null
+++ b/node_modules/.bin/nodemon.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../nodemon/bin/nodemon.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../nodemon/bin/nodemon.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../nodemon/bin/nodemon.js" $args
+ } else {
+ & "node$exe" "$basedir/../nodemon/bin/nodemon.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/node_modules/.bin/nodetouch b/node_modules/.bin/nodetouch
new file mode 100644
index 0000000..3e146b4
--- /dev/null
+++ b/node_modules/.bin/nodetouch
@@ -0,0 +1,16 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*)
+ if command -v cygpath > /dev/null 2>&1; then
+ basedir=`cygpath -w "$basedir"`
+ fi
+ ;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../touch/bin/nodetouch.js" "$@"
+else
+ exec node "$basedir/../touch/bin/nodetouch.js" "$@"
+fi
diff --git a/node_modules/.bin/nodetouch.cmd b/node_modules/.bin/nodetouch.cmd
new file mode 100644
index 0000000..8298b91
--- /dev/null
+++ b/node_modules/.bin/nodetouch.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\touch\bin\nodetouch.js" %*
diff --git a/node_modules/.bin/nodetouch.ps1 b/node_modules/.bin/nodetouch.ps1
new file mode 100644
index 0000000..5f68b4c
--- /dev/null
+++ b/node_modules/.bin/nodetouch.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../touch/bin/nodetouch.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../touch/bin/nodetouch.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../touch/bin/nodetouch.js" $args
+ } else {
+ & "node$exe" "$basedir/../touch/bin/nodetouch.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/node_modules/.bin/semver b/node_modules/.bin/semver
new file mode 100644
index 0000000..97c5327
--- /dev/null
+++ b/node_modules/.bin/semver
@@ -0,0 +1,16 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*)
+ if command -v cygpath > /dev/null 2>&1; then
+ basedir=`cygpath -w "$basedir"`
+ fi
+ ;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../semver/bin/semver.js" "$@"
+else
+ exec node "$basedir/../semver/bin/semver.js" "$@"
+fi
diff --git a/node_modules/.bin/semver.cmd b/node_modules/.bin/semver.cmd
new file mode 100644
index 0000000..9913fa9
--- /dev/null
+++ b/node_modules/.bin/semver.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\semver\bin\semver.js" %*
diff --git a/node_modules/.bin/semver.ps1 b/node_modules/.bin/semver.ps1
new file mode 100644
index 0000000..314717a
--- /dev/null
+++ b/node_modules/.bin/semver.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../semver/bin/semver.js" $args
+ } else {
+ & "node$exe" "$basedir/../semver/bin/semver.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json
new file mode 100644
index 0000000..eac4208
--- /dev/null
+++ b/node_modules/.package-lock.json
@@ -0,0 +1,1558 @@
+{
+ "name": "server",
+ "version": "1.0.0",
+ "lockfileVersion": 3,
+ "requires": true,
+ "packages": {
+ "node_modules/accepts": {
+ "version": "1.3.8",
+ "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz",
+ "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==",
+ "license": "MIT",
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/anymatch": {
+ "version": "3.1.3",
+ "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz",
+ "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==",
+ "dev": true,
+ "license": "ISC",
+ "dependencies": {
+ "normalize-path": "^3.0.0",
+ "picomatch": "^2.0.4"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+ },
+ "node_modules/array-flatten": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+ "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==",
+ "license": "MIT"
+ },
+ "node_modules/aws-ssl-profiles": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/aws-ssl-profiles/-/aws-ssl-profiles-1.1.2.tgz",
+ "integrity": "sha512-NZKeq9AfyQvEeNlN0zSYAaWrmBffJh3IELMZfRpJVWgrpEbtEpnjvzqBPf+mxoI287JohRDoa+/nsfqqiZmF6g==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 6.0.0"
+ }
+ },
+ "node_modules/balanced-match": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz",
+ "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==",
+ "dev": true,
+ "license": "MIT"
+ },
+ "node_modules/bignumber.js": {
+ "version": "9.0.0",
+ "resolved": "https://registry.npmjs.org/bignumber.js/-/bignumber.js-9.0.0.tgz",
+ "integrity": "sha512-t/OYhhJ2SD+YGBQcjY8GzzDHEk9f3nerxjtfa6tlMXfe7frs/WozhvCNoGvpM0P3bNf3Gq5ZRMlGr5f3r4/N8A==",
+ "license": "MIT",
+ "engines": {
+ "node": "*"
+ }
+ },
+ "node_modules/binary-extensions": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz",
+ "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==",
+ "dev": true,
+ "license": "MIT",
+ "engines": {
+ "node": ">=8"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/body-parser": {
+ "version": "1.20.3",
+ "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.3.tgz",
+ "integrity": "sha512-7rAxByjUMqQ3/bHJy7D6OGXvx/MMc4IqBn/X0fcM1QUcAItpZrBEYhWGem+tzXH90c+G01ypMcYJBO9Y30203g==",
+ "license": "MIT",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.5",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "on-finished": "2.4.1",
+ "qs": "6.13.0",
+ "raw-body": "2.5.2",
+ "type-is": "~1.6.18",
+ "unpipe": "1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ }
+ },
+ "node_modules/brace-expansion": {
+ "version": "1.1.11",
+ "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
+ "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "balanced-match": "^1.0.0",
+ "concat-map": "0.0.1"
+ }
+ },
+ "node_modules/braces": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz",
+ "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "fill-range": "^7.1.1"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/buffer-equal-constant-time": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/buffer-equal-constant-time/-/buffer-equal-constant-time-1.0.1.tgz",
+ "integrity": "sha512-zRpUiDwd/xk6ADqPMATG8vc9VPrkck7T07OIx0gnjmJAnHnTVXNQG3vfvWNuiZIkwu9KrKdA1iJKfsfTVxE6NA==",
+ "license": "BSD-3-Clause"
+ },
+ "node_modules/bytes": {
+ "version": "3.1.2",
+ "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz",
+ "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/call-bind-apply-helpers": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/call-bind-apply-helpers/-/call-bind-apply-helpers-1.0.1.tgz",
+ "integrity": "sha512-BhYE+WDaywFg2TBWYNXAE+8B1ATnThNBqXHP5nQu0jWJdVvY2hvkpyB3qOmtmDePiS5/BDQ8wASEWGMWRG148g==",
+ "license": "MIT",
+ "dependencies": {
+ "es-errors": "^1.3.0",
+ "function-bind": "^1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/call-bound": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/call-bound/-/call-bound-1.0.3.tgz",
+ "integrity": "sha512-YTd+6wGlNlPxSuri7Y6X8tY2dmm12UMH66RpKMhiX6rsk5wXXnYgbUcOt8kiS31/AjfoTOvCsE+w8nZQLQnzHA==",
+ "license": "MIT",
+ "dependencies": {
+ "call-bind-apply-helpers": "^1.0.1",
+ "get-intrinsic": "^1.2.6"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/chokidar": {
+ "version": "3.6.0",
+ "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz",
+ "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "anymatch": "~3.1.2",
+ "braces": "~3.0.2",
+ "glob-parent": "~5.1.2",
+ "is-binary-path": "~2.1.0",
+ "is-glob": "~4.0.1",
+ "normalize-path": "~3.0.0",
+ "readdirp": "~3.6.0"
+ },
+ "engines": {
+ "node": ">= 8.10.0"
+ },
+ "funding": {
+ "url": "https://paulmillr.com/funding/"
+ },
+ "optionalDependencies": {
+ "fsevents": "~2.3.2"
+ }
+ },
+ "node_modules/concat-map": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
+ "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==",
+ "dev": true,
+ "license": "MIT"
+ },
+ "node_modules/content-disposition": {
+ "version": "0.5.4",
+ "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz",
+ "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==",
+ "license": "MIT",
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/content-type": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz",
+ "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/cookie": {
+ "version": "0.7.1",
+ "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.1.tgz",
+ "integrity": "sha512-6DnInpx7SJ2AK3+CTUE/ZM0vWTUboZCegxhC2xiIydHR9jNuTAASBrfEpHhiGOZw/nX51bHt6YQl8jsGo4y/0w==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/cookie-signature": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+ "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ==",
+ "license": "MIT"
+ },
+ "node_modules/core-util-is": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.3.tgz",
+ "integrity": "sha512-ZQBvi1DcpJ4GDqanjucZ2Hj3wEO5pZDS89BWbkcrvdxksJorwUDDZamX9ldFkp9aw2lmBDLgkObEA4DWNJ9FYQ==",
+ "license": "MIT"
+ },
+ "node_modules/cors": {
+ "version": "2.8.5",
+ "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz",
+ "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==",
+ "license": "MIT",
+ "dependencies": {
+ "object-assign": "^4",
+ "vary": "^1"
+ },
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/crypto": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/crypto/-/crypto-1.0.1.tgz",
+ "integrity": "sha512-VxBKmeNcqQdiUQUW2Tzq0t377b54N2bMtXO/qiLa+6eRRmmC4qT3D4OnTGoT/U6O9aklQ/jTwbOtRMTTY8G0Ig==",
+ "deprecated": "This package is no longer supported. It's now a built-in Node module. If you've depended on crypto, you should switch to the one that's built-in.",
+ "license": "ISC"
+ },
+ "node_modules/debug": {
+ "version": "2.6.9",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+ "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+ "license": "MIT",
+ "dependencies": {
+ "ms": "2.0.0"
+ }
+ },
+ "node_modules/denque": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/denque/-/denque-2.1.0.tgz",
+ "integrity": "sha512-HVQE3AAb/pxF8fQAoiqpvg9i3evqug3hoiwakOyZAwJm+6vZehbkYXZ0l4JxS+I3QxM97v5aaRNhj8v5oBhekw==",
+ "license": "Apache-2.0",
+ "engines": {
+ "node": ">=0.10"
+ }
+ },
+ "node_modules/depd": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz",
+ "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/destroy": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz",
+ "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ }
+ },
+ "node_modules/dotenv": {
+ "version": "16.4.7",
+ "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.4.7.tgz",
+ "integrity": "sha512-47qPchRCykZC03FhkYAhrvwU4xDBFIj1QPqaarj6mdM/hgUzfPHcpkHJOn3mJAufFeeAxAzeGsr5X0M4k6fLZQ==",
+ "license": "BSD-2-Clause",
+ "engines": {
+ "node": ">=12"
+ },
+ "funding": {
+ "url": "https://dotenvx.com"
+ }
+ },
+ "node_modules/dunder-proto": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/dunder-proto/-/dunder-proto-1.0.1.tgz",
+ "integrity": "sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==",
+ "license": "MIT",
+ "dependencies": {
+ "call-bind-apply-helpers": "^1.0.1",
+ "es-errors": "^1.3.0",
+ "gopd": "^1.2.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/ecdsa-sig-formatter": {
+ "version": "1.0.11",
+ "resolved": "https://registry.npmjs.org/ecdsa-sig-formatter/-/ecdsa-sig-formatter-1.0.11.tgz",
+ "integrity": "sha512-nagl3RYrbNv6kQkeJIpt6NJZy8twLB/2vtz6yN9Z4vRKHN4/QZJIEbqohALSgwKdnksuY3k5Addp5lg8sVoVcQ==",
+ "license": "Apache-2.0",
+ "dependencies": {
+ "safe-buffer": "^5.0.1"
+ }
+ },
+ "node_modules/ee-first": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+ "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==",
+ "license": "MIT"
+ },
+ "node_modules/encodeurl": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz",
+ "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/es-define-property": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.1.tgz",
+ "integrity": "sha512-e3nRfgfUZ4rNGL232gUgX06QNyyez04KdjFrF+LTRoOXmrOgFKDg4BCdsjW8EnT69eqdYGmRpJwiPVYNrCaW3g==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/es-errors": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz",
+ "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/es-object-atoms": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.1.1.tgz",
+ "integrity": "sha512-FGgH2h8zKNim9ljj7dankFPcICIK9Cp5bm+c2gQSYePhpaG5+esrLODihIorn+Pe6FGJzWhXQotPv73jTaldXA==",
+ "license": "MIT",
+ "dependencies": {
+ "es-errors": "^1.3.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/escape-html": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+ "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==",
+ "license": "MIT"
+ },
+ "node_modules/etag": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+ "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/express": {
+ "version": "4.21.2",
+ "resolved": "https://registry.npmjs.org/express/-/express-4.21.2.tgz",
+ "integrity": "sha512-28HqgMZAmih1Czt9ny7qr6ek2qddF4FclbMzwhCREB6OFfH+rXAnuNCwo1/wFvrtbgsQDb4kSbX9de9lFbrXnA==",
+ "license": "MIT",
+ "dependencies": {
+ "accepts": "~1.3.8",
+ "array-flatten": "1.1.1",
+ "body-parser": "1.20.3",
+ "content-disposition": "0.5.4",
+ "content-type": "~1.0.4",
+ "cookie": "0.7.1",
+ "cookie-signature": "1.0.6",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "encodeurl": "~2.0.0",
+ "escape-html": "~1.0.3",
+ "etag": "~1.8.1",
+ "finalhandler": "1.3.1",
+ "fresh": "0.5.2",
+ "http-errors": "2.0.0",
+ "merge-descriptors": "1.0.3",
+ "methods": "~1.1.2",
+ "on-finished": "2.4.1",
+ "parseurl": "~1.3.3",
+ "path-to-regexp": "0.1.12",
+ "proxy-addr": "~2.0.7",
+ "qs": "6.13.0",
+ "range-parser": "~1.2.1",
+ "safe-buffer": "5.2.1",
+ "send": "0.19.0",
+ "serve-static": "1.16.2",
+ "setprototypeof": "1.2.0",
+ "statuses": "2.0.1",
+ "type-is": "~1.6.18",
+ "utils-merge": "1.0.1",
+ "vary": "~1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.10.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/express"
+ }
+ },
+ "node_modules/fill-range": {
+ "version": "7.1.1",
+ "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz",
+ "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "to-regex-range": "^5.0.1"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/finalhandler": {
+ "version": "1.3.1",
+ "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.3.1.tgz",
+ "integrity": "sha512-6BN9trH7bp3qvnrRyzsBz+g3lZxTNZTbVO2EV1CS0WIcDbawYVdYvGflME/9QP0h0pYlCDBCTjYa9nZzMDpyxQ==",
+ "license": "MIT",
+ "dependencies": {
+ "debug": "2.6.9",
+ "encodeurl": "~2.0.0",
+ "escape-html": "~1.0.3",
+ "on-finished": "2.4.1",
+ "parseurl": "~1.3.3",
+ "statuses": "2.0.1",
+ "unpipe": "~1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/forwarded": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz",
+ "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/fresh": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz",
+ "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/function-bind": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz",
+ "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==",
+ "license": "MIT",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/generate-function": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/generate-function/-/generate-function-2.3.1.tgz",
+ "integrity": "sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==",
+ "license": "MIT",
+ "dependencies": {
+ "is-property": "^1.0.2"
+ }
+ },
+ "node_modules/get-intrinsic": {
+ "version": "1.2.7",
+ "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.7.tgz",
+ "integrity": "sha512-VW6Pxhsrk0KAOqs3WEd0klDiF/+V7gQOpAvY1jVU/LHmaD/kQO4523aiJuikX/QAKYiW6x8Jh+RJej1almdtCA==",
+ "license": "MIT",
+ "dependencies": {
+ "call-bind-apply-helpers": "^1.0.1",
+ "es-define-property": "^1.0.1",
+ "es-errors": "^1.3.0",
+ "es-object-atoms": "^1.0.0",
+ "function-bind": "^1.1.2",
+ "get-proto": "^1.0.0",
+ "gopd": "^1.2.0",
+ "has-symbols": "^1.1.0",
+ "hasown": "^2.0.2",
+ "math-intrinsics": "^1.1.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/get-proto": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/get-proto/-/get-proto-1.0.1.tgz",
+ "integrity": "sha512-sTSfBjoXBp89JvIKIefqw7U2CCebsc74kiY6awiGogKtoSGbgjYE/G/+l9sF3MWFPNc9IcoOC4ODfKHfxFmp0g==",
+ "license": "MIT",
+ "dependencies": {
+ "dunder-proto": "^1.0.1",
+ "es-object-atoms": "^1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/glob-parent": {
+ "version": "5.1.2",
+ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+ "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+ "dev": true,
+ "license": "ISC",
+ "dependencies": {
+ "is-glob": "^4.0.1"
+ },
+ "engines": {
+ "node": ">= 6"
+ }
+ },
+ "node_modules/gopd": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.2.0.tgz",
+ "integrity": "sha512-ZUKRh6/kUFoAiTAtTYPZJ3hw9wNxx+BIBOijnlG9PnrJsCcSjs1wyyD6vJpaYtgnzDrKYRSqf3OO6Rfa93xsRg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-flag": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz",
+ "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==",
+ "dev": true,
+ "license": "MIT",
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/has-symbols": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.1.0.tgz",
+ "integrity": "sha512-1cDNdwJ2Jaohmb3sg4OmKaMBwuC48sYni5HUw2DvsC8LjGTLK9h+eb1X6RyuOHe4hT0ULCW68iomhjUoKUqlPQ==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/hasown": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz",
+ "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==",
+ "license": "MIT",
+ "dependencies": {
+ "function-bind": "^1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/http-errors": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz",
+ "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==",
+ "license": "MIT",
+ "dependencies": {
+ "depd": "2.0.0",
+ "inherits": "2.0.4",
+ "setprototypeof": "1.2.0",
+ "statuses": "2.0.1",
+ "toidentifier": "1.0.1"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/iconv-lite": {
+ "version": "0.4.24",
+ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz",
+ "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==",
+ "license": "MIT",
+ "dependencies": {
+ "safer-buffer": ">= 2.1.2 < 3"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/ignore-by-default": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/ignore-by-default/-/ignore-by-default-1.0.1.tgz",
+ "integrity": "sha512-Ius2VYcGNk7T90CppJqcIkS5ooHUZyIQK+ClZfMfMNFEF9VSE73Fq+906u/CWu92x4gzZMWOwfFYckPObzdEbA==",
+ "dev": true,
+ "license": "ISC"
+ },
+ "node_modules/inherits": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+ "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==",
+ "license": "ISC"
+ },
+ "node_modules/ipaddr.js": {
+ "version": "1.9.1",
+ "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz",
+ "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/is-binary-path": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz",
+ "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "binary-extensions": "^2.0.0"
+ },
+ "engines": {
+ "node": ">=8"
+ }
+ },
+ "node_modules/is-extglob": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
+ "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==",
+ "dev": true,
+ "license": "MIT",
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/is-glob": {
+ "version": "4.0.3",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz",
+ "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "is-extglob": "^2.1.1"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/is-number": {
+ "version": "7.0.0",
+ "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz",
+ "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==",
+ "dev": true,
+ "license": "MIT",
+ "engines": {
+ "node": ">=0.12.0"
+ }
+ },
+ "node_modules/is-property": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-property/-/is-property-1.0.2.tgz",
+ "integrity": "sha512-Ks/IoX00TtClbGQr4TWXemAnktAQvYB7HzcCxDGqEZU6oCmb2INHuOoKxbtR+HFkmYWBKv/dOZtGRiAjDhj92g==",
+ "license": "MIT"
+ },
+ "node_modules/isarray": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
+ "integrity": "sha512-VLghIWNM6ELQzo7zwmcg0NmTVyWKYjvIeM83yjp0wRDTmUnrM678fQbcKBo6n2CJEF0szoG//ytg+TKla89ALQ==",
+ "license": "MIT"
+ },
+ "node_modules/jsonwebtoken": {
+ "version": "9.0.2",
+ "resolved": "https://registry.npmjs.org/jsonwebtoken/-/jsonwebtoken-9.0.2.tgz",
+ "integrity": "sha512-PRp66vJ865SSqOlgqS8hujT5U4AOgMfhrwYIuIhfKaoSCZcirrmASQr8CX7cUg+RMih+hgznrjp99o+W4pJLHQ==",
+ "license": "MIT",
+ "dependencies": {
+ "jws": "^3.2.2",
+ "lodash.includes": "^4.3.0",
+ "lodash.isboolean": "^3.0.3",
+ "lodash.isinteger": "^4.0.4",
+ "lodash.isnumber": "^3.0.3",
+ "lodash.isplainobject": "^4.0.6",
+ "lodash.isstring": "^4.0.1",
+ "lodash.once": "^4.0.0",
+ "ms": "^2.1.1",
+ "semver": "^7.5.4"
+ },
+ "engines": {
+ "node": ">=12",
+ "npm": ">=6"
+ }
+ },
+ "node_modules/jsonwebtoken/node_modules/ms": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+ "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==",
+ "license": "MIT"
+ },
+ "node_modules/jwa": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/jwa/-/jwa-1.4.1.tgz",
+ "integrity": "sha512-qiLX/xhEEFKUAJ6FiBMbes3w9ATzyk5W7Hvzpa/SLYdxNtng+gcurvrI7TbACjIXlsJyr05/S1oUhZrc63evQA==",
+ "license": "MIT",
+ "dependencies": {
+ "buffer-equal-constant-time": "1.0.1",
+ "ecdsa-sig-formatter": "1.0.11",
+ "safe-buffer": "^5.0.1"
+ }
+ },
+ "node_modules/jws": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/jws/-/jws-3.2.2.tgz",
+ "integrity": "sha512-YHlZCB6lMTllWDtSPHz/ZXTsi8S00usEV6v1tjq8tOUZzw7DpSDWVXjXDre6ed1w/pd495ODpHZYSdkRTsa0HA==",
+ "license": "MIT",
+ "dependencies": {
+ "jwa": "^1.4.1",
+ "safe-buffer": "^5.0.1"
+ }
+ },
+ "node_modules/lodash.includes": {
+ "version": "4.3.0",
+ "resolved": "https://registry.npmjs.org/lodash.includes/-/lodash.includes-4.3.0.tgz",
+ "integrity": "sha512-W3Bx6mdkRTGtlJISOvVD/lbqjTlPPUDTMnlXZFnVwi9NKJ6tiAk6LVdlhZMm17VZisqhKcgzpO5Wz91PCt5b0w==",
+ "license": "MIT"
+ },
+ "node_modules/lodash.isboolean": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/lodash.isboolean/-/lodash.isboolean-3.0.3.tgz",
+ "integrity": "sha512-Bz5mupy2SVbPHURB98VAcw+aHh4vRV5IPNhILUCsOzRmsTmSQ17jIuqopAentWoehktxGd9e/hbIXq980/1QJg==",
+ "license": "MIT"
+ },
+ "node_modules/lodash.isinteger": {
+ "version": "4.0.4",
+ "resolved": "https://registry.npmjs.org/lodash.isinteger/-/lodash.isinteger-4.0.4.tgz",
+ "integrity": "sha512-DBwtEWN2caHQ9/imiNeEA5ys1JoRtRfY3d7V9wkqtbycnAmTvRRmbHKDV4a0EYc678/dia0jrte4tjYwVBaZUA==",
+ "license": "MIT"
+ },
+ "node_modules/lodash.isnumber": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/lodash.isnumber/-/lodash.isnumber-3.0.3.tgz",
+ "integrity": "sha512-QYqzpfwO3/CWf3XP+Z+tkQsfaLL/EnUlXWVkIk5FUPc4sBdTehEqZONuyRt2P67PXAk+NXmTBcc97zw9t1FQrw==",
+ "license": "MIT"
+ },
+ "node_modules/lodash.isplainobject": {
+ "version": "4.0.6",
+ "resolved": "https://registry.npmjs.org/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz",
+ "integrity": "sha512-oSXzaWypCMHkPC3NvBEaPHf0KsA5mvPrOPgQWDsbg8n7orZ290M0BmC/jgRZ4vcJ6DTAhjrsSYgdsW/F+MFOBA==",
+ "license": "MIT"
+ },
+ "node_modules/lodash.isstring": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/lodash.isstring/-/lodash.isstring-4.0.1.tgz",
+ "integrity": "sha512-0wJxfxH1wgO3GrbuP+dTTk7op+6L41QCXbGINEmD+ny/G/eCqGzxyCsh7159S+mgDDcoarnBw6PC1PS5+wUGgw==",
+ "license": "MIT"
+ },
+ "node_modules/lodash.once": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/lodash.once/-/lodash.once-4.1.1.tgz",
+ "integrity": "sha512-Sb487aTOCr9drQVL8pIxOzVhafOjZN9UU54hiN8PU3uAiSV7lx1yYNpbNmex2PK6dSJoNTSJUUswT651yww3Mg==",
+ "license": "MIT"
+ },
+ "node_modules/long": {
+ "version": "5.2.4",
+ "resolved": "https://registry.npmjs.org/long/-/long-5.2.4.tgz",
+ "integrity": "sha512-qtzLbJE8hq7VabR3mISmVGtoXP8KGc2Z/AT8OuqlYD7JTR3oqrgwdjnk07wpj1twXxYmgDXgoKVWUG/fReSzHg==",
+ "license": "Apache-2.0"
+ },
+ "node_modules/lru-cache": {
+ "version": "7.18.3",
+ "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-7.18.3.tgz",
+ "integrity": "sha512-jumlc0BIUrS3qJGgIkWZsyfAM7NCWiBcCDhnd+3NNM5KbBmLTgHVfWBcg6W+rLUsIpzpERPsvwUP7CckAQSOoA==",
+ "license": "ISC",
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/lru.min": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/lru.min/-/lru.min-1.1.1.tgz",
+ "integrity": "sha512-FbAj6lXil6t8z4z3j0E5mfRlPzxkySotzUHwRXjlpRh10vc6AI6WN62ehZj82VG7M20rqogJ0GLwar2Xa05a8Q==",
+ "license": "MIT",
+ "engines": {
+ "bun": ">=1.0.0",
+ "deno": ">=1.30.0",
+ "node": ">=8.0.0"
+ },
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wellwelwel"
+ }
+ },
+ "node_modules/math-intrinsics": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/math-intrinsics/-/math-intrinsics-1.1.0.tgz",
+ "integrity": "sha512-/IXtbwEk5HTPyEwyKX6hGkYXxM9nbj64B+ilVJnC/R6B0pH5G4V3b0pVbL7DBj4tkhBAppbQUlf6F6Xl9LHu1g==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/media-typer": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+ "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/merge-descriptors": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.3.tgz",
+ "integrity": "sha512-gaNvAS7TZ897/rVaZ0nMtAyxNyi/pdbjbAwUpFQpN70GqnVfOiXpeUUMKRBmzXaSQ8DdTX4/0ms62r2K+hE6mQ==",
+ "license": "MIT",
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/methods": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz",
+ "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz",
+ "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==",
+ "license": "MIT",
+ "bin": {
+ "mime": "cli.js"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/mime-db": {
+ "version": "1.52.0",
+ "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+ "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime-types": {
+ "version": "2.1.35",
+ "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+ "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+ "license": "MIT",
+ "dependencies": {
+ "mime-db": "1.52.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/minimatch": {
+ "version": "3.1.2",
+ "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz",
+ "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==",
+ "dev": true,
+ "license": "ISC",
+ "dependencies": {
+ "brace-expansion": "^1.1.7"
+ },
+ "engines": {
+ "node": "*"
+ }
+ },
+ "node_modules/ms": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+ "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==",
+ "license": "MIT"
+ },
+ "node_modules/mysql": {
+ "version": "2.18.1",
+ "resolved": "https://registry.npmjs.org/mysql/-/mysql-2.18.1.tgz",
+ "integrity": "sha512-Bca+gk2YWmqp2Uf6k5NFEurwY/0td0cpebAucFpY/3jhrwrVGuxU2uQFCHjU19SJfje0yQvi+rVWdq78hR5lig==",
+ "license": "MIT",
+ "dependencies": {
+ "bignumber.js": "9.0.0",
+ "readable-stream": "2.3.7",
+ "safe-buffer": "5.1.2",
+ "sqlstring": "2.3.1"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mysql/node_modules/safe-buffer": {
+ "version": "5.1.2",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
+ "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
+ "license": "MIT"
+ },
+ "node_modules/mysql/node_modules/sqlstring": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/sqlstring/-/sqlstring-2.3.1.tgz",
+ "integrity": "sha512-ooAzh/7dxIG5+uDik1z/Rd1vli0+38izZhGzSa34FwR7IbelPWCCKSNIl8jlL/F7ERvy8CB2jNeM1E9i9mXMAQ==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mysql2": {
+ "version": "3.12.0",
+ "resolved": "https://registry.npmjs.org/mysql2/-/mysql2-3.12.0.tgz",
+ "integrity": "sha512-C8fWhVysZoH63tJbX8d10IAoYCyXy4fdRFz2Ihrt9jtPILYynFEKUUzpp1U7qxzDc3tMbotvaBH+sl6bFnGZiw==",
+ "license": "MIT",
+ "dependencies": {
+ "aws-ssl-profiles": "^1.1.1",
+ "denque": "^2.1.0",
+ "generate-function": "^2.3.1",
+ "iconv-lite": "^0.6.3",
+ "long": "^5.2.1",
+ "lru.min": "^1.0.0",
+ "named-placeholders": "^1.1.3",
+ "seq-queue": "^0.0.5",
+ "sqlstring": "^2.3.2"
+ },
+ "engines": {
+ "node": ">= 8.0"
+ }
+ },
+ "node_modules/mysql2/node_modules/iconv-lite": {
+ "version": "0.6.3",
+ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz",
+ "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==",
+ "license": "MIT",
+ "dependencies": {
+ "safer-buffer": ">= 2.1.2 < 3.0.0"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/named-placeholders": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/named-placeholders/-/named-placeholders-1.1.3.tgz",
+ "integrity": "sha512-eLoBxg6wE/rZkJPhU/xRX1WTpkFEwDJEN96oxFrTsqBdbT5ec295Q+CoHrL9IT0DipqKhmGcaZmwOt8OON5x1w==",
+ "license": "MIT",
+ "dependencies": {
+ "lru-cache": "^7.14.1"
+ },
+ "engines": {
+ "node": ">=12.0.0"
+ }
+ },
+ "node_modules/negotiator": {
+ "version": "0.6.3",
+ "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz",
+ "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/nodemailer": {
+ "version": "6.10.0",
+ "resolved": "https://registry.npmjs.org/nodemailer/-/nodemailer-6.10.0.tgz",
+ "integrity": "sha512-SQ3wZCExjeSatLE/HBaXS5vqUOQk6GtBdIIKxiFdmm01mOQZX/POJkO3SUX1wDiYcwUOJwT23scFSC9fY2H8IA==",
+ "license": "MIT-0",
+ "engines": {
+ "node": ">=6.0.0"
+ }
+ },
+ "node_modules/nodemon": {
+ "version": "3.1.9",
+ "resolved": "https://registry.npmjs.org/nodemon/-/nodemon-3.1.9.tgz",
+ "integrity": "sha512-hdr1oIb2p6ZSxu3PB2JWWYS7ZQ0qvaZsc3hK8DR8f02kRzc8rjYmxAIvdz+aYC+8F2IjNaB7HMcSDg8nQpJxyg==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "chokidar": "^3.5.2",
+ "debug": "^4",
+ "ignore-by-default": "^1.0.1",
+ "minimatch": "^3.1.2",
+ "pstree.remy": "^1.1.8",
+ "semver": "^7.5.3",
+ "simple-update-notifier": "^2.0.0",
+ "supports-color": "^5.5.0",
+ "touch": "^3.1.0",
+ "undefsafe": "^2.0.5"
+ },
+ "bin": {
+ "nodemon": "bin/nodemon.js"
+ },
+ "engines": {
+ "node": ">=10"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/nodemon"
+ }
+ },
+ "node_modules/nodemon/node_modules/debug": {
+ "version": "4.4.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz",
+ "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "ms": "^2.1.3"
+ },
+ "engines": {
+ "node": ">=6.0"
+ },
+ "peerDependenciesMeta": {
+ "supports-color": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/nodemon/node_modules/ms": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+ "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==",
+ "dev": true,
+ "license": "MIT"
+ },
+ "node_modules/normalize-path": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz",
+ "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==",
+ "dev": true,
+ "license": "MIT",
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/object-assign": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+ "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/object-inspect": {
+ "version": "1.13.3",
+ "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.3.tgz",
+ "integrity": "sha512-kDCGIbxkDSXE3euJZZXzc6to7fCrKHNI/hSRQnRuQ+BWjFNzZwiFF8fj/6o2t2G9/jTj8PSIYTfCLelLZEeRpA==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/on-finished": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz",
+ "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==",
+ "license": "MIT",
+ "dependencies": {
+ "ee-first": "1.1.1"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/parseurl": {
+ "version": "1.3.3",
+ "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz",
+ "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/path-to-regexp": {
+ "version": "0.1.12",
+ "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.12.tgz",
+ "integrity": "sha512-RA1GjUVMnvYFxuqovrEqZoxxW5NUZqbwKtYz/Tt7nXerk0LbLblQmrsgdeOxV5SFHf0UDggjS/bSeOZwt1pmEQ==",
+ "license": "MIT"
+ },
+ "node_modules/picomatch": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz",
+ "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==",
+ "dev": true,
+ "license": "MIT",
+ "engines": {
+ "node": ">=8.6"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/jonschlinkert"
+ }
+ },
+ "node_modules/process-nextick-args": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz",
+ "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==",
+ "license": "MIT"
+ },
+ "node_modules/proxy-addr": {
+ "version": "2.0.7",
+ "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz",
+ "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==",
+ "license": "MIT",
+ "dependencies": {
+ "forwarded": "0.2.0",
+ "ipaddr.js": "1.9.1"
+ },
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/pstree.remy": {
+ "version": "1.1.8",
+ "resolved": "https://registry.npmjs.org/pstree.remy/-/pstree.remy-1.1.8.tgz",
+ "integrity": "sha512-77DZwxQmxKnu3aR542U+X8FypNzbfJ+C5XQDk3uWjWxn6151aIMGthWYRXTqT1E5oJvg+ljaa2OJi+VfvCOQ8w==",
+ "dev": true,
+ "license": "MIT"
+ },
+ "node_modules/qs": {
+ "version": "6.13.0",
+ "resolved": "https://registry.npmjs.org/qs/-/qs-6.13.0.tgz",
+ "integrity": "sha512-+38qI9SOr8tfZ4QmJNplMUxqjbe7LKvvZgWdExBOmd+egZTtjLB67Gu0HRX3u/XOq7UU2Nx6nsjvS16Z9uwfpg==",
+ "license": "BSD-3-Clause",
+ "dependencies": {
+ "side-channel": "^1.0.6"
+ },
+ "engines": {
+ "node": ">=0.6"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/range-parser": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz",
+ "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/raw-body": {
+ "version": "2.5.2",
+ "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.2.tgz",
+ "integrity": "sha512-8zGqypfENjCIqGhgXToC8aB2r7YrBX+AQAfIPs/Mlk+BtPTztOvTS01NRW/3Eh60J+a48lt8qsCzirQ6loCVfA==",
+ "license": "MIT",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "unpipe": "1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/readable-stream": {
+ "version": "2.3.7",
+ "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz",
+ "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==",
+ "license": "MIT",
+ "dependencies": {
+ "core-util-is": "~1.0.0",
+ "inherits": "~2.0.3",
+ "isarray": "~1.0.0",
+ "process-nextick-args": "~2.0.0",
+ "safe-buffer": "~5.1.1",
+ "string_decoder": "~1.1.1",
+ "util-deprecate": "~1.0.1"
+ }
+ },
+ "node_modules/readable-stream/node_modules/safe-buffer": {
+ "version": "5.1.2",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
+ "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
+ "license": "MIT"
+ },
+ "node_modules/readdirp": {
+ "version": "3.6.0",
+ "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz",
+ "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "picomatch": "^2.2.1"
+ },
+ "engines": {
+ "node": ">=8.10.0"
+ }
+ },
+ "node_modules/safe-buffer": {
+ "version": "5.2.1",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz",
+ "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ],
+ "license": "MIT"
+ },
+ "node_modules/safer-buffer": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
+ "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==",
+ "license": "MIT"
+ },
+ "node_modules/semver": {
+ "version": "7.7.1",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-7.7.1.tgz",
+ "integrity": "sha512-hlq8tAfn0m/61p4BVRcPzIGr6LKiMwo4VM6dGi6pt4qcRkmNzTcWq6eCEjEh+qXjkMDvPlOFFSGwQjoEa6gyMA==",
+ "license": "ISC",
+ "bin": {
+ "semver": "bin/semver.js"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/send": {
+ "version": "0.19.0",
+ "resolved": "https://registry.npmjs.org/send/-/send-0.19.0.tgz",
+ "integrity": "sha512-dW41u5VfLXu8SJh5bwRmyYUbAoSB3c9uQh6L8h/KtsFREPWpbX1lrljJo186Jc4nmci/sGUZ9a0a0J2zgfq2hw==",
+ "license": "MIT",
+ "dependencies": {
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "encodeurl": "~1.0.2",
+ "escape-html": "~1.0.3",
+ "etag": "~1.8.1",
+ "fresh": "0.5.2",
+ "http-errors": "2.0.0",
+ "mime": "1.6.0",
+ "ms": "2.1.3",
+ "on-finished": "2.4.1",
+ "range-parser": "~1.2.1",
+ "statuses": "2.0.1"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/send/node_modules/encodeurl": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+ "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/send/node_modules/ms": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+ "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==",
+ "license": "MIT"
+ },
+ "node_modules/seq-queue": {
+ "version": "0.0.5",
+ "resolved": "https://registry.npmjs.org/seq-queue/-/seq-queue-0.0.5.tgz",
+ "integrity": "sha512-hr3Wtp/GZIc/6DAGPDcV4/9WoZhjrkXsi5B/07QgX8tsdc6ilr7BFM6PM6rbdAX1kFSDYeZGLipIZZKyQP0O5Q=="
+ },
+ "node_modules/serve-static": {
+ "version": "1.16.2",
+ "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.16.2.tgz",
+ "integrity": "sha512-VqpjJZKadQB/PEbEwvFdO43Ax5dFBZ2UECszz8bQ7pi7wt//PWe1P6MN7eCnjsatYtBT6EuiClbjSWP2WrIoTw==",
+ "license": "MIT",
+ "dependencies": {
+ "encodeurl": "~2.0.0",
+ "escape-html": "~1.0.3",
+ "parseurl": "~1.3.3",
+ "send": "0.19.0"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/setprototypeof": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz",
+ "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==",
+ "license": "ISC"
+ },
+ "node_modules/side-channel": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.1.0.tgz",
+ "integrity": "sha512-ZX99e6tRweoUXqR+VBrslhda51Nh5MTQwou5tnUDgbtyM0dBgmhEDtWGP/xbKn6hqfPRHujUNwz5fy/wbbhnpw==",
+ "license": "MIT",
+ "dependencies": {
+ "es-errors": "^1.3.0",
+ "object-inspect": "^1.13.3",
+ "side-channel-list": "^1.0.0",
+ "side-channel-map": "^1.0.1",
+ "side-channel-weakmap": "^1.0.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/side-channel-list": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/side-channel-list/-/side-channel-list-1.0.0.tgz",
+ "integrity": "sha512-FCLHtRD/gnpCiCHEiJLOwdmFP+wzCmDEkc9y7NsYxeF4u7Btsn1ZuwgwJGxImImHicJArLP4R0yX4c2KCrMrTA==",
+ "license": "MIT",
+ "dependencies": {
+ "es-errors": "^1.3.0",
+ "object-inspect": "^1.13.3"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/side-channel-map": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/side-channel-map/-/side-channel-map-1.0.1.tgz",
+ "integrity": "sha512-VCjCNfgMsby3tTdo02nbjtM/ewra6jPHmpThenkTYh8pG9ucZ/1P8So4u4FGBek/BjpOVsDCMoLA/iuBKIFXRA==",
+ "license": "MIT",
+ "dependencies": {
+ "call-bound": "^1.0.2",
+ "es-errors": "^1.3.0",
+ "get-intrinsic": "^1.2.5",
+ "object-inspect": "^1.13.3"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/side-channel-weakmap": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/side-channel-weakmap/-/side-channel-weakmap-1.0.2.tgz",
+ "integrity": "sha512-WPS/HvHQTYnHisLo9McqBHOJk2FkHO/tlpvldyrnem4aeQp4hai3gythswg6p01oSoTl58rcpiFAjF2br2Ak2A==",
+ "license": "MIT",
+ "dependencies": {
+ "call-bound": "^1.0.2",
+ "es-errors": "^1.3.0",
+ "get-intrinsic": "^1.2.5",
+ "object-inspect": "^1.13.3",
+ "side-channel-map": "^1.0.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/simple-update-notifier": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/simple-update-notifier/-/simple-update-notifier-2.0.0.tgz",
+ "integrity": "sha512-a2B9Y0KlNXl9u/vsW6sTIu9vGEpfKu2wRV6l1H3XEas/0gUIzGzBoP/IouTcUQbm9JWZLH3COxyn03TYlFax6w==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "semver": "^7.5.3"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/sqlstring": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/sqlstring/-/sqlstring-2.3.3.tgz",
+ "integrity": "sha512-qC9iz2FlN7DQl3+wjwn3802RTyjCx7sDvfQEXchwa6CWOx07/WVfh91gBmQ9fahw8snwGEWU3xGzOt4tFyHLxg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/statuses": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz",
+ "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/string_decoder": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
+ "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
+ "license": "MIT",
+ "dependencies": {
+ "safe-buffer": "~5.1.0"
+ }
+ },
+ "node_modules/string_decoder/node_modules/safe-buffer": {
+ "version": "5.1.2",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
+ "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
+ "license": "MIT"
+ },
+ "node_modules/supports-color": {
+ "version": "5.5.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
+ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "has-flag": "^3.0.0"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/to-regex-range": {
+ "version": "5.0.1",
+ "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",
+ "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==",
+ "dev": true,
+ "license": "MIT",
+ "dependencies": {
+ "is-number": "^7.0.0"
+ },
+ "engines": {
+ "node": ">=8.0"
+ }
+ },
+ "node_modules/toidentifier": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz",
+ "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==",
+ "license": "MIT",
+ "engines": {
+ "node": ">=0.6"
+ }
+ },
+ "node_modules/touch": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/touch/-/touch-3.1.1.tgz",
+ "integrity": "sha512-r0eojU4bI8MnHr8c5bNo7lJDdI2qXlWWJk6a9EAFG7vbhTjElYhBVS3/miuE0uOuoLdb8Mc/rVfsmm6eo5o9GA==",
+ "dev": true,
+ "license": "ISC",
+ "bin": {
+ "nodetouch": "bin/nodetouch.js"
+ }
+ },
+ "node_modules/type-is": {
+ "version": "1.6.18",
+ "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz",
+ "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==",
+ "license": "MIT",
+ "dependencies": {
+ "media-typer": "0.3.0",
+ "mime-types": "~2.1.24"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/undefsafe": {
+ "version": "2.0.5",
+ "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.5.tgz",
+ "integrity": "sha512-WxONCrssBM8TSPRqN5EmsjVrsv4A8X12J4ArBiiayv3DyyG3ZlIg6yysuuSYdZsVz3TKcTg2fd//Ujd4CHV1iA==",
+ "dev": true,
+ "license": "MIT"
+ },
+ "node_modules/unpipe": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz",
+ "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/util-deprecate": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+ "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==",
+ "license": "MIT"
+ },
+ "node_modules/utils-merge": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz",
+ "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.4.0"
+ }
+ },
+ "node_modules/vary": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz",
+ "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==",
+ "license": "MIT",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ }
+ }
+}
diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md
new file mode 100644
index 0000000..cb5990c
--- /dev/null
+++ b/node_modules/accepts/HISTORY.md
@@ -0,0 +1,243 @@
+1.3.8 / 2022-02-02
+==================
+
+ * deps: mime-types@~2.1.34
+ - deps: mime-db@~1.51.0
+ * deps: negotiator@0.6.3
+
+1.3.7 / 2019-04-29
+==================
+
+ * deps: negotiator@0.6.2
+ - Fix sorting charset, encoding, and language with extra parameters
+
+1.3.6 / 2019-04-28
+==================
+
+ * deps: mime-types@~2.1.24
+ - deps: mime-db@~1.40.0
+
+1.3.5 / 2018-02-28
+==================
+
+ * deps: mime-types@~2.1.18
+ - deps: mime-db@~1.33.0
+
+1.3.4 / 2017-08-22
+==================
+
+ * deps: mime-types@~2.1.16
+ - deps: mime-db@~1.29.0
+
+1.3.3 / 2016-05-02
+==================
+
+ * deps: mime-types@~2.1.11
+ - deps: mime-db@~1.23.0
+ * deps: negotiator@0.6.1
+ - perf: improve `Accept` parsing speed
+ - perf: improve `Accept-Charset` parsing speed
+ - perf: improve `Accept-Encoding` parsing speed
+ - perf: improve `Accept-Language` parsing speed
+
+1.3.2 / 2016-03-08
+==================
+
+ * deps: mime-types@~2.1.10
+ - Fix extension of `application/dash+xml`
+ - Update primary extension for `audio/mp4`
+ - deps: mime-db@~1.22.0
+
+1.3.1 / 2016-01-19
+==================
+
+ * deps: mime-types@~2.1.9
+ - deps: mime-db@~1.21.0
+
+1.3.0 / 2015-09-29
+==================
+
+ * deps: mime-types@~2.1.7
+ - deps: mime-db@~1.19.0
+ * deps: negotiator@0.6.0
+ - Fix including type extensions in parameters in `Accept` parsing
+ - Fix parsing `Accept` parameters with quoted equals
+ - Fix parsing `Accept` parameters with quoted semicolons
+ - Lazy-load modules from main entry point
+ - perf: delay type concatenation until needed
+ - perf: enable strict mode
+ - perf: hoist regular expressions
+ - perf: remove closures getting spec properties
+ - perf: remove a closure from media type parsing
+ - perf: remove property delete from media type parsing
+
+1.2.13 / 2015-09-06
+===================
+
+ * deps: mime-types@~2.1.6
+ - deps: mime-db@~1.18.0
+
+1.2.12 / 2015-07-30
+===================
+
+ * deps: mime-types@~2.1.4
+ - deps: mime-db@~1.16.0
+
+1.2.11 / 2015-07-16
+===================
+
+ * deps: mime-types@~2.1.3
+ - deps: mime-db@~1.15.0
+
+1.2.10 / 2015-07-01
+===================
+
+ * deps: mime-types@~2.1.2
+ - deps: mime-db@~1.14.0
+
+1.2.9 / 2015-06-08
+==================
+
+ * deps: mime-types@~2.1.1
+ - perf: fix deopt during mapping
+
+1.2.8 / 2015-06-07
+==================
+
+ * deps: mime-types@~2.1.0
+ - deps: mime-db@~1.13.0
+ * perf: avoid argument reassignment & argument slice
+ * perf: avoid negotiator recursive construction
+ * perf: enable strict mode
+ * perf: remove unnecessary bitwise operator
+
+1.2.7 / 2015-05-10
+==================
+
+ * deps: negotiator@0.5.3
+ - Fix media type parameter matching to be case-insensitive
+
+1.2.6 / 2015-05-07
+==================
+
+ * deps: mime-types@~2.0.11
+ - deps: mime-db@~1.9.1
+ * deps: negotiator@0.5.2
+ - Fix comparing media types with quoted values
+ - Fix splitting media types with quoted commas
+
+1.2.5 / 2015-03-13
+==================
+
+ * deps: mime-types@~2.0.10
+ - deps: mime-db@~1.8.0
+
+1.2.4 / 2015-02-14
+==================
+
+ * Support Node.js 0.6
+ * deps: mime-types@~2.0.9
+ - deps: mime-db@~1.7.0
+ * deps: negotiator@0.5.1
+ - Fix preference sorting to be stable for long acceptable lists
+
+1.2.3 / 2015-01-31
+==================
+
+ * deps: mime-types@~2.0.8
+ - deps: mime-db@~1.6.0
+
+1.2.2 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.7
+ - deps: mime-db@~1.5.0
+
+1.2.1 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.5
+ - deps: mime-db@~1.3.1
+
+1.2.0 / 2014-12-19
+==================
+
+ * deps: negotiator@0.5.0
+ - Fix list return order when large accepted list
+ - Fix missing identity encoding when q=0 exists
+ - Remove dynamic building of Negotiator class
+
+1.1.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - deps: mime-db@~1.3.0
+
+1.1.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - deps: mime-db@~1.2.0
+
+1.1.2 / 2014-10-14
+==================
+
+ * deps: negotiator@0.4.9
+ - Fix error when media type has invalid parameter
+
+1.1.1 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - deps: mime-db@~1.1.0
+ * deps: negotiator@0.4.8
+ - Fix all negotiations to be case-insensitive
+ - Stable sort preferences of same quality according to client order
+
+1.1.0 / 2014-09-02
+==================
+
+ * update `mime-types`
+
+1.0.7 / 2014-07-04
+==================
+
+ * Fix wrong type returned from `type` when match after unknown extension
+
+1.0.6 / 2014-06-24
+==================
+
+ * deps: negotiator@0.4.7
+
+1.0.5 / 2014-06-20
+==================
+
+ * fix crash when unknown extension given
+
+1.0.4 / 2014-06-19
+==================
+
+ * use `mime-types`
+
+1.0.3 / 2014-06-11
+==================
+
+ * deps: negotiator@0.4.6
+ - Order by specificity when quality is the same
+
+1.0.2 / 2014-05-29
+==================
+
+ * Fix interpretation when header not in request
+ * deps: pin negotiator@0.4.5
+
+1.0.1 / 2014-01-18
+==================
+
+ * Identity encoding isn't always acceptable
+ * deps: negotiator@~0.4.0
+
+1.0.0 / 2013-12-27
+==================
+
+ * Genesis
diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE
new file mode 100644
index 0000000..0616607
--- /dev/null
+++ b/node_modules/accepts/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md
new file mode 100644
index 0000000..82680c5
--- /dev/null
+++ b/node_modules/accepts/README.md
@@ -0,0 +1,140 @@
+# accepts
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator).
+Extracted from [koa](https://www.npmjs.com/package/koa) for general use.
+
+In addition to negotiator, it allows:
+
+- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])`
+ as well as `('text/html', 'application/json')`.
+- Allows type shorthands such as `json`.
+- Returns `false` when no types match
+- Treats non-existent headers as `*`
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install accepts
+```
+
+## API
+
+```js
+var accepts = require('accepts')
+```
+
+### accepts(req)
+
+Create a new `Accepts` object for the given `req`.
+
+#### .charset(charsets)
+
+Return the first accepted charset. If nothing in `charsets` is accepted,
+then `false` is returned.
+
+#### .charsets()
+
+Return the charsets that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .encoding(encodings)
+
+Return the first accepted encoding. If nothing in `encodings` is accepted,
+then `false` is returned.
+
+#### .encodings()
+
+Return the encodings that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .language(languages)
+
+Return the first accepted language. If nothing in `languages` is accepted,
+then `false` is returned.
+
+#### .languages()
+
+Return the languages that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .type(types)
+
+Return the first accepted type (and it is returned as the same text as what
+appears in the `types` array). If nothing in `types` is accepted, then `false`
+is returned.
+
+The `types` array can contain full MIME types or file extensions. Any value
+that is not a full MIME types is passed to `require('mime-types').lookup`.
+
+#### .types()
+
+Return the types that the request accepts, in the order of the client's
+preference (most preferred first).
+
+## Examples
+
+### Simple type negotiation
+
+This simple example shows how to use `accepts` to return a different typed
+respond body based on what the client wants to accept. The server lists it's
+preferences in order and will get back the best match between the client and
+server.
+
+```js
+var accepts = require('accepts')
+var http = require('http')
+
+function app (req, res) {
+ var accept = accepts(req)
+
+ // the order of this list is significant; should be server preferred order
+ switch (accept.type(['json', 'html'])) {
+ case 'json':
+ res.setHeader('Content-Type', 'application/json')
+ res.write('{"hello":"world!"}')
+ break
+ case 'html':
+ res.setHeader('Content-Type', 'text/html')
+ res.write('hello, world! ')
+ break
+ default:
+ // the fallback is text/plain, so no need to specify it above
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('hello, world!')
+ break
+ }
+
+ res.end()
+}
+
+http.createServer(app).listen(3000)
+```
+
+You can test this out with the cURL program:
+```sh
+curl -I -H'Accept: text/html' http://localhost:3000/
+```
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master
+[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master
+[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml
+[node-version-image]: https://badgen.net/npm/node/accepts
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/accepts
+[npm-url]: https://npmjs.org/package/accepts
+[npm-version-image]: https://badgen.net/npm/v/accepts
diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js
new file mode 100644
index 0000000..e9b2f63
--- /dev/null
+++ b/node_modules/accepts/index.js
@@ -0,0 +1,238 @@
+/*!
+ * accepts
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Negotiator = require('negotiator')
+var mime = require('mime-types')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = Accepts
+
+/**
+ * Create a new Accepts object for the given req.
+ *
+ * @param {object} req
+ * @public
+ */
+
+function Accepts (req) {
+ if (!(this instanceof Accepts)) {
+ return new Accepts(req)
+ }
+
+ this.headers = req.headers
+ this.negotiator = new Negotiator(req)
+}
+
+/**
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json" or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * this.types('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * this.types('html');
+ * // => "html"
+ * this.types('text/html');
+ * // => "text/html"
+ * this.types('json', 'text');
+ * // => "json"
+ * this.types('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * this.types('image/png');
+ * this.types('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * this.types(['html', 'json']);
+ * this.types('html', 'json');
+ * // => "json"
+ *
+ * @param {String|Array} types...
+ * @return {String|Array|Boolean}
+ * @public
+ */
+
+Accepts.prototype.type =
+Accepts.prototype.types = function (types_) {
+ var types = types_
+
+ // support flattened arguments
+ if (types && !Array.isArray(types)) {
+ types = new Array(arguments.length)
+ for (var i = 0; i < types.length; i++) {
+ types[i] = arguments[i]
+ }
+ }
+
+ // no types, return all requested types
+ if (!types || types.length === 0) {
+ return this.negotiator.mediaTypes()
+ }
+
+ // no accept header, return first given type
+ if (!this.headers.accept) {
+ return types[0]
+ }
+
+ var mimes = types.map(extToMime)
+ var accepts = this.negotiator.mediaTypes(mimes.filter(validMime))
+ var first = accepts[0]
+
+ return first
+ ? types[mimes.indexOf(first)]
+ : false
+}
+
+/**
+ * Return accepted encodings or best fit based on `encodings`.
+ *
+ * Given `Accept-Encoding: gzip, deflate`
+ * an array sorted by quality is returned:
+ *
+ * ['gzip', 'deflate']
+ *
+ * @param {String|Array} encodings...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.encoding =
+Accepts.prototype.encodings = function (encodings_) {
+ var encodings = encodings_
+
+ // support flattened arguments
+ if (encodings && !Array.isArray(encodings)) {
+ encodings = new Array(arguments.length)
+ for (var i = 0; i < encodings.length; i++) {
+ encodings[i] = arguments[i]
+ }
+ }
+
+ // no encodings, return all requested encodings
+ if (!encodings || encodings.length === 0) {
+ return this.negotiator.encodings()
+ }
+
+ return this.negotiator.encodings(encodings)[0] || false
+}
+
+/**
+ * Return accepted charsets or best fit based on `charsets`.
+ *
+ * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
+ * an array sorted by quality is returned:
+ *
+ * ['utf-8', 'utf-7', 'iso-8859-1']
+ *
+ * @param {String|Array} charsets...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.charset =
+Accepts.prototype.charsets = function (charsets_) {
+ var charsets = charsets_
+
+ // support flattened arguments
+ if (charsets && !Array.isArray(charsets)) {
+ charsets = new Array(arguments.length)
+ for (var i = 0; i < charsets.length; i++) {
+ charsets[i] = arguments[i]
+ }
+ }
+
+ // no charsets, return all requested charsets
+ if (!charsets || charsets.length === 0) {
+ return this.negotiator.charsets()
+ }
+
+ return this.negotiator.charsets(charsets)[0] || false
+}
+
+/**
+ * Return accepted languages or best fit based on `langs`.
+ *
+ * Given `Accept-Language: en;q=0.8, es, pt`
+ * an array sorted by quality is returned:
+ *
+ * ['es', 'pt', 'en']
+ *
+ * @param {String|Array} langs...
+ * @return {Array|String}
+ * @public
+ */
+
+Accepts.prototype.lang =
+Accepts.prototype.langs =
+Accepts.prototype.language =
+Accepts.prototype.languages = function (languages_) {
+ var languages = languages_
+
+ // support flattened arguments
+ if (languages && !Array.isArray(languages)) {
+ languages = new Array(arguments.length)
+ for (var i = 0; i < languages.length; i++) {
+ languages[i] = arguments[i]
+ }
+ }
+
+ // no languages, return all requested languages
+ if (!languages || languages.length === 0) {
+ return this.negotiator.languages()
+ }
+
+ return this.negotiator.languages(languages)[0] || false
+}
+
+/**
+ * Convert extnames to mime.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function extToMime (type) {
+ return type.indexOf('/') === -1
+ ? mime.lookup(type)
+ : type
+}
+
+/**
+ * Check if mime is valid.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function validMime (type) {
+ return typeof type === 'string'
+}
diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json
new file mode 100644
index 0000000..0f2d15d
--- /dev/null
+++ b/node_modules/accepts/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "accepts",
+ "description": "Higher-level content negotiation",
+ "version": "1.3.8",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Jonathan Ong (http://jongleberry.com)"
+ ],
+ "license": "MIT",
+ "repository": "jshttp/accepts",
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "4.3.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "keywords": [
+ "content",
+ "negotiation",
+ "accept",
+ "accepts"
+ ]
+}
diff --git a/node_modules/anymatch/LICENSE b/node_modules/anymatch/LICENSE
new file mode 100644
index 0000000..491766c
--- /dev/null
+++ b/node_modules/anymatch/LICENSE
@@ -0,0 +1,15 @@
+The ISC License
+
+Copyright (c) 2019 Elan Shanker, Paul Miller (https://paulmillr.com)
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR
+IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/node_modules/anymatch/README.md b/node_modules/anymatch/README.md
new file mode 100644
index 0000000..1dd67f5
--- /dev/null
+++ b/node_modules/anymatch/README.md
@@ -0,0 +1,87 @@
+anymatch [](https://travis-ci.org/micromatch/anymatch) [](https://coveralls.io/r/micromatch/anymatch?branch=master)
+======
+Javascript module to match a string against a regular expression, glob, string,
+or function that takes the string as an argument and returns a truthy or falsy
+value. The matcher can also be an array of any or all of these. Useful for
+allowing a very flexible user-defined config to define things like file paths.
+
+__Note: This module has Bash-parity, please be aware that Windows-style backslashes are not supported as separators. See https://github.com/micromatch/micromatch#backslashes for more information.__
+
+
+Usage
+-----
+```sh
+npm install anymatch
+```
+
+#### anymatch(matchers, testString, [returnIndex], [options])
+* __matchers__: (_Array|String|RegExp|Function_)
+String to be directly matched, string with glob patterns, regular expression
+test, function that takes the testString as an argument and returns a truthy
+value if it should be matched, or an array of any number and mix of these types.
+* __testString__: (_String|Array_) The string to test against the matchers. If
+passed as an array, the first element of the array will be used as the
+`testString` for non-function matchers, while the entire array will be applied
+as the arguments for function matchers.
+* __options__: (_Object_ [optional]_) Any of the [picomatch](https://github.com/micromatch/picomatch#options) options.
+ * __returnIndex__: (_Boolean [optional]_) If true, return the array index of
+the first matcher that that testString matched, or -1 if no match, instead of a
+boolean result.
+
+```js
+const anymatch = require('anymatch');
+
+const matchers = [ 'path/to/file.js', 'path/anyjs/**/*.js', /foo.js$/, string => string.includes('bar') && string.length > 10 ] ;
+
+anymatch(matchers, 'path/to/file.js'); // true
+anymatch(matchers, 'path/anyjs/baz.js'); // true
+anymatch(matchers, 'path/to/foo.js'); // true
+anymatch(matchers, 'path/to/bar.js'); // true
+anymatch(matchers, 'bar.js'); // false
+
+// returnIndex = true
+anymatch(matchers, 'foo.js', {returnIndex: true}); // 2
+anymatch(matchers, 'path/anyjs/foo.js', {returnIndex: true}); // 1
+
+// any picomatc
+
+// using globs to match directories and their children
+anymatch('node_modules', 'node_modules'); // true
+anymatch('node_modules', 'node_modules/somelib/index.js'); // false
+anymatch('node_modules/**', 'node_modules/somelib/index.js'); // true
+anymatch('node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // false
+anymatch('**/node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // true
+
+const matcher = anymatch(matchers);
+['foo.js', 'bar.js'].filter(matcher); // [ 'foo.js' ]
+anymatch master* ❯
+
+```
+
+#### anymatch(matchers)
+You can also pass in only your matcher(s) to get a curried function that has
+already been bound to the provided matching criteria. This can be used as an
+`Array#filter` callback.
+
+```js
+var matcher = anymatch(matchers);
+
+matcher('path/to/file.js'); // true
+matcher('path/anyjs/baz.js', true); // 1
+
+['foo.js', 'bar.js'].filter(matcher); // ['foo.js']
+```
+
+Changelog
+----------
+[See release notes page on GitHub](https://github.com/micromatch/anymatch/releases)
+
+- **v3.0:** Removed `startIndex` and `endIndex` arguments. Node 8.x-only.
+- **v2.0:** [micromatch](https://github.com/jonschlinkert/micromatch) moves away from minimatch-parity and inline with Bash. This includes handling backslashes differently (see https://github.com/micromatch/micromatch#backslashes for more information).
+- **v1.2:** anymatch uses [micromatch](https://github.com/jonschlinkert/micromatch)
+for glob pattern matching. Issues with glob pattern matching should be
+reported directly to the [micromatch issue tracker](https://github.com/jonschlinkert/micromatch/issues).
+
+License
+-------
+[ISC](https://raw.github.com/micromatch/anymatch/master/LICENSE)
diff --git a/node_modules/anymatch/index.d.ts b/node_modules/anymatch/index.d.ts
new file mode 100644
index 0000000..3ef7eaa
--- /dev/null
+++ b/node_modules/anymatch/index.d.ts
@@ -0,0 +1,20 @@
+type AnymatchFn = (testString: string) => boolean;
+type AnymatchPattern = string|RegExp|AnymatchFn;
+type AnymatchMatcher = AnymatchPattern|AnymatchPattern[]
+type AnymatchTester = {
+ (testString: string|any[], returnIndex: true): number;
+ (testString: string|any[]): boolean;
+}
+
+type PicomatchOptions = {dot: boolean};
+
+declare const anymatch: {
+ (matchers: AnymatchMatcher): AnymatchTester;
+ (matchers: AnymatchMatcher, testString: null, returnIndex: true | PicomatchOptions): AnymatchTester;
+ (matchers: AnymatchMatcher, testString: string|any[], returnIndex: true | PicomatchOptions): number;
+ (matchers: AnymatchMatcher, testString: string|any[]): boolean;
+}
+
+export {AnymatchMatcher as Matcher}
+export {AnymatchTester as Tester}
+export default anymatch
diff --git a/node_modules/anymatch/index.js b/node_modules/anymatch/index.js
new file mode 100644
index 0000000..8eb73e9
--- /dev/null
+++ b/node_modules/anymatch/index.js
@@ -0,0 +1,104 @@
+'use strict';
+
+Object.defineProperty(exports, "__esModule", { value: true });
+
+const picomatch = require('picomatch');
+const normalizePath = require('normalize-path');
+
+/**
+ * @typedef {(testString: string) => boolean} AnymatchFn
+ * @typedef {string|RegExp|AnymatchFn} AnymatchPattern
+ * @typedef {AnymatchPattern|AnymatchPattern[]} AnymatchMatcher
+ */
+const BANG = '!';
+const DEFAULT_OPTIONS = {returnIndex: false};
+const arrify = (item) => Array.isArray(item) ? item : [item];
+
+/**
+ * @param {AnymatchPattern} matcher
+ * @param {object} options
+ * @returns {AnymatchFn}
+ */
+const createPattern = (matcher, options) => {
+ if (typeof matcher === 'function') {
+ return matcher;
+ }
+ if (typeof matcher === 'string') {
+ const glob = picomatch(matcher, options);
+ return (string) => matcher === string || glob(string);
+ }
+ if (matcher instanceof RegExp) {
+ return (string) => matcher.test(string);
+ }
+ return (string) => false;
+};
+
+/**
+ * @param {Array} patterns
+ * @param {Array} negPatterns
+ * @param {String|Array} args
+ * @param {Boolean} returnIndex
+ * @returns {boolean|number}
+ */
+const matchPatterns = (patterns, negPatterns, args, returnIndex) => {
+ const isList = Array.isArray(args);
+ const _path = isList ? args[0] : args;
+ if (!isList && typeof _path !== 'string') {
+ throw new TypeError('anymatch: second argument must be a string: got ' +
+ Object.prototype.toString.call(_path))
+ }
+ const path = normalizePath(_path, false);
+
+ for (let index = 0; index < negPatterns.length; index++) {
+ const nglob = negPatterns[index];
+ if (nglob(path)) {
+ return returnIndex ? -1 : false;
+ }
+ }
+
+ const applied = isList && [path].concat(args.slice(1));
+ for (let index = 0; index < patterns.length; index++) {
+ const pattern = patterns[index];
+ if (isList ? pattern(...applied) : pattern(path)) {
+ return returnIndex ? index : true;
+ }
+ }
+
+ return returnIndex ? -1 : false;
+};
+
+/**
+ * @param {AnymatchMatcher} matchers
+ * @param {Array|string} testString
+ * @param {object} options
+ * @returns {boolean|number|Function}
+ */
+const anymatch = (matchers, testString, options = DEFAULT_OPTIONS) => {
+ if (matchers == null) {
+ throw new TypeError('anymatch: specify first argument');
+ }
+ const opts = typeof options === 'boolean' ? {returnIndex: options} : options;
+ const returnIndex = opts.returnIndex || false;
+
+ // Early cache for matchers.
+ const mtchers = arrify(matchers);
+ const negatedGlobs = mtchers
+ .filter(item => typeof item === 'string' && item.charAt(0) === BANG)
+ .map(item => item.slice(1))
+ .map(item => picomatch(item, opts));
+ const patterns = mtchers
+ .filter(item => typeof item !== 'string' || (typeof item === 'string' && item.charAt(0) !== BANG))
+ .map(matcher => createPattern(matcher, opts));
+
+ if (testString == null) {
+ return (testString, ri = false) => {
+ const returnIndex = typeof ri === 'boolean' ? ri : false;
+ return matchPatterns(patterns, negatedGlobs, testString, returnIndex);
+ }
+ }
+
+ return matchPatterns(patterns, negatedGlobs, testString, returnIndex);
+};
+
+anymatch.default = anymatch;
+module.exports = anymatch;
diff --git a/node_modules/anymatch/package.json b/node_modules/anymatch/package.json
new file mode 100644
index 0000000..2cb2307
--- /dev/null
+++ b/node_modules/anymatch/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "anymatch",
+ "version": "3.1.3",
+ "description": "Matches strings against configurable strings, globs, regular expressions, and/or functions",
+ "files": [
+ "index.js",
+ "index.d.ts"
+ ],
+ "dependencies": {
+ "normalize-path": "^3.0.0",
+ "picomatch": "^2.0.4"
+ },
+ "author": {
+ "name": "Elan Shanker",
+ "url": "https://github.com/es128"
+ },
+ "license": "ISC",
+ "homepage": "https://github.com/micromatch/anymatch",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/micromatch/anymatch"
+ },
+ "keywords": [
+ "match",
+ "any",
+ "string",
+ "file",
+ "fs",
+ "list",
+ "glob",
+ "regex",
+ "regexp",
+ "regular",
+ "expression",
+ "function"
+ ],
+ "scripts": {
+ "test": "nyc mocha",
+ "mocha": "mocha"
+ },
+ "devDependencies": {
+ "mocha": "^6.1.3",
+ "nyc": "^14.0.0"
+ },
+ "engines": {
+ "node": ">= 8"
+ }
+}
diff --git a/node_modules/array-flatten/LICENSE b/node_modules/array-flatten/LICENSE
new file mode 100644
index 0000000..983fbe8
--- /dev/null
+++ b/node_modules/array-flatten/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/array-flatten/README.md b/node_modules/array-flatten/README.md
new file mode 100644
index 0000000..91fa5b6
--- /dev/null
+++ b/node_modules/array-flatten/README.md
@@ -0,0 +1,43 @@
+# Array Flatten
+
+[![NPM version][npm-image]][npm-url]
+[![NPM downloads][downloads-image]][downloads-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+
+> Flatten an array of nested arrays into a single flat array. Accepts an optional depth.
+
+## Installation
+
+```
+npm install array-flatten --save
+```
+
+## Usage
+
+```javascript
+var flatten = require('array-flatten')
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9])
+//=> [1, 2, 3, 4, 5, 6, 7, 8, 9]
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2)
+//=> [1, 2, 3, [4, [5], 6], 7, 8, 9]
+
+(function () {
+ flatten(arguments) //=> [1, 2, 3]
+})(1, [2, 3])
+```
+
+## License
+
+MIT
+
+[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat
+[npm-url]: https://npmjs.org/package/array-flatten
+[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat
+[downloads-url]: https://npmjs.org/package/array-flatten
+[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat
+[travis-url]: https://travis-ci.org/blakeembrey/array-flatten
+[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master
diff --git a/node_modules/array-flatten/array-flatten.js b/node_modules/array-flatten/array-flatten.js
new file mode 100644
index 0000000..089117b
--- /dev/null
+++ b/node_modules/array-flatten/array-flatten.js
@@ -0,0 +1,64 @@
+'use strict'
+
+/**
+ * Expose `arrayFlatten`.
+ */
+module.exports = arrayFlatten
+
+/**
+ * Recursive flatten function with depth.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @param {Number} depth
+ * @return {Array}
+ */
+function flattenWithDepth (array, result, depth) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (depth > 0 && Array.isArray(value)) {
+ flattenWithDepth(value, result, depth - 1)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Recursive flatten function. Omitting depth is slightly faster.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @return {Array}
+ */
+function flattenForever (array, result) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (Array.isArray(value)) {
+ flattenForever(value, result)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Flatten an array, with the ability to define a depth.
+ *
+ * @param {Array} array
+ * @param {Number} depth
+ * @return {Array}
+ */
+function arrayFlatten (array, depth) {
+ if (depth == null) {
+ return flattenForever(array, [])
+ }
+
+ return flattenWithDepth(array, [], depth)
+}
diff --git a/node_modules/array-flatten/package.json b/node_modules/array-flatten/package.json
new file mode 100644
index 0000000..1a24e2a
--- /dev/null
+++ b/node_modules/array-flatten/package.json
@@ -0,0 +1,39 @@
+{
+ "name": "array-flatten",
+ "version": "1.1.1",
+ "description": "Flatten an array of nested arrays into a single flat array",
+ "main": "array-flatten.js",
+ "files": [
+ "array-flatten.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "istanbul cover _mocha -- -R spec"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/blakeembrey/array-flatten.git"
+ },
+ "keywords": [
+ "array",
+ "flatten",
+ "arguments",
+ "depth"
+ ],
+ "author": {
+ "name": "Blake Embrey",
+ "email": "hello@blakeembrey.com",
+ "url": "http://blakeembrey.me"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/blakeembrey/array-flatten/issues"
+ },
+ "homepage": "https://github.com/blakeembrey/array-flatten",
+ "devDependencies": {
+ "istanbul": "^0.3.13",
+ "mocha": "^2.2.4",
+ "pre-commit": "^1.0.7",
+ "standard": "^3.7.3"
+ }
+}
diff --git a/node_modules/aws-ssl-profiles/LICENSE b/node_modules/aws-ssl-profiles/LICENSE
new file mode 100644
index 0000000..95dc096
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2024 Andrey Sidorov, Douglas Wilson, Weslley Araújo and contributors.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/aws-ssl-profiles/README.md b/node_modules/aws-ssl-profiles/README.md
new file mode 100644
index 0000000..99acaad
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/README.md
@@ -0,0 +1,146 @@
+# AWS SSL Profiles
+
+[**AWS RDS**](https://aws.amazon.com/rds/) **SSL** Certificates Bundles.
+
+**Table of Contents**
+
+- [Installation](#installation)
+- [Usage](#usage)
+ - [**mysqljs/mysql**](#mysqljsmysql)
+ - [**MySQL2**](#mysql2)
+ - [**node-postgres**](#node-postgres)
+ - [Custom `ssl` options](#custom-ssl-options)
+- [License](#license)
+- [Security](#security)
+- [Contributing](#contributing)
+- [Acknowledgements](#acknowledgements)
+
+---
+
+## Installation
+
+```bash
+npm install --save aws-ssl-profiles
+```
+
+---
+
+## Usage
+
+### [mysqljs/mysql](https://github.com/mysqljs/mysql)
+
+```js
+const mysql = require('mysql');
+const awsCaBundle = require('aws-ssl-profiles');
+
+// mysql connection
+const connection = mysql.createConnection({
+ //...
+ ssl: awsCaBundle,
+});
+
+// mysql connection pool
+const pool = mysql.createPool({
+ //...
+ ssl: awsCaBundle,
+});
+```
+
+### [MySQL2](https://github.com/sidorares/node-mysql2)
+
+```js
+const mysql = require('mysql2');
+const awsCaBundle = require('aws-ssl-profiles');
+
+// mysql2 connection
+const connection = mysql.createConnection({
+ //...
+ ssl: awsCaBundle,
+});
+
+// mysql2 connection pool
+const pool = mysql.createPool({
+ //...
+ ssl: awsCaBundle,
+});
+```
+
+### [node-postgres](https://github.com/brianc/node-postgres)
+
+```js
+const pg = require('pg');
+const awsCaBundle = require('aws-ssl-profiles');
+
+// pg connection
+const client = new pg.Client({
+ // ...
+ ssl: awsCaBundle,
+});
+
+// pg connection pool
+const pool = new pg.Pool({
+ // ...
+ ssl: awsCaBundle,
+});
+```
+
+### Custom `ssl` options
+
+Using **AWS SSL Profiles** with custom `ssl` options:
+
+```js
+{
+ // ...
+ ssl: {
+ ...awsCaBundle,
+ rejectUnauthorized: true,
+ // ...
+ }
+}
+```
+
+```js
+{
+ // ...
+ ssl: {
+ ca: awsCaBundle.ca,
+ rejectUnauthorized: true,
+ // ...
+ }
+}
+```
+
+### Custom bundles
+
+```js
+const { proxyBundle } = require('aws-ssl-profiles');
+
+{
+ // ...
+ ssl: proxyBundle,
+}
+```
+
+---
+
+## License
+
+**AWS SSL Profiles** is under the [**MIT License**](./LICENSE).
+
+---
+
+## Security
+
+Please check the [**SECURITY.md**](./SECURITY.md).
+
+---
+
+## Contributing
+
+Please check the [**CONTRIBUTING.md**](./CONTRIBUTING.md) for instructions.
+
+---
+
+## Acknowledgements
+
+[**Contributors**](https://github.com/mysqljs/aws-ssl-profiles/graphs/contributors).
diff --git a/node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts b/node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts
new file mode 100644
index 0000000..a02c121
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts
@@ -0,0 +1,4 @@
+export type CA = string[];
+export type Profiles = {
+ ca: CA;
+};
diff --git a/node_modules/aws-ssl-profiles/lib/@types/profiles.js b/node_modules/aws-ssl-profiles/lib/@types/profiles.js
new file mode 100644
index 0000000..c8ad2e5
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/@types/profiles.js
@@ -0,0 +1,2 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
diff --git a/node_modules/aws-ssl-profiles/lib/index.d.ts b/node_modules/aws-ssl-profiles/lib/index.d.ts
new file mode 100644
index 0000000..18d181b
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/index.d.ts
@@ -0,0 +1,8 @@
+import type { Profiles } from "./@types/profiles.js";
+export declare const proxyBundle: Profiles;
+declare const profiles: Profiles;
+declare module "aws-ssl-profiles" {
+ const profiles: Profiles & { proxyBundle: Profiles };
+ export = profiles;
+}
+export default profiles;
diff --git a/node_modules/aws-ssl-profiles/lib/index.js b/node_modules/aws-ssl-profiles/lib/index.js
new file mode 100644
index 0000000..d702ca7
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/index.js
@@ -0,0 +1,13 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+const defaults_js_1 = require("./profiles/ca/defaults.js");
+const proxies_js_1 = require("./profiles/ca/proxies.js");
+const proxyBundle = {
+ ca: proxies_js_1.proxies,
+};
+const profiles = {
+ ca: [...defaults_js_1.defaults, ...proxies_js_1.proxies],
+};
+module.exports = profiles;
+module.exports.proxyBundle = proxyBundle;
+module.exports.default = profiles;
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts
new file mode 100644
index 0000000..347c7b5
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts
@@ -0,0 +1,9 @@
+import type { CA } from '../../@types/profiles.js';
+/**
+ * CA Certificates for **Amazon RDS** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/UsingWithRDS.SSL.html
+ * - https://docs.amazonaws.cn/en_us/AmazonRDS/latest/AuroraUserGuide/UsingWithRDS.SSL.html
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/AuroraUserGuide/aurora-serverless.html#aurora-serverless.tls
+ */
+export declare const defaults: CA;
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js
new file mode 100644
index 0000000..343c8a0
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js
@@ -0,0 +1,2888 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.defaults = void 0;
+/**
+ * CA Certificates for **Amazon RDS** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/UsingWithRDS.SSL.html
+ * - https://docs.amazonaws.cn/en_us/AmazonRDS/latest/AuroraUserGuide/UsingWithRDS.SSL.html
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/AuroraUserGuide/aurora-serverless.html#aurora-serverless.tls
+ */
+exports.defaults = [
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEjCCAvqgAwIBAgIJAM2ZN/+nPi27MA0GCSqGSIb3DQEBCwUAMIGVMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEmMCQGA1UEAwwdQW1hem9uIFJEUyBhZi1zb3V0aC0xIFJvb3QgQ0Ew\n' +
+ 'HhcNMTkxMDI4MTgwNTU4WhcNMjQxMDI2MTgwNTU4WjCBlTELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoM\n' +
+ 'GUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMx\n' +
+ 'JjAkBgNVBAMMHUFtYXpvbiBSRFMgYWYtc291dGgtMSBSb290IENBMIIBIjANBgkq\n' +
+ 'hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAwR2351uPMZaJk2gMGT+1sk8HE9MQh2rc\n' +
+ '/sCnbxGn2p1c7Oi9aBbd/GiFijeJb2BXvHU+TOq3d3Jjqepq8tapXVt4ojbTJNyC\n' +
+ 'J5E7r7KjTktKdLxtBE1MK25aY+IRJjtdU6vG3KiPKUT1naO3xs3yt0F76WVuFivd\n' +
+ '9OHv2a+KHvPkRUWIxpmAHuMY9SIIMmEZtVE7YZGx5ah0iO4JzItHcbVR0y0PBH55\n' +
+ 'arpFBddpIVHCacp1FUPxSEWkOpI7q0AaU4xfX0fe1BV5HZYRKpBOIp1TtZWvJD+X\n' +
+ 'jGUtL1BEsT5vN5g9MkqdtYrC+3SNpAk4VtpvJrdjraI/hhvfeXNnAwIDAQABo2Mw\n' +
+ 'YTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUEEi/\n' +
+ 'WWMcBJsoGXg+EZwkQ0MscZQwHwYDVR0jBBgwFoAUEEi/WWMcBJsoGXg+EZwkQ0Ms\n' +
+ 'cZQwDQYJKoZIhvcNAQELBQADggEBAGDZ5js5Pc/gC58LJrwMPXFhJDBS8QuDm23C\n' +
+ 'FFUdlqucskwOS3907ErK1ZkmVJCIqFLArHqskFXMAkRZ2PNR7RjWLqBs+0znG5yH\n' +
+ 'hRKb4DXzhUFQ18UBRcvT6V6zN97HTRsEEaNhM/7k8YLe7P8vfNZ28VIoJIGGgv9D\n' +
+ 'wQBBvkxQ71oOmAG0AwaGD0ORGUfbYry9Dz4a4IcUsZyRWRMADixgrFv6VuETp26s\n' +
+ '/+z+iqNaGWlELBKh3iQCT6Y/1UnkPLO42bxrCSyOvshdkYN58Q2gMTE1SVTqyo8G\n' +
+ 'Lw8lLAz9bnvUSgHzB3jRrSx6ggF/WRMRYlR++y6LXP4SAsSAaC0=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEjCCAvqgAwIBAgIJAJYM4LxvTZA6MA0GCSqGSIb3DQEBCwUAMIGVMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEmMCQGA1UEAwwdQW1hem9uIFJEUyBldS1zb3V0aC0xIFJvb3QgQ0Ew\n' +
+ 'HhcNMTkxMDMwMjAyMDM2WhcNMjQxMDI4MjAyMDM2WjCBlTELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoM\n' +
+ 'GUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMx\n' +
+ 'JjAkBgNVBAMMHUFtYXpvbiBSRFMgZXUtc291dGgtMSBSb290IENBMIIBIjANBgkq\n' +
+ 'hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAqM921jXCXeqpRNCS9CBPOe5N7gMaEt+D\n' +
+ 's5uR3riZbqzRlHGiF1jZihkXfHAIQewDwy+Yz+Oec1aEZCQMhUHxZJPusuX0cJfj\n' +
+ 'b+UluFqHIijL2TfXJ3D0PVLLoNTQJZ8+GAPECyojAaNuoHbdVqxhOcznMsXIXVFq\n' +
+ 'yVLKDGvyKkJjai/iSPDrQMXufg3kWt0ISjNLvsG5IFXgP4gttsM8i0yvRd4QcHoo\n' +
+ 'DjvH7V3cS+CQqW5SnDrGnHToB0RLskE1ET+oNOfeN9PWOxQprMOX/zmJhnJQlTqD\n' +
+ 'QP7jcf7SddxrKFjuziFiouskJJyNDsMjt1Lf60+oHZhed2ogTeifGwIDAQABo2Mw\n' +
+ 'YTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUFBAF\n' +
+ 'cgJe/BBuZiGeZ8STfpkgRYQwHwYDVR0jBBgwFoAUFBAFcgJe/BBuZiGeZ8STfpkg\n' +
+ 'RYQwDQYJKoZIhvcNAQELBQADggEBAKAYUtlvDuX2UpZW9i1QgsjFuy/ErbW0dLHU\n' +
+ 'e/IcFtju2z6RLZ+uF+5A8Kme7IKG1hgt8s+w9TRVQS/7ukQzoK3TaN6XKXRosjtc\n' +
+ 'o9Rm4gYWM8bmglzY1TPNaiI4HC7546hSwJhubjN0bXCuj/0sHD6w2DkiGuwKNAef\n' +
+ 'yTu5vZhPkeNyXLykxkzz7bNp2/PtMBnzIp+WpS7uUDmWyScGPohKMq5PqvL59z+L\n' +
+ 'ZI3CYeMZrJ5VpXUg3fNNIz/83N3G0sk7wr0ohs/kHTP7xPOYB0zD7Ku4HA0Q9Swf\n' +
+ 'WX0qr6UQgTPMjfYDLffI7aEId0gxKw1eGYc6Cq5JAZ3ipi/cBFc=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEjCCAvqgAwIBAgIJANew34ehz5l8MA0GCSqGSIb3DQEBCwUAMIGVMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEmMCQGA1UEAwwdQW1hem9uIFJEUyBtZS1zb3V0aC0xIFJvb3QgQ0Ew\n' +
+ 'HhcNMTkwNTEwMjE0ODI3WhcNMjQwNTA4MjE0ODI3WjCBlTELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoM\n' +
+ 'GUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMx\n' +
+ 'JjAkBgNVBAMMHUFtYXpvbiBSRFMgbWUtc291dGgtMSBSb290IENBMIIBIjANBgkq\n' +
+ 'hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAp7BYV88MukcY+rq0r79+C8UzkT30fEfT\n' +
+ 'aPXbx1d6M7uheGN4FMaoYmL+JE1NZPaMRIPTHhFtLSdPccInvenRDIatcXX+jgOk\n' +
+ 'UA6lnHQ98pwN0pfDUyz/Vph4jBR9LcVkBbe0zdoKKp+HGbMPRU0N2yNrog9gM5O8\n' +
+ 'gkU/3O2csJ/OFQNnj4c2NQloGMUpEmedwJMOyQQfcUyt9CvZDfIPNnheUS29jGSw\n' +
+ 'ERpJe/AENu8Pxyc72jaXQuD+FEi2Ck6lBkSlWYQFhTottAeGvVFNCzKszCntrtqd\n' +
+ 'rdYUwurYsLTXDHv9nW2hfDUQa0mhXf9gNDOBIVAZugR9NqNRNyYLHQIDAQABo2Mw\n' +
+ 'YTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU54cf\n' +
+ 'DjgwBx4ycBH8+/r8WXdaiqYwHwYDVR0jBBgwFoAU54cfDjgwBx4ycBH8+/r8WXda\n' +
+ 'iqYwDQYJKoZIhvcNAQELBQADggEBAIIMTSPx/dR7jlcxggr+O6OyY49Rlap2laKA\n' +
+ 'eC/XI4ySP3vQkIFlP822U9Kh8a9s46eR0uiwV4AGLabcu0iKYfXjPkIprVCqeXV7\n' +
+ 'ny9oDtrbflyj7NcGdZLvuzSwgl9SYTJp7PVCZtZutsPYlbJrBPHwFABvAkMvRtDB\n' +
+ 'hitIg4AESDGPoCl94sYHpfDfjpUDMSrAMDUyO6DyBdZH5ryRMAs3lGtsmkkNUrso\n' +
+ 'aTW6R05681Z0mvkRdb+cdXtKOSuDZPoe2wJJIaz3IlNQNSrB5TImMYgmt6iAsFhv\n' +
+ '3vfTSTKrZDNTJn4ybG6pq1zWExoXsktZPylJly6R3RBwV6nwqBM=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBjCCAu6gAwIBAgIJAMc0ZzaSUK51MA0GCSqGSIb3DQEBCwUAMIGPMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEgMB4GA1UEAwwXQW1hem9uIFJEUyBSb290IDIwMTkgQ0EwHhcNMTkw\n' +
+ 'ODIyMTcwODUwWhcNMjQwODIyMTcwODUwWjCBjzELMAkGA1UEBhMCVVMxEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoMGUFtYXpv\n' +
+ 'biBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxIDAeBgNV\n' +
+ 'BAMMF0FtYXpvbiBSRFMgUm9vdCAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEArXnF/E6/Qh+ku3hQTSKPMhQQlCpoWvnIthzX6MK3p5a0eXKZ\n' +
+ 'oWIjYcNNG6UwJjp4fUXl6glp53Jobn+tWNX88dNH2n8DVbppSwScVE2LpuL+94vY\n' +
+ '0EYE/XxN7svKea8YvlrqkUBKyxLxTjh+U/KrGOaHxz9v0l6ZNlDbuaZw3qIWdD/I\n' +
+ '6aNbGeRUVtpM6P+bWIoxVl/caQylQS6CEYUk+CpVyJSkopwJlzXT07tMoDL5WgX9\n' +
+ 'O08KVgDNz9qP/IGtAcRduRcNioH3E9v981QO1zt/Gpb2f8NqAjUUCUZzOnij6mx9\n' +
+ 'McZ+9cWX88CRzR0vQODWuZscgI08NvM69Fn2SQIDAQABo2MwYTAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUc19g2LzLA5j0Kxc0LjZa\n' +
+ 'pmD/vB8wHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJKoZIhvcN\n' +
+ 'AQELBQADggEBAHAG7WTmyjzPRIM85rVj+fWHsLIvqpw6DObIjMWokpliCeMINZFV\n' +
+ 'ynfgBKsf1ExwbvJNzYFXW6dihnguDG9VMPpi2up/ctQTN8tm9nDKOy08uNZoofMc\n' +
+ 'NUZxKCEkVKZv+IL4oHoeayt8egtv3ujJM6V14AstMQ6SwvwvA93EP/Ug2e4WAXHu\n' +
+ 'cbI1NAbUgVDqp+DRdfvZkgYKryjTWd/0+1fS8X1bBZVWzl7eirNVnHbSH2ZDpNuY\n' +
+ '0SBd8dj5F6ld3t58ydZbrTHze7JJOd8ijySAp4/kiu9UfZWuTPABzDa/DSdz9Dk/\n' +
+ 'zPW4CXXvhLmE02TA9/HeCw3KEHIwicNuEfw=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEDCCAvigAwIBAgIJAKFMXyltvuRdMA0GCSqGSIb3DQEBCwUAMIGUMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzElMCMGA1UEAwwcQW1hem9uIFJEUyBCZXRhIFJvb3QgMjAxOSBDQTAe\n' +
+ 'Fw0xOTA4MTkxNzM4MjZaFw0yNDA4MTkxNzM4MjZaMIGUMQswCQYDVQQGEwJVUzEQ\n' +
+ 'MA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UECgwZ\n' +
+ 'QW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEl\n' +
+ 'MCMGA1UEAwwcQW1hem9uIFJEUyBCZXRhIFJvb3QgMjAxOSBDQTCCASIwDQYJKoZI\n' +
+ 'hvcNAQEBBQADggEPADCCAQoCggEBAMkZdnIH9ndatGAcFo+DppGJ1HUt4x+zeO+0\n' +
+ 'ZZ29m0sfGetVulmTlv2d5b66e+QXZFWpcPQMouSxxYTW08TbrQiZngKr40JNXftA\n' +
+ 'atvzBqIImD4II0ZX5UEVj2h98qe/ypW5xaDN7fEa5e8FkYB1TEemPaWIbNXqchcL\n' +
+ 'tV7IJPr3Cd7Z5gZJlmujIVDPpMuSiNaal9/6nT9oqN+JSM1fx5SzrU5ssg1Vp1vv\n' +
+ '5Xab64uOg7wCJRB9R2GC9XD04odX6VcxUAGrZo6LR64ZSifupo3l+R5sVOc5i8NH\n' +
+ 'skdboTzU9H7+oSdqoAyhIU717PcqeDum23DYlPE2nGBWckE+eT8CAwEAAaNjMGEw\n' +
+ 'DgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFK2hDBWl\n' +
+ 'sbHzt/EHd0QYOooqcFPhMB8GA1UdIwQYMBaAFK2hDBWlsbHzt/EHd0QYOooqcFPh\n' +
+ 'MA0GCSqGSIb3DQEBCwUAA4IBAQAO/718k8EnOqJDx6wweUscGTGL/QdKXUzTVRAx\n' +
+ 'JUsjNUv49mH2HQVEW7oxszfH6cPCaupNAddMhQc4C/af6GHX8HnqfPDk27/yBQI+\n' +
+ 'yBBvIanGgxv9c9wBbmcIaCEWJcsLp3HzXSYHmjiqkViXwCpYfkoV3Ns2m8bp+KCO\n' +
+ 'y9XmcCKRaXkt237qmoxoh2sGmBHk2UlQtOsMC0aUQ4d7teAJG0q6pbyZEiPyKZY1\n' +
+ 'XR/UVxMJL0Q4iVpcRS1kaNCMfqS2smbLJeNdsan8pkw1dvPhcaVTb7CvjhJtjztF\n' +
+ 'YfDzAI5794qMlWxwilKMmUvDlPPOTen8NNHkLwWvyFCH7Doh\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEFjCCAv6gAwIBAgIJAMzYZJ+R9NBVMA0GCSqGSIb3DQEBCwUAMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEoMCYGA1UEAwwfQW1hem9uIFJEUyBQcmV2aWV3IFJvb3QgMjAxOSBD\n' +
+ 'QTAeFw0xOTA4MjEyMjI5NDlaFw0yNDA4MjEyMjI5NDlaMIGXMQswCQYDVQQGEwJV\n' +
+ 'UzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UE\n' +
+ 'CgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJE\n' +
+ 'UzEoMCYGA1UEAwwfQW1hem9uIFJEUyBQcmV2aWV3IFJvb3QgMjAxOSBDQTCCASIw\n' +
+ 'DQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAM7kkS6vjgKKQTPynC2NjdN5aPPV\n' +
+ 'O71G0JJS/2ARVBVJd93JLiGovVJilfWYfwZCs4gTRSSjrUD4D4HyqCd6A+eEEtJq\n' +
+ 'M0DEC7i0dC+9WNTsPszuB206Jy2IUmxZMIKJAA1NHSbIMjB+b6/JhbSUi7nKdbR/\n' +
+ 'brj83bF+RoSA+ogrgX7mQbxhmFcoZN9OGaJgYKsKWUt5Wqv627KkGodUK8mDepgD\n' +
+ 'S3ZfoRQRx3iceETpcmHJvaIge6+vyDX3d9Z22jmvQ4AKv3py2CmU2UwuhOltFDwB\n' +
+ '0ddtb39vgwrJxaGfiMRHpEP1DfNLWHAnA69/pgZPwIggidS+iBPUhgucMp8CAwEA\n' +
+ 'AaNjMGEwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE\n' +
+ 'FGnTGpQuQ2H/DZlXMQijZEhjs7TdMB8GA1UdIwQYMBaAFGnTGpQuQ2H/DZlXMQij\n' +
+ 'ZEhjs7TdMA0GCSqGSIb3DQEBCwUAA4IBAQC3xz1vQvcXAfpcZlngiRWeqU8zQAMQ\n' +
+ 'LZPCFNv7PVk4pmqX+ZiIRo4f9Zy7TrOVcboCnqmP/b/mNq0gVF4O+88jwXJZD+f8\n' +
+ '/RnABMZcnGU+vK0YmxsAtYU6TIb1uhRFmbF8K80HHbj9vSjBGIQdPCbvmR2zY6VJ\n' +
+ 'BYM+w9U9hp6H4DVMLKXPc1bFlKA5OBTgUtgkDibWJKFOEPW3UOYwp9uq6pFoN0AO\n' +
+ 'xMTldqWFsOF3bJIlvOY0c/1EFZXu3Ns6/oCP//Ap9vumldYMUZWmbK+gK33FPOXV\n' +
+ '8BQ6jNC29icv7lLDpRPwjibJBXX+peDR5UK4FdYcswWEB1Tix5X8dYu6\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZUxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSYwJAYDVQQDDB1BbWF6b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQTAeFw0xOTEw\n' +
+ 'MjgxODA2NTNaFw0yNDEwMjgxODA2NTNaMIGQMQswCQYDVQQGEwJVUzETMBEGA1UE\n' +
+ 'CAwKV2FzaGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9u\n' +
+ 'IFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEhMB8GA1UE\n' +
+ 'AwwYQW1hem9uIFJEUyBhZi1zb3V0aC0xIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEAvtV1OqmFa8zCVQSKOvPUJERLVFtd4rZmDpImc5rIoeBk7w/P\n' +
+ '9lcKUJjO8R/w1a2lJXx3oQ81tiY0Piw6TpT62YWVRMWrOw8+Vxq1dNaDSFp9I8d0\n' +
+ 'UHillSSbOk6FOrPDp+R6AwbGFqUDebbN5LFFoDKbhNmH1BVS0a6YNKpGigLRqhka\n' +
+ 'cClPslWtPqtjbaP3Jbxl26zWzLo7OtZl98dR225pq8aApNBwmtgA7Gh60HK/cX0t\n' +
+ '32W94n8D+GKSg6R4MKredVFqRTi9hCCNUu0sxYPoELuM+mHiqB5NPjtm92EzCWs+\n' +
+ '+vgWhMc6GxG+82QSWx1Vj8sgLqtE/vLrWddf5QIDAQABo2YwZDAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUuLB4gYVJrSKJj/Gz\n' +
+ 'pqc6yeA+RcAwHwYDVR0jBBgwFoAUEEi/WWMcBJsoGXg+EZwkQ0MscZQwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBABauYOZxUhe9/RhzGJ8MsWCz8eKcyDVd4FCnY6Qh+9wcmYNT\n' +
+ 'LtnD88LACtJKb/b81qYzcB0Em6+zVJ3Z9jznfr6buItE6es9wAoja22Xgv44BTHL\n' +
+ 'rimbgMwpTt3uEMXDffaS0Ww6YWb3pSE0XYI2ISMWz+xRERRf+QqktSaL39zuiaW5\n' +
+ 'tfZMre+YhohRa/F0ZQl3RCd6yFcLx4UoSPqQsUl97WhYzwAxZZfwvLJXOc4ATt3u\n' +
+ 'VlCUylNDkaZztDJc/yN5XQoK9W5nOt2cLu513MGYKbuarQr8f+gYU8S+qOyuSRSP\n' +
+ 'NRITzwCRVnsJE+2JmcRInn/NcanB7uOGqTvJ9+c=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZUxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSYwJAYDVQQDDB1BbWF6b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQTAeFw0xOTEw\n' +
+ 'MzAyMDIxMzBaFw0yNDEwMzAyMDIxMzBaMIGQMQswCQYDVQQGEwJVUzETMBEGA1UE\n' +
+ 'CAwKV2FzaGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9u\n' +
+ 'IFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEhMB8GA1UE\n' +
+ 'AwwYQW1hem9uIFJEUyBldS1zb3V0aC0xIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEAtEyjYcajx6xImJn8Vz1zjdmL4ANPgQXwF7+tF7xccmNAZETb\n' +
+ 'bzb3I9i5fZlmrRaVznX+9biXVaGxYzIUIR3huQ3Q283KsDYnVuGa3mk690vhvJbB\n' +
+ 'QIPgKa5mVwJppnuJm78KqaSpi0vxyCPe3h8h6LLFawVyWrYNZ4okli1/U582eef8\n' +
+ 'RzJp/Ear3KgHOLIiCdPDF0rjOdCG1MOlDLixVnPn9IYOciqO+VivXBg+jtfc5J+L\n' +
+ 'AaPm0/Yx4uELt1tkbWkm4BvTU/gBOODnYziITZM0l6Fgwvbwgq5duAtKW+h031lC\n' +
+ '37rEvrclqcp4wrsUYcLAWX79ZyKIlRxcAdvEhQIDAQABo2YwZDAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQU7zPyc0azQxnBCe7D\n' +
+ 'b9KAadH1QSEwHwYDVR0jBBgwFoAUFBAFcgJe/BBuZiGeZ8STfpkgRYQwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAFGaNiYxg7yC/xauXPlaqLCtwbm2dKyK9nIFbF/7be8mk7Q3\n' +
+ 'MOA0of1vGHPLVQLr6bJJpD9MAbUcm4cPAwWaxwcNpxOjYOFDaq10PCK4eRAxZWwF\n' +
+ 'NJRIRmGsl8NEsMNTMCy8X+Kyw5EzH4vWFl5Uf2bGKOeFg0zt43jWQVOX6C+aL3Cd\n' +
+ 'pRS5MhmYpxMG8irrNOxf4NVFE2zpJOCm3bn0STLhkDcV/ww4zMzObTJhiIb5wSWn\n' +
+ 'EXKKWhUXuRt7A2y1KJtXpTbSRHQxE++69Go1tWhXtRiULCJtf7wF2Ksm0RR/AdXT\n' +
+ '1uR1vKyH5KBJPX3ppYkQDukoHTFR0CpB+G84NLo=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZUxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSYwJAYDVQQDDB1BbWF6b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQTAeFw0xOTA1\n' +
+ 'MTAyMTU4NDNaFw0yNTA2MDExMjAwMDBaMIGQMQswCQYDVQQGEwJVUzETMBEGA1UE\n' +
+ 'CAwKV2FzaGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9u\n' +
+ 'IFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEhMB8GA1UE\n' +
+ 'AwwYQW1hem9uIFJEUyBtZS1zb3V0aC0xIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEAudOYPZH+ihJAo6hNYMB5izPVBe3TYhnZm8+X3IoaaYiKtsp1\n' +
+ 'JJhkTT0CEejYIQ58Fh4QrMUyWvU8qsdK3diNyQRoYLbctsBPgxBR1u07eUJDv38/\n' +
+ 'C1JlqgHmMnMi4y68Iy7ymv50QgAMuaBqgEBRI1R6Lfbyrb2YvH5txjJyTVMwuCfd\n' +
+ 'YPAtZVouRz0JxmnfsHyxjE+So56uOKTDuw++Ho4HhZ7Qveej7XB8b+PIPuroknd3\n' +
+ 'FQB5RVbXRvt5ZcVD4F2fbEdBniF7FAF4dEiofVCQGQ2nynT7dZdEIPfPdH3n7ZmE\n' +
+ 'lAOmwHQ6G83OsiHRBLnbp+QZRgOsjkHJxT20bQIDAQABo2YwZDAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUOEVDM7VomRH4HVdA\n' +
+ 'QvIMNq2tXOcwHwYDVR0jBBgwFoAU54cfDjgwBx4ycBH8+/r8WXdaiqYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAHhvMssj+Th8IpNePU6RH0BiL6o9c437R3Q4IEJeFdYL+nZz\n' +
+ 'PW/rELDPvLRUNMfKM+KzduLZ+l29HahxefejYPXtvXBlq/E/9czFDD4fWXg+zVou\n' +
+ 'uDXhyrV4kNmP4S0eqsAP/jQHPOZAMFA4yVwO9hlqmePhyDnszCh9c1PfJSBh49+b\n' +
+ '4w7i/L3VBOMt8j3EKYvqz0gVfpeqhJwL4Hey8UbVfJRFJMJzfNHpePqtDRAY7yjV\n' +
+ 'PYquRaV2ab/E+/7VFkWMM4tazYz/qsYA2jSH+4xDHvYk8LnsbcrF9iuidQmEc5sb\n' +
+ 'FgcWaSKG4DJjcI5k7AJLWcXyTDt21Ci43LE+I9Q=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgICVIYwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MDQxNzEz\n' +
+ 'MDRaFw0yNDA4MjIxNzA4NTBaMIGVMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEmMCQGA1UEAwwdQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQDUYOz1hGL42yUCrcsMSOoU8AeD/3KgZ4q7gP+vAz1WnY9K/kim\n' +
+ 'eWN/2Qqzlo3+mxSFQFyD4MyV3+CnCPnBl9Sh1G/F6kThNiJ7dEWSWBQGAB6HMDbC\n' +
+ 'BaAsmUc1UIz8sLTL3fO+S9wYhA63Wun0Fbm/Rn2yk/4WnJAaMZcEtYf6e0KNa0LM\n' +
+ 'p/kN/70/8cD3iz3dDR8zOZFpHoCtf0ek80QqTich0A9n3JLxR6g6tpwoYviVg89e\n' +
+ 'qCjQ4axxOkWWeusLeTJCcY6CkVyFvDAKvcUl1ytM5AiaUkXblE7zDFXRM4qMMRdt\n' +
+ 'lPm8d3pFxh0fRYk8bIKnpmtOpz3RIctDrZZxAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBT99wKJftD3jb4sHoHG\n' +
+ 'i3uGlH6W6TAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAZ17hhr3dII3hUfuHQ1hPWGrpJOX/G9dLzkprEIcCidkmRYl+\n' +
+ 'hu1Pe3caRMh/17+qsoEErmnVq5jNY9X1GZL04IZH8YbHc7iRHw3HcWAdhN8633+K\n' +
+ 'jYEB2LbJ3vluCGnCejq9djDb6alOugdLMJzxOkHDhMZ6/gYbECOot+ph1tQuZXzD\n' +
+ 'tZ7prRsrcuPBChHlPjmGy8M9z8u+kF196iNSUGC4lM8vLkHM7ycc1/ZOwRq9aaTe\n' +
+ 'iOghbQQyAEe03MWCyDGtSmDfr0qEk+CHN+6hPiaL8qKt4s+V9P7DeK4iW08ny8Ox\n' +
+ 'AVS7u0OK/5+jKMAMrKwpYrBydOjTUTHScocyNw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICQ2QwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MDUxODQ2\n' +
+ 'MjlaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBzYS1lYXN0LTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAMMvR+ReRnOzqJzoaPipNTt1Z2VA968jlN1+SYKUrYM3No+Vpz0H\n' +
+ 'M6Tn0oYB66ByVsXiGc28ulsqX1HbHsxqDPwvQTKvO7SrmDokoAkjJgLocOLUAeld\n' +
+ '5AwvUjxGRP6yY90NV7X786MpnYb2Il9DIIaV9HjCmPt+rjy2CZjS0UjPjCKNfB8J\n' +
+ 'bFjgW6GGscjeyGb/zFwcom5p4j0rLydbNaOr9wOyQrtt3ZQWLYGY9Zees/b8pmcc\n' +
+ 'Jt+7jstZ2UMV32OO/kIsJ4rMUn2r/uxccPwAc1IDeRSSxOrnFKhW3Cu69iB3bHp7\n' +
+ 'JbawY12g7zshE4I14sHjv3QoXASoXjx4xgMCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFI1Fc/Ql2jx+oJPgBVYq\n' +
+ 'ccgP0pQ8MB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQB4VVVabVp70myuYuZ3vltQIWqSUMhkaTzehMgGcHjMf9iLoZ/I\n' +
+ '93KiFUSGnek5cRePyS9wcpp0fcBT3FvkjpUdCjVtdttJgZFhBxgTd8y26ImdDDMR\n' +
+ '4+BUuhI5msvjL08f+Vkkpu1GQcGmyFVPFOy/UY8iefu+QyUuiBUnUuEDd49Hw0Fn\n' +
+ '/kIPII6Vj82a2mWV/Q8e+rgN8dIRksRjKI03DEoP8lhPlsOkhdwU6Uz9Vu6NOB2Q\n' +
+ 'Ls1kbcxAc7cFSyRVJEhh12Sz9d0q/CQSTFsVJKOjSNQBQfVnLz1GwO/IieUEAr4C\n' +
+ 'jkTntH0r1LX5b/GwN4R887LvjAEdTbg1his7\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgIDAIkHMA0GCSqGSIb3DQEBCwUAMIGPMQswCQYDVQQGEwJV\n' +
+ 'UzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UE\n' +
+ 'CgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJE\n' +
+ 'UzEgMB4GA1UEAwwXQW1hem9uIFJEUyBSb290IDIwMTkgQ0EwHhcNMTkwOTA2MTc0\n' +
+ 'MDIxWhcNMjQwODIyMTcwODUwWjCBlDELMAkGA1UEBhMCVVMxEzARBgNVBAgMCldh\n' +
+ 'c2hpbmd0b24xEDAOBgNVBAcMB1NlYXR0bGUxIjAgBgNVBAoMGUFtYXpvbiBXZWIg\n' +
+ 'U2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxJTAjBgNVBAMMHEFt\n' +
+ 'YXpvbiBSRFMgdXMtd2VzdC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQDD2yzbbAl77OofTghDMEf624OvU0eS9O+lsdO0QlbfUfWa1Kd6\n' +
+ '0WkgjkLZGfSRxEHMCnrv4UPBSK/Qwn6FTjkDLgemhqBtAnplN4VsoDL+BkRX4Wwq\n' +
+ '/dSQJE2b+0hm9w9UMVGFDEq1TMotGGTD2B71eh9HEKzKhGzqiNeGsiX4VV+LJzdH\n' +
+ 'uM23eGisNqmd4iJV0zcAZ+Gbh2zK6fqTOCvXtm7Idccv8vZZnyk1FiWl3NR4WAgK\n' +
+ 'AkvWTIoFU3Mt7dIXKKClVmvssG8WHCkd3Xcb4FHy/G756UZcq67gMMTX/9fOFM/v\n' +
+ 'l5C0+CHl33Yig1vIDZd+fXV1KZD84dEJfEvHAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBR+ap20kO/6A7pPxo3+\n' +
+ 'T3CfqZpQWjAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAHCJky2tPjPttlDM/RIqExupBkNrnSYnOK4kr9xJ3sl8UF2DA\n' +
+ 'PAnYsjXp3rfcjN/k/FVOhxwzi3cXJF/2Tjj39Bm/OEfYTOJDNYtBwB0VVH4ffa/6\n' +
+ 'tZl87jaIkrxJcreeeHqYMnIxeN0b/kliyA+a5L2Yb0VPjt9INq34QDc1v74FNZ17\n' +
+ '4z8nr1nzg4xsOWu0Dbjo966lm4nOYIGBRGOKEkHZRZ4mEiMgr3YLkv8gSmeitx57\n' +
+ 'Z6dVemNtUic/LVo5Iqw4n3TBS0iF2C1Q1xT/s3h+0SXZlfOWttzSluDvoMv5PvCd\n' +
+ 'pFjNn+aXLAALoihL1MJSsxydtsLjOBro5eK0Vw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICOFAwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTAxNzQ2\n' +
+ 'MjFaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMiAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAzU72e6XbaJbi4HjJoRNjKxzUEuChKQIt7k3CWzNnmjc5\n' +
+ '8I1MjCpa2W1iw1BYVysXSNSsLOtUsfvBZxi/1uyMn5ZCaf9aeoA9UsSkFSZBjOCN\n' +
+ 'DpKPCmfV1zcEOvJz26+1m8WDg+8Oa60QV0ou2AU1tYcw98fOQjcAES0JXXB80P2s\n' +
+ '3UfkNcnDz+l4k7j4SllhFPhH6BQ4lD2NiFAP4HwoG6FeJUn45EPjzrydxjq6v5Fc\n' +
+ 'cQ8rGuHADVXotDbEhaYhNjIrsPL+puhjWfhJjheEw8c4whRZNp6gJ/b6WEes/ZhZ\n' +
+ 'h32DwsDsZw0BfRDUMgUn8TdecNexHUw8vQWeC181hwIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUwW9bWgkWkr0U\n' +
+ 'lrOsq2kvIdrECDgwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAEugF0Gj7HVhX0ehPZoGRYRt3PBuI2YjfrrJRTZ9X5wc\n' +
+ '9T8oHmw07mHmNy1qqWvooNJg09bDGfB0k5goC2emDiIiGfc/kvMLI7u+eQOoMKj6\n' +
+ 'mkfCncyRN3ty08Po45vTLBFZGUvtQmjM6yKewc4sXiASSBmQUpsMbiHRCL72M5qV\n' +
+ 'obcJOjGcIdDTmV1BHdWT+XcjynsGjUqOvQWWhhLPrn4jWe6Xuxll75qlrpn3IrIx\n' +
+ 'CRBv/5r7qbcQJPOgwQsyK4kv9Ly8g7YT1/vYBlR3cRsYQjccw5ceWUj2DrMVWhJ4\n' +
+ 'prf+E3Aa4vYmLLOUUvKnDQ1k3RGNu56V0tonsQbfsaM=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECjCCAvKgAwIBAgICEzUwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTAyMDUy\n' +
+ 'MjVaFw0yNDA4MjIxNzA4NTBaMIGXMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEoMCYGA1UEAwwfQW1h\n' +
+ 'em9uIFJEUyBjYS1jZW50cmFsLTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQAD\n' +
+ 'ggEPADCCAQoCggEBAOxHqdcPSA2uBjsCP4DLSlqSoPuQ/X1kkJLusVRKiQE2zayB\n' +
+ 'viuCBt4VB9Qsh2rW3iYGM+usDjltGnI1iUWA5KHcvHszSMkWAOYWLiMNKTlg6LCp\n' +
+ 'XnE89tvj5dIH6U8WlDvXLdjB/h30gW9JEX7S8supsBSci2GxEzb5mRdKaDuuF/0O\n' +
+ 'qvz4YE04pua3iZ9QwmMFuTAOYzD1M72aOpj+7Ac+YLMM61qOtU+AU6MndnQkKoQi\n' +
+ 'qmUN2A9IFaqHFzRlSdXwKCKUA4otzmz+/N3vFwjb5F4DSsbsrMfjeHMo6o/nb6Nh\n' +
+ 'YDb0VJxxPee6TxSuN7CQJ2FxMlFUezcoXqwqXD0CAwEAAaNmMGQwDgYDVR0PAQH/\n' +
+ 'BAQDAgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFDGGpon9WfIpsggE\n' +
+ 'CxHq8hZ7E2ESMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqG\n' +
+ 'SIb3DQEBCwUAA4IBAQAvpeQYEGZvoTVLgV9rd2+StPYykMsmFjWQcyn3dBTZRXC2\n' +
+ 'lKq7QhQczMAOhEaaN29ZprjQzsA2X/UauKzLR2Uyqc2qOeO9/YOl0H3qauo8C/W9\n' +
+ 'r8xqPbOCDLEXlOQ19fidXyyEPHEq5WFp8j+fTh+s8WOx2M7IuC0ANEetIZURYhSp\n' +
+ 'xl9XOPRCJxOhj7JdelhpweX0BJDNHeUFi0ClnFOws8oKQ7sQEv66d5ddxqqZ3NVv\n' +
+ 'RbCvCtEutQMOUMIuaygDlMn1anSM8N7Wndx8G6+Uy67AnhjGx7jw/0YPPxopEj6x\n' +
+ 'JXP8j0sJbcT9K/9/fPVLNT25RvQ/93T2+IQL4Ca2\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICYpgwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTExNzMx\n' +
+ 'NDhaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAMk3YdSZ64iAYp6MyyKtYJtNzv7zFSnnNf6vv0FB4VnfITTMmOyZ\n' +
+ 'LXqKAT2ahZ00hXi34ewqJElgU6eUZT/QlzdIu359TEZyLVPwURflL6SWgdG01Q5X\n' +
+ 'O++7fSGcBRyIeuQWs9FJNIIqK8daF6qw0Rl5TXfu7P9dBc3zkgDXZm2DHmxGDD69\n' +
+ '7liQUiXzoE1q2Z9cA8+jirDioJxN9av8hQt12pskLQumhlArsMIhjhHRgF03HOh5\n' +
+ 'tvi+RCfihVOxELyIRTRpTNiIwAqfZxxTWFTgfn+gijTmd0/1DseAe82aYic8JbuS\n' +
+ 'EMbrDduAWsqrnJ4GPzxHKLXX0JasCUcWyMECAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFPLtsq1NrwJXO13C9eHt\n' +
+ 'sLY11AGwMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQAnWBKj5xV1A1mYd0kIgDdkjCwQkiKF5bjIbGkT3YEFFbXoJlSP\n' +
+ '0lZZ/hDaOHI8wbLT44SzOvPEEmWF9EE7SJzkvSdQrUAWR9FwDLaU427ALI3ngNHy\n' +
+ 'lGJ2hse1fvSRNbmg8Sc9GBv8oqNIBPVuw+AJzHTacZ1OkyLZrz1c1QvwvwN2a+Jd\n' +
+ 'vH0V0YIhv66llKcYDMUQJAQi4+8nbRxXWv6Gq3pvrFoorzsnkr42V3JpbhnYiK+9\n' +
+ 'nRKd4uWl62KRZjGkfMbmsqZpj2fdSWMY1UGyN1k+kDmCSWYdrTRDP0xjtIocwg+A\n' +
+ 'J116n4hV/5mbA0BaPiS2krtv17YAeHABZcvz\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECjCCAvKgAwIBAgICV2YwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTExOTM2\n' +
+ 'MjBaFw0yNDA4MjIxNzA4NTBaMIGXMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEoMCYGA1UEAwwfQW1h\n' +
+ 'em9uIFJEUyBldS1jZW50cmFsLTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQAD\n' +
+ 'ggEPADCCAQoCggEBAMEx54X2pHVv86APA0RWqxxRNmdkhAyp2R1cFWumKQRofoFv\n' +
+ 'n+SPXdkpIINpMuEIGJANozdiEz7SPsrAf8WHyD93j/ZxrdQftRcIGH41xasetKGl\n' +
+ 'I67uans8d+pgJgBKGb/Z+B5m+UsIuEVekpvgpwKtmmaLFC/NCGuSsJoFsRqoa6Gh\n' +
+ 'm34W6yJoY87UatddCqLY4IIXaBFsgK9Q/wYzYLbnWM6ZZvhJ52VMtdhcdzeTHNW0\n' +
+ '5LGuXJOF7Ahb4JkEhoo6TS2c0NxB4l4MBfBPgti+O7WjR3FfZHpt18A6Zkq6A2u6\n' +
+ 'D/oTSL6c9/3sAaFTFgMyL3wHb2YlW0BPiljZIqECAwEAAaNmMGQwDgYDVR0PAQH/\n' +
+ 'BAQDAgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFOcAToAc6skWffJa\n' +
+ 'TnreaswAfrbcMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqG\n' +
+ 'SIb3DQEBCwUAA4IBAQA1d0Whc1QtspK496mFWfFEQNegLh0a9GWYlJm+Htcj5Nxt\n' +
+ 'DAIGXb+8xrtOZFHmYP7VLCT5Zd2C+XytqseK/+s07iAr0/EPF+O2qcyQWMN5KhgE\n' +
+ 'cXw2SwuP9FPV3i+YAm11PBVeenrmzuk9NrdHQ7TxU4v7VGhcsd2C++0EisrmquWH\n' +
+ 'mgIfmVDGxphwoES52cY6t3fbnXmTkvENvR+h3rj+fUiSz0aSo+XZUGHPgvuEKM/W\n' +
+ 'CBD9Smc9CBoBgvy7BgHRgRUmwtABZHFUIEjHI5rIr7ZvYn+6A0O6sogRfvVYtWFc\n' +
+ 'qpyrW1YX8mD0VlJ8fGKM3G+aCOsiiPKDV/Uafrm+\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgICGAcwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTIxODE5\n' +
+ 'NDRaFw0yNDA4MjIxNzA4NTBaMIGVMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEmMCQGA1UEAwwdQW1h\n' +
+ 'em9uIFJEUyBldS1ub3J0aC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQCiIYnhe4UNBbdBb/nQxl5giM0XoVHWNrYV5nB0YukA98+TPn9v\n' +
+ 'Aoj1RGYmtryjhrf01Kuv8SWO+Eom95L3zquoTFcE2gmxCfk7bp6qJJ3eHOJB+QUO\n' +
+ 'XsNRh76fwDzEF1yTeZWH49oeL2xO13EAx4PbZuZpZBttBM5zAxgZkqu4uWQczFEs\n' +
+ 'JXfla7z2fvWmGcTagX10O5C18XaFroV0ubvSyIi75ue9ykg/nlFAeB7O0Wxae88e\n' +
+ 'uhiBEFAuLYdqWnsg3459NfV8Yi1GnaitTym6VI3tHKIFiUvkSiy0DAlAGV2iiyJE\n' +
+ 'q+DsVEO4/hSINJEtII4TMtysOsYPpINqeEzRAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBRR0UpnbQyjnHChgmOc\n' +
+ 'hnlc0PogzTAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAKJD4xVzSf4zSGTBJrmamo86jl1NHQxXUApAZuBZEc8tqC6TI\n' +
+ 'T5CeoSr9CMuVC8grYyBjXblC4OsM5NMvmsrXl/u5C9dEwtBFjo8mm53rOOIm1fxl\n' +
+ 'I1oYB/9mtO9ANWjkykuLzWeBlqDT/i7ckaKwalhLODsRDO73vRhYNjsIUGloNsKe\n' +
+ 'pxw3dzHwAZx4upSdEVG4RGCZ1D0LJ4Gw40OfD69hfkDfRVVxKGrbEzqxXRvovmDc\n' +
+ 'tKLdYZO/6REoca36v4BlgIs1CbUXJGLSXUwtg7YXGLSVBJ/U0+22iGJmBSNcoyUN\n' +
+ 'cjPFD9JQEhDDIYYKSGzIYpvslvGc4T5ISXFiuQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICZIEwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTIyMTMy\n' +
+ 'MzJaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTIgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBALGiwqjiF7xIjT0Sx7zB3764K2T2a1DHnAxEOr+/EIftWKxWzT3u\n' +
+ 'PFwS2eEZcnKqSdRQ+vRzonLBeNLO4z8aLjQnNbkizZMBuXGm4BqRm1Kgq3nlLDQn\n' +
+ '7YqdijOq54SpShvR/8zsO4sgMDMmHIYAJJOJqBdaus2smRt0NobIKc0liy7759KB\n' +
+ '6kmQ47Gg+kfIwxrQA5zlvPLeQImxSoPi9LdbRoKvu7Iot7SOa+jGhVBh3VdqndJX\n' +
+ '7tm/saj4NE375csmMETFLAOXjat7zViMRwVorX4V6AzEg1vkzxXpA9N7qywWIT5Y\n' +
+ 'fYaq5M8i6vvLg0CzrH9fHORtnkdjdu1y+0MCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFFOhOx1yt3Z7mvGB9jBv\n' +
+ '2ymdZwiOMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQBehqY36UGDvPVU9+vtaYGr38dBbp+LzkjZzHwKT1XJSSUc2wqM\n' +
+ 'hnCIQKilonrTIvP1vmkQi8qHPvDRtBZKqvz/AErW/ZwQdZzqYNFd+BmOXaeZWV0Q\n' +
+ 'oHtDzXmcwtP8aUQpxN0e1xkWb1E80qoy+0uuRqb/50b/R4Q5qqSfJhkn6z8nwB10\n' +
+ '7RjLtJPrK8igxdpr3tGUzfAOyiPrIDncY7UJaL84GFp7WWAkH0WG3H8Y8DRcRXOU\n' +
+ 'mqDxDLUP3rNuow3jnGxiUY+gGX5OqaZg4f4P6QzOSmeQYs6nLpH0PiN00+oS1BbD\n' +
+ 'bpWdZEttILPI+vAYkU4QuBKKDjJL6HbSd+cn\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgIDAIVCMA0GCSqGSIb3DQEBCwUAMIGPMQswCQYDVQQGEwJV\n' +
+ 'UzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UE\n' +
+ 'CgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJE\n' +
+ 'UzEgMB4GA1UEAwwXQW1hem9uIFJEUyBSb290IDIwMTkgQ0EwHhcNMTkwOTEzMTcw\n' +
+ 'NjQxWhcNMjQwODIyMTcwODUwWjCBlDELMAkGA1UEBhMCVVMxEzARBgNVBAgMCldh\n' +
+ 'c2hpbmd0b24xEDAOBgNVBAcMB1NlYXR0bGUxIjAgBgNVBAoMGUFtYXpvbiBXZWIg\n' +
+ 'U2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxJTAjBgNVBAMMHEFt\n' +
+ 'YXpvbiBSRFMgdXMtZWFzdC0yIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQDE+T2xYjUbxOp+pv+gRA3FO24+1zCWgXTDF1DHrh1lsPg5k7ht\n' +
+ '2KPYzNc+Vg4E+jgPiW0BQnA6jStX5EqVh8BU60zELlxMNvpg4KumniMCZ3krtMUC\n' +
+ 'au1NF9rM7HBh+O+DYMBLK5eSIVt6lZosOb7bCi3V6wMLA8YqWSWqabkxwN4w0vXI\n' +
+ '8lu5uXXFRemHnlNf+yA/4YtN4uaAyd0ami9+klwdkZfkrDOaiy59haOeBGL8EB/c\n' +
+ 'dbJJlguHH5CpCscs3RKtOOjEonXnKXldxarFdkMzi+aIIjQ8GyUOSAXHtQHb3gZ4\n' +
+ 'nS6Ey0CMlwkB8vUObZU9fnjKJcL5QCQqOfwvAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBQUPuRHohPxx4VjykmH\n' +
+ '6usGrLL1ETAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAUdR9Vb3y33Yj6X6KGtuthZ08SwjImVQPtknzpajNE5jOJAh8\n' +
+ 'quvQnU9nlnMO85fVDU1Dz3lLHGJ/YG1pt1Cqq2QQ200JcWCvBRgdvH6MjHoDQpqZ\n' +
+ 'HvQ3vLgOGqCLNQKFuet9BdpsHzsctKvCVaeBqbGpeCtt3Hh/26tgx0rorPLw90A2\n' +
+ 'V8QSkZJjlcKkLa58N5CMM8Xz8KLWg3MZeT4DmlUXVCukqK2RGuP2L+aME8dOxqNv\n' +
+ 'OnOz1zrL5mR2iJoDpk8+VE/eBDmJX40IJk6jBjWoxAO/RXq+vBozuF5YHN1ujE92\n' +
+ 'tO8HItgTp37XT8bJBAiAnt5mxw+NLSqtxk2QdQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICY4kwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTMyMDEx\n' +
+ 'NDJaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMSAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAr5u9OuLL/OF/fBNUX2kINJLzFl4DnmrhnLuSeSnBPgbb\n' +
+ 'qddjf5EFFJBfv7IYiIWEFPDbDG5hoBwgMup5bZDbas+ZTJTotnnxVJTQ6wlhTmns\n' +
+ 'eHECcg2pqGIKGrxZfbQhlj08/4nNAPvyYCTS0bEcmQ1emuDPyvJBYDDLDU6AbCB5\n' +
+ '6Z7YKFQPTiCBblvvNzchjLWF9IpkqiTsPHiEt21sAdABxj9ityStV3ja/W9BfgxH\n' +
+ 'wzABSTAQT6FbDwmQMo7dcFOPRX+hewQSic2Rn1XYjmNYzgEHisdUsH7eeXREAcTw\n' +
+ '61TRvaLH8AiOWBnTEJXPAe6wYfrcSd1pD0MXpoB62wIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUytwMiomQOgX5\n' +
+ 'Ichd+2lDWRUhkikwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBACf6lRDpfCD7BFRqiWM45hqIzffIaysmVfr+Jr+fBTjP\n' +
+ 'uYe/ba1omSrNGG23bOcT9LJ8hkQJ9d+FxUwYyICQNWOy6ejicm4z0C3VhphbTPqj\n' +
+ 'yjpt9nG56IAcV8BcRJh4o/2IfLNzC/dVuYJV8wj7XzwlvjysenwdrJCoLadkTr1h\n' +
+ 'eIdG6Le07sB9IxrGJL9e04afk37h7c8ESGSE4E+oS4JQEi3ATq8ne1B9DQ9SasXi\n' +
+ 'IRmhNAaISDzOPdyLXi9N9V9Lwe/DHcja7hgLGYx3UqfjhLhOKwp8HtoZORixAmOI\n' +
+ 'HfILgNmwyugAbuZoCazSKKBhQ0wgO0WZ66ZKTMG8Oho=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICUYkwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTYxODIx\n' +
+ 'MTVaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyB1cy13ZXN0LTIgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBANCEZBZyu6yJQFZBJmSUZfSZd3Ui2gitczMKC4FLr0QzkbxY+cLa\n' +
+ 'uVONIOrPt4Rwi+3h/UdnUg917xao3S53XDf1TDMFEYp4U8EFPXqCn/GXBIWlU86P\n' +
+ 'PvBN+gzw3nS+aco7WXb+woTouvFVkk8FGU7J532llW8o/9ydQyDIMtdIkKTuMfho\n' +
+ 'OiNHSaNc+QXQ32TgvM9A/6q7ksUoNXGCP8hDOkSZ/YOLiI5TcdLh/aWj00ziL5bj\n' +
+ 'pvytiMZkilnc9dLY9QhRNr0vGqL0xjmWdoEXz9/OwjmCihHqJq+20MJPsvFm7D6a\n' +
+ '2NKybR9U+ddrjb8/iyLOjURUZnj5O+2+OPcCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFEBxMBdv81xuzqcK5TVu\n' +
+ 'pHj+Aor8MB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQBZkfiVqGoJjBI37aTlLOSjLcjI75L5wBrwO39q+B4cwcmpj58P\n' +
+ '3sivv+jhYfAGEbQnGRzjuFoyPzWnZ1DesRExX+wrmHsLLQbF2kVjLZhEJMHF9eB7\n' +
+ 'GZlTPdTzHErcnuXkwA/OqyXMpj9aghcQFuhCNguEfnROY9sAoK2PTfnTz9NJHL+Q\n' +
+ 'UpDLEJEUfc0GZMVWYhahc0x38ZnSY2SKacIPECQrTI0KpqZv/P+ijCEcMD9xmYEb\n' +
+ 'jL4en+XKS1uJpw5fIU5Sj0MxhdGstH6S84iAE5J3GM3XHklGSFwwqPYvuTXvANH6\n' +
+ 'uboynxRgSae59jIlAK6Jrr6GWMwQRbgcaAlW\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICEkYwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTYxOTUz\n' +
+ 'NDdaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMiAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAufodI2Flker8q7PXZG0P0vmFSlhQDw907A6eJuF/WeMo\n' +
+ 'GHnll3b4S6nC3oRS3nGeRMHbyU2KKXDwXNb3Mheu+ox+n5eb/BJ17eoj9HbQR1cd\n' +
+ 'gEkIciiAltf8gpMMQH4anP7TD+HNFlZnP7ii3geEJB2GGXSxgSWvUzH4etL67Zmn\n' +
+ 'TpGDWQMB0T8lK2ziLCMF4XAC/8xDELN/buHCNuhDpxpPebhct0T+f6Arzsiswt2j\n' +
+ '7OeNeLLZwIZvVwAKF7zUFjC6m7/VmTQC8nidVY559D6l0UhhU0Co/txgq3HVsMOH\n' +
+ 'PbxmQUwJEKAzQXoIi+4uZzHFZrvov/nDTNJUhC6DqwIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUwaZpaCme+EiV\n' +
+ 'M5gcjeHZSTgOn4owHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAAR6a2meCZuXO2TF9bGqKGtZmaah4pH2ETcEVUjkvXVz\n' +
+ 'sl+ZKbYjrun+VkcMGGKLUjS812e7eDF726ptoku9/PZZIxlJB0isC/0OyixI8N4M\n' +
+ 'NsEyvp52XN9QundTjkl362bomPnHAApeU0mRbMDRR2JdT70u6yAzGLGsUwMkoNnw\n' +
+ '1VR4XKhXHYGWo7KMvFrZ1KcjWhubxLHxZWXRulPVtGmyWg/MvE6KF+2XMLhojhUL\n' +
+ '+9jB3Fpn53s6KMx5tVq1x8PukHmowcZuAF8k+W4gk8Y68wIwynrdZrKRyRv6CVtR\n' +
+ 'FZ8DeJgoNZT3y/GT254VqMxxfuy2Ccb/RInd16tEvVk=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICOYIwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTcyMDA1\n' +
+ 'MjlaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMyAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEA4dMak8W+XW8y/2F6nRiytFiA4XLwePadqWebGtlIgyCS\n' +
+ 'kbug8Jv5w7nlMkuxOxoUeD4WhI6A9EkAn3r0REM/2f0aYnd2KPxeqS2MrtdxxHw1\n' +
+ 'xoOxk2x0piNSlOz6yog1idsKR5Wurf94fvM9FdTrMYPPrDabbGqiBMsZZmoHLvA3\n' +
+ 'Z+57HEV2tU0Ei3vWeGIqnNjIekS+E06KhASxrkNU5vi611UsnYZlSi0VtJsH4UGV\n' +
+ 'LhnHl53aZL0YFO5mn/fzuNG/51qgk/6EFMMhaWInXX49Dia9FnnuWXwVwi6uX1Wn\n' +
+ '7kjoHi5VtmC8ZlGEHroxX2DxEr6bhJTEpcLMnoQMqwIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUsUI5Cb3SWB8+\n' +
+ 'gv1YLN/ABPMdxSAwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAJAF3E9PM1uzVL8YNdzb6fwJrxxqI2shvaMVmC1mXS+w\n' +
+ 'G0zh4v2hBZOf91l1EO0rwFD7+fxoI6hzQfMxIczh875T6vUXePKVOCOKI5wCrDad\n' +
+ 'zQbVqbFbdhsBjF4aUilOdtw2qjjs9JwPuB0VXN4/jY7m21oKEOcnpe36+7OiSPjN\n' +
+ 'xngYewCXKrSRqoj3mw+0w/+exYj3Wsush7uFssX18av78G+ehKPIVDXptOCP/N7W\n' +
+ '8iKVNeQ2QGTnu2fzWsGUSvMGyM7yqT+h1ILaT//yQS8er511aHMLc142bD4D9VSy\n' +
+ 'DgactwPDTShK/PXqhvNey9v/sKXm4XatZvwcc8KYlW4=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICcEUwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTgxNjU2\n' +
+ 'MjBaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMSAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAndtkldmHtk4TVQAyqhAvtEHSMb6pLhyKrIFved1WO3S7\n' +
+ '+I+bWwv9b2W/ljJxLq9kdT43bhvzonNtI4a1LAohS6bqyirmk8sFfsWT3akb+4Sx\n' +
+ '1sjc8Ovc9eqIWJCrUiSvv7+cS7ZTA9AgM1PxvHcsqrcUXiK3Jd/Dax9jdZE1e15s\n' +
+ 'BEhb2OEPE+tClFZ+soj8h8Pl2Clo5OAppEzYI4LmFKtp1X/BOf62k4jviXuCSst3\n' +
+ 'UnRJzE/CXtjmN6oZySVWSe0rQYuyqRl6//9nK40cfGKyxVnimB8XrrcxUN743Vud\n' +
+ 'QQVU0Esm8OVTX013mXWQXJHP2c0aKkog8LOga0vobQIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQULmoOS1mFSjj+\n' +
+ 'snUPx4DgS3SkLFYwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAAkVL2P1M2/G9GM3DANVAqYOwmX0Xk58YBHQu6iiQg4j\n' +
+ 'b4Ky/qsZIsgT7YBsZA4AOcPKQFgGTWhe9pvhmXqoN3RYltN8Vn7TbUm/ZVDoMsrM\n' +
+ 'gwv0+TKxW1/u7s8cXYfHPiTzVSJuOogHx99kBW6b2f99GbP7O1Sv3sLq4j6lVvBX\n' +
+ 'Fiacf5LAWC925nvlTzLlBgIc3O9xDtFeAGtZcEtxZJ4fnGXiqEnN4539+nqzIyYq\n' +
+ 'nvlgCzyvcfRAxwltrJHuuRu6Maw5AGcd2Y0saMhqOVq9KYKFKuD/927BTrbd2JVf\n' +
+ '2sGWyuPZPCk3gq+5pCjbD0c6DkhcMGI6WwxvM5V/zSM=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICJDQwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTgxNzAz\n' +
+ 'MTVaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTMgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAL9bL7KE0n02DLVtlZ2PL+g/BuHpMYFq2JnE2RgompGurDIZdjmh\n' +
+ '1pxfL3nT+QIVMubuAOy8InRfkRxfpxyjKYdfLJTPJG+jDVL+wDcPpACFVqoV7Prg\n' +
+ 'pVYEV0lc5aoYw4bSeYFhdzgim6F8iyjoPnObjll9mo4XsHzSoqJLCd0QC+VG9Fw2\n' +
+ 'q+GDRZrLRmVM2oNGDRbGpGIFg77aRxRapFZa8SnUgs2AqzuzKiprVH5i0S0M6dWr\n' +
+ 'i+kk5epmTtkiDHceX+dP/0R1NcnkCPoQ9TglyXyPdUdTPPRfKCq12dftqll+u4mV\n' +
+ 'ARdN6WFjovxax8EAP2OAUTi1afY+1JFMj+sCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFLfhrbrO5exkCVgxW0x3\n' +
+ 'Y2mAi8lNMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQAigQ5VBNGyw+OZFXwxeJEAUYaXVoP/qrhTOJ6mCE2DXUVEoJeV\n' +
+ 'SxScy/TlFA9tJXqmit8JH8VQ/xDL4ubBfeMFAIAo4WzNWDVoeVMqphVEcDWBHsI1\n' +
+ 'AETWzfsapRS9yQekOMmxg63d/nV8xewIl8aNVTHdHYXMqhhik47VrmaVEok1UQb3\n' +
+ 'O971RadLXIEbVd9tjY5bMEHm89JsZDnDEw1hQXBb67Elu64OOxoKaHBgUH8AZn/2\n' +
+ 'zFsL1ynNUjOhCSAA15pgd1vjwc0YsBbAEBPcHBWYBEyME6NLNarjOzBl4FMtATSF\n' +
+ 'wWCKRGkvqN8oxYhwR2jf2rR5Mu4DWkK5Q8Ep\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICJVUwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTkxODE2\n' +
+ 'NTNaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyB1cy1lYXN0LTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAM3i/k2u6cqbMdcISGRvh+m+L0yaSIoOXjtpNEoIftAipTUYoMhL\n' +
+ 'InXGlQBVA4shkekxp1N7HXe1Y/iMaPEyb3n+16pf3vdjKl7kaSkIhjdUz3oVUEYt\n' +
+ 'i8Z/XeJJ9H2aEGuiZh3kHixQcZczn8cg3dA9aeeyLSEnTkl/npzLf//669Ammyhs\n' +
+ 'XcAo58yvT0D4E0D/EEHf2N7HRX7j/TlyWvw/39SW0usiCrHPKDLxByLojxLdHzso\n' +
+ 'QIp/S04m+eWn6rmD+uUiRteN1hI5ncQiA3wo4G37mHnUEKo6TtTUh+sd/ku6a8HK\n' +
+ 'glMBcgqudDI90s1OpuIAWmuWpY//8xEG2YECAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFPqhoWZcrVY9mU7tuemR\n' +
+ 'RBnQIj1jMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQB6zOLZ+YINEs72heHIWlPZ8c6WY8MDU+Be5w1M+BK2kpcVhCUK\n' +
+ 'PJO4nMXpgamEX8DIiaO7emsunwJzMSvavSPRnxXXTKIc0i/g1EbiDjnYX9d85DkC\n' +
+ 'E1LaAUCmCZBVi9fIe0H2r9whIh4uLWZA41oMnJx/MOmo3XyMfQoWcqaSFlMqfZM4\n' +
+ '0rNoB/tdHLNuV4eIdaw2mlHxdWDtF4oH+HFm+2cVBUVC1jXKrFv/euRVtsTT+A6i\n' +
+ 'h2XBHKxQ1Y4HgAn0jACP2QSPEmuoQEIa57bEKEcZsBR8SDY6ZdTd2HLRIApcCOSF\n' +
+ 'MRM8CKLeF658I0XgF8D5EsYoKPsA+74Z+jDH\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEETCCAvmgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZQxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSUwIwYDVQQDDBxBbWF6b24gUkRTIEJldGEgUm9vdCAyMDE5IENBMB4XDTE5MDgy\n' +
+ 'MDE3MTAwN1oXDTI0MDgxOTE3MzgyNlowgZkxCzAJBgNVBAYTAlVTMRMwEQYDVQQI\n' +
+ 'DApXYXNoaW5ndG9uMRAwDgYDVQQHDAdTZWF0dGxlMSIwIAYDVQQKDBlBbWF6b24g\n' +
+ 'V2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMSowKAYDVQQD\n' +
+ 'DCFBbWF6b24gUkRTIEJldGEgdXMtZWFzdC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3\n' +
+ 'DQEBAQUAA4IBDwAwggEKAoIBAQDTNCOlotQcLP8TP82U2+nk0bExVuuMVOgFeVMx\n' +
+ 'vbUHZQeIj9ikjk+jm6eTDnnkhoZcmJiJgRy+5Jt69QcRbb3y3SAU7VoHgtraVbxF\n' +
+ 'QDh7JEHI9tqEEVOA5OvRrDRcyeEYBoTDgh76ROco2lR+/9uCvGtHVrMCtG7BP7ZB\n' +
+ 'sSVNAr1IIRZZqKLv2skKT/7mzZR2ivcw9UeBBTUf8xsfiYVBvMGoEsXEycjYdf6w\n' +
+ 'WV+7XS7teNOc9UgsFNN+9AhIBc1jvee5E//72/4F8pAttAg/+mmPUyIKtekNJ4gj\n' +
+ 'OAR2VAzGx1ybzWPwIgOudZFHXFduxvq4f1hIRPH0KbQ/gkRrAgMBAAGjZjBkMA4G\n' +
+ 'A1UdDwEB/wQEAwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBTkvpCD\n' +
+ '6C43rar9TtJoXr7q8dkrrjAfBgNVHSMEGDAWgBStoQwVpbGx87fxB3dEGDqKKnBT\n' +
+ '4TANBgkqhkiG9w0BAQsFAAOCAQEAJd9fOSkwB3uVdsS+puj6gCER8jqmhd3g/J5V\n' +
+ 'Zjk9cKS8H0e8pq/tMxeJ8kpurPAzUk5RkCspGt2l0BSwmf3ahr8aJRviMX6AuW3/\n' +
+ 'g8aKplTvq/WMNGKLXONa3Sq8591J+ce8gtOX/1rDKmFI4wQ/gUzOSYiT991m7QKS\n' +
+ 'Fr6HMgFuz7RNJbb3Fy5cnurh8eYWA7mMv7laiLwTNsaro5qsqErD5uXuot6o9beT\n' +
+ 'a+GiKinEur35tNxAr47ax4IRubuIzyfCrezjfKc5raVV2NURJDyKP0m0CCaffAxE\n' +
+ 'qn2dNfYc3v1D8ypg3XjHlOzRo32RB04o8ALHMD9LSwsYDLpMag==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEFzCCAv+gAwIBAgICFSUwDQYJKoZIhvcNAQELBQAwgZcxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSgwJgYDVQQDDB9BbWF6b24gUkRTIFByZXZpZXcgUm9vdCAyMDE5IENBMB4XDTE5\n' +
+ 'MDgyMTIyMzk0N1oXDTI0MDgyMTIyMjk0OVowgZwxCzAJBgNVBAYTAlVTMRMwEQYD\n' +
+ 'VQQIDApXYXNoaW5ndG9uMRAwDgYDVQQHDAdTZWF0dGxlMSIwIAYDVQQKDBlBbWF6\n' +
+ 'b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMS0wKwYD\n' +
+ 'VQQDDCRBbWF6b24gUkRTIFByZXZpZXcgdXMtZWFzdC0yIDIwMTkgQ0EwggEiMA0G\n' +
+ 'CSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQD0dB/U7qRnSf05wOi7m10Pa2uPMTJv\n' +
+ 'r6U/3Y17a5prq5Zr4++CnSUYarG51YuIf355dKs+7Lpzs782PIwCmLpzAHKWzix6\n' +
+ 'pOaTQ+WZ0+vUMTxyqgqWbsBgSCyP7pVBiyqnmLC/L4az9XnscrbAX4pNaoJxsuQe\n' +
+ 'mzBo6yofjQaAzCX69DuqxFkVTRQnVy7LCFkVaZtjNAftnAHJjVgQw7lIhdGZp9q9\n' +
+ 'IafRt2gteihYfpn+EAQ/t/E4MnhrYs4CPLfS7BaYXBycEKC5Muj1l4GijNNQ0Efo\n' +
+ 'xG8LSZz7SNgUvfVwiNTaqfLP3AtEAWiqxyMyh3VO+1HpCjT7uNBFtmF3AgMBAAGj\n' +
+ 'ZjBkMA4GA1UdDwEB/wQEAwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQW\n' +
+ 'BBQtinkdrj+0B2+qdXngV2tgHnPIujAfBgNVHSMEGDAWgBRp0xqULkNh/w2ZVzEI\n' +
+ 'o2RIY7O03TANBgkqhkiG9w0BAQsFAAOCAQEAtJdqbCxDeMc8VN1/RzCabw9BIL/z\n' +
+ '73Auh8eFTww/sup26yn8NWUkfbckeDYr1BrXa+rPyLfHpg06kwR8rBKyrs5mHwJx\n' +
+ 'bvOzXD/5WTdgreB+2Fb7mXNvWhenYuji1MF+q1R2DXV3I05zWHteKX6Dajmx+Uuq\n' +
+ 'Yq78oaCBSV48hMxWlp8fm40ANCL1+gzQ122xweMFN09FmNYFhwuW+Ao+Vv90ZfQG\n' +
+ 'PYwTvN4n/gegw2TYcifGZC2PNX74q3DH03DXe5fvNgRW5plgz/7f+9mS+YHd5qa9\n' +
+ 'tYTPUvoRbi169ou6jicsMKUKPORHWhiTpSCWR1FMMIbsAcsyrvtIsuaGCQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQdOCSuA9psBpQd8EI368/0DANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHNhLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTE5MTgwNjI2WhgPMjA2MTA1MTkxOTA2MjZaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgc2EtZWFzdC0xIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAN6ftL6w8v3dB2yW\n' +
+ 'LjCxSP1D7ZsOTeLZOSCz1Zv0Gkd0XLhil5MdHOHBvwH/DrXqFU2oGzCRuAy+aZis\n' +
+ 'DardJU6ChyIQIciXCO37f0K23edhtpXuruTLLwUwzeEPdcnLPCX+sWEn9Y5FPnVm\n' +
+ 'pCd6J8edH2IfSGoa9LdErkpuESXdidLym/w0tWG/O2By4TabkNSmpdrCL00cqI+c\n' +
+ 'prA8Bx1jX8/9sY0gpAovtuFaRN+Ivg3PAnWuhqiSYyQ5nC2qDparOWuDiOhpY56E\n' +
+ 'EgmTvjwqMMjNtExfYx6Rv2Ndu50TriiNKEZBzEtkekwXInTupmYTvc7U83P/959V\n' +
+ 'UiQ+WSMCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU4uYHdH0+\n' +
+ 'bUeh81Eq2l5/RJbW+vswDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQBhxcExJ+w74bvDknrPZDRgTeMLYgbVJjx2ExH7/Ac5FZZWcpUpFwWMIJJxtewI\n' +
+ 'AnhryzM3tQYYd4CG9O+Iu0+h/VVfW7e4O3joWVkxNMb820kQSEwvZfA78aItGwOY\n' +
+ 'WSaFNVRyloVicZRNJSyb1UL9EiJ9ldhxm4LTT0ax+4ontI7zTx6n6h8Sr6r/UOvX\n' +
+ 'd9T5aUUENWeo6M9jGupHNn3BobtL7BZm2oS8wX8IVYj4tl0q5T89zDi2x0MxbsIV\n' +
+ '5ZjwqBQ5JWKv7ASGPb+z286RjPA9R2knF4lJVZrYuNV90rHvI/ECyt/JrDqeljGL\n' +
+ 'BLl1W/UsvZo6ldLIpoMbbrb5\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBDCCAuygAwIBAgIQUfVbqapkLYpUqcLajpTJWzANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIG1lLWNlbnRyYWwtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNTA2MjMyMDA5WhgPMjA2MjA1MDcwMDIwMDlaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgbWUtY2VudHJhbC0xIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAJIeovu3\n' +
+ 'ewI9FVitXMQzvkh34aQ6WyI4NO3YepfJaePiv3cnyFGYHN2S1cR3UQcLWgypP5va\n' +
+ 'j6bfroqwGbCbZZcb+6cyOB4ceKO9Ws1UkcaGHnNDcy5gXR7aCW2OGTUfinUuhd2d\n' +
+ '5bOGgV7JsPbpw0bwJ156+MwfOK40OLCWVbzy8B1kITs4RUPNa/ZJnvIbiMu9rdj4\n' +
+ '8y7GSFJLnKCjlOFUkNI5LcaYvI1+ybuNgphT3nuu5ZirvTswGakGUT/Q0J3dxP0J\n' +
+ 'pDfg5Sj/2G4gXiaM0LppVOoU5yEwVewhQ250l0eQAqSrwPqAkdTg9ng360zqCFPE\n' +
+ 'JPPcgI1tdGUgneECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU\n' +
+ '/2AJVxWdZxc8eJgdpbwpW7b0f7IwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEB\n' +
+ 'CwUAA4IBAQBYm63jTu2qYKJ94gKnqc+oUgqmb1mTXmgmp/lXDbxonjszJDOXFbri\n' +
+ '3CCO7xB2sg9bd5YWY8sGKHaWmENj3FZpCmoefbUx++8D7Mny95Cz8R32rNcwsPTl\n' +
+ 'ebpd9A/Oaw5ug6M0x/cNr0qzF8Wk9Dx+nFEimp8RYQdKvLDfNFZHjPa1itnTiD8M\n' +
+ 'TorAqj+VwnUGHOYBsT/0NY12tnwXdD+ATWfpEHdOXV+kTMqFFwDyhfgRVNpTc+os\n' +
+ 'ygr8SwhnSCpJPB/EYl2S7r+tgAbJOkuwUvGT4pTqrzDQEhwE7swgepnHC87zhf6l\n' +
+ 'qN6mVpSnQKQLm6Ob5TeCEFgcyElsF5bH\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAOxu0I1QuMAhIeszB3fJIlkwCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyB1cy13ZXN0LTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTI0MjIwNjU5WhgPMjEyMTA1MjQyMzA2NTlaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgdXMtd2VzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEz4bylRcGqqDWdP7gQIIoTHdBK6FNtKH1\n' +
+ '4SkEIXRXkYDmRvL9Bci1MuGrwuvrka5TDj4b7e+csY0llEzHpKfq6nJPFljoYYP9\n' +
+ 'uqHFkv77nOpJJ633KOr8IxmeHW5RXgrZo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBQQikVz8wmjd9eDFRXzBIU8OseiGzAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIwf06Mcrpw1O0EBLBBrp84m37NYtOkE/0Z0O+C7D41wnXi\n' +
+ 'EQdn6PXUVgdD23Gj82SrAjEAklhKs+liO1PtN15yeZR1Io98nFve+lLptaLakZcH\n' +
+ '+hfFuUtCqMbaI8CdvJlKnPqT\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRALyWMTyCebLZOGcZZQmkmfcwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI0MjAyODAzWhgPMjEyMTA1MjQyMTI4MDNa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTMgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'wGFiyDyCrGqgdn4fXG12cxKAAfVvhMea1mw5h9CVRoavkPqhzQpAitSOuMB9DeiP\n' +
+ 'wQyqcsiGl/cTEau4L+AUBG8b9v26RlY48exUYBXj8CieYntOT9iNw5WtdYJa3kF/\n' +
+ 'JxgI+HDMzE9cmHDs5DOO3S0uwZVyra/xE1ymfSlpOeUIOTpHRJv97CBUEpaZMUW5\n' +
+ 'Sr6GruuOwFVpO5FX3A/jQlcS+UN4GjSRgDUJuqg6RRQldEZGCVCCmodbByvI2fGm\n' +
+ 'reGpsPJD54KkmAX08nOR8e5hkGoHxq0m2DLD4SrOFmt65vG47qnuwplWJjtk9B3Z\n' +
+ '9wDoopwZLBOtlkPIkUllWm1P8EuHC1IKOA+wSP6XdT7cy8S77wgyHzR0ynxv7q/l\n' +
+ 'vlZtH30wnNqFI0y9FeogD0TGMCHcnGqfBSicJXPy9T4fU6f0r1HwqKwPp2GArwe7\n' +
+ 'dnqLTj2D7M9MyVtFjEs6gfGWXmu1y5uDrf+CszurE8Cycoma+OfjjuVQgWOCy7Nd\n' +
+ 'jJswPxAroTzVfpgoxXza4ShUY10woZu0/J+HmNmqK7lh4NS75q1tz75in8uTZDkV\n' +
+ 'be7GK+SEusTrRgcf3tlgPjSTWG3veNzFDF2Vn1GLJXmuZfhdlVQDBNXW4MNREExS\n' +
+ 'dG57kJjICpT+r8X+si+5j51gRzkSnMYs7VHulpxfcwECAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQU4JWOpDBmUBuWKvGPZelw87ezhL8wDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQBRNLMql7itvXSEFQRAnyOjivHz\n' +
+ 'l5IlWVQjAbOUr6ogZcwvK6YpxNAFW5zQr8F+fdkiypLz1kk5irx9TIpff0BWC9hQ\n' +
+ '/odMPO8Gxn8+COlSvc+dLsF2Dax3Hvz0zLeKMo+cYisJOzpdR/eKd0/AmFdkvQoM\n' +
+ 'AOK9n0yYvVJU2IrSgeJBiiCarpKSeAktEVQ4rvyacQGr+QAPkkjRwm+5LHZKK43W\n' +
+ 'nNnggRli9N/27qYtc5bgr3AaQEhEXMI4RxPRXCLsod0ehMGWyRRK728a+6PMMJAJ\n' +
+ 'WHOU0x7LCEMPP/bvpLj3BdvSGqNor4ZtyXEbwREry1uzsgODeRRns5acPwTM6ff+\n' +
+ 'CmxO2NZ0OktIUSYRmf6H/ZFlZrIhV8uWaIwEJDz71qvj7buhQ+RFDZ9CNL64C0X6\n' +
+ 'mf0zJGEpddjANHaaVky+F4gYMtEy2K2Lcm4JGTdyIzUoIe+atzCnRp0QeIcuWtF+\n' +
+ 's8AjDYCVFNypcMmqbRmNpITSnOoCHSRuVkY3gutVoYyMLbp8Jm9SJnCIlEWTA6Rm\n' +
+ 'wADOMGZJVn5/XRTRuetVOB3KlQDjs9OO01XN5NzGSZO2KT9ngAUfh9Eqhf1iRWSP\n' +
+ 'nZlRbQ2NRCuY/oJ5N59mLGxnNJSE7giEKEBRhTQ/XEPIUYAUPD5fca0arKRJwbol\n' +
+ 'l9Se1Hsq0ZU5f+OZKQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAK7vlRrGVEePJpW1VHMXdlIwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhZi1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MTkxOTI4NDNaGA8yMTIxMDUxOTIwMjg0M1owgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhZi1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMZiHOQC6x4o\n' +
+ 'eC7vVOMCGiN5EuLqPYHdceFPm4h5k/ZejXTf7kryk6aoKZKsDIYihkaZwXVS7Y/y\n' +
+ '7Ig1F1ABi2jD+CYprj7WxXbhpysmN+CKG7YC3uE4jSvfvUnpzionkQbjJsRJcrPO\n' +
+ 'cZJM4FVaVp3mlHHtvnM+K3T+ni4a38nAd8xrv1na4+B8ZzZwWZXarfg8lJoGskSn\n' +
+ 'ou+3rbGQ0r+XlUP03zWujHoNlVK85qUIQvDfTB7n3O4s1XNGvkfv3GNBhYRWJYlB\n' +
+ '4p8T+PFN8wG+UOByp1gV7BD64RnpuZ8V3dRAlO6YVAmINyG5UGrPzkIbLtErUNHO\n' +
+ '4iSp4UqYvztDqJWWHR/rA84ef+I9RVwwZ8FQbjKq96OTnPrsr63A5mXTC9dXKtbw\n' +
+ 'XNJPQY//FEdyM3K8sqM0IdCzxCA1MXZ8+QapWVjwyTjUwFvL69HYky9H8eAER59K\n' +
+ '5I7u/CWWeCy2R1SYUBINc3xxLr0CGGukcWPEZW2aPo5ibW5kepU1P/pzdMTaTfao\n' +
+ 'F42jSFXbc7gplLcSqUgWwzBnn35HLTbiZOFBPKf6vRRu8aRX9atgHw/EjCebi2xP\n' +
+ 'xIYr5Ub8u0QVHIqcnF1/hVzO/Xz0chj3E6VF/yTXnsakm+W1aM2QkZbFGpga+LMy\n' +
+ 'mFCtdPrELjea2CfxgibaJX1Q4rdEpc8DAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFDSaycEyuspo/NOuzlzblui8KotFMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAbosemjeTRsL9o4v0KadBUNS3V7gdAH+X4vH2\n' +
+ 'Ee1Jc91VOGLdd/s1L9UX6bhe37b9WjUD69ur657wDW0RzxMYgQdZ27SUl0tEgGGp\n' +
+ 'cCmVs1ky3zEN+Hwnhkz+OTmIg1ufq0W2hJgJiluAx2r1ib1GB+YI3Mo3rXSaBYUk\n' +
+ 'bgQuujYPctf0PA153RkeICE5GI3OaJ7u6j0caYEixBS3PDHt2MJWexITvXGwHWwc\n' +
+ 'CcrC05RIrTUNOJaetQw8smVKYOfRImEzLLPZ5kf/H3Cbj8BNAFNsa10wgvlPuGOW\n' +
+ 'XLXqzNXzrG4V3sjQU5YtisDMagwYaN3a6bBf1wFwFIHQoAPIgt8q5zaQ9WI+SBns\n' +
+ 'Il6rd4zfvjq/BPmt0uI7rVg/cgbaEg/JDL2neuM9CJAzmKxYxLQuHSX2i3Fy4Y1B\n' +
+ 'cnxnRQETCRZNPGd00ADyxPKVoYBC45/t+yVusArFt+2SVLEGiFBr23eG2CEZu+HS\n' +
+ 'nDEgIfQ4V3YOTUNa86wvbAss1gbbnT/v1XCnNGClEWCWNCSRjwV2ZmQ/IVTmNHPo\n' +
+ '7axTTBBJbKJbKzFndCnuxnDXyytdYRgFU7Ly3sa27WS2KFyFEDebLFRHQEfoYqCu\n' +
+ 'IupSqBSbXsR3U10OTjc9z6EPo1nuV6bdz+gEDthmxKa1NI+Qb1kvyliXQHL2lfhr\n' +
+ '5zT5+Bs=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAOLV6zZcL4IV2xmEneN1GwswDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy13ZXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE5MDg1OFoYDzIxMjEwNTE5MjAwODU4WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLXdlc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC7koAKGXXlLixN\n' +
+ 'fVjhuqvz0WxDeTQfhthPK60ekRpftkfE5QtnYGzeovaUAiS58MYVzqnnTACDwcJs\n' +
+ 'IGTFE6Wd7sB6r8eI/3CwI1pyJfxepubiQNVAQG0zJETOVkoYKe/5KnteKtnEER3X\n' +
+ 'tCBRdV/rfbxEDG9ZAsYfMl6zzhEWKF88G6xhs2+VZpDqwJNNALvQuzmTx8BNbl5W\n' +
+ 'RUWGq9CQ9GK9GPF570YPCuURW7kl35skofudE9bhURNz51pNoNtk2Z3aEeRx3ouT\n' +
+ 'ifFJlzh+xGJRHqBG7nt5NhX8xbg+vw4xHCeq1aAe6aVFJ3Uf9E2HzLB4SfIT9bRp\n' +
+ 'P7c9c0ySGt+3n+KLSHFf/iQ3E4nft75JdPjeSt0dnyChi1sEKDi0tnWGiXaIg+J+\n' +
+ 'r1ZtcHiyYpCB7l29QYMAdD0TjfDwwPayLmq//c20cPmnSzw271VwqjUT0jYdrNAm\n' +
+ 'gV+JfW9t4ixtE3xF2jaUh/NzL3bAmN5v8+9k/aqPXlU1BgE3uPwMCjrfn7V0I7I1\n' +
+ 'WLpHyd9jF3U/Ysci6H6i8YKgaPiOfySimQiDu1idmPld659qerutUSemQWmPD3bE\n' +
+ 'dcjZolmzS9U0Ujq/jDF1YayN3G3xvry1qWkTci0qMRMu2dZu30Herugh9vsdTYkf\n' +
+ '00EqngPbqtIVLDrDjEQLqPcb8QvWFQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBQBqg8Za/L0YMHURGExHfvPyfLbOTAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBACAGPMa1QL7P/FIO7jEtMelJ0hQlQepKnGtbKz4r\n' +
+ 'Xq1bUX1jnLvnAieR9KZmeQVuKi3g3CDU6b0mDgygS+FL1KDDcGRCSPh238Ou8KcG\n' +
+ 'HIxtt3CMwMHMa9gmdcMlR5fJF9vhR0C56KM2zvyelUY51B/HJqHwGvWuexryXUKa\n' +
+ 'wq1/iK2/d9mNeOcjDvEIj0RCMI8dFQCJv3PRCTC36XS36Tzr6F47TcTw1c3mgKcs\n' +
+ 'xpcwt7ezrXMUunzHS4qWAA5OGdzhYlcv+P5GW7iAA7TDNrBF+3W4a/6s9v2nQAnX\n' +
+ 'UvXd9ul0ob71377UhZbJ6SOMY56+I9cJOOfF5QvaL83Sz29Ij1EKYw/s8TYdVqAq\n' +
+ '+dCyQZBkMSnDFLVe3J1KH2SUSfm3O98jdPORQrUlORQVYCHPls19l2F6lCmU7ICK\n' +
+ 'hRt8EVSpXm4sAIA7zcnR2nU00UH8YmMQLnx5ok9YGhuh3Ehk6QlTQLJux6LYLskd\n' +
+ '9YHOLGW/t6knVtV78DgPqDeEx/Wu/5A8R0q7HunpWxr8LCPBK6hksZnOoUhhb8IP\n' +
+ 'vl46Ve5Tv/FlkyYr1RTVjETmg7lb16a8J0At14iLtpZWmwmuv4agss/1iBVMXfFk\n' +
+ '+ZGtx5vytWU5XJmsfKA51KLsMQnhrLxb3X3zC+JRCyJoyc8++F3YEcRi2pkRYE3q\n' +
+ 'Hing\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRANxgyBbnxgTEOpDul2ZnC0UwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMyBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNjEwMTgxOTA3WhgPMjA2MTA2MTAxOTE5MDda\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTMgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'xnwSDAChrMkfk5TA4Dk8hKzStDlSlONzmd3fTG0Wqr5+x3EmFT6Ksiu/WIwEl9J2\n' +
+ 'K98UI7vYyuZfCxUKb1iMPeBdVGqk0zb92GpURd+Iz/+K1ps9ZLeGBkzR8mBmAi1S\n' +
+ 'OfpwKiTBzIv6E8twhEn4IUpHsdcuX/2Y78uESpJyM8O5CpkG0JaV9FNEbDkJeBUQ\n' +
+ 'Ao2qqNcH4R0Qcr5pyeqA9Zto1RswgL06BQMI9dTpfwSP5VvkvcNUaLl7Zv5WzLQE\n' +
+ 'JzORWePvdPzzvWEkY/3FPjxBypuYwssKaERW0fkPDmPtykktP9W/oJolKUFI6pXp\n' +
+ 'y+Y6p6/AVdnQD2zZjW5FhQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBT+jEKs96LC+/X4BZkUYUkzPfXdqTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAIGQqgqcQ6XSGkmNebzR6DhadTbfDmbYeN5N0Vuzv+Tdmufb\n' +
+ 'tMGjdjnYMg4B+IVnTKQb+Ox3pL9gbX6KglGK8HupobmIRtwKVth+gYYz3m0SL/Nk\n' +
+ 'haWPYzOm0x3tJm8jSdufJcEob4/ATce9JwseLl76pSWdl5A4lLjnhPPKudUDfH+1\n' +
+ 'BLNUi3lxpp6GkC8aWUPtupnhZuXddolTLOuA3GwTZySI44NfaFRm+o83N1jp+EwD\n' +
+ '6e94M4cTRzjUv6J3MZmSbdtQP/Tk1uz2K4bQZGP0PZC3bVpqiesdE/xr+wbu8uHr\n' +
+ 'cM1JXH0AmXf1yIkTgyWzmvt0k1/vgcw5ixAqvvE=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEATCCAumgAwIBAgIRAMhw98EQU18mIji+unM2YH8wDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMjA2MDYyMTQyMjJaGA8yMDYyMDYwNjIyNDIyMlowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAIeeRoLfTm+7\n' +
+ 'vqm7ZlFSx+1/CGYHyYrOOryM4/Z3dqYVHFMgWTR7V3ziO8RZ6yUanrRcWVX3PZbF\n' +
+ 'AfX0KFE8OgLsXEZIX8odSrq86+/Th5eZOchB2fDBsUB7GuN2rvFBbM8lTI9ivVOU\n' +
+ 'lbuTnYyb55nOXN7TpmH2bK+z5c1y9RVC5iQsNAl6IJNvSN8VCqXh31eK5MlKB4DT\n' +
+ '+Y3OivCrSGsjM+UR59uZmwuFB1h+icE+U0p9Ct3Mjq3MzSX5tQb6ElTNGlfmyGpW\n' +
+ 'Kh7GQ5XU1KaKNZXoJ37H53woNSlq56bpVrKI4uv7ATpdpFubOnSLtpsKlpLdR3sy\n' +
+ 'Ws245200pC8CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUp0ki\n' +
+ '6+eWvsnBjQhMxwMW5pwn7DgwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUA\n' +
+ 'A4IBAQB2V8lv0aqbYQpj/bmVv/83QfE4vOxKCJAHv7DQ35cJsTyBdF+8pBczzi3t\n' +
+ '3VNL5IUgW6WkyuUOWnE0eqAFOUVj0yTS1jSAtfl3vOOzGJZmWBbqm9BKEdu1D8O6\n' +
+ 'sB8bnomwiab2tNDHPmUslpdDqdabbkWwNWzLJ97oGFZ7KNODMEPXWKWNxg33iHfS\n' +
+ '/nlmnrTVI3XgaNK9qLZiUrxu9Yz5gxi/1K+sG9/Dajd32ZxjRwDipOLiZbiXQrsd\n' +
+ 'qzIMY4GcWf3g1gHL5mCTfk7dG22h/rhPyGV0svaDnsb+hOt6sv1McMN6Y3Ou0mtM\n' +
+ '/UaAXojREmJmTSCNvs2aBny3/2sy\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAMnRxsKLYscJV8Qv5pWbL7swCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyBzYS1lYXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTgxNjAxWhgPMjEyMTA1MTkxOTE2MDFaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgc2EtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEjFOCZgTNVKxLKhUxffiDEvTLFhrmIqdO\n' +
+ 'dKqVdgDoELEzIHWDdC+19aDPitbCYtBVHl65ITu/9pn6mMUl5hhUNtfZuc6A+Iw1\n' +
+ 'sBe0v0qI3y9Q9HdQYrGgeHDh8M5P7E2ho0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBS5L7/8M0TzoBZk39Ps7BkfTB4yJTAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIwI43O0NtWKTgnVv9z0LO5UMZYgSve7GvGTwqktZYCMObE\n' +
+ 'rUI4QerXM9D6JwLy09mqAjEAypfkdLyVWtaElVDUyHFkihAS1I1oUxaaDrynLNQK\n' +
+ 'Ou/Ay+ns+J+GyvyDUjBpVVW1\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQR71Z8lTO5Sj+as2jB7IWXzANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLXdlc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI0MjIwMzIwWhgPMjEyMTA1MjQyMzAzMjBaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtd2VzdC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAM977bHIs1WJijrS\n' +
+ 'XQMfUOhmlJjr2v0K0UjPl52sE1TJ76H8umo1yR4T7Whkd9IwBHNGKXCJtJmMr9zp\n' +
+ 'fB38eLTu+5ydUAXdFuZpRMKBWwPVe37AdJRKqn5beS8HQjd3JXAgGKUNNuE92iqF\n' +
+ 'qi2fIqFMpnJXWo0FIW6s2Dl2zkORd7tH0DygcRi7lgVxCsw1BJQhFJon3y+IV8/F\n' +
+ 'bnbUXSNSDUnDW2EhvWSD8L+t4eiXYsozhDAzhBvojpxhPH9OB7vqFYw5qxFx+G0t\n' +
+ 'lSLX5iWi1jzzc3XyGnB6WInZDVbvnvJ4BGZ+dTRpOCvsoMIn9bz4EQTvu243c7aU\n' +
+ 'HbS/kvnCASNt+zk7C6lbmaq0AGNztwNj85Opn2enFciWZVnnJ/4OeefUWQxD0EPp\n' +
+ 'SjEd9Cn2IHzkBZrHCg+lWZJQBKbUVS0lLIMSsLQQ6WvR38jY7D2nxM1A93xWxwpt\n' +
+ 'ZtQnYRCVXH6zt2OwDAFePInWwxUjR5t/wu3XxPgpSfrmTi3WYtr1wFypAJ811e/P\n' +
+ 'yBtswWUQ6BNJQvy+KnOEeGfOwmtdDFYR+GOCfvCihzrKJrxOtHIieehR5Iw3cbXG\n' +
+ 'sm4pDzfMUVvDDz6C2M6PRlJhhClbatHCjik9hxFYEsAlqtVVK9pxaz9i8hOqSFQq\n' +
+ 'kJSQsgWw+oM/B2CyjcSqkSQEu8RLAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFPmrdxpRRgu3IcaB5BTqlprcKdTsMA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEAVdlxWjPvVKky3kn8ZizeM4D+EsLw9dWLau2UD/ls\n' +
+ 'zwDCFoT6euagVeCknrn+YEl7g20CRYT9iaonGoMUPuMR/cdtPL1W/Rf40PSrGf9q\n' +
+ 'QuxavWiHLEXOQTCtCaVZMokkvjuuLNDXyZnstgECuiZECTwhexUF4oiuhyGk9o01\n' +
+ 'QMaiz4HX4lgk0ozALUvEzaNd9gWEwD2qe+rq9cQMTVq3IArUkvTIftZUaVUMzr0O\n' +
+ 'ed1+zAsNa9nJhURJ/6anJPJjbQgb5qA1asFcp9UaMT1ku36U3gnR1T/BdgG2jX3X\n' +
+ 'Um0UcaGNVPrH1ukInWW743pxWQb7/2sumEEMVh+jWbB18SAyLI4WIh4lkurdifzS\n' +
+ 'IuTFp8TEx+MouISFhz/vJDWZ84tqoLVjkEcP6oDypq9lFoEzHDJv3V1CYcIgOusT\n' +
+ 'k1jm9P7BXdTG7TYzUaTb9USb6bkqkD9EwJAOSs7DI94aE6rsSws2yAHavjAMfuMZ\n' +
+ 'sDAZvkqS2Qg2Z2+CI6wUZn7mzkJXbZoqRjDvChDXEB1mIhzVXhiNW/CR5WKVDvlj\n' +
+ '9v1sdGByh2pbxcLQtVaq/5coM4ANgphoNz3pOYUPWHS+JUrIivBZ+JobjXcxr3SN\n' +
+ '9iDzcu5/FVVNbq7+KN/nvPMngT+gduEN5m+EBjm8GukJymFG0m6BENRA0QSDqZ7k\n' +
+ 'zDY=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAK5EYG3iHserxMqgg+0EFjgwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI0MjAyMzE2WhgPMjA2MTA1MjQyMTIzMTZa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTMgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 's1L6TtB84LGraLHVC+rGPhLBW2P0oN/91Rq3AnYwqDOuTom7agANwEjvLq7dSRG/\n' +
+ 'sIfZsSV/ABTgArZ5sCmLjHFZAo8Kd45yA9byx20RcYtAG8IZl+q1Cri+s0XefzyO\n' +
+ 'U6mlfXZkVe6lzjlfXBkrlE/+5ifVbJK4dqOS1t9cWIpgKqv5fbE6Qbq4LVT+5/WM\n' +
+ 'Vd2BOljuBMGMzdZubqFKFq4mzTuIYfnBm7SmHlZfTdfBYPP1ScNuhpjuzw4n3NCR\n' +
+ 'EdU6dQv04Q6th4r7eiOCwbWI9LkmVbvBe3ylhH63lApC7MiiPYLlB13xBubVHVhV\n' +
+ 'q1NHoNTi+zA3MN9HWicRxQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBSuxoqm0/wjNiZLvqv+JlQwsDvTPDAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAFfTK/j5kv90uIbM8VaFdVbr/6weKTwehafT0pAk1bfLVX+7\n' +
+ 'uf8oHgYiyKTTl0DFQicXejghXTeyzwoEkWSR8c6XkhD5vYG3oESqmt/RGvvoxz11\n' +
+ 'rHHy7yHYu7RIUc3VQG60c4qxXv/1mWySGwVwJrnuyNT9KZXPevu3jVaWOVHEILaK\n' +
+ 'HvzQ2YEcWBPmde/zEseO2QeeGF8FL45Q1d66wqIP4nNUd2pCjeTS5SpB0MMx7yi9\n' +
+ 'ki1OH1pv8tOuIdimtZ7wkdB8+JSZoaJ81b8sRrydRwJyvB88rftuI3YB4WwGuONT\n' +
+ 'ZezUPsmaoK69B0RChB0ofDpAaviF9V3xOWvVZfo=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGDzCCA/egAwIBAgIRAI0sMNG2XhaBMRN3zD7ZyoEwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZ8xCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE4MDYGA1UEAwwv\n' +
+ 'QW1hem9uIFJEUyBQcmV2aWV3IHVzLWVhc3QtMiBSb290IENBIFJTQTQwOTYgRzEx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUwIBcNMjEwNTE4MjA1NzUwWhgPMjEyMTA1MTgyMTU3\n' +
+ 'NTBaMIGfMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNl\n' +
+ 'cywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExODA2BgNV\n' +
+ 'BAMML0FtYXpvbiBSRFMgUHJldmlldyB1cy1lYXN0LTIgUm9vdCBDQSBSU0E0MDk2\n' +
+ 'IEcxMRAwDgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIIC\n' +
+ 'CgKCAgEAh/otSiCu4Uw3hu7OJm0PKgLsLRqBmUS6jihcrkxfN2SHmp2zuRflkweU\n' +
+ 'BhMkebzL+xnNvC8okzbgPWtUxSmDnIRhE8J7bvSKFlqs/tmEdiI/LMqe/YIKcdsI\n' +
+ '20UYmvyLIjtDaJIh598SHHlF9P8DB5jD8snJfhxWY+9AZRN+YVTltgQAAgayxkWp\n' +
+ 'M1BbvxpOnz4CC00rE0eqkguXIUSuobb1vKqdKIenlYBNxm2AmtgvQfpsBIQ0SB+8\n' +
+ '8Zip8Ef5rtjSw5J3s2Rq0aYvZPfCVIsKYepIboVwXtD7E9J31UkB5onLBQlaHaA6\n' +
+ 'XlH4srsMmrew5d2XejQGy/lGZ1nVWNsKO0x/Az2QzY5Kjd6AlXZ8kq6H68hscA5i\n' +
+ 'OMbNlXzeEQsZH0YkId3+UsEns35AAjZv4qfFoLOu8vDotWhgVNT5DfdbIWZW3ZL8\n' +
+ 'qbmra3JnCHuaTwXMnc25QeKgVq7/rG00YB69tCIDwcf1P+tFJWxvaGtV0g2NthtB\n' +
+ 'a+Xo09eC0L53gfZZ3hZw1pa3SIF5dIZ6RFRUQ+lFOux3Q/I3u+rYstYw7Zxc4Zeo\n' +
+ 'Y8JiedpQXEAnbw2ECHix/L6mVWgiWCiDzBnNLLdbmXjJRnafNSndSfFtHCnY1SiP\n' +
+ 'aCrNpzwZIJejoV1zDlWAMO+gyS28EqzuIq3WJK/TFE7acHkdKIcCAwEAAaNCMEAw\n' +
+ 'DwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUrmV1YASnuudfmqAZP4sKGTvScaEw\n' +
+ 'DgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQBGpEKeQoPvE85tN/25\n' +
+ 'qHFkys9oHDl93DZ62EnOqAUKLd6v0JpCyEiop4nlrJe+4KrBYVBPyKOJDcIqE2Sp\n' +
+ '3cvgJXLhY4i46VM3Qxe8yuYF1ElqBpg3jJVj/sCQnYz9dwoAMWIJFaDWOvmU2E7M\n' +
+ 'MRaKx+sPXFkIjiDA6Bv0m+VHef7aedSYIY7IDltEQHuXoqNacGrYo3I50R+fZs88\n' +
+ '/mB3e/V7967e99D6565yf9Lcjw4oQf2Hy7kl/6P9AuMz0LODnGITwh2TKk/Zo3RU\n' +
+ 'Vgq25RDrT4xJK6nFHyjUF6+4cOBxVpimmFw/VP1zaXT8DN5r4HyJ9p4YuSK8ha5N\n' +
+ '2pJc/exvU8Nv2+vS/efcDZWyuEdZ7eh1IJWQZlOZKIAONfRDRTpeQHJ3zzv3QVYy\n' +
+ 't78pYp/eWBHyVIfEE8p2lFKD4279WYe+Uvdb8c4Jm4TJwqkSJV8ifID7Ub80Lsir\n' +
+ 'lPAU3OCVTBeVRFPXT2zpC4PB4W6KBSuj6OOcEu2y/HgWcoi7Cnjvp0vFTUhDFdus\n' +
+ 'Wz3ucmJjfVsrkEO6avDKu4SwdbVHsk30TVAwPd6srIdi9U6MOeOQSOSE4EsrrS7l\n' +
+ 'SVmu2QIDUVFpm8QAHYplkyWIyGkupyl3ashH9mokQhixIU/Pzir0byePxHLHrwLu\n' +
+ '1axqeKpI0F5SBUPsaVNYY2uNFg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgIQCREfzzVyDTMcNME+gWnTCTANBgkqhkiG9w0BAQsFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA1MjQyMDQyMzNaGA8yMDYxMDUyNDIxNDIzM1ow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDL\n' +
+ '1MT6br3L/4Pq87DPXtcjlXN3cnbNk2YqRAZHJayStTz8VtsFcGPJOpk14geRVeVk\n' +
+ 'e9uKFHRbcyr/RM4owrJTj5X4qcEuATYZbo6ou/rW2kYzuWFZpFp7lqm0vasV4Z9F\n' +
+ 'fChlhwkNks0UbM3G+psCSMNSoF19ERunj7w2c4E62LwujkeYLvKGNepjnaH10TJL\n' +
+ '2krpERd+ZQ4jIpObtRcMH++bTrvklc+ei8W9lqrVOJL+89v2piN3Ecdd389uphst\n' +
+ 'qQdb1BBVXbhUrtuGHgVf7zKqN1SkCoktoWxVuOprVWhSvr7akaWeq0UmlvbEsujU\n' +
+ 'vADqxGMcJFyCzxx3CkJjAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0O\n' +
+ 'BBYEFFk8UJmlhoxFT3PP12PvhvazHjT4MA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAfFtr2lGoWVXmWAsIo2NYre7kzL8Xb9Tx7desKxCCz5HOOvIr\n' +
+ '8JMB1YK6A7IOvQsLJQ/f1UnKRh3X3mJZjKIywfrMSh0FiDf+rjcEzXxw2dGtUem4\n' +
+ 'A+WMvIA3jwxnJ90OQj5rQ8bg3iPtE6eojzo9vWQGw/Vu48Dtw1DJo9210Lq/6hze\n' +
+ 'hPhNkFh8fMXNT7Q1Wz/TJqJElyAQGNOXhyGpHKeb0jHMMhsy5UNoW5hLeMS5ffao\n' +
+ 'TBFWEJ1gVfxIU9QRxSh+62m46JIg+dwDlWv8Aww14KgepspRbMqDuaM2cinoejv6\n' +
+ 't3dyOyHHrsOyv3ffZUKtQhQbQr+sUcL89lARsg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAIJLTMpzGNxqHZ4t+c1MlCIwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBhcC1lYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIxMzAzM1oYDzIwNjEwNTI1MjIzMDMzWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFwLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDtdHut0ZhJ9Nn2\n' +
+ 'MpVafFcwHdoEzx06okmmhjJsNy4l9QYVeh0UUoek0SufRNMRF4d5ibzpgZol0Y92\n' +
+ '/qKWNe0jNxhEj6sXyHsHPeYtNBPuDMzThfbvsLK8z7pBP7vVyGPGuppqW/6m4ZBB\n' +
+ 'lcc9fsf7xpZ689iSgoyjiT6J5wlVgmCx8hFYc/uvcRtfd8jAHvheug7QJ3zZmIye\n' +
+ 'V4htOW+fRVWnBjf40Q+7uTv790UAqs0Zboj4Yil+hER0ibG62y1g71XcCyvcVpto\n' +
+ '2/XW7Y9NCgMNqQ7fGN3wR1gjtSYPd7DO32LTzYhutyvfbpAZjsAHnoObmoljcgXI\n' +
+ 'QjfBcCFpAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFJI3aWLg\n' +
+ 'CS5xqU5WYVaeT5s8lpO0MA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAUwATpJOcGVOs3hZAgJwznWOoTzOVJKfrqBum7lvkVH1vBwxBl9CahaKj3ZOt\n' +
+ 'YYp2qJzhDUWludL164DL4ZjS6eRedLRviyy5cRy0581l1MxPWTThs27z+lCC14RL\n' +
+ 'PJZNVYYdl7Jy9Q5NsQ0RBINUKYlRY6OqGDySWyuMPgno2GPbE8aynMdKP+f6G/uE\n' +
+ 'YHOf08gFDqTsbyfa70ztgVEJaRooVf5JJq4UQtpDvVswW2reT96qi6tXPKHN5qp3\n' +
+ '3wI0I1Mp4ePmiBKku2dwYzPfrJK/pQlvu0Gu5lKOQ65QdotwLAAoaFqrf9za1yYs\n' +
+ 'INUkHLWIxDds+4OHNYcerGp5Dw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAIO6ldra1KZvNWJ0TA1ihXEwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIxMjE0NTA1WhgPMjEyMTA1MjEyMjQ1MDVa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'sDN52Si9pFSyZ1ruh3xAN0nVqEs960o2IK5CPu/ZfshFmzAwnx/MM8EHt/jMeZtj\n' +
+ 'SM58LADAsNDL01ELpFZATjgZQ6xNAyXRXE7RiTRUvNkK7O3o2qAGbLnJq/UqF7Sw\n' +
+ 'LRnB8V6hYOv+2EjVnohtGCn9SUFGZtYDjWXsLd4ML4Zpxv0a5LK7oEC7AHzbUR7R\n' +
+ 'jsjkrXqSv7GE7bvhSOhMkmgxgj1F3J0b0jdQdtyyj109aO0ATUmIvf+Bzadg5AI2\n' +
+ 'A9UA+TUcGeebhpHu8AP1Hf56XIlzPpaQv3ZJ4vzoLaVNUC7XKzAl1dlvCl7Klg/C\n' +
+ '84qmbD/tjZ6GHtzpLKgg7kQEV7mRoXq8X4wDX2AFPPQl2fv+Kbe+JODqm5ZjGegm\n' +
+ 'uskABBi8IFv1hYx9jEulZPxC6uD/09W2+niFm3pirnlWS83BwVDTUBzF+CooUIMT\n' +
+ 'jhWkIIZGDDgMJTzouBHfoSJtS1KpUZi99m2WyVs21MNKHeWAbs+zmI6TO5iiMC+T\n' +
+ 'uB8spaOiHFO1573Fmeer4sy3YA6qVoqVl6jjTQqOdy3frAMbCkwH22/crV8YA+08\n' +
+ 'hLeHXrMK+6XUvU+EtHAM3VzcrLbuYJUI2XJbzTj5g0Eb8I8JWsHvWHR5K7Z7gceR\n' +
+ '78AzxQmoGEfV6KABNWKsgoCQnfb1BidDJIe3BsI0A6UCAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUABp0MlB14MSHgAcuNSOhs3MOlUcwDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQCv4CIOBSQi/QR9NxdRgVAG/pAh\n' +
+ 'tFJhV7OWb/wqwsNKFDtg6tTxwaahdCfWpGWId15OUe7G9LoPiKiwM9C92n0ZeHRz\n' +
+ '4ewbrQVo7Eu1JI1wf0rnZJISL72hVYKmlvaWaacHhWxvsbKLrB7vt6Cknxa+S993\n' +
+ 'Kf8i2Psw8j5886gaxhiUtzMTBwoDWak8ZaK7m3Y6C6hXQk08+3pnIornVSFJ9dlS\n' +
+ 'PAqt5UPwWmrEfF+0uIDORlT+cvrAwgSp7nUF1q8iasledycZ/BxFgQqzNwnkBDwQ\n' +
+ 'Z/aM52ArGsTzfMhkZRz9HIEhz1/0mJw8gZtDVQroD8778h8zsx2SrIz7eWQ6uWsD\n' +
+ 'QEeSWXpcheiUtEfzkDImjr2DLbwbA23c9LoexUD10nwohhoiQQg77LmvBVxeu7WU\n' +
+ 'E63JqaYUlOLOzEmNJp85zekIgR8UTkO7Gc+5BD7P4noYscI7pPOL5rP7YLg15ZFi\n' +
+ 'ega+G53NTckRXz4metsd8XFWloDjZJJq4FfD60VuxgXzoMNT9wpFTNSH42PR2s9L\n' +
+ 'I1vcl3w8yNccs9se2utM2nLsItZ3J0m/+QSRiw9hbrTYTcM9sXki0DtH2kyIOwYf\n' +
+ 'lOrGJDiYOIrXSQK36H0gQ+8omlrUTvUj4msvkXuQjlfgx6sgp2duOAfnGxE7uHnc\n' +
+ 'UhnJzzoe6M+LfGHkVQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj2gAwIBAgIQSAG6j2WHtWUUuLGJTPb1nTAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE2MzgyNloYDzIxMjEwNTIwMTczODI2WjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAE2eqwU4FOzW8RV1W381Bd\n' +
+ 'olhDOrqoMqzWli21oDUt7y8OnXM/lmAuOS6sr8Nt61BLVbONdbr+jgCYw75KabrK\n' +
+ 'ZGg3siqvMOgabIKkKuXO14wtrGyGDt7dnKXg5ERGYOZlo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBS1Acp2WYxOcblv5ikZ3ZIbRCCW+zAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaQAwZgIxAJL84J08PBprxmsAKPTotBuVI3MyW1r8\n' +
+ 'xQ0i8lgCQUf8GcmYjQ0jI4oZyv+TuYJAcwIxAP9Xpzq0Docxb+4N1qVhpiOfWt1O\n' +
+ 'FnemFiy9m1l+wv6p3riQMPV7mBVpklmijkIv3Q==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRALZLcqCVIJ25maDPE3sbPCIwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIxMjEzOTM5WhgPMjA2MTA1MjEyMjM5Mzla\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'ypKc+6FfGx6Gl6fQ78WYS29QoKgQiur58oxR3zltWeg5fqh9Z85K5S3UbRSTqWWu\n' +
+ 'Xcfnkz0/FS07qHX+nWAGU27JiQb4YYqhjZNOAq8q0+ptFHJ6V7lyOqXBq5xOzO8f\n' +
+ '+0DlbJSsy7GEtJp7d7QCM3M5KVY9dENVZUKeJwa8PC5StvwPx4jcLeZRJC2rAVDG\n' +
+ 'SW7NAInbATvr9ssSh03JqjXb+HDyywiqoQ7EVLtmtXWimX+0b3/2vhqcH5jgcKC9\n' +
+ 'IGFydrjPbv4kwMrKnm6XlPZ9L0/3FMzanXPGd64LQVy51SI4d5Xymn0Mw2kMX8s6\n' +
+ 'Nf05OsWcDzJ1n6/Q1qHSxQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBRmaIc8eNwGP7i6P7AJrNQuK6OpFzAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAIBeHfGwz3S2zwIUIpqEEI5/sMySDeS+3nJR+woWAHeO0C8i\n' +
+ 'BJdDh+kzzkP0JkWpr/4NWz84/IdYo1lqASd1Kopz9aT1+iROXaWr43CtbzjXb7/X\n' +
+ 'Zv7eZZFC8/lS5SROq42pPWl4ekbR0w8XGQElmHYcWS41LBfKeHCUwv83ATF0XQ6I\n' +
+ '4t+9YSqZHzj4vvedrvcRInzmwWJaal9s7Z6GuwTGmnMsN3LkhZ+/GD6oW3pU/Pyh\n' +
+ 'EtWqffjsLhfcdCs3gG8x9BbkcJPH5aPAVkPn4wc8wuXg6xxb9YGsQuY930GWTYRf\n' +
+ 'schbgjsuqznW4HHakq4WNhs1UdTSTKkRdZz7FUQ=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDzCCAvegAwIBAgIRAM2zAbhyckaqRim63b+Tib8wDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZ8xCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE4MDYGA1UEAwwv\n' +
+ 'QW1hem9uIFJEUyBQcmV2aWV3IHVzLWVhc3QtMiBSb290IENBIFJTQTIwNDggRzEx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUwIBcNMjEwNTE4MjA0OTQ1WhgPMjA2MTA1MTgyMTQ5\n' +
+ 'NDVaMIGfMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNl\n' +
+ 'cywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExODA2BgNV\n' +
+ 'BAMML0FtYXpvbiBSRFMgUHJldmlldyB1cy1lYXN0LTIgUm9vdCBDQSBSU0EyMDQ4\n' +
+ 'IEcxMRAwDgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB\n' +
+ 'CgKCAQEA1ybjQMH1MkbvfKsWJaCTXeCSN1SG5UYid+Twe+TjuSqaXWonyp4WRR5z\n' +
+ 'tlkqq+L2MWUeQQAX3S17ivo/t84mpZ3Rla0cx39SJtP3BiA2BwfUKRjhPwOjmk7j\n' +
+ '3zrcJjV5k1vSeLNOfFFSlwyDiVyLAE61lO6onBx+cRjelu0egMGq6WyFVidTdCmT\n' +
+ 'Q9Zw3W6LTrnPvPmEyjHy2yCHzH3E50KSd/5k4MliV4QTujnxYexI2eR8F8YQC4m3\n' +
+ 'DYjXt/MicbqA366SOoJA50JbgpuVv62+LSBu56FpzY12wubmDZsdn4lsfYKiWxUy\n' +
+ 'uc83a2fRXsJZ1d3whxrl20VFtLFHFQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBRC0ytKmDYbfz0Bz0Psd4lRQV3aNTAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQELBQADggEBAGv8qZu4uaeoF6zsbumauz6ea6tdcWt+hGFuwGrb\n' +
+ 'tRbI85ucAmVSX06x59DJClsb4MPhL1XmqO3RxVMIVVfRwRHWOsZQPnXm8OYQ2sny\n' +
+ 'rYuFln1COOz1U/KflZjgJmxbn8x4lYiTPZRLarG0V/OsCmnLkQLPtEl/spMu8Un7\n' +
+ 'r3K8SkbWN80gg17Q8EV5mnFwycUx9xsTAaFItuG0en9bGsMgMmy+ZsDmTRbL+lcX\n' +
+ 'Fq8r4LT4QjrFz0shrzCwuuM4GmcYtBSxlacl+HxYEtAs5k10tmzRf6OYlY33tGf6\n' +
+ '1tkYvKryxDPF/EDgGp/LiBwx6ixYMBfISoYASt4V/ylAlHA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtTCCAjqgAwIBAgIRAK9BSZU6nIe6jqfODmuVctYwCgYIKoZIzj0EAwMwgZkx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1h\n' +
+ 'em9uIFJEUyBjYS1jZW50cmFsLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTIxMjIxMzA5WhgPMjEyMTA1MjEyMzEzMDlaMIGZMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMjAwBgNVBAMMKUFtYXpv\n' +
+ 'biBSRFMgY2EtY2VudHJhbC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEUkEERcgxneT5H+P+fERcbGmf\n' +
+ 'bVx+M7rNWtgWUr6w+OBENebQA9ozTkeSg4c4M+qdYSObFqjxITdYxT1z/nHz1gyx\n' +
+ 'OKAhLjWu+nkbRefqy3RwXaWT680uUaAP6ccnkZOMo0IwQDAPBgNVHRMBAf8EBTAD\n' +
+ 'AQH/MB0GA1UdDgQWBBSN6fxlg0s5Wny08uRBYZcQ3TUoyzAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwCgYIKoZIzj0EAwMDaQAwZgIxAORaz+MBVoFBTmZ93j2G2vYTwA6T5hWzBWrx\n' +
+ 'CrI54pKn5g6At56DBrkjrwZF5T1enAIxAJe/LZ9xpDkAdxDgGJFN8gZYLRWc0NRy\n' +
+ 'Rb4hihy5vj9L+w9uKc9VfEBIFuhT7Z3ljg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQB/57HSuaqUkLaasdjxUdPjANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE3NDAzNFoYDzIwNjEwNTE5MTg0MDM0WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAtbkaoVsUS76o\n' +
+ 'TgLFmcnaB8cswBk1M3Bf4IVRcwWT3a1HeJSnaJUqWHCJ+u3ip/zGVOYl0gN1MgBb\n' +
+ 'MuQRIJiB95zGVcIa6HZtx00VezDTr3jgGWRHmRjNVCCHGmxOZWvJjsIE1xavT/1j\n' +
+ 'QYV/ph4EZEIZ/qPq7e3rHohJaHDe23Z7QM9kbyqp2hANG2JtU/iUhCxqgqUHNozV\n' +
+ 'Zd0l5K6KnltZQoBhhekKgyiHqdTrH8fWajYl5seD71bs0Axowb+Oh0rwmrws3Db2\n' +
+ 'Dh+oc2PwREnjHeca9/1C6J2vhY+V0LGaJmnnIuOANrslx2+bgMlyhf9j0Bv8AwSi\n' +
+ 'dSWsobOhNQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBQb7vJT\n' +
+ 'VciLN72yJGhaRKLn6Krn2TAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAAxEj8N9GslReAQnNOBpGl8SLgCMTejQ6AW/bapQvzxrZrfVOZOYwp/5oV0f\n' +
+ '9S1jcGysDM+DrmfUJNzWxq2Y586R94WtpH4UpJDGqZp+FuOVJL313te4609kopzO\n' +
+ 'lDdmd+8z61+0Au93wB1rMiEfnIMkOEyt7D2eTFJfJRKNmnPrd8RjimRDlFgcLWJA\n' +
+ '3E8wca67Lz/G0eAeLhRHIXv429y8RRXDtKNNz0wA2RwURWIxyPjn1fHjA9SPDkeW\n' +
+ 'E1Bq7gZj+tBnrqz+ra3yjZ2blss6Ds3/uRY6NYqseFTZWmQWT7FolZEnT9vMUitW\n' +
+ 'I0VynUbShVpGf6946e0vgaaKw20=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQGyUVTaVjYJvWhroVEiHPpDANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLXdlc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTE5MTkwNDA2WhgPMjA2MTA1MTkyMDA0MDZaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtd2VzdC0xIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBANhyXpJ0t4nigRDZ\n' +
+ 'EwNtFOem1rM1k8k5XmziHKDvDk831p7QsX9ZOxl/BT59Pu/P+6W6SvasIyKls1sW\n' +
+ 'FJIjFF+6xRQcpoE5L5evMgN/JXahpKGeQJPOX9UEXVW5B8yi+/dyUitFT7YK5LZA\n' +
+ 'MqWBN/LtHVPa8UmE88RCDLiKkqiv229tmwZtWT7nlMTTCqiAHMFcryZHx0pf9VPh\n' +
+ 'x/iPV8p2gBJnuPwcz7z1kRKNmJ8/cWaY+9w4q7AYlAMaq/rzEqDaN2XXevdpsYAK\n' +
+ 'TMMj2kji4x1oZO50+VPNfBl5ZgJc92qz1ocF95SAwMfOUsP8AIRZkf0CILJYlgzk\n' +
+ '/6u6qZECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUm5jfcS9o\n' +
+ '+LwL517HpB6hG+PmpBswDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQAcQ6lsqxi63MtpGk9XK8mCxGRLCad51+MF6gcNz6i6PAqhPOoKCoFqdj4cEQTF\n' +
+ 'F8dCfa3pvfJhxV6RIh+t5FCk/y6bWT8Ls/fYKVo6FhHj57bcemWsw/Z0XnROdVfK\n' +
+ 'Yqbc7zvjCPmwPHEqYBhjU34NcY4UF9yPmlLOL8uO1JKXa3CAR0htIoW4Pbmo6sA4\n' +
+ '6P0co/clW+3zzsQ92yUCjYmRNeSbdXbPfz3K/RtFfZ8jMtriRGuO7KNxp8MqrUho\n' +
+ 'HK8O0mlSUxGXBZMNicfo7qY8FD21GIPH9w5fp5oiAl7lqFzt3E3sCLD3IiVJmxbf\n' +
+ 'fUwpGd1XZBBSdIxysRLM6j48\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrTCCAjOgAwIBAgIQU+PAILXGkpoTcpF200VD/jAKBggqhkjOPQQDAzCBljEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMS8wLQYDVQQDDCZBbWF6\n' +
+ 'b24gUkRTIGFwLWVhc3QtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTAgFw0yMTA1MjUyMTQ1MTFaGA8yMTIxMDUyNTIyNDUxMVowgZYxCzAJBgNV\n' +
+ 'BAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYD\n' +
+ 'VQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1hem9uIFJE\n' +
+ 'UyBhcC1lYXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0bGUw\n' +
+ 'djAQBgcqhkjOPQIBBgUrgQQAIgNiAAT3tFKE8Kw1sGQAvNLlLhd8OcGhlc7MiW/s\n' +
+ 'NXm3pOiCT4vZpawKvHBzD76Kcv+ZZzHRxQEmG1/muDzZGlKR32h8AAj+NNO2Wy3d\n' +
+ 'CKTtYMiVF6Z2zjtuSkZQdjuQbe4eQ7qjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD\n' +
+ 'VR0OBBYEFAiSQOp16Vv0Ohpvqcbd2j5RmhYNMA4GA1UdDwEB/wQEAwIBhjAKBggq\n' +
+ 'hkjOPQQDAwNoADBlAjBVsi+5Ape0kOhMt/WFkANkslD4qXA5uqhrfAtH29Xzz2NV\n' +
+ 'tR7akiA771OaIGB/6xsCMQCZt2egCtbX7J0WkuZ2KivTh66jecJr5DHvAP4X2xtS\n' +
+ 'F/5pS+AUhcKTEGjI9jDH3ew=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj2gAwIBAgIQT5mGlavQzFHsB7hV6Mmy6TAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNDIwNTAxNVoYDzIxMjEwNTI0MjE1MDE1WjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEcm4BBBjYK7clwm0HJRWS\n' +
+ 'flt3iYwoJbIXiXn9c1y3E+Vb7bmuyKhS4eO8mwO4GefUcXObRfoHY2TZLhMJLVBQ\n' +
+ '7MN2xDc0RtZNj07BbGD3VAIFRTDX0mH9UNYd0JQM3t/Oo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBRrd5ITedfAwrGo4FA9UaDaGFK3rjAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaQAwZgIxAPBNqmVv1IIA3EZyQ6XuVf4gj79/DMO8\n' +
+ 'bkicNS1EcBpUqbSuU4Zwt2BYc8c/t7KVOQIxAOHoWkoKZPiKyCxfMtJpCZySUG+n\n' +
+ 'sXgB/LOyWE5BJcXUfm+T1ckeNoWeUUMOLmnJjg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAJcDeinvdNrDQBeJ8+t38WQwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtNCBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjIwNTI1MTY0OTE2WhgPMjA2MjA1MjUxNzQ5MTZa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTQgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'k8DBNkr9tMoIM0NHoFiO7cQfSX0cOMhEuk/CHt0fFx95IBytx7GHCnNzpM27O5z6\n' +
+ 'x6iRhfNnx+B6CrGyCzOjxvPizneY+h+9zfvNz9jj7L1I2uYMuiNyOKR6FkHR46CT\n' +
+ '1CiArfVLLPaTqgD/rQjS0GL2sLHS/0dmYipzynnZcs613XT0rAWdYDYgxDq7r/Yi\n' +
+ 'Xge5AkWQFkMUq3nOYDLCyGGfQqWKkwv6lZUHLCDKf+Y0Uvsrj8YGCI1O8mF0qPCQ\n' +
+ 'lmlfaDvbuBu1AV+aabmkvyFj3b8KRIlNLEtQ4N8KGYR2Jdb82S4YUGIOAt4wuuFt\n' +
+ '1B7AUDLk3V/u+HTWiwfoLQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBSNpcjz6ArWBtAA+Gz6kyyZxrrgdDAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAGJEd7UgOzHYIcQRSF7nSYyjLROyalaIV9AX4WXW/Cqlul1c\n' +
+ 'MblP5etDZm7A/thliZIWAuyqv2bNicmS3xKvNy6/QYi1YgxZyy/qwJ3NdFl067W0\n' +
+ 't8nGo29B+EVK94IPjzFHWShuoktIgp+dmpijB7wkTIk8SmIoe9yuY4+hzgqk+bo4\n' +
+ 'ms2SOXSN1DoQ75Xv+YmztbnZM8MuWhL1T7hA4AMorzTQLJ9Pof8SpSdMHeDsHp0R\n' +
+ '01jogNFkwy25nw7cL62nufSuH2fPYGWXyNDg+y42wKsKWYXLRgUQuDVEJ2OmTFMB\n' +
+ 'T0Vf7VuNijfIA9hkN2d3K53m/9z5WjGPSdOjGhg=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQRiwspKyrO0xoxDgSkqLZczANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLXdlc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI0MjE1OTAwWhgPMjA2MTA1MjQyMjU5MDBaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtd2VzdC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAL53Jk3GsKiu+4bx\n' +
+ 'jDfsevWbwPCNJ3H08Zp7GWhvI3Tgi39opfHYv2ku2BKFjK8N2L6RvNPSR8yplv5j\n' +
+ 'Y0tK0U+XVNl8o0ibhqRDhbTuh6KL8CFINWYzAajuxFS+CF0U6c1Q3tXLBdALxA7l\n' +
+ 'FlXJ71QrP06W31kRe7kvgrvO7qWU3/OzUf9qYw4LSiR1/VkvvRCTqcVNw09clw/M\n' +
+ 'Jbw6FSgweN65M9j7zPbjGAXSHkXyxH1Erin2fa+B9PE4ZDgX9cp2C1DHewYJQL/g\n' +
+ 'SepwwcudVNRN1ibKH7kpMrgPnaNIVNx5sXVsTjk6q2ZqYw3SVHegltJpLy/cZReP\n' +
+ 'mlivF2kCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUmTcQd6o1\n' +
+ 'CuS65MjBrMwQ9JJjmBwwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQAKSDSIzl956wVddPThf2VAzI8syw9ngSwsEHZvxVGHBvu5gg618rDyguVCYX9L\n' +
+ '4Kw/xJrk6S3qxOS2ZDyBcOpsrBskgahDFIunzoRP3a18ARQVq55LVgfwSDQiunch\n' +
+ 'Bd05cnFGLoiLkR5rrkgYaP2ftn3gRBRaf0y0S3JXZ2XB3sMZxGxavYq9mfiEcwB0\n' +
+ 'LMTMQ1NYzahIeG6Jm3LqRqR8HkzP/Ztq4dT2AtSLvFebbNMiWqeqT7OcYp94HTYT\n' +
+ 'zqrtaVdUg9bwyAUCDgy0GV9RHDIdNAOInU/4LEETovrtuBU7Z1q4tcHXvN6Hd1H8\n' +
+ 'gMb0mCG5I393qW5hFsA/diFb\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAPQAvihfjBg/JDbj6U64K98wDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIwMTYyODQxWhgPMjA2MTA1MjAxNzI4NDFa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'vJ9lgyksCxkBlY40qOzI1TCj/Q0FVGuPL/Z1Mw2YN0l+41BDv0FHApjTUkIKOeIP\n' +
+ 'nwDwpXTa3NjYbk3cOZ/fpH2rYJ++Fte6PNDGPgKppVCUh6x3jiVZ1L7wOgnTdK1Q\n' +
+ 'Trw8440IDS5eLykRHvz8OmwvYDl0iIrt832V0QyOlHTGt6ZJ/aTQKl12Fy3QBLv7\n' +
+ 'stClPzvHTrgWqVU6uidSYoDtzHbU7Vda7YH0wD9IUoMBf7Tu0rqcE4uH47s2XYkc\n' +
+ 'SdLEoOg/Ngs7Y9B1y1GCyj3Ux7hnyvCoRTw014QyNB7dTatFMDvYlrRDGG14KeiU\n' +
+ 'UL7Vo/+EejWI31eXNLw84wIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBQkgTWFsNg6wA3HbbihDQ4vpt1E2zAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAGz1Asiw7hn5WYUj8RpOCzpE0h/oBZcnxP8wulzZ5Xd0YxWO\n' +
+ '0jYUcUk3tTQy1QvoY+Q5aCjg6vFv+oFBAxkib/SmZzp4xLisZIGlzpJQuAgRkwWA\n' +
+ '6BVMgRS+AaOMQ6wKPgz1x4v6T0cIELZEPq3piGxvvqkcLZKdCaeC3wCS6sxuafzZ\n' +
+ '4qA3zMwWuLOzRftgX2hQto7d/2YkRXga7jSvQl3id/EI+xrYoH6zIWgjdU1AUaNq\n' +
+ 'NGT7DIo47vVMfnd9HFZNhREsd4GJE83I+JhTqIxiKPNxrKgESzyADmNPt0gXDnHo\n' +
+ 'tbV1pMZz5HpJtjnP/qVZhEK5oB0tqlKPv9yx074=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuTCCAj6gAwIBAgIRAKp1Rn3aL/g/6oiHVIXtCq8wCgYIKoZIzj0EAwMwgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjQyMDMyMTdaGA8yMTIxMDUyNDIxMzIxN1owgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABGTYWPILeBJXfcL3Dz4z\n' +
+ 'EWMUq78xB1HpjBwHoTURYfcMd5r96BTVG6yaUBWnAVCMeeD6yTG9a1eVGNhG14Hk\n' +
+ 'ZAEjgLiNB7RRbEG5JZ/XV7W/vODh09WCst2y9SLKsdgeAaNCMEAwDwYDVR0TAQH/\n' +
+ 'BAUwAwEB/zAdBgNVHQ4EFgQUoE0qZHmDCDB+Bnm8GUa/evpfPwgwDgYDVR0PAQH/\n' +
+ 'BAQDAgGGMAoGCCqGSM49BAMDA2kAMGYCMQCnil5MMwhY3qoXv0xvcKZGxGPaBV15\n' +
+ '0CCssCKn0oVtdJQfJQ3Jrf3RSaEyijXIJsoCMQC35iJi4cWoNX3N/qfgnHohW52O\n' +
+ 'B5dg0DYMqy5cNZ40+UcAanRMyqNQ6P7fy3umGco=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtzCCAj2gAwIBAgIQPXnDTPegvJrI98qz8WxrMjAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIEJldGEgdXMtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxODIxNDAxMloYDzIxMjEwNTE4MjI0MDEyWjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIEJldGEgdXMtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEI0sR7gwutK5AB46hM761\n' +
+ 'gcLTGBIYlURSEoM1jcBwy56CL+3CJKZwLLyJ7qoOKfWbu5GsVLUTWS8MV6Nw33cx\n' +
+ '2KQD2svb694wi+Px2f4n9+XHkEFQw8BbiodDD7RZA70fo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBTQSioOvnVLEMXwNSDg+zgln/vAkjAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIxAMwu1hqm5Bc98uE/E0B5iMYbBQ4kpMxO\n' +
+ 'tP8FTfz5UR37HUn26nXE0puj6S/Ffj4oJgIwXI7s2c26tFQeqzq6u3lrNJHp5jC9\n' +
+ 'Uxlo/hEJOLoDj5jnpxo8dMAtCNoQPaHdfL0P\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjWgAwIBAgIQGKVv+5VuzEZEBzJ+bVfx2zAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTc1MDU5WhgPMjEyMTA1MTkxODUwNTlaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgYXAtc291dGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABMqdLJ0tZF/DGFZTKZDrGRJZID8ivC2I\n' +
+ 'JRCYTWweZKCKSCAzoiuGGHzJhr5RlLHQf/QgmFcgXsdmO2n3CggzhA4tOD9Ip7Lk\n' +
+ 'P05eHd2UPInyPCHRgmGjGb0Z+RdQ6zkitKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUC1yhRgVqU5bR8cGzOUCIxRpl4EYwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2cAMGQCMG0c/zLGECRPzGKJvYCkpFTCUvdP4J74YP0v/dPvKojL\n' +
+ 't/BrR1Tg4xlfhaib7hPc7wIwFvgqHes20CubQnZmswbTKLUrgSUW4/lcKFpouFd2\n' +
+ 't2/ewfi/0VhkeUW+IiHhOMdU\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAOXxJuyXVkbfhZCkS/dOpfEwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI1MjE1OTEwWhgPMjEyMTA1MjUyMjU5MTBa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'xiP4RDYm4tIS12hGgn1csfO8onQDmK5SZDswUpl0HIKXOUVVWkHNlINkVxbdqpqH\n' +
+ 'FhbyZmNN6F/EWopotMDKe1B+NLrjNQf4zefv2vyKvPHJXhxoKmfyuTd5Wk8k1F7I\n' +
+ 'lNwLQzznB+ElhrLIDJl9Ro8t31YBBNFRGAGEnxyACFGcdkjlsa52UwfYrwreEg2l\n' +
+ 'gW5AzqHgjFfj9QRLydeU/n4bHm0F1adMsV7P3rVwilcUlqsENDwXnWyPEyv3sw6F\n' +
+ 'wNemLEs1129mB77fwvySb+lLNGsnzr8w4wdioZ74co+T9z2ca+eUiP+EQccVw1Is\n' +
+ 'D4Fh57IjPa6Wuc4mwiUYKkKY63+38aCfEWb0Qoi+zW+mE9nek6MOQ914cN12u5LX\n' +
+ 'dBoYopphRO5YmubSN4xcBy405nIdSdbrAVWwxXnVVyjqjknmNeqQsPZaxAhdoKhV\n' +
+ 'AqxNr8AUAdOAO6Sz3MslmcLlDXFihrEEOeUbpg/m1mSUUHGbu966ajTG1FuEHHwS\n' +
+ '7WB52yxoJo/tHvt9nAWnh3uH5BHmS8zn6s6CGweWKbX5yICnZ1QFR1e4pogxX39v\n' +
+ 'XD6YcNOO+Vn+HY4nXmjgSYVC7l+eeP8eduMg1xJujzjrbmrXU+d+cBObgdTOAlpa\n' +
+ 'JFHaGwYw1osAwPCo9cZ2f04yitBfj9aPFia8ASKldakCAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUqKS+ltlior0SyZKYAkJ/efv55towDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQAdElvp8bW4B+Cv+1WSN87dg6TN\n' +
+ 'wGyIjJ14/QYURgyrZiYpUmZpj+/pJmprSWXu4KNyqHftmaidu7cdjL5nCAvAfnY5\n' +
+ '/6eDDbX4j8Gt9fb/6H9y0O0dn3mUPSEKG0crR+JRFAtPhn/2FNvst2P82yguWLv0\n' +
+ 'pHjHVUVcq+HqDMtUIJsTPYjSh9Iy77Q6TOZKln9dyDOWJpCSkiUWQtMAKbCSlvzd\n' +
+ 'zTs/ahqpT+zLfGR1SR+T3snZHgQnbnemmz/XtlKl52NxccARwfcEEKaCRQyGq/pR\n' +
+ '0PVZasyJS9JY4JfQs4YOdeOt4UMZ8BmW1+BQWGSkkb0QIRl8CszoKofucAlqdPcO\n' +
+ 'IT/ZaMVhI580LFGWiQIizWFskX6lqbCyHqJB3LDl8gJISB5vNTHOHpvpMOMs5PYt\n' +
+ 'cRl5Mrksx5MKMqG7y5R734nMlZxQIHjL5FOoOxTBp9KeWIL/Ib89T2QDaLw1SQ+w\n' +
+ 'ihqWBJ4ZdrIMWYpP3WqM+MXWk7WAem+xsFJdR+MDgOOuobVQTy5dGBlPks/6gpjm\n' +
+ 'rO9TjfQ36ppJ3b7LdKUPeRfnYmlR5RU4oyYJ//uLbClI443RZAgxaCXX/nyc12lr\n' +
+ 'eVLUMNF2abLX4/VF63m2/Z9ACgMRfqGshPssn1NN33OonrotQoj4S3N9ZrjvzKt8\n' +
+ 'iHcaqd60QKpfiH2A3A==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj2gAwIBAgIQPaVGRuu86nh/ylZVCLB0MzAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIyMDMxNloYDzIxMjEwNTI1MjMwMzE2WjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEexNURoB9KE93MEtEAlJG\n' +
+ 'obz4LS/pD2hc8Gczix1WhVvpJ8bN5zCDXaKdnDMCebetyRQsmQ2LYlfmCwpZwSDu\n' +
+ '0zowB11Pt3I5Avu2EEcuKTlKIDMBeZ1WWuOd3Tf7MEAMo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBSaYbZPBvFLikSAjpa8mRJvyArMxzAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaQAwZgIxAOEJkuh3Zjb7Ih/zuNRd1RBqmIYcnyw0\n' +
+ 'nwUZczKXry+9XebYj3VQxSRNadrarPWVqgIxAMg1dyGoDAYjY/L/9YElyMnvHltO\n' +
+ 'PwpJShmqHvCLc/mXMgjjYb/akK7yGthvW6j/uQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCDCCA/CgAwIBAgIQChu3v5W1Doil3v6pgRIcVzANBgkqhkiG9w0BAQwFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIEJldGEgdXMtZWFzdC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA1MTgyMTM0MTVaGA8yMTIxMDUxODIyMzQxNVow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBCZXRhIHVzLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC1\n' +
+ 'FUGQ5tf3OwpDR6hGBxhUcrkwKZhaXP+1St1lSOQvjG8wXT3RkKzRGMvb7Ee0kzqI\n' +
+ 'mzKKe4ASIhtV3UUWdlNmP0EA3XKnif6N79MismTeGkDj75Yzp5A6tSvqByCgxIjK\n' +
+ 'JqpJrch3Dszoyn8+XhwDxMZtkUa5nQVdJgPzJ6ltsQ8E4SWLyLtTu0S63jJDkqYY\n' +
+ 'S7cQblk7y7fel+Vn+LS5dGTdRRhMvSzEnb6mkVBaVzRyVX90FNUED06e8q+gU8Ob\n' +
+ 'htvQlf9/kRzHwRAdls2YBhH40ZeyhpUC7vdtPwlmIyvW5CZ/QiG0yglixnL6xahL\n' +
+ 'pbmTuTSA/Oqz4UGQZv2WzHe1lD2gRHhtFX2poQZeNQX8wO9IcUhrH5XurW/G9Xwl\n' +
+ 'Sat9CMPERQn4KC3HSkat4ir2xaEUrjfg6c4XsGyh2Pk/LZ0gLKum0dyWYpWP4JmM\n' +
+ 'RQNjrInXPbMhzQObozCyFT7jYegS/3cppdyy+K1K7434wzQGLU1gYXDKFnXwkX8R\n' +
+ 'bRKgx2pHNbH5lUddjnNt75+e8m83ygSq/ZNBUz2Ur6W2s0pl6aBjwaDES4VfWYlI\n' +
+ 'jokcmrGvJNDfQWygb1k00eF2bzNeNCHwgWsuo3HSxVgc/WGsbcGrTlDKfz+g3ich\n' +
+ 'bXUeUidPhRiv5UQIVCLIHpHuin3bj9lQO/0t6p+tAQIDAQABo0IwQDAPBgNVHRMB\n' +
+ 'Af8EBTADAQH/MB0GA1UdDgQWBBSFmMBgm5IsRv3hLrvDPIhcPweXYTAOBgNVHQ8B\n' +
+ 'Af8EBAMCAYYwDQYJKoZIhvcNAQEMBQADggIBAAa2EuozymOsQDJlEi7TqnyA2OhT\n' +
+ 'GXPfYqCyMJVkfrqNgcnsNpCAiNEiZbb+8sIPXnT8Ay8hrwJYEObJ5b7MHXpLuyft\n' +
+ 'z0Pu1oFLKnQxKjNxrIsCvaB4CRRdYjm1q7EqGhMGv76se9stOxkOqO9it31w/LoU\n' +
+ 'ENDk7GLsSqsV1OzYLhaH8t+MaNP6rZTSNuPrHwbV3CtBFl2TAZ7iKgKOhdFz1Hh9\n' +
+ 'Pez0lG+oKi4mHZ7ajov6PD0W7njn5KqzCAkJR6OYmlNVPjir+c/vUtEs0j+owsMl\n' +
+ 'g7KE5g4ZpTRShyh5BjCFRK2tv0tkqafzNtxrKC5XNpEkqqVTCnLcKG+OplIEadtr\n' +
+ 'C7UWf4HyhCiR+xIyxFyR05p3uY/QQU/5uza7GlK0J+U1sBUytx7BZ+Fo8KQfPPqV\n' +
+ 'CqDCaYUksoJcnJE/KeoksyqNQys7sDGJhkd0NeUGDrFLKHSLhIwAMbEWnqGxvhli\n' +
+ 'E7sP2E5rI/I9Y9zTbLIiI8pfeZlFF8DBdoP/Hzg8pqsiE/yiXSFTKByDwKzGwNqz\n' +
+ 'F0VoFdIZcIbLdDbzlQitgGpJtvEL7HseB0WH7B2PMMD8KPJlYvPveO3/6OLzCsav\n' +
+ '+CAkvk47NQViKMsUTKOA0JDCW+u981YRozxa3K081snhSiSe83zIPBz1ikldXxO9\n' +
+ '6YYLNPRrj3mi9T/f\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAMkvdFnVDb0mWWFiXqnKH68wCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyB1cy13ZXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTkxMzI0WhgPMjEyMTA1MTkyMDEzMjRaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgdXMtd2VzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEy86DB+9th/0A5VcWqMSWDxIUblWTt/R0\n' +
+ 'ao6Z2l3vf2YDF2wt1A2NIOGpfQ5+WAOJO/IQmnV9LhYo+kacB8sOnXdQa6biZZkR\n' +
+ 'IyouUfikVQAKWEJnh1Cuo5YMM4E2sUt5o0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBQ8u3OnecANmG8OoT7KLWDuFzZwBTAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIwQ817qkb7mWJFnieRAN+m9W3E0FLVKaV3zC5aYJUk2fcZ\n' +
+ 'TaUx3oLp3jPLGvY5+wgeAjEA6wAicAki4ZiDfxvAIuYiIe1OS/7H5RA++R8BH6qG\n' +
+ 'iRzUBM/FItFpnkus7u/eTkvo\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQS/+Ryfgb/IOVEa1pWoe8oTAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoLTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjIwNjA2MjE1NDQyWhgPMjEyMjA2MDYyMjU0NDJaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgYXAtc291dGgtMiBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABDsX6fhdUWBQpYTdseBD/P3s96Dtw2Iw\n' +
+ 'OrXKNToCnmX5nMkUGdRn9qKNiz1pw3EPzaPxShbYwQ7LYP09ENK/JN4QQjxMihxC\n' +
+ 'jLFxS85nhBQQQGRCWikDAe38mD8fSvREQKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUIh1xZiseQYFjPYKJmGbruAgRH+AwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMFudS4zLy+UUGrtgNLtRMcu/DZ9BUzV4NdHxo0bkG44O\n' +
+ 'thnjl4+wTKI6VbyAbj2rkgIxAOHps8NMITU5DpyiMnKTxV8ubb/WGHrLl0BjB8Lw\n' +
+ 'ETVJk5DNuZvsIIcm7ykk6iL4Tw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBDCCA+ygAwIBAgIQDcEmNIAVrDpUw5cH5ynutDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIG1lLWNlbnRyYWwtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNTA3MDA0MDIzWhgPMjEyMjA1MDcwMTQwMjNaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgbWUtY2VudHJhbC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAKvADk8t\n' +
+ 'Fl9bFlU5sajLPPDSOUpPAkKs6iPlz+27o1GJC88THcOvf3x0nVAcu9WYe9Qaas+4\n' +
+ 'j4a0vv51agqyODRD/SNi2HnqW7DbtLPAm6KBHe4twl28ItB/JD5g7u1oPAHFoXMS\n' +
+ 'cH1CZEAs5RtlZGzJhcBXLFsHNv/7+SCLyZ7+2XFh9OrtgU4wMzkHoRNndhfwV5bu\n' +
+ '17bPTwuH+VxH37zXf1mQ/KjhuJos0C9dL0FpjYBAuyZTAWhZKs8dpSe4DI544z4w\n' +
+ 'gkwUB4bC2nA1TBzsywEAHyNuZ/xRjNpWvx0ToWAA2iFJqC3VO3iKcnBplMvaUuMt\n' +
+ 'jwzVSNBnKcoabXCZL2XDLt4YTZR8FSwz05IvsmwcPB7uNTBXq3T9sjejW8QQK3vT\n' +
+ 'tzyfLq4jKmQE7PoS6cqYm+hEPm2hDaC/WP9bp3FdEJxZlPH26fq1b7BWYWhQ9pBA\n' +
+ 'Nv9zTnzdR1xohTyOJBUFQ81ybEzabqXqVXUIANqIOaNcTB09/sLJ7+zuMhp3mwBu\n' +
+ 'LtjfJv8PLuT1r63bU3seROhKA98b5KfzjvbvPSg3vws78JQyoYGbqNyDfyjVjg3U\n' +
+ 'v//AdVuPie6PNtdrW3upZY4Qti5IjP9e3kimaJ+KAtTgMRG56W0WxD3SP7+YGGbG\n' +
+ 'KhntDOkKsN39hLpn9UOafTIqFu7kIaueEy/NAgMBAAGjQjBAMA8GA1UdEwEB/wQF\n' +
+ 'MAMBAf8wHQYDVR0OBBYEFHAems86dTwdZbLe8AaPy3kfIUVoMA4GA1UdDwEB/wQE\n' +
+ 'AwIBhjANBgkqhkiG9w0BAQwFAAOCAgEAOBHpp0ICx81kmeoBcZTrMdJs2gnhcd85\n' +
+ 'FoSCjXx9H5XE5rmN/lQcxxOgj8hr3uPuLdLHu+i6THAyzjrl2NA1FWiqpfeECGmy\n' +
+ '0jm7iZsYORgGQYp/VKnDrwnKNSqlZvOuRr0kfUexwFlr34Y4VmupvEOK/RdGsd3S\n' +
+ '+3hiemcHse9ST/sJLHx962AWMkN86UHPscJEe4+eT3f2Wyzg6La8ARwdWZSNS+WH\n' +
+ 'ZfybrncMmuiXuUdHv9XspPsqhKgtHhcYeXOGUtrwQPLe3+VJZ0LVxhlTWr9951GZ\n' +
+ 'GfmWwTV/9VsyKVaCFIXeQ6L+gjcKyEzYF8wpMtQlSc7FFqwgC4bKxvMBSaRy88Nr\n' +
+ 'lV2+tJD/fr8zGUeBK44Emon0HKDBWGX+/Hq1ZIv0Da0S+j6LbA4fusWxtGfuGha+\n' +
+ 'luhHgVInCpALIOamiBEdGhILkoTtx7JrYppt3/Raqg9gUNCOOYlCvGhqX7DXeEfL\n' +
+ 'DGabooiY2FNWot6h04JE9nqGj5QqT8D6t/TL1nzxhRPzbcSDIHUd/b5R+a0bAA+7\n' +
+ 'YTU6JqzEVCWKEIEynYmqikgLMGB/OzWsgyEL6822QW6hJAQ78XpbNeCzrICF4+GC\n' +
+ '7KShLnwuWoWpAb26268lvOEvCTFM47VC6jNQl97md+2SA9Ma81C9wflid2M83Wle\n' +
+ 'cuLMVcQZceE=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQAhAteLRCvizAElaWORFU2zANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE3MDkxNloYDzIwNjEwNTIwMTgwOTE2WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA+qg7JAcOVKjh\n' +
+ 'N83SACnBFZPyB63EusfDr/0V9ZdL8lKcmZX9sv/CqoBo3N0EvBqHQqUUX6JvFb7F\n' +
+ 'XrMUZ740kr28gSRALfXTFgNODjXeDsCtEkKRTkac/UM8xXHn+hR7UFRPHS3e0GzI\n' +
+ 'iLiwQWDkr0Op74W8aM0CfaVKvh2bp4BI1jJbdDnQ9OKXpOxNHGUf0ZGb7TkNPkgI\n' +
+ 'b2CBAc8J5o3H9lfw4uiyvl6Fz5JoP+A+zPELAioYBXDrbE7wJeqQDJrETWqR9VEK\n' +
+ 'BXURCkVnHeaJy123MpAX2ozf4pqk0V0LOEOZRS29I+USF5DcWr7QIXR/w2I8ws1Q\n' +
+ '7ys+qbE+kQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBQFJ16n\n' +
+ '1EcCMOIhoZs/F9sR+Jy++zAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAOc5nXbT3XTDEZsxX2iD15YrQvmL5m13B3ImZWpx/pqmObsgx3/dg75rF2nQ\n' +
+ 'qS+Vl+f/HLh516pj2BPP/yWCq12TRYigGav8UH0qdT3CAClYy2o+zAzUJHm84oiB\n' +
+ 'ud+6pFVGkbqpsY+QMpJUbZWu52KViBpJMYsUEy+9cnPSFRVuRAHjYynSiLk2ZEjb\n' +
+ 'Wkdc4x0nOZR5tP0FgrX0Ve2KcjFwVQJVZLgOUqmFYQ/G0TIIGTNh9tcmR7yp+xJR\n' +
+ 'A2tbPV2Z6m9Yxx4E8lLEPNuoeouJ/GR4CkMEmF8cLwM310t174o3lKKUXJ4Vs2HO\n' +
+ 'Wj2uN6R9oI+jGLMSswTzCNV1vgc=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj6gAwIBAgIRAOocLeZWjYkG/EbHmscuy8gwCgYIKoZIzj0EAwMwgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjEyMTUwMDFaGA8yMTIxMDUyMTIyNTAwMVowgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABCEr3jq1KtRncnZfK5cq\n' +
+ 'btY0nW6ZG3FMbh7XwBIR6Ca0f8llGZ4vJEC1pXgiM/4Dh045B9ZIzNrR54rYOIfa\n' +
+ '2NcYZ7mk06DjIQML64hbAxbQzOAuNzLPx268MrlL2uW2XaNCMEAwDwYDVR0TAQH/\n' +
+ 'BAUwAwEB/zAdBgNVHQ4EFgQUln75pChychwN4RfHl+tOinMrfVowDgYDVR0PAQH/\n' +
+ 'BAQDAgGGMAoGCCqGSM49BAMDA2gAMGUCMGiyPINRU1mwZ4Crw01vpuPvxZxb2IOr\n' +
+ 'yX3RNlOIu4We1H+5dQk5tIvH8KGYFbWEpAIxAO9NZ6/j9osMhLgZ0yj0WVjb+uZx\n' +
+ 'YlZR9fyFisY/jNfX7QhSk+nrc3SFLRUNtpXrng==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBTCCAu2gAwIBAgIRAKiaRZatN8eiz9p0s0lu0rQwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZoxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEzMDEGA1UEAwwq\n' +
+ 'QW1hem9uIFJEUyBjYS1jZW50cmFsLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUyMTIyMDIzNVoYDzIwNjEwNTIxMjMwMjM1WjCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGNhLWNlbnRyYWwtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCygVMf\n' +
+ 'qB865IR9qYRBRFHn4eAqGJOCFx+UbraQZmjr/mnRqSkY+nhbM7Pn/DWOrRnxoh+w\n' +
+ 'q5F9ZxdZ5D5T1v6kljVwxyfFgHItyyyIL0YS7e2h7cRRscCM+75kMedAP7icb4YN\n' +
+ 'LfWBqfKHbHIOqvvQK8T6+Emu/QlG2B5LvuErrop9K0KinhITekpVIO4HCN61cuOe\n' +
+ 'CADBKF/5uUJHwS9pWw3uUbpGUwsLBuhJzCY/OpJlDqC8Y9aToi2Ivl5u3/Q/sKjr\n' +
+ '6AZb9lx4q3J2z7tJDrm5MHYwV74elGSXoeoG8nODUqjgklIWAPrt6lQ3WJpO2kug\n' +
+ '8RhCdSbWkcXHfX95AgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE\n' +
+ 'FOIxhqTPkKVqKBZvMWtKewKWDvDBMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0B\n' +
+ 'AQsFAAOCAQEAqoItII89lOl4TKvg0I1EinxafZLXIheLcdGCxpjRxlZ9QMQUN3yb\n' +
+ 'y/8uFKBL0otbQgJEoGhxm4h0tp54g28M6TN1U0332dwkjYxUNwvzrMaV5Na55I2Z\n' +
+ '1hq4GB3NMXW+PvdtsgVOZbEN+zOyOZ5MvJHEQVkT3YRnf6avsdntltcRzHJ16pJc\n' +
+ 'Y8rR7yWwPXh1lPaPkxddrCtwayyGxNbNmRybjR48uHRhwu7v2WuAMdChL8H8bp89\n' +
+ 'TQLMrMHgSbZfee9hKhO4Zebelf1/cslRSrhkG0ESq6G5MUINj6lMg2g6F0F7Xz2v\n' +
+ 'ncD/vuRN5P+vT8th/oZ0Q2Gc68Pun0cn/g==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAJYlnmkGRj4ju/2jBQsnXJYwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy1lYXN0LTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMTIzMDQ0NFoYDzIwNjEwNTIyMDAwNDQ0WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQC74V3eigv+pCj5\n' +
+ 'nqDBqplY0Jp16pTeNB06IKbzb4MOTvNde6QjsZxrE1xUmprT8LxQqN9tI3aDYEYk\n' +
+ 'b9v4F99WtQVgCv3Y34tYKX9NwWQgwS1vQwnIR8zOFBYqsAsHEkeJuSqAB12AYUSd\n' +
+ 'Zv2RVFjiFmYJho2X30IrSLQfS/IE3KV7fCyMMm154+/K1Z2IJlcissydEAwgsUHw\n' +
+ 'edrE6CxJVkkJ3EvIgG4ugK/suxd8eEMztaQYJwSdN8TdfT59LFuSPl7zmF3fIBdJ\n' +
+ '//WexcQmGabaJ7Xnx+6o2HTfkP8Zzzzaq8fvjAcvA7gyFH5EP26G2ZqMG+0y4pTx\n' +
+ 'SPVTrQEXAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFIWWuNEF\n' +
+ 'sUMOC82XlfJeqazzrkPDMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAgClmxcJaQTGpEZmjElL8G2Zc8lGc+ylGjiNlSIw8X25/bcLRptbDA90nuP+q\n' +
+ 'zXAMhEf0ccbdpwxG/P5a8JipmHgqQLHfpkvaXx+0CuP++3k+chAJ3Gk5XtY587jX\n' +
+ '+MJfrPgjFt7vmMaKmynndf+NaIJAYczjhJj6xjPWmGrjM3MlTa9XesmelMwP3jep\n' +
+ 'bApIWAvCYVjGndbK9byyMq1nyj0TUzB8oJZQooaR3MMjHTmADuVBylWzkRMxbKPl\n' +
+ '4Nlsk4Ef1JvIWBCzsMt+X17nuKfEatRfp3c9tbpGlAE/DSP0W2/Lnayxr4RpE9ds\n' +
+ 'ICF35uSis/7ZlsftODUe8wtpkQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAPvvd+MCcp8E36lHziv0xhMwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy1lYXN0LTIgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMTIzMTEwNloYDzIxMjEwNTIyMDAxMTA2WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDbvwekKIKGcV/s\n' +
+ 'lDU96a71ZdN2pTYkev1X2e2/ICb765fw/i1jP9MwCzs8/xHBEQBJSxdfO4hPeNx3\n' +
+ 'ENi0zbM+TrMKliS1kFVe1trTTEaHYjF8BMK9yTY0VgSpWiGxGwg4tshezIA5lpu8\n' +
+ 'sF6XMRxosCEVCxD/44CFqGZTzZaREIvvFPDTXKJ6yOYnuEkhH3OcoOajHN2GEMMQ\n' +
+ 'ShuyRFDQvYkqOC/Q5icqFbKg7eGwfl4PmimdV7gOVsxSlw2s/0EeeIILXtHx22z3\n' +
+ '8QBhX25Lrq2rMuaGcD3IOMBeBo2d//YuEtd9J+LGXL9AeOXHAwpvInywJKAtXTMq\n' +
+ 'Wsy3LjhuANFrzMlzjR2YdjkGVzeQVx3dKUzJ2//Qf7IXPSPaEGmcgbxuatxjnvfT\n' +
+ 'H85oeKr3udKnXm0Kh7CLXeqJB5ITsvxI+Qq2iXtYCc+goHNR01QJwtGDSzuIMj3K\n' +
+ 'f+YMrqBXZgYBwU2J/kCNTH31nfw96WTbOfNGwLwmVRDgguzFa+QzmQsJW4FTDMwc\n' +
+ '7cIjwdElQQVA+Gqa67uWmyDKAnoTkudmgAP+OTBkhnmc6NJuZDcy6f/iWUdl0X0u\n' +
+ '/tsfgXXR6ZovnHonM13ANiN7VmEVqFlEMa0VVmc09m+2FYjjlk8F9sC7Rc4wt214\n' +
+ '7u5YvCiCsFZwx44baP5viyRZgkJVpQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBQgCZCsc34nVTRbWsniXBPjnUTQ2DAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBAAQas3x1G6OpsIvQeMS9BbiHG3+kU9P/ba6Rrg+E\n' +
+ 'lUz8TmL04Bcd+I+R0IyMBww4NznT+K60cFdk+1iSmT8Q55bpqRekyhcdWda1Qu0r\n' +
+ 'JiTi7zz+3w2v66akofOnGevDpo/ilXGvCUJiLOBnHIF0izUqzvfczaMZGJT6xzKq\n' +
+ 'PcEVRyAN1IHHf5KnGzUlVFv9SGy47xJ9I1vTk24JU0LWkSLzMMoxiUudVmHSqJtN\n' +
+ 'u0h+n/x3Q6XguZi1/C1KOntH56ewRh8n5AF7c+9LJJSRM9wunb0Dzl7BEy21Xe9q\n' +
+ '03xRYjf5wn8eDELB8FZPa1PrNKXIOLYM9egdctbKEcpSsse060+tkyBrl507+SJT\n' +
+ '04lvJ4tcKjZFqxn+bUkDQvXYj0D3WK+iJ7a8kZJPRvz8BDHfIqancY8Tgw+69SUn\n' +
+ 'WqIb+HNZqFuRs16WFSzlMksqzXv6wcDSyI7aZOmCGGEcYW9NHk8EuOnOQ+1UMT9C\n' +
+ 'Qb1GJcipjRzry3M4KN/t5vN3hIetB+/PhmgTO4gKhBETTEyPC3HC1QbdVfRndB6e\n' +
+ 'U/NF2U/t8U2GvD26TTFLK4pScW7gyw4FQyXWs8g8FS8f+R2yWajhtS9++VDJQKom\n' +
+ 'fAUISoCH+PlPRJpu/nHd1Zrddeiiis53rBaLbXu2J1Q3VqjWOmtj0HjxJJxWnYmz\n' +
+ 'Pqj2\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAI/U4z6+GF8/znpHM8Dq8G0wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMjA2MDYyMTQ4MThaGA8yMTIyMDYwNjIyNDgxOFowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAK5WqMvyq888\n' +
+ '3uuOtEj1FcP6iZhqO5kJurdJF59Otp2WCg+zv6I+QwaAspEWHQsKD405XfFsTGKV\n' +
+ 'SKTCwoMxwBniuChSmyhlagQGKSnRY9+znOWq0v7hgmJRwp6FqclTbubmr+K6lzPy\n' +
+ 'hs86mEp68O5TcOTYWUlPZDqfKwfNTbtCl5YDRr8Gxb5buHmkp6gUSgDkRsXiZ5VV\n' +
+ 'b3GBmXRqbnwo5ZRNAzQeM6ylXCn4jKs310lQGUrFbrJqlyxUdfxzqdlaIRn2X+HY\n' +
+ 'xRSYbHox3LVNPpJxYSBRvpQVFSy9xbX8d1v6OM8+xluB31cbLBtm08KqPFuqx+cO\n' +
+ 'I2H5F0CYqYzhyOSKJsiOEJT6/uH4ewryskZzncx9ae62SC+bB5n3aJLmOSTkKLFY\n' +
+ 'YS5IsmDT2m3iMgzsJNUKVoCx2zihAzgBanFFBsG+Xmoq0aKseZUI6vd2qpd5tUST\n' +
+ '/wS1sNk0Ph7teWB2ACgbFE6etnJ6stwjHFZOj/iTYhlnR2zDRU8akunFdGb6CB4/\n' +
+ 'hMxGJxaqXSJeGtHm7FpadlUTf+2ESbYcVW+ui/F8sdBJseQdKZf3VdZZMgM0bcaX\n' +
+ 'NE47cauDTy72WdU9YJX/YXKYMLDE0iFHTnGpfVGsuWGPYhlwZ3dFIO07mWnCRM6X\n' +
+ 'u5JXRB1oy5n5HRluMsmpSN/R92MeBxKFAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFNtH0F0xfijSLHEyIkRGD9gW6NazMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEACo+5jFeY3ygxoDDzL3xpfe5M0U1WxdKk+az4\n' +
+ '/OfjZvkoma7WfChi3IIMtwtKLYC2/seKWA4KjlB3rlTsCVNPnK6D+gAnybcfTKk/\n' +
+ 'IRSPk92zagwQkSUWtAk80HpVfWJzpkSU16ejiajhedzOBRtg6BwsbSqLCDXb8hXr\n' +
+ 'eXWC1S9ZceGc+LcKRHewGWPu31JDhHE9bNcl9BFSAS0lYVZqxIRWxivZ+45j5uQv\n' +
+ 'wPrC8ggqsdU3K8quV6dblUQzzA8gKbXJpCzXZihkPrYpQHTH0szvXvgebh+CNUAG\n' +
+ 'rUxm8+yTS0NFI3U+RLbcLFVzSvjMOnEwCX0SPj5XZRYYXs5ajtQCoZhTUkkwpDV8\n' +
+ 'RxXk8qGKiXwUxDO8GRvmvM82IOiXz5w2jy/h7b7soyIgdYiUydMq4Ja4ogB/xPZa\n' +
+ 'gf4y0o+bremO15HFf1MkaU2UxPK5FFVUds05pKvpSIaQWbF5lw4LHHj4ZtVup7zF\n' +
+ 'CLjPWs4Hs/oUkxLMqQDw0FBwlqa4uot8ItT8uq5BFpz196ZZ+4WXw5PVzfSxZibI\n' +
+ 'C/nwcj0AS6qharXOs8yPnPFLPSZ7BbmWzFDgo3tpglRqo3LbSPsiZR+sLeivqydr\n' +
+ '0w4RK1btRda5Ws88uZMmW7+2aufposMKcbAdrApDEAVzHijbB/nolS5nsnFPHZoA\n' +
+ 'KDPtFEk=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtzCCAj2gAwIBAgIQVZ5Y/KqjR4XLou8MCD5pOjAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC00IFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIyMDUyNTE2NTgzM1oYDzIxMjIwNTI1MTc1ODMzWjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC00IFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEbo473OmpD5vkckdJajXg\n' +
+ 'brhmNFyoSa0WCY1njuZC2zMFp3zP6rX4I1r3imrYnJd9pFH/aSiV/r6L5ACE5RPx\n' +
+ '4qdg5SQ7JJUaZc3DWsTOiOed7BCZSzM+KTYK/2QzDMApo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBTmogc06+1knsej1ltKUOdWFvwgsjAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIxAIs7TlLMbGTWNXpGiKf9DxaM07d/iDHe\n' +
+ 'F/Vv/wyWSTGdobxBL6iArQNVXz0Gr4dvPAIwd0rsoa6R0x5mtvhdRPtM37FYrbHJ\n' +
+ 'pbV+OMusQqcSLseunLBoCHenvJW0QOCQ8EDY\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICvTCCAkOgAwIBAgIQCIY7E/bFvFN2lK9Kckb0dTAKBggqhkjOPQQDAzCBnjEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTcwNQYDVQQDDC5BbWF6\n' +
+ 'b24gUkRTIFByZXZpZXcgdXMtZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUxODIxMDUxMFoYDzIxMjEwNTE4MjIwNTEwWjCB\n' +
+ 'njELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTcwNQYDVQQDDC5B\n' +
+ 'bWF6b24gUkRTIFByZXZpZXcgdXMtZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEMI0hzf1JCEOI\n' +
+ 'Eue4+DmcNnSs2i2UaJxHMrNGGfU7b42a7vwP53F7045ffHPBGP4jb9q02/bStZzd\n' +
+ 'VHqfcgqkSRI7beBKjD2mfz82hF/wJSITTgCLs+NRpS6zKMFOFHUNo0IwQDAPBgNV\n' +
+ 'HRMBAf8EBTADAQH/MB0GA1UdDgQWBBS8uF/6hk5mPLH4qaWv9NVZaMmyTjAOBgNV\n' +
+ 'HQ8BAf8EBAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIxAO7Pu9wzLyM0X7Q08uLIL+vL\n' +
+ 'qaxe3UFuzFTWjM16MLJHbzLf1i9IDFKz+Q4hXCSiJwIwClMBsqT49BPUxVsJnjGr\n' +
+ 'EbyEk6aOOVfY1p2yQL649zh3M4h8okLnwf+bYIb1YpeU\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQY+JhwFEQTe36qyRlUlF8ozANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE5MjQxNloYDzIwNjEwNTE5MjAyNDE2WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAnIye77j6ev40\n' +
+ '8wRPyN2OdKFSUfI9jB20Or2RLO+RDoL43+USXdrze0Wv4HMRLqaen9BcmCfaKMp0\n' +
+ 'E4SFo47bXK/O17r6G8eyq1sqnHE+v288mWtYH9lAlSamNFRF6YwA7zncmE/iKL8J\n' +
+ '0vePHMHP/B6svw8LULZCk+nZk3tgxQn2+r0B4FOz+RmpkoVddfqqUPMbKUxhM2wf\n' +
+ 'fO7F6bJaUXDNMBPhCn/3ayKCjYr49ErmnpYV2ZVs1i34S+LFq39J7kyv6zAgbHv9\n' +
+ '+/MtRMoRB1CjpqW0jIOZkHBdYcd1o9p1zFn591Do1wPkmMsWdjIYj+6e7UXcHvOB\n' +
+ '2+ScIRAcnwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBQGtq2W\n' +
+ 'YSyMMxpdQ3IZvcGE+nyZqTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAEgoP3ixJsKSD5FN8dQ01RNHERl/IFbA7TRXfwC+L1yFocKnQh4Mp/msPRSV\n' +
+ '+OeHIvemPW/wtZDJzLTOFJ6eTolGekHK1GRTQ6ZqsWiU2fmiOP8ks4oSpI+tQ9Lw\n' +
+ 'VrfZqTiEcS5wEIqyfUAZZfKDo7W1xp+dQWzfczSBuZJZwI5iaha7+ILM0r8Ckden\n' +
+ 'TVTapc5pLSoO15v0ziRuQ2bT3V3nwu/U0MRK44z+VWOJdSiKxdnOYDs8hFNnKhfe\n' +
+ 'klbTZF7kW7WbiNYB43OaAQBJ6BALZsIskEaqfeZT8FD71uN928TcEQyBDXdZpRN+\n' +
+ 'iGQZDGhht0r0URGMDSs9waJtTfA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQXY/dmS+72lZPranO2JM9jjANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIGFwLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI1MjEzNDUxWhgPMjEyMTA1MjUyMjM0NTFaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgYXAtZWFzdC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMyW9kBJjD/hx8e8\n' +
+ 'b5E1sF42bp8TXsz1htSYE3Tl3T1Aq379DfEhB+xa/ASDZxt7/vwa81BkNo4M6HYq\n' +
+ 'okYIXeE7cu5SnSgjWXqcERhgPevtAwgmhdE3yREe8oz2DyOi2qKKZqah+1gpPaIQ\n' +
+ 'fK0uAqoeQlyHosye3KZZKkDHBatjBsQ5kf8lhuf7wVulEZVRHY2bP2X7N98PfbpL\n' +
+ 'QdH7mWXzDtJJ0LiwFwds47BrkgK1pkHx2p1mTo+HMkfX0P6Fq1atkVC2RHHtbB/X\n' +
+ 'iYyH7paaHBzviFrhr679zNqwXIOKlbf74w3mS11P76rFn9rS1BAH2Qm6eY5S/Fxe\n' +
+ 'HEKXm4kjPN63Zy0p3yE5EjPt54yPkvumOnT+RqDGJ2HCI9k8Ehcbve0ogfdRKNqQ\n' +
+ 'VHWYTy8V33ndQRHZlx/CuU1yN61TH4WSoMly1+q1ihTX9sApmlQ14B2pJi/9DnKW\n' +
+ 'cwECrPy1jAowC2UJ45RtC8UC05CbP9yrIy/7Noj8gQDiDOepm+6w1g6aNlWoiuQS\n' +
+ 'kyI6nzz1983GcnOHya73ga7otXo0Qfg9jPghlYiMomrgshlSLDHZG0Ib/3hb8cnR\n' +
+ '1OcN9FpzNmVK2Ll1SmTMLrIhuCkyNYX9O/bOknbcf706XeESxGduSkHEjIw/k1+2\n' +
+ 'Atteoq5dT6cwjnJ9hyhiueVlVkiDAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFLUI+DD7RJs+0nRnjcwIVWzzYSsFMA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEAb1mcCHv4qMQetLGTBH9IxsB2YUUhr5dda0D2BcHr\n' +
+ 'UtDbfd0VQs4tux6h/6iKwHPx0Ew8fuuYj99WknG0ffgJfNc5/fMspxR/pc1jpdyU\n' +
+ '5zMQ+B9wi0lOZPO9uH7/pr+d2odcNEy8zAwqdv/ihsTwLmGP54is9fVbsgzNW1cm\n' +
+ 'HKAVL2t/Ope+3QnRiRilKCN1lzhav4HHdLlN401TcWRWKbEuxF/FgxSO2Hmx86pj\n' +
+ 'e726lweCTMmnq/cTsPOVY0WMjs0or3eHDVlyLgVeV5ldyN+ptg3Oit60T05SRa58\n' +
+ 'AJPTaVKIcGQ/gKkKZConpu7GDofT67P/ox0YNY57LRbhsx9r5UY4ROgz7WMQ1yoS\n' +
+ 'Y+19xizm+mBm2PyjMUbfwZUyCxsdKMwVdOq5/UmTmdms+TR8+m1uBHPOTQ2vKR0s\n' +
+ 'Pd/THSzPuu+d3dbzRyDSLQbHFFneG760CUlD/ZmzFlQjJ89/HmAmz8IyENq+Sjhx\n' +
+ 'Jgzy+FjVZb8aRUoYLlnffpUpej1n87Ynlr1GrvC4GsRpNpOHlwuf6WD4W0qUTsC/\n' +
+ 'C9JO+fBzUj/aWlJzNcLEW6pte1SB+EdkR2sZvWH+F88TxemeDrV0jKJw5R89CDf8\n' +
+ 'ZQNfkxJYjhns+YeV0moYjqQdc7tq4i04uggEQEtVzEhRLU5PE83nlh/K2NZZm8Kj\n' +
+ 'dIA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAPVSMfFitmM5PhmbaOFoGfUwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy1lYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIyMzQ1N1oYDzIwNjEwNTI1MjMzNDU3WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDu9H7TBeGoDzMr\n' +
+ 'dxN6H8COntJX4IR6dbyhnj5qMD4xl/IWvp50lt0VpmMd+z2PNZzx8RazeGC5IniV\n' +
+ '5nrLg0AKWRQ2A/lGGXbUrGXCSe09brMQCxWBSIYe1WZZ1iU1IJ/6Bp4D2YEHpXrW\n' +
+ 'bPkOq5x3YPcsoitgm1Xh8ygz6vb7PsvJvPbvRMnkDg5IqEThapPjmKb8ZJWyEFEE\n' +
+ 'QRrkCIRueB1EqQtJw0fvP4PKDlCJAKBEs/y049FoOqYpT3pRy0WKqPhWve+hScMd\n' +
+ '6obq8kxTFy1IHACjHc51nrGII5Bt76/MpTWhnJIJrCnq1/Uc3Qs8IVeb+sLaFC8K\n' +
+ 'DI69Sw6bAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFE7PCopt\n' +
+ 'lyOgtXX0Y1lObBUxuKaCMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAFj+bX8gLmMNefr5jRJfHjrL3iuZCjf7YEZgn89pS4z8408mjj9z6Q5D1H7yS\n' +
+ 'jNETVV8QaJip1qyhh5gRzRaArgGAYvi2/r0zPsy+Tgf7v1KGL5Lh8NT8iCEGGXwF\n' +
+ 'g3Ir+Nl3e+9XUp0eyyzBIjHtjLBm6yy8rGk9p6OtFDQnKF5OxwbAgip42CD75r/q\n' +
+ 'p421maEDDvvRFR4D+99JZxgAYDBGqRRceUoe16qDzbMvlz0A9paCZFclxeftAxv6\n' +
+ 'QlR5rItMz/XdzpBJUpYhdzM0gCzAzdQuVO5tjJxmXhkSMcDP+8Q+Uv6FA9k2VpUV\n' +
+ 'E/O5jgpqUJJ2Hc/5rs9VkAPXeA==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQW0yuFCle3uj4vWiGU0SaGzAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTkzNTE2WhgPMjEyMTA1MTkyMDM1MTZaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgYWYtc291dGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABDPiKNZSaXs3Un/J/v+LTsFDANHpi7en\n' +
+ 'oL2qh0u0DoqNzEBTbBjvO23bLN3k599zh6CY3HKW0r2k1yaIdbWqt4upMCRCcUFi\n' +
+ 'I4iedAmubgzh56wJdoMZztjXZRwDthTkJKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUWbYkcrvVSnAWPR5PJhIzppcAnZIwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMCESGqpat93CjrSEjE7z+Hbvz0psZTHwqaxuiH64GKUm\n' +
+ 'mYynIiwpKHyBrzjKBmeDoQIxANGrjIo6/b8Jl6sdIZQI18V0pAyLfLiZjlHVOnhM\n' +
+ 'MOTVgr82ZuPoEHTX78MxeMnYlw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAIbsx8XOl0sgTNiCN4O+18QwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI1MjE1NDU4WhgPMjA2MTA1MjUyMjU0NTha\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'tROxwXWCgn5R9gI/2Ivjzaxc0g95ysBjoJsnhPdJEHQb7w3y2kWrVWU3Y9fOitgb\n' +
+ 'CEsnEC3PrhRnzNVW0fPsK6kbvOeCmjvY30rdbxbc8h+bjXfGmIOgAkmoULEr6Hc7\n' +
+ 'G1Q/+tvv4lEwIs7bEaf+abSZxRJbZ0MBxhbHn7UHHDiMZYvzK+SV1MGCxx7JVhrm\n' +
+ 'xWu3GC1zZCsGDhB9YqY9eR6PmjbqA5wy8vqbC57dZZa1QVtWIQn3JaRXn+faIzHx\n' +
+ 'nLMN5CEWihsdmHBXhnRboXprE/OS4MFv1UrQF/XM/h5RBeCywpHePpC+Oe1T3LNC\n' +
+ 'iP8KzRFrjC1MX/WXJnmOVQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBS33XbXAUMs1znyZo4B0+B3D68WFTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBADuadd2EmlpueY2VlrIIPC30QkoA1EOSoCmZgN6124apkoY1\n' +
+ 'HiV4r+QNPljN4WP8gmcARnNkS7ZeR4fvWi8xPh5AxQCpiaBMw4gcbTMCuKDV68Pw\n' +
+ 'P2dZCTMspvR3CDfM35oXCufdtFnxyU6PAyINUqF/wyTHguO3owRFPz64+sk3r2pT\n' +
+ 'WHmJjG9E7V+KOh0s6REgD17Gqn6C5ijLchSrPUHB0wOIkeLJZndHxN/76h7+zhMt\n' +
+ 'fFeNxPWHY2MfpcaLjz4UREzZPSB2U9k+y3pW1omCIcl6MQU9itGx/LpQE+H3ZeX2\n' +
+ 'M2bdYd5L+ow+bdbGtsVKOuN+R9Dm17YpswF+vyQ=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAKlQ+3JX9yHXyjP/Ja6kZhkwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MTkxNzQ1MjBaGA8yMTIxMDUxOTE4NDUyMFowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAKtahBrpUjQ6\n' +
+ 'H2mni05BAKU6Z5USPZeSKmBBJN3YgD17rJ93ikJxSgzJ+CupGy5rvYQ0xznJyiV0\n' +
+ '91QeQN4P+G2MjGQR0RGeUuZcfcZitJro7iAg3UBvw8WIGkcDUg+MGVpRv/B7ry88\n' +
+ '7E4OxKb8CPNoa+a9j6ABjOaaxaI22Bb7j3OJ+JyMICs6CU2bgkJaj3VUV9FCNUOc\n' +
+ 'h9PxD4jzT9yyGYm/sK9BAT1WOTPG8XQUkpcFqy/IerZDfiQkf1koiSd4s5VhBkUn\n' +
+ 'aQHOdri/stldT7a+HJFVyz2AXDGPDj+UBMOuLq0K6GAT6ThpkXCb2RIf4mdTy7ox\n' +
+ 'N5BaJ+ih+Ro3ZwPkok60egnt/RN98jgbm+WstgjJWuLqSNInnMUgkuqjyBWwePqX\n' +
+ 'Kib+wdpyx/LOzhKPEFpeMIvHQ3A0sjlulIjnh+j+itezD+dp0UNxMERlW4Bn/IlS\n' +
+ 'sYQVNfYutWkRPRLErXOZXtlxxkI98JWQtLjvGzQr+jywxTiw644FSLWdhKa6DtfU\n' +
+ '2JWBHqQPJicMElfZpmfaHZjtXuCZNdZQXWg7onZYohe281ZrdFPOqC4rUq7gYamL\n' +
+ 'T+ZB+2P+YCPOLJ60bj/XSvcB7mesAdg8P0DNddPhHUFWx2dFqOs1HxIVB4FZVA9U\n' +
+ 'Ppbv4a484yxjTgG7zFZNqXHKTqze6rBBAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFCEAqjighncv/UnWzBjqu1Ka2Yb4MA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAYyvumblckIXlohzi3QiShkZhqFzZultbFIu9\n' +
+ 'GhA5CDar1IFMhJ9vJpO9nUK/camKs1VQRs8ZsBbXa0GFUM2p8y2cgUfLwFULAiC/\n' +
+ 'sWETyW5lcX/xc4Pyf6dONhqFJt/ovVBxNZtcmMEWv/1D6Tf0nLeEb0P2i/pnSRR4\n' +
+ 'Oq99LVFjossXtyvtaq06OSiUUZ1zLPvV6AQINg8dWeBOWRcQYhYcEcC2wQ06KShZ\n' +
+ '0ahuu7ar5Gym3vuLK6nH+eQrkUievVomN/LpASrYhK32joQ5ypIJej3sICIgJUEP\n' +
+ 'UoeswJ+Z16f3ECoL1OSnq4A0riiLj1ZGmVHNhM6m/gotKaHNMxsK9zsbqmuU6IT/\n' +
+ 'P6cR0S+vdigQG8ZNFf5vEyVNXhl8KcaJn6lMD/gMB2rY0qpaeTg4gPfU5wcg8S4Y\n' +
+ 'C9V//tw3hv0f2n+8kGNmqZrylOQDQWSSo8j8M2SRSXiwOHDoTASd1fyBEIqBAwzn\n' +
+ 'LvXVg8wQd1WlmM3b0Vrsbzltyh6y4SuKSkmgufYYvC07NknQO5vqvZcNoYbLNea3\n' +
+ '76NkFaMHUekSbwVejZgG5HGwbaYBgNdJEdpbWlA3X4yGRVxknQSUyt4dZRnw/HrX\n' +
+ 'k8x6/wvtw7wht0/DOqz1li7baSsMazqxx+jDdSr1h9xML416Q4loFCLgqQhil8Jq\n' +
+ 'Em4Hy3A=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBTCCA+2gAwIBAgIRAJfKe4Zh4aWNt3bv6ZjQwogwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZoxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEzMDEGA1UEAwwq\n' +
+ 'QW1hem9uIFJEUyBjYS1jZW50cmFsLTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUyMTIyMDg1M1oYDzIxMjEwNTIxMjMwODUzWjCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGNhLWNlbnRyYWwtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCpgUH6\n' +
+ 'Crzd8cOw9prAh2rkQqAOx2vtuI7xX4tmBG4I/um28eBjyVmgwQ1fpq0Zg2nCKS54\n' +
+ 'Nn0pCmT7f3h6Bvopxn0J45AzXEtajFqXf92NQ3iPth95GVfAJSD7gk2LWMhpmID9\n' +
+ 'JGQyoGuDPg+hYyr292X6d0madzEktVVGO4mKTF989qEg+tY8+oN0U2fRTrqa2tZp\n' +
+ 'iYsmg350ynNopvntsJAfpCO/srwpsqHHLNFZ9jvhTU8uW90wgaKO9i31j/mHggCE\n' +
+ '+CAOaJCM3g+L8DPl/2QKsb6UkBgaaIwKyRgKSj1IlgrK+OdCBCOgM9jjId4Tqo2j\n' +
+ 'ZIrrPBGl6fbn1+etZX+2/tf6tegz+yV0HHQRAcKCpaH8AXF44bny9andslBoNjGx\n' +
+ 'H6R/3ib4FhPrnBMElzZ5i4+eM/cuPC2huZMBXb/jKgRC/QN1Wm3/nah5FWq+yn+N\n' +
+ 'tiAF10Ga0BYzVhHDEwZzN7gn38bcY5yi/CjDUNpY0OzEe2+dpaBKPlXTaFfn9Nba\n' +
+ 'CBmXPRF0lLGGtPeTAgjcju+NEcVa82Ht1pqxyu2sDtbu3J5bxp4RKtj+ShwN8nut\n' +
+ 'Tkf5Ea9rSmHEY13fzgibZlQhXaiFSKA2ASUwgJP19Putm0XKlBCNSGCoECemewxL\n' +
+ '+7Y8FszS4Uu4eaIwvXVqUEE2yf+4ex0hqQ1acQIDAQABo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBSeUnXIRxNbYsZLtKomIz4Y1nOZEzAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwDQYJKoZIhvcNAQEMBQADggIBAIpRvxVS0dzoosBh/qw65ghPUGSbP2D4\n' +
+ 'dm6oYCv5g/zJr4fR7NzEbHOXX5aOQnHbQL4M/7veuOCLNPOW1uXwywMg6gY+dbKe\n' +
+ 'YtPVA1as8G9sUyadeXyGh2uXGsziMFXyaESwiAXZyiYyKChS3+g26/7jwECFo5vC\n' +
+ 'XGhWpIO7Hp35Yglp8AnwnEAo/PnuXgyt2nvyTSrxlEYa0jus6GZEZd77pa82U1JH\n' +
+ 'qFhIgmKPWWdvELA3+ra1nKnvpWM/xX0pnMznMej5B3RT3Y+k61+kWghJE81Ix78T\n' +
+ '+tG4jSotgbaL53BhtQWBD1yzbbilqsGE1/DXPXzHVf9yD73fwh2tGWSaVInKYinr\n' +
+ 'a4tcrB3KDN/PFq0/w5/21lpZjVFyu/eiPj6DmWDuHW73XnRwZpHo/2OFkei5R7cT\n' +
+ 'rn/YdDD6c1dYtSw5YNnS6hdCQ3sOiB/xbPRN9VWJa6se79uZ9NLz6RMOr73DNnb2\n' +
+ 'bhIR9Gf7XAA5lYKqQk+A+stoKbIT0F65RnkxrXi/6vSiXfCh/bV6B41cf7MY/6YW\n' +
+ 'ehserSdjhQamv35rTFdM+foJwUKz1QN9n9KZhPxeRmwqPitAV79PloksOnX25ElN\n' +
+ 'SlyxdndIoA1wia1HRd26EFm2pqfZ2vtD2EjU3wD42CXX4H8fKVDna30nNFSYF0yn\n' +
+ 'jGKc3k6UNxpg\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQaRHaEqqacXN20e8zZJtmDDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI1MjIzODM1WhgPMjEyMTA1MjUyMzM4MzVaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtZWFzdC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAInfBCaHuvj6Rb5c\n' +
+ 'L5Wmn1jv2PHtEGMHm+7Z8dYosdwouG8VG2A+BCYCZfij9lIGszrTXkY4O7vnXgru\n' +
+ 'JUNdxh0Q3M83p4X+bg+gODUs3jf+Z3Oeq7nTOk/2UYvQLcxP4FEXILxDInbQFcIx\n' +
+ 'yen1ESHggGrjEodgn6nbKQNRfIhjhW+TKYaewfsVWH7EF2pfj+cjbJ6njjgZ0/M9\n' +
+ 'VZifJFBgat6XUTOf3jwHwkCBh7T6rDpgy19A61laImJCQhdTnHKvzTpxcxiLRh69\n' +
+ 'ZObypR7W04OAUmFS88V7IotlPmCL8xf7kwxG+gQfvx31+A9IDMsiTqJ1Cc4fYEKg\n' +
+ 'bL+Vo+2Ii4W2esCTGVYmHm73drznfeKwL+kmIC/Bq+DrZ+veTqKFYwSkpHRyJCEe\n' +
+ 'U4Zym6POqQ/4LBSKwDUhWLJIlq99bjKX+hNTJykB+Lbcx0ScOP4IAZQoxmDxGWxN\n' +
+ 'S+lQj+Cx2pwU3S/7+OxlRndZAX/FKgk7xSMkg88HykUZaZ/ozIiqJqSnGpgXCtED\n' +
+ 'oQ4OJw5ozAr+/wudOawaMwUWQl5asD8fuy/hl5S1nv9XxIc842QJOtJFxhyeMIXt\n' +
+ 'LVECVw/dPekhMjS3Zo3wwRgYbnKG7YXXT5WMxJEnHu8+cYpMiRClzq2BEP6/MtI2\n' +
+ 'AZQQUFu2yFjRGL2OZA6IYjxnXYiRAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFADCcQCPX2HmkqQcmuHfiQ2jjqnrMA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEASXkGQ2eUmudIKPeOIF7RBryCoPmMOsqP0+1qxF8l\n' +
+ 'pGkwmrgNDGpmd9s0ArfIVBTc1jmpgB3oiRW9c6n2OmwBKL4UPuQ8O3KwSP0iD2sZ\n' +
+ 'KMXoMEyphCEzW1I2GRvYDugL3Z9MWrnHkoaoH2l8YyTYvszTvdgxBPpM2x4pSkp+\n' +
+ '76d4/eRpJ5mVuQ93nC+YG0wXCxSq63hX4kyZgPxgCdAA+qgFfKIGyNqUIqWgeyTP\n' +
+ 'n5OgKaboYk2141Rf2hGMD3/hsGm0rrJh7g3C0ZirPws3eeJfulvAOIy2IZzqHUSY\n' +
+ 'jkFzraz6LEH3IlArT3jUPvWKqvh2lJWnnp56aqxBR7qHH5voD49UpJWY1K0BjGnS\n' +
+ 'OHcurpp0Yt/BIs4VZeWdCZwI7JaSeDcPMaMDBvND3Ia5Fga0thgYQTG6dE+N5fgF\n' +
+ 'z+hRaujXO2nb0LmddVyvE8prYlWRMuYFv+Co8hcMdJ0lEZlfVNu0jbm9/GmwAZ+l\n' +
+ '9umeYO9yz/uC7edC8XJBglMAKUmVK9wNtOckUWAcCfnPWYLbYa/PqtXBYcxrso5j\n' +
+ 'iaS/A7iEW51uteHBGrViCy1afGG+hiUWwFlesli+Rq4dNstX3h6h2baWABaAxEVJ\n' +
+ 'y1RnTQSz6mROT1VmZSgSVO37rgIyY0Hf0872ogcTS+FfvXgBxCxsNWEbiQ/XXva4\n' +
+ '0Ws=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtDCCAjqgAwIBAgIRAMyaTlVLN0ndGp4ffwKAfoMwCgYIKoZIzj0EAwMwgZkx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1h\n' +
+ 'em9uIFJEUyBtZS1jZW50cmFsLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjIwNTA3MDA0NDM3WhgPMjEyMjA1MDcwMTQ0MzdaMIGZMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMjAwBgNVBAMMKUFtYXpv\n' +
+ 'biBSRFMgbWUtY2VudHJhbC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAE19nCV1nsI6CohSor13+B25cr\n' +
+ 'zg+IHdi9Y3L7ziQnHWI6yjBazvnKD+oC71aRRlR8b5YXsYGUQxWzPLHN7EGPcSGv\n' +
+ 'bzA9SLG1KQYCJaQ0m9Eg/iGrwKWOgylbhVw0bCxoo0IwQDAPBgNVHRMBAf8EBTAD\n' +
+ 'AQH/MB0GA1UdDgQWBBS4KsknsJXM9+QPEkBdZxUPaLr11zAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwCgYIKoZIzj0EAwMDaAAwZQIxAJaRgrYIEfXQMZQQDxMTYS0azpyWSseQooXo\n' +
+ 'L3nYq4OHGBgYyQ9gVjvRYWU85PXbfgIwdi82DtANQFkCu+j+BU0JBY/uRKPEeYzo\n' +
+ 'JG92igKIcXPqCoxIJ7lJbbzmuf73gQu5\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAJwCobx0Os8F7ihbJngxrR8wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBtZS1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjAxNzE1MzNaGA8yMTIxMDUyMDE4MTUzM1owgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBtZS1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANukKwlm+ZaI\n' +
+ 'Y5MkWGbEVLApEyLmlrHLEg8PfiiEa9ts7jssQcin3bzEPdTqGr5jo91ONoZ3ccWq\n' +
+ 'xJgg1W3bLu5CAO2CqIOXTXHRyCO/u0Ch1FGgWB8xETPSi3UHt/Vn1ltdO6DYdbDU\n' +
+ 'mYgwzYrvLBdRCwxsb9o+BuYQHVFzUYonqk/y9ujz3gotzFq7r55UwDTA1ita3vb4\n' +
+ 'eDKjIb4b1M4Wr81M23WHonpje+9qkkrAkdQcHrkgvSCV046xsq/6NctzwCUUNsgF\n' +
+ '7Q1a8ut5qJEYpz5ta8vI1rqFqAMBqCbFjRYlmAoTTpFPOmzAVxV+YoqTrW5A16su\n' +
+ '/2SXlMYfJ/n/ad/QfBNPPAAQMpyOr2RCL/YiL/PFZPs7NxYjnZHNWxMLSPgFyI+/\n' +
+ 't2klnn5jR76KJK2qimmaXedB90EtFsMRUU1e4NxH9gDuyrihKPJ3aVnZ35mSipvR\n' +
+ '/1KB8t8gtFXp/VQaz2sg8+uxPMKB81O37fL4zz6Mg5K8+aq3ejBiyHucpFGnsnVB\n' +
+ '3kQWeD36ONkybngmgWoyPceuSWm1hQ0Z7VRAQX+KlxxSaHmSaIk1XxZu9h9riQHx\n' +
+ 'fMuev6KXjRn/CjCoUTn+7eFrt0dT5GryQEIZP+nA0oq0LKxogigHNZlwAT4flrqb\n' +
+ 'JUfZJrqgoce5HjZSXl10APbtPjJi0fW9AgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFEfV+LztI29OVDRm0tqClP3NrmEWMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAvSNe+0wuk53KhWlRlRf2x/97H2Q76X3anzF0\n' +
+ '5fOSVm022ldALzXMzqOfdnoKIhAu2oVKiHHKs7mMas+T6TL+Mkphx0CYEVxFE3PG\n' +
+ '061q3CqJU+wMm9W9xsB79oB2XG47r1fIEywZZ3GaRsatAbjcNOT8uBaATPQAfJFN\n' +
+ 'zjFe4XyN+rA4cFrYNvfHTeu5ftrYmvks7JlRaJgEGWsz+qXux7uvaEEVPqEumd2H\n' +
+ 'uYeaRNOZ2V23R009X5lbgBFx9tq5VDTnKhQiTQ2SeT0rc1W3Dz5ik6SbQQNP3nSR\n' +
+ '0Ywy7r/sZ3fcDyfFiqnrVY4Ympfvb4YW2PZ6OsQJbzH6xjdnTG2HtzEU30ngxdp1\n' +
+ 'WUEF4zt6rjJCp7QBUqXgdlHvJqYu6949qtWjEPiFN9uSsRV2i1YDjJqN52dLjAPn\n' +
+ 'AipJKo8x1PHTwUzuITqnB9BdP+5TlTl8biJfkEf/+08eWDTLlDHr2VrZLOLompTh\n' +
+ 'bS5OrhDmqA2Q+O+EWrTIhMflwwlCpR9QYM/Xwvlbad9H0FUHbJsCVNaru3wGOgWo\n' +
+ 'tt3dNSK9Lqnv/Ej9K9v6CRr36in4ylJKivhJ5B9E7ABHg7EpBJ1xi7O5eNDkNoJG\n' +
+ '+pFyphJq3AkBR2U4ni2tUaTAtSW2tks7IaiDV+UMtqZyGabT5ISQfWLLtLHSWn2F\n' +
+ 'Tspdjbg=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAJZFh4s9aZGzKaTMLrSb4acwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBCZXRhIHVzLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTE4MjEyODQxWhgPMjA2MTA1MTgyMjI4NDFa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgQmV0YSB1cy1lYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ '17i2yoU6diep+WrqxIn2CrDEO2NdJVwWTSckx4WMZlLpkQDoymSmkNHjq9ADIApD\n' +
+ 'A31Cx+843apL7wub8QkFZD0Tk7/ThdHWJOzcAM3ov98QBPQfOC1W5zYIIRP2F+vQ\n' +
+ 'TRETHQnLcW3rLv0NMk5oQvIKpJoC9ett6aeVrzu+4cU4DZVWYlJUoC/ljWzCluau\n' +
+ '8blfW0Vwin6OB7s0HCG5/wijQWJBU5SrP/KAIPeQi1GqG5efbqAXDr/ple0Ipwyo\n' +
+ 'Xjjl73LenGUgqpANlC9EAT4i7FkJcllLPeK3NcOHjuUG0AccLv1lGsHAxZLgjk/x\n' +
+ 'z9ZcnVV9UFWZiyJTKxeKPwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBRWyMuZUo4gxCR3Luf9/bd2AqZ7CjAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAIqN2DlIKlvDFPO0QUZQVFbsi/tLdYM98/vvzBpttlTGVMyD\n' +
+ 'gJuQeHVz+MnhGIwoCGOlGU3OOUoIlLAut0+WG74qYczn43oA2gbMd7HoD7oL/IGg\n' +
+ 'njorBwJVcuuLv2G//SqM3nxGcLRtkRnQ+lvqPxMz9+0fKFUn6QcIDuF0QSfthLs2\n' +
+ 'WSiGEPKO9c9RSXdRQ4pXA7c3hXng8P4A2ZmdciPne5Nu4I4qLDGZYRrRLRkNTrOi\n' +
+ 'TyS6r2HNGUfgF7eOSeKt3NWL+mNChcYj71/Vycf5edeczpUgfnWy9WbPrK1svKyl\n' +
+ 'aAs2xg+X6O8qB+Mnj2dNBzm+lZIS3sIlm+nO9sg=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAPAlEk8VJPmEzVRRaWvTh2AwCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyB1cy1lYXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTI1MjI0MTU1WhgPMjEyMTA1MjUyMzQxNTVaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgdXMtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEx5xjrup8II4HOJw15NTnS3H5yMrQGlbj\n' +
+ 'EDA5MMGnE9DmHp5dACIxmPXPMe/99nO7wNdl7G71OYPCgEvWm0FhdvVUeTb3LVnV\n' +
+ 'BnaXt32Ek7/oxGk1T+Df03C+W0vmuJ+wo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBTGXmqBWN/1tkSea4pNw0oHrjk2UDAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIxAIqqZWCSrIkZ7zsv/FygtAusW6yvlL935YAWYPVXU30m\n' +
+ 'jkMFLM+/RJ9GMvnO8jHfCgIwB+whlkcItzE9CRQ6CsMo/d5cEHDUu/QW6jSIh9BR\n' +
+ 'OGh9pTYPVkUbBiKPA7lVVhre\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAJGY9kZITwfSRaAS/bSBOw8wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBzYS1lYXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE4MTEyMFoYDzIxMjEwNTE5MTkxMTIwWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHNhLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDe2vlDp6Eo4WQi\n' +
+ 'Wi32YJOgdXHhxTFrLjB9SRy22DYoMaWfginJIwJcSR8yse8ZDQuoNhERB9LRggAE\n' +
+ 'eng23mhrfvtL1yQkMlZfBu4vG1nOb22XiPFzk7X2wqz/WigdYNBCqa1kK3jrLqPx\n' +
+ 'YUy7jk2oZle4GLVRTNGuMfcid6S2hs3UCdXfkJuM2z2wc3WUlvHoVNk37v2/jzR/\n' +
+ 'hSCHZv5YHAtzL/kLb/e64QkqxKll5QmKhyI6d7vt6Lr1C0zb+DmwxUoJhseAS0hI\n' +
+ 'dRk5DklMb4Aqpj6KN0ss0HAYqYERGRIQM7KKA4+hxDMUkJmt8KqWKZkAlCZgflzl\n' +
+ 'm8NZ31o2cvBzf6g+VFHx+6iVrSkohVQydkCxx7NJ743iPKsh8BytSM4qU7xx4OnD\n' +
+ 'H2yNXcypu+D5bZnVZr4Pywq0w0WqbTM2bpYthG9IC4JeVUvZ2mDc01lqOlbMeyfT\n' +
+ 'og5BRPLDXdZK8lapo7se2teh64cIfXtCmM2lDSwm1wnH2iSK+AWZVIM3iE45WSGc\n' +
+ 'vZ+drHfVgjJJ5u1YrMCWNL5C2utFbyF9Obw9ZAwm61MSbPQL9JwznhNlCh7F2ANW\n' +
+ 'ZHWQPNcOAJqzE4uVcJB1ZeVl28ORYY1668lx+s9yYeMXk3QQdj4xmdnvoBFggqRB\n' +
+ 'ZR6Z0D7ZohADXe024RzEo1TukrQgKQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBT7Vs4Y5uG/9aXnYGNMEs6ycPUT3jAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBACN4Htp2PvGcQA0/sAS+qUVWWJoAXSsu8Pgc6Gar\n' +
+ '7tKVlNJ/4W/a6pUV2Xo/Tz3msg4yiE8sMESp2k+USosD5n9Alai5s5qpWDQjrqrh\n' +
+ '76AGyF2nzve4kIN19GArYhm4Mz/EKEG1QHYvBDGgXi3kNvL/a2Zbybp+3LevG+q7\n' +
+ 'xtx4Sz9yIyMzuT/6Y7ijtiMZ9XbuxGf5wab8UtwT3Xq1UradJy0KCkzRJAz/Wy/X\n' +
+ 'HbTkEvKSaYKExH6sLo0jqdIjV/d2Io31gt4e0Ly1ER2wPyFa+pc/swu7HCzrN+iz\n' +
+ 'A2ZM4+KX9nBvFyfkHLix4rALg+WTYJa/dIsObXkdZ3z8qPf5A9PXlULiaa1mcP4+\n' +
+ 'rokw74IyLEYooQ8iSOjxumXhnkTS69MAdGzXYE5gnHokABtGD+BB5qLhtLt4fqAp\n' +
+ '8AyHpQWMyV42M9SJLzQ+iOz7kAgJOBOaVtJI3FV/iAg/eqWVm3yLuUTWDxSHrKuL\n' +
+ 'N19+pSjF6TNvUSFXwEa2LJkfDqIOCE32iOuy85QY//3NsgrSQF6UkSPa95eJrSGI\n' +
+ '3hTRYYh3Up2GhBGl1KUy7/o0k3KRZTk4s38fylY8bZ3TakUOH5iIGoHyFVVcp361\n' +
+ 'Pyy25SzFSmNalWoQd9wZVc/Cps2ldxhcttM+WLkFNzprd0VJa8qTz8vYtHP0ouDN\n' +
+ 'nWS0\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAOY7gfcBZgR2tqfBzMbFQCUwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtNCBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjIwNTI1MTY1NDU5WhgPMjEyMjA1MjUxNzU0NTla\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTQgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'lfxER43FuLRdL08bddF0YhbCP+XXKj1A/TFMXmd2My8XDei8rPXFYyyjMig9+xZw\n' +
+ 'uAsIxLwz8uiA26CKA8bCZKg5VG2kTeOJAfvBJaLv1CZefs3Z4Uf1Sjvm6MF2yqEj\n' +
+ 'GoORfyfL9HiZFTDuF/hcjWoKYCfMuG6M/wO8IbdICrX3n+BiYQJu/pFO660Mg3h/\n' +
+ '8YBBWYDbHoCiH/vkqqJugQ5BM3OI5nsElW51P1icEEqti4AZ7JmtSv9t7fIFBVyR\n' +
+ 'oaEyOgpp0sm193F/cDJQdssvjoOnaubsSYm1ep3awZAUyGN/X8MBrPY95d0hLhfH\n' +
+ 'Ehc5Icyg+hsosBljlAyksmt4hFQ9iBnWIz/ZTfGMck+6p3HVL9RDgvluez+rWv59\n' +
+ '8q7omUGsiPApy5PDdwI/Wt/KtC34/2sjslIJfvgifdAtkRPkhff1WEwER00ADrN9\n' +
+ 'eGGInaCpJfb1Rq8cV2n00jxg7DcEd65VR3dmIRb0bL+jWK62ni/WdEyomAOMfmGj\n' +
+ 'aWf78S/4rasHllWJ+QwnaUYY3u6N8Cgio0/ep4i34FxMXqMV3V0/qXdfhyabi/LM\n' +
+ 'wCxNo1Dwt+s6OtPJbwO92JL+829QAxydfmaMTeHBsgMPkG7RwAekeuatKGHNsc2Z\n' +
+ 'x2Q4C2wVvOGAhcHwxfM8JfZs3nDSZJndtVVnFlUY0UECAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUpnG7mWazy6k97/tb5iduRB3RXgQwDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQCDLqq1Wwa9Tkuv7vxBnIeVvvFF\n' +
+ 'ecTn+P+wJxl9Qa2ortzqTHZsBDyJO62d04AgBwiDXkJ9a+bthgG0H1J7Xee8xqv1\n' +
+ 'xyX2yKj24ygHjspLotKP4eDMdDi5TYq+gdkbPmm9Q69B1+W6e049JVGXvWG8/7kU\n' +
+ 'igxeuCYwtCCdUPRLf6D8y+1XMGgVv3/DSOHWvTg3MJ1wJ3n3+eve3rjGdRYWZeJu\n' +
+ 'k21HLSZYzVrCtUsh2YAeLnUbSxVuT2Xr4JehYe9zW5HEQ8Je/OUfnCy9vzoN/ITw\n' +
+ 'osAH+EBJQey7RxEDqMwCaRefH0yeHFcnOll0OXg/urnQmwbEYzQ1uutJaBPsjU0J\n' +
+ 'Qf06sMxI7GiB5nPE+CnI2sM6A9AW9kvwexGXpNJiLxF8dvPQthpOKGcYu6BFvRmt\n' +
+ '6ctfXd9b7JJoVqMWuf5cCY6ihpk1e9JTlAqu4Eb/7JNyGiGCR40iSLvV28un9wiE\n' +
+ 'plrdYxwcNYq851BEu3r3AyYWw/UW1AKJ5tM+/Gtok+AphMC9ywT66o/Kfu44mOWm\n' +
+ 'L3nSLSWEcgfUVgrikpnyGbUnGtgCmHiMlUtNVexcE7OtCIZoVAlCGKNu7tyuJf10\n' +
+ 'Qlk8oIIzfSIlcbHpOYoN79FkLoDNc2er4Gd+7w1oPQmdAB0jBJnA6t0OUBPKdDdE\n' +
+ 'Ufff2jrbfbzECn1ELg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCDCCA/CgAwIBAgIQIuO1A8LOnmc7zZ/vMm3TrDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA1MjQyMDQ2MThaGA8yMTIxMDUyNDIxNDYxOFow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDq\n' +
+ 'qRHKbG8ZK6/GkGm2cenznEF06yHwI1gD5sdsHjTgekDZ2Dl9RwtDmUH2zFuIQwGj\n' +
+ 'SeC7E2iKwrJRA5wYzL9/Vk8NOILEKQOP8OIKUHbc7q8rEtjs401KcU6pFBBEdO9G\n' +
+ 'CTiRhogq+8mhC13AM/UriZJbKhwgM2UaDOzAneGMhQAGjH8z83NsNcPxpYVE7tqM\n' +
+ 'sch5yLtIJLkJRusrmQQTeHUev16YNqyUa+LuFclFL0FzFCimkcxUhXlbfEKXbssS\n' +
+ 'yPzjiv8wokGyo7+gA0SueceMO2UjfGfute3HlXZDcNvBbkSY+ver41jPydyRD6Qq\n' +
+ 'oEkh0tyIbPoa3oU74kwipJtz6KBEA3u3iq61OUR0ENhR2NeP7CSKrC24SnQJZ/92\n' +
+ 'qxusrbyV/0w+U4m62ug/o4hWNK1lUcc2AqiBOvCSJ7qpdteTFxcEIzDwYfERDx6a\n' +
+ 'd9+3IPvzMb0ZCxBIIUFMxLTF7yAxI9s6KZBBXSZ6tDcCCYIgEysEPRWMRAcG+ye/\n' +
+ 'fZVn9Vnzsj4/2wchC2eQrYpb1QvG4eMXA4M5tFHKi+/8cOPiUzJRgwS222J8YuDj\n' +
+ 'yEBval874OzXk8H8Mj0JXJ/jH66WuxcBbh5K7Rp5oJn7yju9yqX6qubY8gVeMZ1i\n' +
+ 'u4oXCopefDqa35JplQNUXbWwSebi0qJ4EK0V8F9Q+QIDAQABo0IwQDAPBgNVHRMB\n' +
+ 'Af8EBTADAQH/MB0GA1UdDgQWBBT4ysqCxaPe7y+g1KUIAenqu8PAgzAOBgNVHQ8B\n' +
+ 'Af8EBAMCAYYwDQYJKoZIhvcNAQEMBQADggIBALU8WN35KAjPZEX65tobtCDQFkIO\n' +
+ 'uJjv0alD7qLB0i9eY80C+kD87HKqdMDJv50a5fZdqOta8BrHutgFtDm+xo5F/1M3\n' +
+ 'u5/Vva5lV4xy5DqPajcF4Mw52czYBmeiLRTnyPJsU93EQIC2Bp4Egvb6LI4cMOgm\n' +
+ '4pY2hL8DojOC5PXt4B1/7c1DNcJX3CMzHDm4SMwiv2MAxSuC/cbHXcWMk+qXdrVx\n' +
+ '+ayLUSh8acaAOy3KLs1MVExJ6j9iFIGsDVsO4vr4ZNsYQiyHjp+L8ops6YVBO5AT\n' +
+ 'k/pI+axHIVsO5qiD4cFWvkGqmZ0gsVtgGUchZaacboyFsVmo6QPrl28l6LwxkIEv\n' +
+ 'GGJYvIBW8sfqtGRspjfX5TlNy5IgW/VOwGBdHHsvg/xpRo31PR3HOFw7uPBi7cAr\n' +
+ 'FiZRLJut7af98EB2UvovZnOh7uIEGPeecQWeOTQfJeWet2FqTzFYd0NUMgqPuJx1\n' +
+ 'vLKferP+ajAZLJvVnW1J7Vccx/pm0rMiUJEf0LRb/6XFxx7T2RGjJTi0EzXODTYI\n' +
+ 'gnLfBBjnolQqw+emf4pJ4pAtly0Gq1KoxTG2QN+wTd4lsCMjnelklFDjejwnl7Uy\n' +
+ 'vtxzRBAu/hi/AqDkDFf94m6j+edIrjbi9/JDFtQ9EDlyeqPgw0qwi2fwtJyMD45V\n' +
+ 'fejbXelUSJSzDIdY\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAN7Y9G9i4I+ZaslPobE7VL4wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIwMTYzMzIzWhgPMjEyMTA1MjAxNzMzMjNa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTIgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ '4BEPCiIfiK66Q/qa8k+eqf1Q3qsa6Xuu/fPkpuStXVBShhtXd3eqrM0iT4Xxs420\n' +
+ 'Va0vSB3oZ7l86P9zYfa60n6PzRxdYFckYX330aI7L/oFIdaodB/C9szvROI0oLG+\n' +
+ '6RwmIF2zcprH0cTby8MiM7G3v9ykpq27g4WhDC1if2j8giOQL3oHpUaByekZNIHF\n' +
+ 'dIllsI3RkXmR3xmmxoOxJM1B9MZi7e1CvuVtTGOnSGpNCQiqofehTGwxCN2wFSK8\n' +
+ 'xysaWlw48G0VzZs7cbxoXMH9QbMpb4tpk0d+T8JfAPu6uWO9UwCLWWydf0CkmA/+\n' +
+ 'D50/xd1t33X9P4FEaPSg5lYbHXzSLWn7oLbrN2UqMLaQrkoEBg/VGvzmfN0mbflw\n' +
+ '+T87bJ/VEOVNlG+gepyCTf89qIQVWOjuYMox4sK0PjzZGsYEuYiq1+OUT3vk/e5K\n' +
+ 'ag1fCcq2Isy4/iwB2xcXrsQ6ljwdk1fc+EmOnjGKrhuOHJY3S+RFv4ToQBsVyYhC\n' +
+ 'XGaC3EkqIX0xaCpDimxYhFjWhpDXAjG/zJ+hRLDAMCMhl/LPGRk/D1kzSbPmdjpl\n' +
+ 'lEMK5695PeBvEBTQdBQdOiYgOU3vWU6tzwwHfiM2/wgvess/q0FDAHfJhppbgbb9\n' +
+ '3vgsIUcsvoC5o29JvMsUxsDRvsAfEmMSDGkJoA/X6GECAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUgEWm1mZCbGD6ytbwk2UU1aLaOUUwDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQBb4+ABTGBGwxK1U/q4g8JDqTQM\n' +
+ '1Wh8Oz8yAk4XtPJMAmCctxbd81cRnSnePWw/hxViLVtkZ/GsemvXfqAQyOn1coN7\n' +
+ 'QeYSw+ZOlu0j2jEJVynmgsR7nIRqE7QkCyZAU+d2FTJUfmee+IiBiGyFGgxz9n7A\n' +
+ 'JhBZ/eahBbiuoOik/APW2JWLh0xp0W0GznfJ8lAlaQTyDa8iDXmVtbJg9P9qzkvl\n' +
+ 'FgPXQttzEOyooF8Pb2LCZO4kUz+1sbU7tHdr2YE+SXxt6D3SBv+Yf0FlvyWLiqVk\n' +
+ 'GDEOlPPTDSjAWgKnqST8UJ0RDcZK/v1ixs7ayqQJU0GUQm1I7LGTErWXHMnCuHKe\n' +
+ 'UKYuiSZwmTcJ06NgdhcCnGZgPq13ryMDqxPeltQc3n5eO7f1cL9ERYLDLOzm6A9P\n' +
+ 'oQ3MfcVOsbHgGHZWaPSeNrQRN9xefqBXH0ZPasgcH9WJdsLlEjVUXoultaHOKx3b\n' +
+ 'UCCb+d3EfqF6pRT488ippOL6bk7zNubwhRa/+y4wjZtwe3kAX78ACJVcjPobH9jZ\n' +
+ 'ErySads5zdQeaoee5wRKdp3TOfvuCe4bwLRdhOLCHWzEcXzY3g/6+ppLvNom8o+h\n' +
+ 'Bh5X26G6KSfr9tqhQ3O9IcbARjnuPbvtJnoPY0gz3EHHGPhy0RNW8i2gl3nUp0ah\n' +
+ 'PtjwbKW0hYAhIttT0Q==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtzCCAj2gAwIBAgIQQRBQTs6Y3H1DDbpHGta3lzAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0zIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDYxMTAwMTI0M1oYDzIxMjEwNjExMDExMjQzWjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0zIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEs0942Xj4m/gKA+WA6F5h\n' +
+ 'AHYuek9eGpzTRoLJddM4rEV1T3eSueytMVKOSlS3Ub9IhyQrH2D8EHsLYk9ktnGR\n' +
+ 'pATk0kCYTqFbB7onNo070lmMJmGT/Q7NgwC8cySChFxbo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBQ20iKBKiNkcbIZRu0y1uoF1yJTEzAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIwYv0wTSrpQTaPaarfLN8Xcqrqu3hzl07n\n' +
+ 'FrESIoRw6Cx77ZscFi2/MV6AFyjCV/TlAjEAhpwJ3tpzPXpThRML8DMJYZ3YgMh3\n' +
+ 'CMuLqhPpla3cL0PhybrD27hJWl29C4el6aMO\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrDCCAjOgAwIBAgIQGcztRyV40pyMKbNeSN+vXTAKBggqhkjOPQQDAzCBljEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMS8wLQYDVQQDDCZBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMiBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTAgFw0yMTA1MjEyMzE1NTZaGA8yMTIxMDUyMjAwMTU1NlowgZYxCzAJBgNV\n' +
+ 'BAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYD\n' +
+ 'VQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1hem9uIFJE\n' +
+ 'UyB1cy1lYXN0LTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0bGUw\n' +
+ 'djAQBgcqhkjOPQIBBgUrgQQAIgNiAAQfDcv+GGRESD9wT+I5YIPRsD3L+/jsiIis\n' +
+ 'Tr7t9RSbFl+gYpO7ZbDXvNbV5UGOC5lMJo/SnqFRTC6vL06NF7qOHfig3XO8QnQz\n' +
+ '6T5uhhrhnX2RSY3/10d2kTyHq3ZZg3+jQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD\n' +
+ 'VR0OBBYEFLDyD3PRyNXpvKHPYYxjHXWOgfPnMA4GA1UdDwEB/wQEAwIBhjAKBggq\n' +
+ 'hkjOPQQDAwNnADBkAjB20HQp6YL7CqYD82KaLGzgw305aUKw2aMrdkBR29J183jY\n' +
+ '6Ocj9+Wcif9xnRMS+7oCMAvrt03rbh4SU9BohpRUcQ2Pjkh7RoY0jDR4Xq4qzjNr\n' +
+ '5UFr3BXpFvACxXF51BksGQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjWgAwIBAgIQeKbS5zvtqDvRtwr5H48cAjAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTIwMTcxOTU1WhgPMjEyMTA1MjAxODE5NTVaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgbWUtc291dGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABEKjgUaAPmUlRMEQdBC7BScAGosJ1zRV\n' +
+ 'LDd38qTBjzgmwBfQJ5ZfGIvyEK5unB09MB4e/3qqK5I/L6Qn5Px/n5g4dq0c7MQZ\n' +
+ 'u7G9GBYm90U3WRJBf7lQrPStXaRnS4A/O6NCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUNKcAbGEIn03/vkwd8g6jNyiRdD4wDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2cAMGQCMHIeTrjenCSYuGC6txuBt/0ZwnM/ciO9kHGWVCoK8QLs\n' +
+ 'jGghb5/YSFGZbmQ6qpGlSAIwVOQgdFfTpEfe5i+Vs9frLJ4QKAfc27cTNYzRIM0I\n' +
+ 'E+AJgK4C4+DiyyMzOpiCfmvq\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCDCCA/CgAwIBAgIQSFkEUzu9FYgC5dW+5lnTgjANBgkqhkiG9w0BAQwFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoZWFzdC0zIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA2MTEwMDA4MzZaGA8yMTIxMDYxMTAxMDgzNlow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMyBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDx\n' +
+ 'my5Qmd8zdwaI/KOKV9Xar9oNbhJP5ED0JCiigkuvCkg5qM36klszE8JhsUj40xpp\n' +
+ 'vQw9wkYW4y+C8twBpzKGBvakqMnoaVUV7lOCKx0RofrnNwkZCboTBB4X/GCZ3fIl\n' +
+ 'YTybS7Ehi1UuiaZspIT5A2jidoA8HiBPk+mTg1UUkoWS9h+MEAPa8L4DY6fGf4pO\n' +
+ 'J1Gk2cdePuNzzIrpm2yPto+I8MRROwZ3ha7ooyymOXKtz2c7jEHHJ314boCXAv9G\n' +
+ 'cdo27WiebewZkHHH7Zx9iTIVuuk2abyVSzvLVeGv7Nuy4lmSqa5clWYqWsGXxvZ2\n' +
+ '0fZC5Gd+BDUMW1eSpW7QDTk3top6x/coNoWuLSfXiC5ZrJkIKimSp9iguULgpK7G\n' +
+ 'abMMN4PR+O+vhcB8E879hcwmS2yd3IwcPTl3QXxufqeSV58/h2ibkqb/W4Bvggf6\n' +
+ '5JMHQPlPHOqMCVFIHP1IffIo+Of7clb30g9FD2j3F4qgV3OLwEDNg/zuO1DiAvH1\n' +
+ 'L+OnmGHkfbtYz+AVApkAZrxMWwoYrwpauyBusvSzwRE24vLTd2i80ZDH422QBLXG\n' +
+ 'rN7Zas8rwIiBKacJLYtBYETw8mfsNt8gb72aIQX6cZOsphqp6hUtKaiMTVgGazl7\n' +
+ 'tBXqbB+sIv3S9X6bM4cZJKkMJOXbnyCCLZFYv8TurwIDAQABo0IwQDAPBgNVHRMB\n' +
+ 'Af8EBTADAQH/MB0GA1UdDgQWBBTOVtaS1b/lz6yJDvNk65vEastbQTAOBgNVHQ8B\n' +
+ 'Af8EBAMCAYYwDQYJKoZIhvcNAQEMBQADggIBABEONg+TmMZM/PrYGNAfB4S41zp1\n' +
+ '3CVjslZswh/pC4kgXSf8cPJiUOzMwUevuFQj7tCqxQtJEygJM2IFg4ViInIah2kh\n' +
+ 'xlRakEGGw2dEVlxZAmmLWxlL1s1lN1565t5kgVwM0GVfwYM2xEvUaby6KDVJIkD3\n' +
+ 'aM6sFDBshvVA70qOggM6kU6mwTbivOROzfoIQDnVaT+LQjHqY/T+ok6IN0YXXCWl\n' +
+ 'Favai8RDjzLDFwXSRvgIK+1c49vlFFY4W9Efp7Z9tPSZU1TvWUcKdAtV8P2fPHAS\n' +
+ 'vAZ+g9JuNfeawhEibjXkwg6Z/yFUueQCQOs9TRXYogzp5CMMkfdNJF8byKYqHscs\n' +
+ 'UosIcETnHwqwban99u35sWcoDZPr6aBIrz7LGKTJrL8Nis8qHqnqQBXu/fsQEN8u\n' +
+ 'zJ2LBi8sievnzd0qI0kaWmg8GzZmYH1JCt1GXSqOFkI8FMy2bahP7TUQR1LBUKQ3\n' +
+ 'hrOSqldkhN+cSAOnvbQcFzLr+iEYEk34+NhcMIFVE+51KJ1n6+zISOinr6mI3ckX\n' +
+ '6p2tmiCD4Shk2Xx/VTY/KGvQWKFcQApWezBSvDNlGe0yV71LtLf3dr1pr4ofo7cE\n' +
+ 'rYucCJ40bfxEU/fmzYdBF32xP7AOD9U0FbOR3Mcthc6Z6w20WFC+zru8FGY08gPf\n' +
+ 'WT1QcNdw7ntUJP/w\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQARky6+5PNFRkFVOp3Ob1CTAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjIwNTIzMTg0MTI4WhgPMjEyMjA1MjMxOTQxMjdaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgZXUtc291dGgtMiBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABNVGL5oF7cfIBxKyWd2PVK/S5yQfaJY3\n' +
+ 'QFHWvEdt6951n9JhiiPrHzfVHsxZp1CBjILRMzjgRbYWmc8qRoLkgGE7htGdwudJ\n' +
+ 'Fa/WuKzO574Prv4iZXUnVGTboC7JdvKbh6NCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUgDeIIEKynwUbNXApdIPnmRWieZwwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMEOOJfucrST+FxuqJkMZyCM3gWGZaB+/w6+XUAJC6hFM\n' +
+ 'uSTY0F44/bERkA4XhH+YGAIxAIpJQBakCA1/mXjsTnQ+0El9ty+LODp8ibkn031c\n' +
+ '8DKDS7pR9UK7ZYdR6zFg3ZCjQw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjOgAwIBAgIQJvkWUcYLbnxtuwnyjMmntDAKBggqhkjOPQQDAzCBljEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMS8wLQYDVQQDDCZBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMyBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTAgFw0yMTA1MjUyMjI2MTJaGA8yMTIxMDUyNTIzMjYxMlowgZYxCzAJBgNV\n' +
+ 'BAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYD\n' +
+ 'VQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1hem9uIFJE\n' +
+ 'UyBldS13ZXN0LTMgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0bGUw\n' +
+ 'djAQBgcqhkjOPQIBBgUrgQQAIgNiAARENn8uHCyjn1dFax4OeXxvbV861qsXFD9G\n' +
+ 'DshumTmFzWWHN/69WN/AOsxy9XN5S7Cgad4gQgeYYYgZ5taw+tFo/jQvCLY//uR5\n' +
+ 'uihcLuLJ78opvRPvD9kbWZ6oXfBtFkWjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD\n' +
+ 'VR0OBBYEFKiK3LpoF+gDnqPldGSwChBPCYciMA4GA1UdDwEB/wQEAwIBhjAKBggq\n' +
+ 'hkjOPQQDAwNpADBmAjEA+7qfvRlnvF1Aosyp9HzxxCbN7VKu+QXXPhLEBWa5oeWW\n' +
+ 'UOcifunf/IVLC4/FGCsLAjEAte1AYp+iJyOHDB8UYkhBE/1sxnFaTiEPbvQBU0wZ\n' +
+ 'SuwWVLhu2wWDuSW+K7tTuL8p\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAKeDpqX5WFCGNo94M4v69sUwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTMgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIyMTgzM1oYDzIwNjEwNTI1MjMxODMzWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMyBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCcKOTEMTfzvs4H\n' +
+ 'WtJR8gI7GXN6xesulWtZPv21oT+fLGwJ+9Bv8ADCGDDrDxfeH/HxJmzG9hgVAzVn\n' +
+ '4g97Bn7q07tGZM5pVi96/aNp11velZT7spOJKfJDZTlGns6DPdHmx48whpdO+dOb\n' +
+ '6+eR0VwCIv+Vl1fWXgoACXYCoKjhxJs+R+fwY//0JJ1YG8yjZ+ghLCJmvlkOJmE1\n' +
+ 'TCPUyIENaEONd6T+FHGLVYRRxC2cPO65Jc4yQjsXvvQypoGgx7FwD5voNJnFMdyY\n' +
+ '754JGPOOe/SZdepN7Tz7UEq8kn7NQSbhmCsgA/Hkjkchz96qN/YJ+H/okiQUTNB0\n' +
+ 'eG9ogiVFAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFFjayw9Y\n' +
+ 'MjbxfF14XAhMM2VPl0PfMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAAtmx6d9+9CWlMoU0JCirtp4dSS41bBfb9Oor6GQ8WIr2LdfZLL6uES/ubJPE\n' +
+ '1Sh5Vu/Zon5/MbqLMVrfniv3UpQIof37jKXsjZJFE1JVD/qQfRzG8AlBkYgHNEiS\n' +
+ 'VtD4lFxERmaCkY1tjKB4Dbd5hfhdrDy29618ZjbSP7NwAfnwb96jobCmMKgxVGiH\n' +
+ 'UqsLSiEBZ33b2hI7PJ6iTJnYBWGuiDnsWzKRmheA4nxwbmcQSfjbrNwa93w3caL2\n' +
+ 'v/4u54Kcasvcu3yFsUwJygt8z43jsGAemNZsS7GWESxVVlW93MJRn6M+MMakkl9L\n' +
+ 'tWaXdHZ+KUV7LhfYLb0ajvb40w==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBDCCAuygAwIBAgIQJ5oxPEjefCsaESSwrxk68DANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNjA2MjExNzA1WhgPMjA2MjA2MDYyMjE3MDVaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgZXUtY2VudHJhbC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALTQt5eX\n' +
+ 'g+VP3BjO9VBkWJhE0GfLrU/QIk32I6WvrnejayTrlup9H1z4QWlXF7GNJrqScRMY\n' +
+ 'KhJHlcP05aPsx1lYco6pdFOf42ybXyWHHJdShj4A5glU81GTT+VrXGzHSarLmtua\n' +
+ 'eozkQgPpDsSlPt0RefyTyel7r3Cq+5K/4vyjCTcIqbfgaGwTU36ffjM1LaPCuE4O\n' +
+ 'nINMeD6YuImt2hU/mFl20FZ+IZQUIFZZU7pxGLqTRz/PWcH8tDDxnkYg7tNuXOeN\n' +
+ 'JbTpXrw7St50/E9ZQ0llGS+MxJD8jGRAa/oL4G/cwnV8P2OEPVVkgN9xDDQeieo0\n' +
+ '3xkzolkDkmeKOnUCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU\n' +
+ 'bwu8635iQGQMRanekesORM8Hkm4wDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEB\n' +
+ 'CwUAA4IBAQAgN6LE9mUgjsj6xGCX1afYE69fnmCjjb0rC6eEe1mb/QZNcyw4XBIW\n' +
+ '6+zTXo4mjZ4ffoxb//R0/+vdTE7IvaLgfAZgFsLKJCtYDDstXZj8ujQnGR9Pig3R\n' +
+ 'W+LpNacvOOSJSawNQq0Xrlcu55AU4buyD5VjcICnfF1dqBMnGTnh27m/scd/ZMx/\n' +
+ 'kapHZ/fMoK2mAgSX/NvUKF3UkhT85vSSM2BTtET33DzCPDQTZQYxFBa4rFRmFi4c\n' +
+ 'BLlmIReiCGyh3eJhuUUuYAbK6wLaRyPsyEcIOLMQmZe1+gAFm1+1/q5Ke9ugBmjf\n' +
+ 'PbTWjsi/lfZ5CdVAhc5lmZj/l5aKqwaS\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAKKPTYKln9L4NTx9dpZGUjowCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTIxMjI1NTIxWhgPMjEyMTA1MjEyMzU1MjFaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgZXUtd2VzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAE/owTReDvaRqdmbtTzXbyRmEpKCETNj6O\n' +
+ 'hZMKH0F8oU9Tmn8RU7kQQj6xUKEyjLPrFBN7c+26TvrVO1KmJAvbc8bVliiJZMbc\n' +
+ 'C0yV5PtJTalvlMZA1NnciZuhxaxrzlK1o0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBT4i5HaoHtrs7Mi8auLhMbKM1XevDAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIxAK9A+8/lFdX4XJKgfP+ZLy5ySXC2E0Spoy12Gv2GdUEZ\n' +
+ 'p1G7c1KbWVlyb1d6subzkQIwKyH0Naf/3usWfftkmq8SzagicKz5cGcEUaULq4tO\n' +
+ 'GzA/AMpr63IDBAqkZbMDTCmH\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQTgIvwTDuNWQo0Oe1sOPQEzAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LW5vcnRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTI0MjEwNjM4WhgPMjEyMTA1MjQyMjA2MzhaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgZXUtbm9ydGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABJuzXLU8q6WwSKXBvx8BbdIi3mPhb7Xo\n' +
+ 'rNJBfuMW1XRj5BcKH1ZoGaDGw+BIIwyBJg8qNmCK8kqIb4cH8/Hbo3Y+xBJyoXq/\n' +
+ 'cuk8aPrxiNoRsKWwiDHCsVxaK9L7GhHHAqNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUYgcsdU4fm5xtuqLNppkfTHM2QMYwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMQDz/Rm89+QJOWJecYAmYcBWCcETASyoK1kbr4vw7Hsg\n' +
+ '7Ew3LpLeq4IRmTyuiTMl0gMCMAa0QSjfAnxBKGhAnYxcNJSntUyyMpaXzur43ec0\n' +
+ '3D8npJghwC4DuICtKEkQiI5cSg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAORIGqQXLTcbbYT2upIsSnQwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBldS1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMjA1MjMxODM0MjJaGA8yMTIyMDUyMzE5MzQyMlowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBldS1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAPKukwsW2s/h\n' +
+ '1k+Hf65pOP0knVBnOnMQyT1mopp2XHGdXznj9xS49S30jYoUnWccyXgD983A1bzu\n' +
+ 'w4fuJRHg4MFdz/NWTgXvy+zy0Roe83OPIJjUmXnnzwUHQcBa9vl6XUO65iQ3pbSi\n' +
+ 'fQfNDFXD8cvuXbkezeADoy+iFAlzhXTzV9MD44GTuo9Z3qAXNGHQCrgRSCL7uRYt\n' +
+ 't1nfwboCbsVRnElopn2cTigyVXE62HzBUmAw1GTbAZeFAqCn5giBWYAfHwTUldRL\n' +
+ '6eEa6atfsS2oPNus4ZENa1iQxXq7ft+pMdNt0qKXTCZiiCZjmLkY0V9kWwHTRRF8\n' +
+ 'r+75oSL//3di43QnuSCgjwMRIeWNtMud5jf3eQzSBci+9njb6DrrSUbx7blP0srg\n' +
+ '94/C/fYOp/0/EHH34w99Th14VVuGWgDgKahT9/COychLOubXUT6vD1As47S9KxTv\n' +
+ 'yYleVKwJnF9cVjepODN72fNlEf74BwzgSIhUmhksmZSeJBabrjSUj3pdyo/iRZN/\n' +
+ 'CiYz9YPQ29eXHPQjBZVIUqWbOVfdwsx0/Xu5T1e7yyXByQ3/oDulahtcoKPAFQ3J\n' +
+ 'ee6NJK655MdS7pM9hJnU2Rzu3qZ/GkM6YK7xTlMXVouPUZov/VbiaCKbqYDs8Dg+\n' +
+ 'UKdeNXAT6+BMleGQzly1X7vjhgeA8ugVAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFJdaPwpCf78UolFTEn6GO85/QwUIMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAWkxHIT3mers5YnZRSVjmpxCLivGj1jMB9VYC\n' +
+ 'iKqTAeIvD0940L0YaZgivQll5pue8UUcQ6M2uCdVVAsNJdmQ5XHIYiGOknYPtxzO\n' +
+ 'aO+bnZp7VIZw/vJ49hvH6RreA2bbxYMZO/ossYdcWsWbOKHFrRmAw0AhtK/my51g\n' +
+ 'obV7eQg+WmlE5Iqc75ycUsoZdc3NimkjBi7LQoNP1HMvlLHlF71UZhQDdq+/WdV7\n' +
+ '0zmg+epkki1LjgMmuPyb+xWuYkFKT1/faX+Xs62hIm5BY+aI4if4RuQ+J//0pOSs\n' +
+ 'UajrjTo+jLGB8A96jAe8HaFQenbwMjlaHRDAF0wvbkYrMr5a6EbneAB37V05QD0Y\n' +
+ 'Rh4L4RrSs9DX2hbSmS6iLDuPEjanHKzglF5ePEvnItbRvGGkynqDVlwF+Bqfnw8l\n' +
+ '0i8Hr1f1/LP1c075UjkvsHlUnGgPbLqA0rDdcxF8Fdlv1BunUjX0pVlz10Ha5M6P\n' +
+ 'AdyWUOneOfaA5G7jjv7i9qg3r99JNs1/Lmyg/tV++gnWTAsSPFSSEte81kmPhlK3\n' +
+ '2UtAO47nOdTtk+q4VIRAwY1MaOR7wTFZPfer1mWs4RhKNu/odp8urEY87iIzbMWT\n' +
+ 'QYO/4I6BGj9rEWNGncvR5XTowwIthMCj2KWKM3Z/JxvjVFylSf+s+FFfO1bNIm6h\n' +
+ 'u3UBpZI=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtDCCAjmgAwIBAgIQenQbcP/Zbj9JxvZ+jXbRnTAKBggqhkjOPQQDAzCBmTEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTIwMAYDVQQDDClBbWF6\n' +
+ 'b24gUkRTIGV1LWNlbnRyYWwtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTAgFw0yMTA1MjEyMjMzMjRaGA8yMTIxMDUyMTIzMzMyNFowgZkxCzAJ\n' +
+ 'BgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMw\n' +
+ 'EQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1hem9u\n' +
+ 'IFJEUyBldS1jZW50cmFsLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAATlBHiEM9LoEb1Hdnd5j2VpCDOU\n' +
+ '5nGuFoBD8ROUCkFLFh5mHrHfPXwBc63heW9WrP3qnDEm+UZEUvW7ROvtWCTPZdLz\n' +
+ 'Z4XaqgAlSqeE2VfUyZOZzBSgUUJk7OlznXfkCMOjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFDT/ThjQZl42Nv/4Z/7JYaPNMly2MA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjAKBggqhkjOPQQDAwNpADBmAjEAnZWmSgpEbmq+oiCa13l5aGmxSlfp9h12Orvw\n' +
+ 'Dq/W5cENJz891QD0ufOsic5oGq1JAjEAp5kSJj0MxJBTHQze1Aa9gG4sjHBxXn98\n' +
+ '4MP1VGsQuhfndNHQb4V0Au7OWnOeiobq\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAMgnyikWz46xY6yRgiYwZ3swDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE2NDkxMloYDzIwNjEwNTIwMTc0OTEyWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCi8JYOc9cYSgZH\n' +
+ 'gYPxLk6Xcc7HqzamvsnjYU98Dcb98y6iDqS46Ra2Ne02MITtU5MDL+qjxb8WGDZV\n' +
+ 'RUA9ZS69tkTO3gldW8QdiSh3J6hVNJQW81F0M7ZWgV0gB3n76WCmfT4IWos0AXHM\n' +
+ '5v7M/M4tqVmCPViQnZb2kdVlM3/Xc9GInfSMCgNfwHPTXl+PXX+xCdNBePaP/A5C\n' +
+ '5S0oK3HiXaKGQAy3K7VnaQaYdiv32XUatlM4K2WS4AMKt+2cw3hTCjlmqKRHvYFQ\n' +
+ 'veWCXAuc+U5PQDJ9SuxB1buFJZhT4VP3JagOuZbh5NWpIbOTxlAJOb5pGEDuJTKi\n' +
+ '1gQQQVEFAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFNXm+N87\n' +
+ 'OFxK9Af/bjSxDCiulGUzMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAkqIbkgZ45spvrgRQ6n9VKzDLvNg+WciLtmVrqyohwwJbj4pYvWwnKQCkVc7c\n' +
+ 'hUOSBmlSBa5REAPbH5o8bdt00FPRrD6BdXLXhaECKgjsHe1WW08nsequRKD8xVmc\n' +
+ '8bEX6sw/utBeBV3mB+3Zv7ejYAbDFM4vnRsWtO+XqgReOgrl+cwdA6SNQT9oW3e5\n' +
+ 'rSQ+VaXgJtl9NhkiIysq9BeYigxqS/A13pHQp0COMwS8nz+kBPHhJTsajHCDc8F4\n' +
+ 'HfLi6cgs9G0gaRhT8FCH66OdGSqn196sE7Y3bPFFFs/3U+vxvmQgoZC6jegQXAg5\n' +
+ 'Prxd+VNXtNI/azitTysQPumH7A==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBTCCAu2gAwIBAgIRAO8bekN7rUReuNPG8pSTKtEwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZoxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEzMDEGA1UEAwwq\n' +
+ 'QW1hem9uIFJEUyBldS1jZW50cmFsLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUyMTIyMjM0N1oYDzIwNjEwNTIxMjMyMzQ3WjCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCTTYds\n' +
+ 'Tray+Q9VA5j5jTh5TunHKFQzn68ZbOzdqaoi/Rq4ohfC0xdLrxCpfqn2TGDHN6Zi\n' +
+ '2qGK1tWJZEd1H0trhzd9d1CtGK+3cjabUmz/TjSW/qBar7e9MA67/iJ74Gc+Ww43\n' +
+ 'A0xPNIWcL4aLrHaLm7sHgAO2UCKsrBUpxErOAACERScVYwPAfu79xeFcX7DmcX+e\n' +
+ 'lIqY16pQAvK2RIzrekSYfLFxwFq2hnlgKHaVgZ3keKP+nmXcXmRSHQYUUr72oYNZ\n' +
+ 'HcNYl2+gxCc9ccPEHM7xncVEKmb5cWEWvVoaysgQ+osi5f5aQdzgC2X2g2daKbyA\n' +
+ 'XL/z5FM9GHpS5BJjAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE\n' +
+ 'FBDAiJ7Py9/A9etNa/ebOnx5l5MGMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0B\n' +
+ 'AQsFAAOCAQEALMh/+81fFPdJV/RrJUeoUvFCGMp8iaANu97NpeJyKitNOv7RoeVP\n' +
+ 'WjivS0KcCqZaDBs+p6IZ0sLI5ZH098LDzzytcfZg0PsGqUAb8a0MiU/LfgDCI9Ee\n' +
+ 'jsOiwaFB8k0tfUJK32NPcIoQYApTMT2e26lPzYORSkfuntme2PTHUnuC7ikiQrZk\n' +
+ 'P+SZjWgRuMcp09JfRXyAYWIuix4Gy0eZ4rpRuaTK6mjAb1/LYoNK/iZ/gTeIqrNt\n' +
+ 'l70OWRsWW8jEmSyNTIubGK/gGGyfuZGSyqoRX6OKHESkP6SSulbIZHyJ5VZkgtXo\n' +
+ '2XvyRyJ7w5pFyoofrL3Wv0UF8yt/GDszmg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAMDk/F+rrhdn42SfE+ghPC8wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTIgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMTIyNTEyMloYDzIxMjEwNTIxMjM1MTIyWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC2twMALVg9vRVu\n' +
+ 'VNqsr6N8thmp3Dy8jEGTsm3GCQ+C5P2YcGlD/T/5icfWW84uF7Sx3ezcGlvsqFMf\n' +
+ 'Ukj9sQyqtz7qfFFugyy7pa/eH9f48kWFHLbQYm9GEgbYBIrWMp1cy3vyxuMCwQN4\n' +
+ 'DCncqU+yNpy0CprQJEha3PzY+3yJOjDQtc3zr99lyECCFJTDUucxHzyQvX89eL74\n' +
+ 'uh8la0lKH3v9wPpnEoftbrwmm5jHNFdzj7uXUHUJ41N7af7z7QUfghIRhlBDiKtx\n' +
+ '5lYZemPCXajTc3ryDKUZC/b+B6ViXZmAeMdmQoPE0jwyEp/uaUcdp+FlUQwCfsBk\n' +
+ 'ayPFEApTWgPiku2isjdeTVmEgL8bJTDUZ6FYFR7ZHcYAsDzcwHgIu3GGEMVRS3Uf\n' +
+ 'ILmioiyly9vcK4Sa01ondARmsi/I0s7pWpKflaekyv5boJKD/xqwz9lGejmJHelf\n' +
+ '8Od2TyqJScMpB7Q8c2ROxBwqwB72jMCEvYigB+Wnbb8RipliqNflIGx938FRCzKL\n' +
+ 'UQUBmNAznR/yRRL0wHf9UAE/8v9a09uZABeiznzOFAl/frHpgdAbC00LkFlnwwgX\n' +
+ 'g8YfEFlkp4fLx5B7LtoO6uVNFVimLxtwirpyKoj3G4M/kvSTux8bTw0heBCmWmKR\n' +
+ '57MS6k7ODzbv+Kpeht2hqVZCNFMxoQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBRuMnDhJjoj7DcKALj+HbxEqj3r6jAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBALSnXfx72C3ldhBP5kY4Mo2DDaGQ8FGpTOOiD95d\n' +
+ '0rf7I9LrsBGVqu/Nir+kqqP80PB70+Jy9fHFFigXwcPBX3MpKGxK8Cel7kVf8t1B\n' +
+ '4YD6A6bqlzP+OUL0uGWfZpdpDxwMDI2Flt4NEldHgXWPjvN1VblEKs0+kPnKowyg\n' +
+ 'jhRMgBbD/y+8yg0fIcjXUDTAw/+INcp21gWaMukKQr/8HswqC1yoqW9in2ijQkpK\n' +
+ '2RB9vcQ0/gXR0oJUbZQx0jn0OH8Agt7yfMAnJAdnHO4M3gjvlJLzIC5/4aGrRXZl\n' +
+ 'JoZKfJ2fZRnrFMi0nhAYDeInoS+Rwx+QzaBk6fX5VPyCj8foZ0nmqvuYoydzD8W5\n' +
+ 'mMlycgxFqS+DUmO+liWllQC4/MnVBlHGB1Cu3wTj5kgOvNs/k+FW3GXGzD3+rpv0\n' +
+ 'QTLuwSbMr+MbEThxrSZRSXTCQzKfehyC+WZejgLb+8ylLJUA10e62o7H9PvCrwj+\n' +
+ 'ZDVmN7qj6amzvndCP98sZfX7CFZPLfcBd4wVIjHsFjSNEwWHOiFyLPPG7cdolGKA\n' +
+ 'lOFvonvo4A1uRc13/zFeP0Xi5n5OZ2go8aOOeGYdI2vB2sgH9R2IASH/jHmr0gvY\n' +
+ '0dfBCcfXNgrS0toq0LX/y+5KkKOxh52vEYsJLdhqrveuZhQnsFEm/mFwjRXkyO7c\n' +
+ '2jpC\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGADCCA+igAwIBAgIQYe0HgSuFFP9ivYM2vONTrTANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE4MzMyMVoYDzIxMjEwNTE5MTkzMzIxWjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEAuO7QPKfPMTo2\n' +
+ 'POQWvzDLwi5f++X98hGjORI1zkN9kotCYH5pAzSBwBPoMNaIfedgmsIxGHj2fq5G\n' +
+ '4oXagNhNuGP79Zl6uKW5H7S74W7aWM8C0s8zuxMOI4GZy5h2IfQk3m/3AzZEX5w8\n' +
+ 'UtNPkzo2feDVOkerHT+j+vjXgAxZ4wHnuMDcRT+K4r9EXlAH6X9b/RO0JlfEwmNz\n' +
+ 'xlqqGxocq9qRC66N6W0HF2fNEAKP84n8H80xcZBOBthQORRi8HSmKcPdmrvwCuPz\n' +
+ 'M+L+j18q6RAVaA0ABbD0jMWcTf0UvjUfBStn5mvu/wGlLjmmRkZsppUTRukfwqXK\n' +
+ 'yltUsTq0tOIgCIpne5zA4v+MebbR5JBnsvd4gdh5BI01QH470yB7BkUefZ9bobOm\n' +
+ 'OseAAVXcYFJKe4DAA6uLDrqOfFSxV+CzVvEp3IhLRaik4G5MwI/h2c/jEYDqkg2J\n' +
+ 'HMflxc2gcSMdk7E5ByLz5f6QrFfSDFk02ZJTs4ssbbUEYohht9znPMQEaWVqATWE\n' +
+ '3n0VspqZyoBNkH/agE5GiGZ/k/QyeqzMNj+c9kr43Upu8DpLrz8v2uAp5xNj3YVg\n' +
+ 'ihaeD6GW8+PQoEjZ3mrCmH7uGLmHxh7Am59LfEyNrDn+8Rq95WvkmbyHSVxZnBmo\n' +
+ 'h/6O3Jk+0/QhIXZ2hryMflPcYWeRGH0CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB\n' +
+ '/zAdBgNVHQ4EFgQU2eFK7+R3x/me8roIBNxBrplkM6EwDgYDVR0PAQH/BAQDAgGG\n' +
+ 'MA0GCSqGSIb3DQEBDAUAA4ICAQB5gWFe5s7ObQFj1fTO9L6gYgtFhnwdmxU0q8Ke\n' +
+ 'HWCrdFmyXdC39qdAFOwM5/7fa9zKmiMrZvy9HNvCXEp4Z7z9mHhBmuqPZQx0qPgU\n' +
+ 'uLdP8wGRuWryzp3g2oqkX9t31Z0JnkbIdp7kfRT6ME4I4VQsaY5Y3mh+hIHOUvcy\n' +
+ 'p+98i3UuEIcwJnVAV9wTTzrWusZl9iaQ1nSYbmkX9bBssJ2GmtW+T+VS/1hJ/Q4f\n' +
+ 'AlE3dOQkLFoPPb3YRWBHr2n1LPIqMVwDNAuWavRA2dSfaLl+kzbn/dua7HTQU5D4\n' +
+ 'b2Fu2vLhGirwRJe+V7zdef+tI7sngXqjgObyOeG5O2BY3s+um6D4fS0Th3QchMO7\n' +
+ '0+GwcIgSgcjIjlrt6/xJwJLE8cRkUUieYKq1C4McpZWTF30WnzOPUzRzLHkcNzNA\n' +
+ '0A7sKMK6QoYWo5Rmo8zewUxUqzc9oQSrYADP7PEwGncLtFe+dlRFx+PA1a+lcIgo\n' +
+ '1ZGfXigYtQ3VKkcknyYlJ+hN4eCMBHtD81xDy9iP2MLE41JhLnoB2rVEtewO5diF\n' +
+ '7o95Mwl84VMkLhhHPeGKSKzEbBtYYBifHNct+Bst8dru8UumTltgfX6urH3DN+/8\n' +
+ 'JF+5h3U8oR2LL5y76cyeb+GWDXXy9zoQe2QvTyTy88LwZq1JzujYi2k8QiLLhFIf\n' +
+ 'FEv9Bg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICsDCCAjagAwIBAgIRAMgApnfGYPpK/fD0dbN2U4YwCgYIKoZIzj0EAwMwgZcx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwnQW1h\n' +
+ 'em9uIFJEUyBldS1zb3V0aC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMCAXDTIxMDUxOTE4MzgxMVoYDzIxMjEwNTE5MTkzODExWjCBlzELMAkG\n' +
+ 'A1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzAR\n' +
+ 'BgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6b24g\n' +
+ 'UkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0\n' +
+ 'bGUwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAAQfEWl6d4qSuIoECdZPp+39LaKsfsX7\n' +
+ 'THs3/RrtT0+h/jl3bjZ7Qc68k16x+HGcHbaayHfqD0LPdzH/kKtNSfQKqemdxDQh\n' +
+ 'Z4pwkixJu8T1VpXZ5zzCvBXCl75UqgEFS92jQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFFPrSNtWS5JU+Tvi6ABV231XbjbEMA4GA1UdDwEB/wQEAwIBhjAK\n' +
+ 'BggqhkjOPQQDAwNoADBlAjEA+a7hF1IrNkBd2N/l7IQYAQw8chnRZDzh4wiGsZsC\n' +
+ '6A83maaKFWUKIb3qZYXFSi02AjAbp3wxH3myAmF8WekDHhKcC2zDvyOiKLkg9Y6v\n' +
+ 'ZVmyMR043dscQbcsVoacOYv198c=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtDCCAjqgAwIBAgIRAPhVkIsQ51JFhD2kjFK5uAkwCgYIKoZIzj0EAwMwgZkx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1h\n' +
+ 'em9uIFJEUyBldS1jZW50cmFsLTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjIwNjA2MjEyOTE3WhgPMjEyMjA2MDYyMjI5MTdaMIGZMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMjAwBgNVBAMMKUFtYXpv\n' +
+ 'biBSRFMgZXUtY2VudHJhbC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEA5xnIEBtG5b2nmbj49UEwQza\n' +
+ 'yX0844fXjccYzZ8xCDUe9dS2XOUi0aZlGblgSe/3lwjg8fMcKXLObGGQfgIx1+5h\n' +
+ 'AIBjORis/dlyN5q/yH4U5sjS8tcR0GDGVHrsRUZCo0IwQDAPBgNVHRMBAf8EBTAD\n' +
+ 'AQH/MB0GA1UdDgQWBBRK+lSGutXf4DkTjR3WNfv4+KeNFTAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwCgYIKoZIzj0EAwMDaAAwZQIxAJ4NxQ1Gerqr70ZrnUqc62Vl8NNqTzInamCG\n' +
+ 'Kce3FTsMWbS9qkgrjZkO9QqOcGIw/gIwSLrwUT+PKr9+H9eHyGvpq9/3AIYSnFkb\n' +
+ 'Cf3dyWPiLKoAtLFwjzB/CkJlsAS1c8dS\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQGZH12Q7x41qIh9vDu9ikTjANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIGV1LXdlc3QtMyBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI1MjIyMjMzWhgPMjEyMTA1MjUyMzIyMzNaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgZXUtd2VzdC0zIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMqE47sHXWzdpuqj\n' +
+ 'JHb+6jM9tDbQLDFnYjDWpq4VpLPZhb7xPNh9gnYYTPKG4avG421EblAHqzy9D2pN\n' +
+ '1z90yKbIfUb/Sy2MhQbmZomsObhONEra06fJ0Dydyjswf1iYRp2kwpx5AgkVoNo7\n' +
+ '3dlws73zFjD7ImKvUx2C7B75bhnw2pJWkFnGcswl8fZt9B5Yt95sFOKEz2MSJE91\n' +
+ 'kZlHtya19OUxZ/cSGci4MlOySzqzbGwUqGxEIDlY8I39VMwXaYQ8uXUN4G780VcL\n' +
+ 'u46FeyRGxZGz2n3hMc805WAA1V5uir87vuirTvoSVREET97HVRGVVNJJ/FM6GXr1\n' +
+ 'VKtptybbo81nefYJg9KBysxAa2Ao2x2ry/2ZxwhS6VZ6v1+90bpZA1BIYFEDXXn/\n' +
+ 'dW07HSCFnYSlgPtSc+Muh15mdr94LspYeDqNIierK9i4tB6ep7llJAnq0BU91fM2\n' +
+ 'JPeqyoTtc3m06QhLf68ccSxO4l8Hmq9kLSHO7UXgtdjfRVaffngopTNk8qK7bIb7\n' +
+ 'LrgkqhiQw/PRCZjUdyXL153/fUcsj9nFNe25gM4vcFYwH6c5trd2tUl31NTi1MfG\n' +
+ 'Mgp3d2dqxQBIYANkEjtBDMy3SqQLIo9EymqmVP8xx2A/gCBgaxvMAsI6FSWRoC7+\n' +
+ 'hqJ8XH4mFnXSHKtYMe6WPY+/XZgtAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFIkXqTnllT/VJnI2NqipA4XV8rh1MA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEAKjSle8eenGeHgT8pltWCw/HzWyQruVKhfYIBfKJd\n' +
+ 'MhV4EnH5BK7LxBIvpXGsFUrb0ThzSw0fn0zoA9jBs3i/Sj6KyeZ9qUF6b8ycDXd+\n' +
+ 'wHonmJiQ7nk7UuMefaYAfs06vosgl1rI7eBHC0itexIQmKh0aX+821l4GEgEoSMf\n' +
+ 'loMFTLXv2w36fPHHCsZ67ODldgcZbKNnpCTX0YrCwEYO3Pz/L398btiRcWGrewrK\n' +
+ 'jdxAAyietra8DRno1Zl87685tfqc6HsL9v8rVw58clAo9XAQvT+fmSOFw/PogRZ7\n' +
+ 'OMHUat3gu/uQ1M5S64nkLLFsKu7jzudBuoNmcJysPlzIbqJ7vYc82OUGe9ucF3wi\n' +
+ '3tbKQ983hdJiTExVRBLX/fYjPsGbG3JtPTv89eg2tjWHlPhCDMMxyRKl6isu2RTq\n' +
+ '6VT489Z2zQrC33MYF8ZqO1NKjtyMAMIZwxVu4cGLkVsqFmEV2ScDHa5RadDyD3Ok\n' +
+ 'm+mqybhvEVm5tPgY6p0ILPMN3yvJsMSPSvuBXhO/X5ppNnpw9gnxpwbjQKNhkFaG\n' +
+ 'M5pkADZ14uRguOLM4VthSwUSEAr5VQYCFZhEwK+UOyJAGiB/nJz6IxL5XBNUXmRM\n' +
+ 'Hl8Xvz4riq48LMQbjcVQj0XvH941yPh+P8xOi00SGaQRaWp55Vyr4YKGbV0mEDz1\n' +
+ 'r1o=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAKwYju1QWxUZpn6D1gOtwgQwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE2NTM1NFoYDzIxMjEwNTIwMTc1MzU0WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCKdBP1U4lqWWkc\n' +
+ 'Cb25/BKRTsvNVnISiKocva8GAzJyKfcGRa85gmgu41U+Hz6+39K+XkRfM0YS4BvQ\n' +
+ 'F1XxWT0bNyypuvwCvmYShSTjN1TY0ltncDddahTajE/4MdSOZb/c98u0yt03cH+G\n' +
+ 'hVwRyT50h0v/UEol50VfwcVAEZEgcQQYhf1IFUFlIvKpmDOqLuFakOnc7c9akK+i\n' +
+ 'ivST+JO1tgowbnNkn2iLlSSgUWgb1gjaOsNfysagv1RXdlyPw3EyfwkFifAQvF2P\n' +
+ 'Q0ayYZfYS640cccv7efM1MSVyFHR9PrrDsF/zr2S2sGPbeHr7R/HwLl+S5J/l9N9\n' +
+ 'y0rk6IHAWV4dEkOvgpnuJKURwA48iu1Hhi9e4moNS6eqoK2KmY3VFpuiyWcA73nH\n' +
+ 'GSmyaH+YuMrF7Fnuu7GEHZL/o6+F5cL3mj2SJJhL7sz0ryf5Cs5R4yN9BIEj/f49\n' +
+ 'wh84pM6nexoI0Q4wiSFCxWiBpjSmOK6h7z6+2utaB5p20XDZHhxAlmlx4vMuWtjh\n' +
+ 'XckgRFxc+ZpVMU3cAHUpVEoO49e/+qKEpPzp8Xg4cToKw2+AfTk3cmyyXQfGwXMQ\n' +
+ 'ZUHNZ3w9ILMWihGCM2aGUsLcGDRennvNmnmin/SENsOQ8Ku0/a3teEzwV9cmmdYz\n' +
+ '5iYs1YtgPvKFobY6+T2RXXh+A5kprwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBSyUrsQVnKmA8z6/2Ech0rCvqpNmTAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBAFlj3IFmgiFz5lvTzFTRizhVofhTJsGr14Yfkuc7\n' +
+ 'UrXPuXOwJomd4uot2d/VIeGJpfnuS84qGdmQyGewGTJ9inatHsGZgHl9NHNWRwKZ\n' +
+ 'lTKTbBiq7aqgtUSFa06v202wpzU+1kadxJJePrbABxiXVfOmIW/a1a4hPNcT3syH\n' +
+ 'FIEg1+CGsp71UNjBuwg3JTKWna0sLSKcxLOSOvX1fzxK5djzVpEsvQMB4PSAzXca\n' +
+ 'vENgg2ErTwgTA+4s6rRtiBF9pAusN1QVuBahYP3ftrY6f3ycS4K65GnqscyfvKt5\n' +
+ 'YgjtEKO3ZeeX8NpubMbzC+0Z6tVKfPFk/9TXuJtwvVeqow0YMrLLyRiYvK7EzJ97\n' +
+ 'rrkxoKnHYQSZ+rH2tZ5SE392/rfk1PJL0cdHnkpDkUDO+8cKsFjjYKAQSNC52sKX\n' +
+ '74AVh6wMwxYwVZZJf2/2XxkjMWWhKNejsZhUkTISSmiLs+qPe3L67IM7GyKm9/m6\n' +
+ 'R3r8x6NGjhTsKH64iYJg7AeKeax4b2e4hBb6GXFftyOs7unpEOIVkJJgM6gh3mwn\n' +
+ 'R7v4gwFbLKADKt1vHuerSZMiTuNTGhSfCeDM53XI/mjZl2HeuCKP1mCDLlaO+gZR\n' +
+ 'Q/G+E0sBKgEX4xTkAc3kgkuQGfExdGtnN2U2ehF80lBHB8+2y2E+xWWXih/ZyIcW\n' +
+ 'wOx+\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBDCCA+ygAwIBAgIQM4C8g5iFRucSWdC8EdqHeDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjEwNTIxMjIyODI2WhgPMjEyMTA1MjEyMzI4MjZaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgZXUtY2VudHJhbC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANeTsD/u\n' +
+ '6saPiY4Sg0GlJlMXMBltnrcGAEkwq34OKQ0bCXqcoNJ2rcAMmuFC5x9Ho1Y3YzB7\n' +
+ 'NO2GpIh6bZaO76GzSv4cnimcv9n/sQSYXsGbPD+bAtnN/RvNW1avt4C0q0/ghgF1\n' +
+ 'VFS8JihIrgPYIArAmDtGNEdl5PUrdi9y6QGggbRfidMDdxlRdZBe1C18ZdgERSEv\n' +
+ 'UgSTPRlVczONG5qcQkUGCH83MMqL5MKQiby/Br5ZyPq6rxQMwRnQ7tROuElzyYzL\n' +
+ '7d6kke+PNzG1mYy4cbYdjebwANCtZ2qYRSUHAQsOgybRcSoarv2xqcjO9cEsDiRU\n' +
+ 'l97ToadGYa4VVERuTaNZxQwrld4mvzpyKuirqZltOqg0eoy8VUsaRPL3dc5aChR0\n' +
+ 'dSrBgRYmSAClcR2/2ZCWpXemikwgt031Dsc0A/+TmVurrsqszwbr0e5xqMow9LzO\n' +
+ 'MI/JtLd0VFtoOkL/7GG2tN8a+7gnLFxpv+AQ0DH5n4k/BY/IyS+H1erqSJhOTQ11\n' +
+ 'vDOFTM5YplB9hWV9fp5PRs54ILlHTlZLpWGs3I2BrJwzRtg/rOlvsosqcge9ryai\n' +
+ 'AKm2j+JBg5wJ19R8oxRy8cfrNTftZePpISaLTyV2B16w/GsSjqixjTQe9LRN2DHk\n' +
+ 'cC+HPqYyzW2a3pUVyTGHhW6a7YsPBs9yzt6hAgMBAAGjQjBAMA8GA1UdEwEB/wQF\n' +
+ 'MAMBAf8wHQYDVR0OBBYEFIqA8QkOs2cSirOpCuKuOh9VDfJfMA4GA1UdDwEB/wQE\n' +
+ 'AwIBhjANBgkqhkiG9w0BAQwFAAOCAgEAOUI90mEIsa+vNJku0iUwdBMnHiO4gm7E\n' +
+ '5JloP7JG0xUr7d0hypDorMM3zVDAL+aZRHsq8n934Cywj7qEp1304UF6538ByGdz\n' +
+ 'tkfacJsUSYfdlNJE9KbA4T+U+7SNhj9jvePpVjdQbhgzxITE9f8CxY/eM40yluJJ\n' +
+ 'PhbaWvOiRagzo74wttlcDerzLT6Y/JrVpWhnB7IY8HvzK+BwAdaCsBUPC3HF+kth\n' +
+ 'CIqLq7J3YArTToejWZAp5OOI6DLPM1MEudyoejL02w0jq0CChmZ5i55ElEMnapRX\n' +
+ '7GQTARHmjgAOqa95FjbHEZzRPqZ72AtZAWKFcYFNk+grXSeWiDgPFOsq6mDg8DDB\n' +
+ '0kfbYwKLFFCC9YFmYzR2YrWw2NxAScccUc2chOWAoSNHiqBbHR8ofrlJSWrtmKqd\n' +
+ 'YRCXzn8wqXnTS3NNHNccqJ6dN+iMr9NGnytw8zwwSchiev53Fpc1mGrJ7BKTWH0t\n' +
+ 'ZrA6m32wzpMymtKozlOPYoE5mtZEzrzHEXfa44Rns7XIHxVQSXVWyBHLtIsZOrvW\n' +
+ 'U5F41rQaFEpEeUQ7sQvqUoISfTUVRNDn6GK6YaccEhCji14APLFIvhRQUDyYMIiM\n' +
+ '4vll0F/xgVRHTgDVQ8b8sxdhSYlqB4Wc2Ym41YRz+X2yPqk3typEZBpc4P5Tt1/N\n' +
+ '89cEIGdbjsA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQYjbPSg4+RNRD3zNxO1fuKDANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LW5vcnRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNDIwNTkyMVoYDzIwNjEwNTI0MjE1OTIxWjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LW5vcnRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA179eQHxcV0YL\n' +
+ 'XMkqEmhSBazHhnRVd8yICbMq82PitE3BZcnv1Z5Zs/oOgNmMkOKae4tCXO/41JCX\n' +
+ 'wAgbs/eWWi+nnCfpQ/FqbLPg0h3dqzAgeszQyNl9IzTzX4Nd7JFRBVJXPIIKzlRf\n' +
+ '+GmFsAhi3rYgDgO27pz3ciahVSN+CuACIRYnA0K0s9lhYdddmrW/SYeWyoB7jPa2\n' +
+ 'LmWpAs7bDOgS4LlP2H3eFepBPgNufRytSQUVA8f58lsE5w25vNiUSnrdlvDrIU5n\n' +
+ 'Qwzc7NIZCx4qJpRbSKWrUtbyJriWfAkGU7i0IoainHLn0eHp9bWkwb9D+C/tMk1X\n' +
+ 'ERZw2PDGkwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBSFmR7s\n' +
+ 'dAblusFN+xhf1ae0KUqhWTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAHsXOpjPMyH9lDhPM61zYdja1ebcMVgfUvsDvt+w0xKMKPhBzYDMs/cFOi1N\n' +
+ 'Q8LV79VNNfI2NuvFmGygcvTIR+4h0pqqZ+wjWl3Kk5jVxCrbHg3RBX02QLumKd/i\n' +
+ 'kwGcEtTUvTssn3SM8bgM0/1BDXgImZPC567ciLvWDo0s/Fe9dJJC3E0G7d/4s09n\n' +
+ 'OMdextcxFuWBZrBm/KK3QF0ByA8MG3//VXaGO9OIeeOJCpWn1G1PjT1UklYhkg61\n' +
+ 'EbsTiZVA2DLd1BGzfU4o4M5mo68l0msse/ndR1nEY6IywwpgIFue7+rEleDh6b9d\n' +
+ 'PYkG1rHVw2I0XDG4o17aOn5E94I=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQC6W4HFghUkkgyQw14a6JljANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LXNvdXRoLTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIyMDUyMzE4MTYzMloYDzIwNjIwNTIzMTkxNjMyWjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAiM/t4FV2R9Nx\n' +
+ 'UQG203UY83jInTa/6TMq0SPyg617FqYZxvz2kkx09x3dmxepUg9ttGMlPgjsRZM5\n' +
+ 'LCFEi1FWk+hxHzt7vAdhHES5tdjwds3aIkgNEillmRDVrUsbrDwufLaa+MMDO2E1\n' +
+ 'wQ/JYFXw16WBCCi2g1EtyQ2Xp+tZDX5IWOTnvhZpW8vVDptZ2AcJ5rMhfOYO3OsK\n' +
+ '5EF0GGA5ldzuezP+BkrBYGJ4wVKGxeaq9+5AT8iVZrypjwRkD7Y5CurywK3+aBwm\n' +
+ 's9Q5Nd8t45JCOUzYp92rFKsCriD86n/JnEvgDfdP6Hvtm0/DkwXK40Wz2q0Zrd0k\n' +
+ 'mjP054NRPwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRR7yqd\n' +
+ 'SfKcX2Q8GzhcVucReIpewTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAEszBRDwXcZyNm07VcFwI1Im94oKwKccuKYeJEsizTBsVon8VpEiMwDs+yGu\n' +
+ '3p8kBhvkLwWybkD/vv6McH7T5b9jDX2DoOudqYnnaYeypsPH/00Vh3LvKagqzQza\n' +
+ 'orWLx+0tLo8xW4BtU+Wrn3JId8LvAhxyYXTn9bm+EwPcStp8xGLwu53OPD1RXYuy\n' +
+ 'uu+3ps/2piP7GVfou7H6PRaqbFHNfiGg6Y+WA0HGHiJzn8uLmrRJ5YRdIOOG9/xi\n' +
+ 'qTmAZloUNM7VNuurcMM2hWF494tQpsQ6ysg2qPjbBqzlGoOt3GfBTOZmqmwmqtam\n' +
+ 'K7juWM/mdMQAJ3SMlE5wI8nVdx4=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAL9SdzVPcpq7GOpvdGoM80IwCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTIwMTY1ODA3WhgPMjEyMTA1MjAxNzU4MDdaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgZXUtd2VzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEJWDgXebvwjR+Ce+hxKOLbnsfN5W5dOlP\n' +
+ 'Zn8kwWnD+SLkU81Eac/BDJsXGrMk6jFD1vg16PEkoSevsuYWlC8xR6FmT6F6pmeh\n' +
+ 'fsMGOyJpfK4fyoEPhKeQoT23lFIc5Orjo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBSVNAN1CHAz0eZ77qz2adeqjm31TzAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIxAMlQeHbcjor49jqmcJ9gRLWdEWpXG8thIf6zfYQ/OEAg\n' +
+ 'd7GDh4fR/OUk0VfjsBUN/gIwZB0bGdXvK38s6AAE/9IT051cz/wMe9GIrX1MnL1T\n' +
+ '1F5OqnXJdiwfZRRTHsRQ/L00\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBDCCA+ygAwIBAgIQalr16vDfX4Rsr+gfQ4iVFDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNjA2MjEyNTIzWhgPMjEyMjA2MDYyMjI1MjNaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgZXUtY2VudHJhbC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANbHbFg7\n' +
+ '2VhZor1YNtez0VlNFaobS3PwOMcEn45BE3y7HONnElIIWXGQa0811M8V2FnyqnE8\n' +
+ 'Z5aO1EuvijvWf/3D8DPZkdmAkIfh5hlZYY6Aatr65kEOckwIAm7ZZzrwFogYuaFC\n' +
+ 'z/q0CW+8gxNK+98H/zeFx+IxiVoPPPX6UlrLvn+R6XYNERyHMLNgoZbbS5gGHk43\n' +
+ 'KhENVv3AWCCcCc85O4rVd+DGb2vMVt6IzXdTQt6Kih28+RGph+WDwYmf+3txTYr8\n' +
+ 'xMcCBt1+whyCPlMbC+Yn/ivtCO4LRf0MPZDRQrqTTrFf0h/V0BGEUmMGwuKgmzf5\n' +
+ 'Kl9ILdWv6S956ioZin2WgAxhcn7+z//sN++zkqLreSf90Vgv+A7xPRqIpTdJ/nWG\n' +
+ 'JaAOUofBfsDsk4X4SUFE7xJa1FZAiu2lqB/E+y7jnWOvFRalzxVJ2Y+D/ZfUfrnK\n' +
+ '4pfKtyD1C6ni1celrZrAwLrJ3PoXPSg4aJKh8+CHex477SRsGj8KP19FG8r0P5AG\n' +
+ '8lS1V+enFCNvT5KqEBpDZ/Y5SQAhAYFUX+zH4/n4ql0l/emS+x23kSRrF+yMkB9q\n' +
+ 'lhC/fMk6Pi3tICBjrDQ8XAxv56hfud9w6+/ljYB2uQ1iUYtlE3JdIiuE+3ws26O8\n' +
+ 'i7PLMD9zQmo+sVi12pLHfBHQ6RRHtdVRXbXRAgMBAAGjQjBAMA8GA1UdEwEB/wQF\n' +
+ 'MAMBAf8wHQYDVR0OBBYEFBFot08ipEL9ZUXCG4lagmF53C0/MA4GA1UdDwEB/wQE\n' +
+ 'AwIBhjANBgkqhkiG9w0BAQwFAAOCAgEAi2mcZi6cpaeqJ10xzMY0F3L2eOKYnlEQ\n' +
+ 'h6QyhmNKCUF05q5u+cok5KtznzqMwy7TFOZtbVHl8uUX+xvgq/MQCxqFAnuStBXm\n' +
+ 'gr2dg1h509ZwvTdk7TDxGdftvPCfnPNJBFbMSq4CZtNcOFBg9Rj8c3Yj+Qvwd56V\n' +
+ 'zWs65BUkDNJrXmxdvhJZjUkMa9vi/oFN+M84xXeZTaC5YDYNZZeW9706QqDbAVES\n' +
+ '5ulvKLavB8waLI/lhRBK5/k0YykCMl0A8Togt8D1QsQ0eWWbIM8/HYJMPVFhJ8Wj\n' +
+ 'vT1p/YVeDA3Bo1iKDOttgC5vILf5Rw1ZEeDxjf/r8A7VS13D3OLjBmc31zxRTs3n\n' +
+ 'XvHKP9MieQHn9GE44tEYPjK3/yC6BDFzCBlvccYHmqGb+jvDEXEBXKzimdC9mcDl\n' +
+ 'f4BBQWGJBH5jkbU9p6iti19L/zHhz7qU6UJWbxY40w92L9jS9Utljh4A0LCTjlnR\n' +
+ 'NQUgjnGC6K+jkw8hj0LTC5Ip87oqoT9w7Av5EJ3VJ4hcnmNMXJJ1DkWYdnytcGpO\n' +
+ 'DMVITQzzDZRwhbitCVPHagTN2wdi9TEuYE33J0VmFeTc6FSI50wP2aOAZ0Q1/8Aj\n' +
+ 'bxeM5jS25eaHc2CQAuhrc/7GLnxOcPwdWQb2XWT8eHudhMnoRikVv/KSK3mf6om4\n' +
+ '1YfpdH2jp30=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQTDc+UgTRtYO7ZGTQ8UWKDDANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIGV1LXdlc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTIxMjI0NjI0WhgPMjA2MTA1MjEyMzQ2MjRaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgZXUtd2VzdC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAM1oGtthQ1YiVIC2\n' +
+ 'i4u4swMAGxAjc/BZp0yq0eP5ZQFaxnxs7zFAPabEWsrjeDzrRhdVO0h7zskrertP\n' +
+ 'gblGhfD20JfjvCHdP1RUhy/nzG+T+hn6Takan/GIgs8grlBMRHMgBYHW7tklhjaH\n' +
+ '3F7LujhceAHhhgp6IOrpb6YTaTTaJbF3GTmkqxSJ3l1LtEoWz8Al/nL/Ftzxrtez\n' +
+ 'Vs6ebpvd7sw37sxmXBWX2OlvUrPCTmladw9OrllGXtCFw4YyLe3zozBlZ3cHzQ0q\n' +
+ 'lINhpRcajTMfZrsiGCkQtoJT+AqVJPS2sHjqsEH8yiySW9Jbq4zyMbM1yqQ2vnnx\n' +
+ 'MJgoYMcCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUaQG88UnV\n' +
+ 'JPTI+Pcti1P+q3H7pGYwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQBAkgr75V0sEJimC6QRiTVWEuj2Khy7unjSfudbM6zumhXEU2/sUaVLiYy6cA/x\n' +
+ '3v0laDle6T07x9g64j5YastE/4jbzrGgIINFlY0JnaYmR3KZEjgi1s1fkRRf3llL\n' +
+ 'PJm9u4Q1mbwAMQK/ZjLuuRcL3uRIHJek18nRqT5h43GB26qXyvJqeYYpYfIjL9+/\n' +
+ 'YiZAbSRRZG+Li23cmPWrbA1CJY121SB+WybCbysbOXzhD3Sl2KSZRwSw4p2HrFtV\n' +
+ '1Prk0dOBtZxCG9luf87ultuDZpfS0w6oNBAMXocgswk24ylcADkkFxBWW+7BETn1\n' +
+ 'EpK+t1Lm37mU4sxtuha00XAi\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQcY44/8NUvBwr6LlHfRy7KjANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE4MjcxOFoYDzIwNjEwNTE5MTkyNzE4WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA0UaBeC+Usalu\n' +
+ 'EtXnV7+PnH+gi7/71tI/jkKVGKuhD2JDVvqLVoqbMHRh3+wGMvqKCjbHPcC2XMWv\n' +
+ '566fpAj4UZ9CLB5fVzss+QVNTl+FH2XhEzigopp+872ajsNzcZxrMkifxGb4i0U+\n' +
+ 't0Zi+UrbL5tsfP2JonKR1crOrbS6/DlzHBjIiJazGOQcMsJjNuTOItLbMohLpraA\n' +
+ '/nApa3kOvI7Ufool1/34MG0+wL3UUA4YkZ6oBJVxjZvvs6tI7Lzz/SnhK2widGdc\n' +
+ 'snbLqBpHNIZQSorVoiwcFaRBGYX/uzYkiw44Yfa4cK2V/B5zgu1Fbr0gbI2am4eh\n' +
+ 'yVYyg4jPawIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBS9gM1m\n' +
+ 'IIjyh9O5H/7Vj0R/akI7UzAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAF0Sm9HC2AUyedBVnwgkVXMibnYChOzz7T+0Y+fOLXYAEXex2s8oqGeZdGYX\n' +
+ 'JHkjBn7JXu7LM+TpTbPbFFDoc1sgMguD/ls+8XsqAl1CssW+amryIL+jfcfbgQ+P\n' +
+ 'ICwEUD9hGdjBgJ5WcuS+qqxHsEIlFNci3HxcxfBa9VsWs5TjI7Vsl4meL5lf7ZyL\n' +
+ 'wDV7dHRuU+cImqG1MIvPRIlvPnT7EghrCYi2VCPhP2pM/UvShuwVnkz4MJ29ebIk\n' +
+ 'WR9kpblFxFdE92D5UUvMCjC2kmtgzNiErvTcwIvOO9YCbBHzRB1fFiWrXUHhJWq9\n' +
+ 'IkaxR5icb/IpAV0A1lYZEWMVsfQ=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAMa0TPL+QgbWfUPpYXQkf8wwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBldS1ub3J0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjQyMTAzMjBaGA8yMTIxMDUyNDIyMDMyMFowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBldS1ub3J0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANhS9LJVJyWp\n' +
+ '6Rudy9t47y6kzvgnFYDrvJVtgEK0vFn5ifdlHE7xqMz4LZqWBFTnS+3oidwVRqo7\n' +
+ 'tqsuuElsouStO8m315/YUzKZEPmkw8h5ufWt/lg3NTCoUZNkB4p4skr7TspyMUwE\n' +
+ 'VdlKQuWTCOLtofwmWT+BnFF3To6xTh3XPlT3ssancw27Gob8kJegD7E0TSMVsecP\n' +
+ 'B8je65+3b8CGwcD3QB3kCTGLy87tXuS2+07pncHvjMRMBdDQQQqhXWsRSeUNg0IP\n' +
+ 'xdHTWcuwMldYPWK5zus9M4dCNBDlmZjKdcZZVUOKeBBAm7Uo7CbJCk8r/Fvfr6mw\n' +
+ 'nXXDtuWhqn/WhJiI/y0QU27M+Hy5CQMxBwFsfAjJkByBpdXmyYxUgTmMpLf43p7H\n' +
+ 'oWfH1xN0cT0OQEVmAQjMakauow4AQLNkilV+X6uAAu3STQVFRSrpvMen9Xx3EPC3\n' +
+ 'G9flHueTa71bU65Xe8ZmEmFhGeFYHY0GrNPAFhq9RThPRY0IPyCZe0Th8uGejkek\n' +
+ 'jQjm0FHPOqs5jc8CD8eJs4jSEFt9lasFLVDcAhx0FkacLKQjGHvKAnnbRwhN/dF3\n' +
+ 'xt4oL8Z4JGPCLau056gKnYaEyviN7PgO+IFIVOVIdKEBu2ASGE8/+QJB5bcHefNj\n' +
+ '04hEkDW0UYJbSfPpVbGAR0gFI/QpycKnAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFFMXvvjoaGGUcul8GA3FT05DLbZcMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAQLwFhd2JKn4K/6salLyIA4mP58qbA/9BTB/r\n' +
+ 'D9l0bEwDlVPSdY7R3gZCe6v7SWLfA9RjE5tdWDrQMi5IU6W2OVrVsZS/yGJfwnwe\n' +
+ 'a/9iUAYprA5QYKDg37h12XhVsDKlYCekHdC+qa5WwB1SL3YUprDLPWeaIQdg+Uh2\n' +
+ '+LxvpZGoxoEbca0fc7flwq9ke/3sXt/3V4wJDyY6AL2YNdjFzC+FtYjHHx8rYxHs\n' +
+ 'aesP7yunuN17KcfOZBBnSFRrx96k+Xm95VReTEEpwiBqAECqEpMbd+R0mFAayMb1\n' +
+ 'cE77GaK5yeC2f67NLYGpkpIoPbO9p9rzoXLE5GpSizMjimnz6QCbXPFAFBDfSzim\n' +
+ 'u6azp40kEUO6kWd7rBhqRwLc43D3TtNWQYxMve5mTRG4Od+eMKwYZmQz89BQCeqm\n' +
+ 'aZiJP9y9uwJw4p/A5V3lYHTDQqzmbOyhGUk6OdpdE8HXs/1ep1xTT20QDYOx3Ekt\n' +
+ 'r4mmNYfH/8v9nHNRlYJOqFhmoh1i85IUl5IHhg6OT5ZTTwsGTSxvgQQXrmmHVrgZ\n' +
+ 'rZIqyBKllCgVeB9sMEsntn4bGLig7CS/N1y2mYdW/745yCLZv2gj0NXhPqgEIdVV\n' +
+ 'f9DhFD4ohE1C63XP0kOQee+LYg/MY5vH8swpCSWxQgX5icv5jVDz8YTdCKgUc5u8\n' +
+ 'rM2p0kk=\n' +
+ '-----END CERTIFICATE-----\n',
+];
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts
new file mode 100644
index 0000000..da2b76b
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts
@@ -0,0 +1,8 @@
+import type { CA } from '../../@types/profiles.js';
+/**
+ * CA Certificates for **Amazon RDS Proxy** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/rds-proxy.howitworks.html#rds-proxy-security.tls
+ * - https://www.amazontrust.com/repository/
+ */
+export declare const proxies: CA;
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js
new file mode 100644
index 0000000..367a4c3
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js
@@ -0,0 +1,111 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.proxies = void 0;
+/**
+ * CA Certificates for **Amazon RDS Proxy** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/rds-proxy.howitworks.html#rds-proxy-security.tls
+ * - https://www.amazontrust.com/repository/
+ */
+exports.proxies = [
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIDQTCCAimgAwIBAgITBmyfz5m/jAo54vB4ikPmljZbyjANBgkqhkiG9w0BAQsF\n' +
+ 'ADA5MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6\n' +
+ 'b24gUm9vdCBDQSAxMB4XDTE1MDUyNjAwMDAwMFoXDTM4MDExNzAwMDAwMFowOTEL\n' +
+ 'MAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJv\n' +
+ 'b3QgQ0EgMTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALJ4gHHKeNXj\n' +
+ 'ca9HgFB0fW7Y14h29Jlo91ghYPl0hAEvrAIthtOgQ3pOsqTQNroBvo3bSMgHFzZM\n' +
+ '9O6II8c+6zf1tRn4SWiw3te5djgdYZ6k/oI2peVKVuRF4fn9tBb6dNqcmzU5L/qw\n' +
+ 'IFAGbHrQgLKm+a/sRxmPUDgH3KKHOVj4utWp+UhnMJbulHheb4mjUcAwhmahRWa6\n' +
+ 'VOujw5H5SNz/0egwLX0tdHA114gk957EWW67c4cX8jJGKLhD+rcdqsq08p8kDi1L\n' +
+ '93FcXmn/6pUCyziKrlA4b9v7LWIbxcceVOF34GfID5yHI9Y/QCB/IIDEgEw+OyQm\n' +
+ 'jgSubJrIqg0CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwHQYDVR0OBBYEFIQYzIU07LwMlJQuCFmcx7IQTgoIMA0GCSqGSIb3DQEBCwUA\n' +
+ 'A4IBAQCY8jdaQZChGsV2USggNiMOruYou6r4lK5IpDB/G/wkjUu0yKGX9rbxenDI\n' +
+ 'U5PMCCjjmCXPI6T53iHTfIUJrU6adTrCC2qJeHZERxhlbI1Bjjt/msv0tadQ1wUs\n' +
+ 'N+gDS63pYaACbvXy8MWy7Vu33PqUXHeeE6V/Uq2V8viTO96LXFvKWlJbYK8U90vv\n' +
+ 'o/ufQJVtMVT8QtPHRh8jrdkPSHCa2XV4cdFyQzR1bldZwgJcJmApzyMZFo6IQ6XU\n' +
+ '5MsI+yMRQ+hDKXJioaldXgjUkK642M4UwtBV8ob2xJNDd2ZhwLnoQdeXeGADbkpy\n' +
+ 'rqXRfboQnoZsG4q5WTP468SQvvG5\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIFQTCCAymgAwIBAgITBmyf0pY1hp8KD+WGePhbJruKNzANBgkqhkiG9w0BAQwF\n' +
+ 'ADA5MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6\n' +
+ 'b24gUm9vdCBDQSAyMB4XDTE1MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTEL\n' +
+ 'MAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJv\n' +
+ 'b3QgQ0EgMjCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAK2Wny2cSkxK\n' +
+ 'gXlRmeyKy2tgURO8TW0G/LAIjd0ZEGrHJgw12MBvIITplLGbhQPDW9tK6Mj4kHbZ\n' +
+ 'W0/jTOgGNk3Mmqw9DJArktQGGWCsN0R5hYGCrVo34A3MnaZMUnbqQ523BNFQ9lXg\n' +
+ '1dKmSYXpN+nKfq5clU1Imj+uIFptiJXZNLhSGkOQsL9sBbm2eLfq0OQ6PBJTYv9K\n' +
+ '8nu+NQWpEjTj82R0Yiw9AElaKP4yRLuH3WUnAnE72kr3H9rN9yFVkE8P7K6C4Z9r\n' +
+ '2UXTu/Bfh+08LDmG2j/e7HJV63mjrdvdfLC6HM783k81ds8P+HgfajZRRidhW+me\n' +
+ 'z/CiVX18JYpvL7TFz4QuK/0NURBs+18bvBt+xa47mAExkv8LV/SasrlX6avvDXbR\n' +
+ '8O70zoan4G7ptGmh32n2M8ZpLpcTnqWHsFcQgTfJU7O7f/aS0ZzQGPSSbtqDT6Zj\n' +
+ 'mUyl+17vIWR6IF9sZIUVyzfpYgwLKhbcAS4y2j5L9Z469hdAlO+ekQiG+r5jqFoz\n' +
+ '7Mt0Q5X5bGlSNscpb/xVA1wf+5+9R+vnSUeVC06JIglJ4PVhHvG/LopyboBZ/1c6\n' +
+ '+XUyo05f7O0oYtlNc/LMgRdg7c3r3NunysV+Ar3yVAhU/bQtCSwXVEqY0VThUWcI\n' +
+ '0u1ufm8/0i2BWSlmy5A5lREedCf+3euvAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBSwDPBMMPQFWAJI/TPlUq9LhONm\n' +
+ 'UjANBgkqhkiG9w0BAQwFAAOCAgEAqqiAjw54o+Ci1M3m9Zh6O+oAA7CXDpO8Wqj2\n' +
+ 'LIxyh6mx/H9z/WNxeKWHWc8w4Q0QshNabYL1auaAn6AFC2jkR2vHat+2/XcycuUY\n' +
+ '+gn0oJMsXdKMdYV2ZZAMA3m3MSNjrXiDCYZohMr/+c8mmpJ5581LxedhpxfL86kS\n' +
+ 'k5Nrp+gvU5LEYFiwzAJRGFuFjWJZY7attN6a+yb3ACfAXVU3dJnJUH/jWS5E4ywl\n' +
+ '7uxMMne0nxrpS10gxdr9HIcWxkPo1LsmmkVwXqkLN1PiRnsn/eBG8om3zEK2yygm\n' +
+ 'btmlyTrIQRNg91CMFa6ybRoVGld45pIq2WWQgj9sAq+uEjonljYE1x2igGOpm/Hl\n' +
+ 'urR8FLBOybEfdF849lHqm/osohHUqS0nGkWxr7JOcQ3AWEbWaQbLU8uz/mtBzUF+\n' +
+ 'fUwPfHJ5elnNXkoOrJupmHN5fLT0zLm4BwyydFy4x2+IoZCn9Kr5v2c69BoVYh63\n' +
+ 'n749sSmvZ6ES8lgQGVMDMBu4Gon2nL2XA46jCfMdiyHxtN/kHNGfZQIG6lzWE7OE\n' +
+ '76KlXIx3KadowGuuQNKotOrN8I1LOJwZmhsoVLiJkO/KdYE+HvJkJMcYr07/R54H\n' +
+ '9jVlpNMKVv/1F2Rs76giJUmTtt8AF9pYfl3uxRuw0dFfIRDH+fO6AgonB8Xx1sfT\n' +
+ '4PsJYGw=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIBtjCCAVugAwIBAgITBmyf1XSXNmY/Owua2eiedgPySjAKBggqhkjOPQQDAjA5\n' +
+ 'MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24g\n' +
+ 'Um9vdCBDQSAzMB4XDTE1MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkG\n' +
+ 'A1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJvb3Qg\n' +
+ 'Q0EgMzBZMBMGByqGSM49AgEGCCqGSM49AwEHA0IABCmXp8ZBf8ANm+gBG1bG8lKl\n' +
+ 'ui2yEujSLtf6ycXYqm0fc4E7O5hrOXwzpcVOho6AF2hiRVd9RFgdszflZwjrZt6j\n' +
+ 'QjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBSr\n' +
+ 'ttvXBp43rDCGB5Fwx5zEGbF4wDAKBggqhkjOPQQDAgNJADBGAiEA4IWSoxe3jfkr\n' +
+ 'BqWTrBqYaGFy+uGh0PsceGCmQ5nFuMQCIQCcAu/xlJyzlvnrxir4tiz+OpAUFteM\n' +
+ 'YyRIHN8wfdVoOw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIB8jCCAXigAwIBAgITBmyf18G7EEwpQ+Vxe3ssyBrBDjAKBggqhkjOPQQDAzA5\n' +
+ 'MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24g\n' +
+ 'Um9vdCBDQSA0MB4XDTE1MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkG\n' +
+ 'A1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJvb3Qg\n' +
+ 'Q0EgNDB2MBAGByqGSM49AgEGBSuBBAAiA2IABNKrijdPo1MN/sGKe0uoe0ZLY7Bi\n' +
+ '9i0b2whxIdIA6GO9mif78DluXeo9pcmBqqNbIJhFXRbb/egQbeOc4OO9X4Ri83Bk\n' +
+ 'M6DLJC9wuoihKqB1+IGuYgbEgds5bimwHvouXKNCMEAwDwYDVR0TAQH/BAUwAwEB\n' +
+ '/zAOBgNVHQ8BAf8EBAMCAYYwHQYDVR0OBBYEFNPsxzplbszh2naaVvuc84ZtV+WB\n' +
+ 'MAoGCCqGSM49BAMDA2gAMGUCMDqLIfG9fhGt0O9Yli/W651+kI0rz2ZVwyzjKKlw\n' +
+ 'CkcO8DdZEv8tmZQoTipPNU0zWgIxAOp1AE47xDqUEpHJWEadIRNyp4iciuRMStuW\n' +
+ '1KyLa2tJElMzrdfkviT8tQp21KW8EA==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID7zCCAtegAwIBAgIBADANBgkqhkiG9w0BAQsFADCBmDELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAgTB0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoT\n' +
+ 'HFN0YXJmaWVsZCBUZWNobm9sb2dpZXMsIEluYy4xOzA5BgNVBAMTMlN0YXJmaWVs\n' +
+ 'ZCBTZXJ2aWNlcyBSb290IENlcnRpZmljYXRlIEF1dGhvcml0eSAtIEcyMB4XDTA5\n' +
+ 'MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgZgxCzAJBgNVBAYTAlVTMRAwDgYD\n' +
+ 'VQQIEwdBcml6b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxTdGFy\n' +
+ 'ZmllbGQgVGVjaG5vbG9naWVzLCBJbmMuMTswOQYDVQQDEzJTdGFyZmllbGQgU2Vy\n' +
+ 'dmljZXMgUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZI\n' +
+ 'hvcNAQEBBQADggEPADCCAQoCggEBANUMOsQq+U7i9b4Zl1+OiFOxHz/Lz58gE20p\n' +
+ 'OsgPfTz3a3Y4Y9k2YKibXlwAgLIvWX/2h/klQ4bnaRtSmpDhcePYLQ1Ob/bISdm2\n' +
+ '8xpWriu2dBTrz/sm4xq6HZYuajtYlIlHVv8loJNwU4PahHQUw2eeBGg6345AWh1K\n' +
+ 'Ts9DkTvnVtYAcMtS7nt9rjrnvDH5RfbCYM8TWQIrgMw0R9+53pBlbQLPLJGmpufe\n' +
+ 'hRhJfGZOozptqbXuNC66DQO4M99H67FrjSXZm86B0UVGMpZwh94CDklDhbZsc7tk\n' +
+ '6mFBrMnUVN+HL8cisibMn1lUaJ/8viovxFUcdUBgF4UCVTmLfwUCAwEAAaNCMEAw\n' +
+ 'DwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFJxfAN+q\n' +
+ 'AdcwKziIorhtSpzyEZGDMA0GCSqGSIb3DQEBCwUAA4IBAQBLNqaEd2ndOxmfZyMI\n' +
+ 'bw5hyf2E3F/YNoHN2BtBLZ9g3ccaaNnRbobhiCPPE95Dz+I0swSdHynVv/heyNXB\n' +
+ 've6SbzJ08pGCL72CQnqtKrcgfU28elUSwhXqvfdqlS5sdJ/PHLTyxQGjhdByPq1z\n' +
+ 'qwubdQxtRbeOlKyWN7Wg0I8VRw7j6IPdj/3vQQF3zCepYoUz8jcI73HPdwbeyBkd\n' +
+ 'iEDPfUYd/x7H4c7/I9vG+o1VTqkC50cRRj70/b17KSa7qWFiNyi2LSr2EIZkyXCn\n' +
+ '0q23KXB56jzaYyWf/Wi3MOxw+3WKt21gZ7IeyLnp2KhvAotnDU0mV3HaIPzBSlCN\n' +
+ 'sSi6\n' +
+ '-----END CERTIFICATE-----\n',
+];
diff --git a/node_modules/aws-ssl-profiles/package.json b/node_modules/aws-ssl-profiles/package.json
new file mode 100644
index 0000000..0856ad9
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/package.json
@@ -0,0 +1,52 @@
+{
+ "name": "aws-ssl-profiles",
+ "version": "1.1.2",
+ "main": "lib/index.js",
+ "author": "https://github.com/wellwelwel",
+ "description": "AWS RDS SSL certificates bundles.",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/mysqljs/aws-ssl-profiles"
+ },
+ "bugs": {
+ "url": "https://github.com/mysqljs/aws-ssl-profiles/issues"
+ },
+ "devDependencies": {
+ "@biomejs/biome": "^1.8.3",
+ "@types/node": "^22.5.1",
+ "@types/x509.js": "^1.0.3",
+ "poku": "^2.5.0",
+ "prettier": "^3.3.3",
+ "tsx": "^4.19.0",
+ "typescript": "^5.5.4",
+ "x509.js": "^1.0.0"
+ },
+ "files": [
+ "lib"
+ ],
+ "engines": {
+ "node": ">= 6.0.0"
+ },
+ "keywords": [
+ "mysql",
+ "mysql2",
+ "pg",
+ "postgres",
+ "aws",
+ "rds",
+ "ssl",
+ "certificates",
+ "ca",
+ "bundle"
+ ],
+ "scripts": {
+ "build": "npx tsc",
+ "postbuild": "cp src/index.d.ts lib/index.d.ts",
+ "lint": "npx @biomejs/biome lint && prettier --check .",
+ "lint:fix": "npx @biomejs/biome lint --write . && prettier --write .",
+ "pretest": "npm run build",
+ "test": "poku --parallel ./test",
+ "test:ci": "npm run lint && npm run test"
+ }
+}
diff --git a/node_modules/balanced-match/.github/FUNDING.yml b/node_modules/balanced-match/.github/FUNDING.yml
new file mode 100644
index 0000000..cea8b16
--- /dev/null
+++ b/node_modules/balanced-match/.github/FUNDING.yml
@@ -0,0 +1,2 @@
+tidelift: "npm/balanced-match"
+patreon: juliangruber
diff --git a/node_modules/balanced-match/LICENSE.md b/node_modules/balanced-match/LICENSE.md
new file mode 100644
index 0000000..2cdc8e4
--- /dev/null
+++ b/node_modules/balanced-match/LICENSE.md
@@ -0,0 +1,21 @@
+(MIT)
+
+Copyright (c) 2013 Julian Gruber <julian@juliangruber.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/balanced-match/README.md b/node_modules/balanced-match/README.md
new file mode 100644
index 0000000..d2a48b6
--- /dev/null
+++ b/node_modules/balanced-match/README.md
@@ -0,0 +1,97 @@
+# balanced-match
+
+Match balanced string pairs, like `{` and `}` or `` and ` `. Supports regular expressions as well!
+
+[](http://travis-ci.org/juliangruber/balanced-match)
+[](https://www.npmjs.org/package/balanced-match)
+
+[](https://ci.testling.com/juliangruber/balanced-match)
+
+## Example
+
+Get the first matching pair of braces:
+
+```js
+var balanced = require('balanced-match');
+
+console.log(balanced('{', '}', 'pre{in{nested}}post'));
+console.log(balanced('{', '}', 'pre{first}between{second}post'));
+console.log(balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post'));
+```
+
+The matches are:
+
+```bash
+$ node example.js
+{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' }
+{ start: 3,
+ end: 9,
+ pre: 'pre',
+ body: 'first',
+ post: 'between{second}post' }
+{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' }
+```
+
+## API
+
+### var m = balanced(a, b, str)
+
+For the first non-nested matching pair of `a` and `b` in `str`, return an
+object with those keys:
+
+* **start** the index of the first match of `a`
+* **end** the index of the matching `b`
+* **pre** the preamble, `a` and `b` not included
+* **body** the match, `a` and `b` not included
+* **post** the postscript, `a` and `b` not included
+
+If there's no match, `undefined` will be returned.
+
+If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`.
+
+### var r = balanced.range(a, b, str)
+
+For the first non-nested matching pair of `a` and `b` in `str`, return an
+array with indexes: `[ , ]`.
+
+If there's no match, `undefined` will be returned.
+
+If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`.
+
+## Installation
+
+With [npm](https://npmjs.org) do:
+
+```bash
+npm install balanced-match
+```
+
+## Security contact information
+
+To report a security vulnerability, please use the
+[Tidelift security contact](https://tidelift.com/security).
+Tidelift will coordinate the fix and disclosure.
+
+## License
+
+(MIT)
+
+Copyright (c) 2013 Julian Gruber <julian@juliangruber.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/balanced-match/index.js b/node_modules/balanced-match/index.js
new file mode 100644
index 0000000..c67a646
--- /dev/null
+++ b/node_modules/balanced-match/index.js
@@ -0,0 +1,62 @@
+'use strict';
+module.exports = balanced;
+function balanced(a, b, str) {
+ if (a instanceof RegExp) a = maybeMatch(a, str);
+ if (b instanceof RegExp) b = maybeMatch(b, str);
+
+ var r = range(a, b, str);
+
+ return r && {
+ start: r[0],
+ end: r[1],
+ pre: str.slice(0, r[0]),
+ body: str.slice(r[0] + a.length, r[1]),
+ post: str.slice(r[1] + b.length)
+ };
+}
+
+function maybeMatch(reg, str) {
+ var m = str.match(reg);
+ return m ? m[0] : null;
+}
+
+balanced.range = range;
+function range(a, b, str) {
+ var begs, beg, left, right, result;
+ var ai = str.indexOf(a);
+ var bi = str.indexOf(b, ai + 1);
+ var i = ai;
+
+ if (ai >= 0 && bi > 0) {
+ if(a===b) {
+ return [ai, bi];
+ }
+ begs = [];
+ left = str.length;
+
+ while (i >= 0 && !result) {
+ if (i == ai) {
+ begs.push(i);
+ ai = str.indexOf(a, i + 1);
+ } else if (begs.length == 1) {
+ result = [ begs.pop(), bi ];
+ } else {
+ beg = begs.pop();
+ if (beg < left) {
+ left = beg;
+ right = bi;
+ }
+
+ bi = str.indexOf(b, i + 1);
+ }
+
+ i = ai < bi && ai >= 0 ? ai : bi;
+ }
+
+ if (begs.length) {
+ result = [ left, right ];
+ }
+ }
+
+ return result;
+}
diff --git a/node_modules/balanced-match/package.json b/node_modules/balanced-match/package.json
new file mode 100644
index 0000000..ce6073e
--- /dev/null
+++ b/node_modules/balanced-match/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "balanced-match",
+ "description": "Match balanced character pairs, like \"{\" and \"}\"",
+ "version": "1.0.2",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/juliangruber/balanced-match.git"
+ },
+ "homepage": "https://github.com/juliangruber/balanced-match",
+ "main": "index.js",
+ "scripts": {
+ "test": "tape test/test.js",
+ "bench": "matcha test/bench.js"
+ },
+ "devDependencies": {
+ "matcha": "^0.7.0",
+ "tape": "^4.6.0"
+ },
+ "keywords": [
+ "match",
+ "regexp",
+ "test",
+ "balanced",
+ "parse"
+ ],
+ "author": {
+ "name": "Julian Gruber",
+ "email": "mail@juliangruber.com",
+ "url": "http://juliangruber.com"
+ },
+ "license": "MIT",
+ "testling": {
+ "files": "test/*.js",
+ "browsers": [
+ "ie/8..latest",
+ "firefox/20..latest",
+ "firefox/nightly",
+ "chrome/25..latest",
+ "chrome/canary",
+ "opera/12..latest",
+ "opera/next",
+ "safari/5.1..latest",
+ "ipad/6.0..latest",
+ "iphone/6.0..latest",
+ "android-browser/4.2..latest"
+ ]
+ }
+}
diff --git a/node_modules/bignumber.js/CHANGELOG.md b/node_modules/bignumber.js/CHANGELOG.md
new file mode 100644
index 0000000..e3ec980
--- /dev/null
+++ b/node_modules/bignumber.js/CHANGELOG.md
@@ -0,0 +1,266 @@
+#### 9.0.0
+* 27/05/2019
+* For compatibility with legacy browsers, remove `Symbol` references.
+
+#### 8.1.1
+* 24/02/2019
+* [BUGFIX] #222 Restore missing `var` to `export BigNumber`.
+* Allow any key in BigNumber.Instance in *bignumber.d.ts*.
+
+#### 8.1.0
+* 23/02/2019
+* [NEW FEATURE] #220 Create a BigNumber using `{s, e, c}`.
+* [NEW FEATURE] `isBigNumber`: if `BigNumber.DEBUG` is `true`, also check that the BigNumber instance is well-formed.
+* Remove `instanceof` checks; just use `_isBigNumber` to identify a BigNumber instance.
+* Add `_isBigNumber` to prototype in *bignumber.mjs*.
+* Add tests for BigNumber creation from object.
+* Update *API.html*.
+
+#### 8.0.2
+* 13/01/2019
+* #209 `toPrecision` without argument should follow `toString`.
+* Improve *Use* section of *README*.
+* Optimise `toString(10)`.
+* Add verson number to API doc.
+
+#### 8.0.1
+* 01/11/2018
+* Rest parameter must be array type in *bignumber.d.ts*.
+
+#### 8.0.0
+* 01/11/2018
+* [NEW FEATURE] Add `BigNumber.sum` method.
+* [NEW FEATURE]`toFormat`: add `prefix` and `suffix` options.
+* [NEW FEATURE] #178 Pass custom formatting to `toFormat`.
+* [BREAKING CHANGE] #184 `toFraction`: return array of BigNumbers not strings.
+* [NEW FEATURE] #185 Enable overwrite of `valueOf` to prevent accidental addition to string.
+* #183 Add Node.js `crypto` requirement to documentation.
+* [BREAKING CHANGE] #198 Disallow signs and whitespace in custom alphabet.
+* [NEW FEATURE] #188 Implement `util.inspect.custom` for Node.js REPL.
+* #170 Make `isBigNumber` a type guard in *bignumber.d.ts*.
+* [BREAKING CHANGE] `BigNumber.min` and `BigNumber.max`: don't accept an array.
+* Update *.travis.yml*.
+* Remove *bower.json*.
+
+#### 7.2.1
+* 24/05/2018
+* Add `browser` field to *package.json*.
+
+#### 7.2.0
+* 22/05/2018
+* #166 Correct *.mjs* file. Remove extension from `main` field in *package.json*.
+
+#### 7.1.0
+* 18/05/2018
+* Add `module` field to *package.json* for *bignumber.mjs*.
+
+#### 7.0.2
+* 17/05/2018
+* #165 Bugfix: upper-case letters for bases 11-36 in a custom alphabet.
+* Add note to *README* regarding creating BigNumbers from Number values.
+
+#### 7.0.1
+* 26/04/2018
+* #158 Fix global object variable name typo.
+
+#### 7.0.0
+* 26/04/2018
+* #143 Remove global BigNumber from typings.
+* #144 Enable compatibility with `Object.freeze(Object.prototype)`.
+* #148 #123 #11 Only throw on a number primitive with more than 15 significant digits if `BigNumber.DEBUG` is `true`.
+* Only throw on an invalid BigNumber value if `BigNumber.DEBUG` is `true`. Return BigNumber `NaN` instead.
+* #154 `exponentiatedBy`: allow BigNumber exponent.
+* #156 Prevent Content Security Policy *unsafe-eval* issue.
+* `toFraction`: allow `Infinity` maximum denominator.
+* Comment-out some excess tests to reduce test time.
+* Amend indentation and other spacing.
+
+#### 6.0.0
+* 26/01/2018
+* #137 Implement `APLHABET` configuration option.
+* Remove `ERRORS` configuration option.
+* Remove `toDigits` method; extend `precision` method accordingly.
+* Remove s`round` method; extend `decimalPlaces` method accordingly.
+* Remove methods: `ceil`, `floor`, and `truncated`.
+* Remove method aliases: `add`, `cmp`, `isInt`, `isNeg`, `trunc`, `mul`, `neg` and `sub`.
+* Rename methods: `shift` to `shiftedBy`, `another` to `clone`, `toPower` to `exponentiatedBy`, and `equals` to `isEqualTo`.
+* Rename methods: add `is` prefix to `greaterThan`, `greaterThanOrEqualTo`, `lessThan` and `lessThanOrEqualTo`.
+* Add methods: `multipliedBy`, `isBigNumber`, `isPositive`, `integerValue`, `maximum` and `minimum`.
+* Refactor test suite.
+* Add *CHANGELOG.md*.
+* Rewrite *bignumber.d.ts*.
+* Redo API image.
+
+#### 5.0.0
+* 27/11/2017
+* #81 Don't throw on constructor call without `new`.
+
+#### 4.1.0
+* 26/09/2017
+* Remove node 0.6 from *.travis.yml*.
+* Add *bignumber.mjs*.
+
+#### 4.0.4
+* 03/09/2017
+* Add missing aliases to *bignumber.d.ts*.
+
+#### 4.0.3
+* 30/08/2017
+* Add types: *bignumber.d.ts*.
+
+#### 4.0.2
+* 03/05/2017
+* #120 Workaround Safari/Webkit bug.
+
+#### 4.0.1
+* 05/04/2017
+* #121 BigNumber.default to BigNumber['default'].
+
+#### 4.0.0
+* 09/01/2017
+* Replace BigNumber.isBigNumber method with isBigNumber prototype property.
+
+#### 3.1.2
+* 08/01/2017
+* Minor documentation edit.
+
+#### 3.1.1
+* 08/01/2017
+* Uncomment `isBigNumber` tests.
+* Ignore dot files.
+
+#### 3.1.0
+* 08/01/2017
+* Add `isBigNumber` method.
+
+#### 3.0.2
+* 08/01/2017
+* Bugfix: Possible incorrect value of `ERRORS` after a `BigNumber.another` call (due to `parseNumeric` declaration in outer scope).
+
+#### 3.0.1
+* 23/11/2016
+* Apply fix for old ipads with `%` issue, see #57 and #102.
+* Correct error message.
+
+#### 3.0.0
+* 09/11/2016
+* Remove `require('crypto')` - leave it to the user.
+* Add `BigNumber.set` as `BigNumber.config` alias.
+* Default `POW_PRECISION` to `0`.
+
+#### 2.4.0
+* 14/07/2016
+* #97 Add exports to support ES6 imports.
+
+#### 2.3.0
+* 07/03/2016
+* #86 Add modulus parameter to `toPower`.
+
+#### 2.2.0
+* 03/03/2016
+* #91 Permit larger JS integers.
+
+#### 2.1.4
+* 15/12/2015
+* Correct UMD.
+
+#### 2.1.3
+* 13/12/2015
+* Refactor re global object and crypto availability when bundling.
+
+#### 2.1.2
+* 10/12/2015
+* Bugfix: `window.crypto` not assigned to `crypto`.
+
+#### 2.1.1
+* 09/12/2015
+* Prevent code bundler from adding `crypto` shim.
+
+#### 2.1.0
+* 26/10/2015
+* For `valueOf` and `toJSON`, include the minus sign with negative zero.
+
+#### 2.0.8
+* 2/10/2015
+* Internal round function bugfix.
+
+#### 2.0.6
+* 31/03/2015
+* Add bower.json. Tweak division after in-depth review.
+
+#### 2.0.5
+* 25/03/2015
+* Amend README. Remove bitcoin address.
+
+#### 2.0.4
+* 25/03/2015
+* Critical bugfix #58: division.
+
+#### 2.0.3
+* 18/02/2015
+* Amend README. Add source map.
+
+#### 2.0.2
+* 18/02/2015
+* Correct links.
+
+#### 2.0.1
+* 18/02/2015
+* Add `max`, `min`, `precision`, `random`, `shiftedBy`, `toDigits` and `truncated` methods.
+* Add the short-forms: `add`, `mul`, `sd`, `sub` and `trunc`.
+* Add an `another` method to enable multiple independent constructors to be created.
+* Add support for the base 2, 8 and 16 prefixes `0b`, `0o` and `0x`.
+* Enable a rounding mode to be specified as a second parameter to `toExponential`, `toFixed`, `toFormat` and `toPrecision`.
+* Add a `CRYPTO` configuration property so cryptographically-secure pseudo-random number generation can be specified.
+* Add a `MODULO_MODE` configuration property to enable the rounding mode used by the `modulo` operation to be specified.
+* Add a `POW_PRECISION` configuration property to enable the number of significant digits calculated by the power operation to be limited.
+* Improve code quality.
+* Improve documentation.
+
+#### 2.0.0
+* 29/12/2014
+* Add `dividedToIntegerBy`, `isInteger` and `toFormat` methods.
+* Remove the following short-forms: `isF`, `isZ`, `toE`, `toF`, `toFr`, `toN`, `toP`, `toS`.
+* Store a BigNumber's coefficient in base 1e14, rather than base 10.
+* Add fast path for integers to BigNumber constructor.
+* Incorporate the library into the online documentation.
+
+#### 1.5.0
+* 13/11/2014
+* Add `toJSON` and `decimalPlaces` methods.
+
+#### 1.4.1
+* 08/06/2014
+* Amend README.
+
+#### 1.4.0
+* 08/05/2014
+* Add `toNumber`.
+
+#### 1.3.0
+* 08/11/2013
+* Ensure correct rounding of `sqrt` in all, rather than almost all, cases.
+* Maximum radix to 64.
+
+#### 1.2.1
+* 17/10/2013
+* Sign of zero when x < 0 and x + (-x) = 0.
+
+#### 1.2.0
+* 19/9/2013
+* Throw Error objects for stack.
+
+#### 1.1.1
+* 22/8/2013
+* Show original value in constructor error message.
+
+#### 1.1.0
+* 1/8/2013
+* Allow numbers with trailing radix point.
+
+#### 1.0.1
+* Bugfix: error messages with incorrect method name
+
+#### 1.0.0
+* 8/11/2012
+* Initial release
diff --git a/node_modules/bignumber.js/LICENCE b/node_modules/bignumber.js/LICENCE
new file mode 100644
index 0000000..3c39f85
--- /dev/null
+++ b/node_modules/bignumber.js/LICENCE
@@ -0,0 +1,23 @@
+The MIT Licence.
+
+Copyright (c) 2019 Michael Mclaughlin
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/bignumber.js/README.md b/node_modules/bignumber.js/README.md
new file mode 100644
index 0000000..a4a3e10
--- /dev/null
+++ b/node_modules/bignumber.js/README.md
@@ -0,0 +1,268 @@
+
+
+A JavaScript library for arbitrary-precision decimal and non-decimal arithmetic.
+
+[](https://travis-ci.org/MikeMcl/bignumber.js)
+
+
+
+## Features
+
+ - Integers and decimals
+ - Simple API but full-featured
+ - Faster, smaller, and perhaps easier to use than JavaScript versions of Java's BigDecimal
+ - 8 KB minified and gzipped
+ - Replicates the `toExponential`, `toFixed`, `toPrecision` and `toString` methods of JavaScript's Number type
+ - Includes a `toFraction` and a correctly-rounded `squareRoot` method
+ - Supports cryptographically-secure pseudo-random number generation
+ - No dependencies
+ - Wide platform compatibility: uses JavaScript 1.5 (ECMAScript 3) features only
+ - Comprehensive [documentation](http://mikemcl.github.io/bignumber.js/) and test set
+
+
+
+If a smaller and simpler library is required see [big.js](https://github.com/MikeMcl/big.js/).
+It's less than half the size but only works with decimal numbers and only has half the methods.
+It also does not allow `NaN` or `Infinity`, or have the configuration options of this library.
+
+See also [decimal.js](https://github.com/MikeMcl/decimal.js/), which among other things adds support for non-integer powers, and performs all operations to a specified number of significant digits.
+
+## Load
+
+The library is the single JavaScript file *bignumber.js* (or minified, *bignumber.min.js*).
+
+Browser:
+
+```html
+
+```
+
+[Node.js](http://nodejs.org):
+
+```bash
+$ npm install bignumber.js
+```
+
+```javascript
+const BigNumber = require('bignumber.js');
+```
+
+ES6 module:
+
+```javascript
+import BigNumber from "./bignumber.mjs"
+```
+
+AMD loader libraries such as [requireJS](http://requirejs.org/):
+
+```javascript
+require(['bignumber'], function(BigNumber) {
+ // Use BigNumber here in local scope. No global BigNumber.
+});
+```
+
+## Use
+
+The library exports a single constructor function, [`BigNumber`](http://mikemcl.github.io/bignumber.js/#bignumber), which accepts a value of type Number, String or BigNumber,
+
+```javascript
+let x = new BigNumber(123.4567);
+let y = BigNumber('123456.7e-3');
+let z = new BigNumber(x);
+x.isEqualTo(y) && y.isEqualTo(z) && x.isEqualTo(z); // true
+```
+
+To get the string value of a BigNumber use [`toString()`](http://mikemcl.github.io/bignumber.js/#toS) or [`toFixed()`](http://mikemcl.github.io/bignumber.js/#toFix). Using `toFixed()` prevents exponential notation being returned, no matter how large or small the value.
+
+```javascript
+let x = new BigNumber('1111222233334444555566');
+x.toString(); // "1.111222233334444555566e+21"
+x.toFixed(); // "1111222233334444555566"
+```
+
+If the limited precision of Number values is not well understood, it is recommended to create BigNumbers from String values rather than Number values to avoid a potential loss of precision.
+
+*In all further examples below, `let`, semicolons and `toString` calls are not shown. If a commented-out value is in quotes it means `toString` has been called on the preceding expression.*
+
+```javascript
+// Precision loss from using numeric literals with more than 15 significant digits.
+new BigNumber(1.0000000000000001) // '1'
+new BigNumber(88259496234518.57) // '88259496234518.56'
+new BigNumber(99999999999999999999) // '100000000000000000000'
+
+// Precision loss from using numeric literals outside the range of Number values.
+new BigNumber(2e+308) // 'Infinity'
+new BigNumber(1e-324) // '0'
+
+// Precision loss from the unexpected result of arithmetic with Number values.
+new BigNumber(0.7 + 0.1) // '0.7999999999999999'
+```
+
+When creating a BigNumber from a Number, note that a BigNumber is created from a Number's decimal `toString()` value not from its underlying binary value. If the latter is required, then pass the Number's `toString(2)` value and specify base 2.
+
+```javascript
+new BigNumber(Number.MAX_VALUE.toString(2), 2)
+```
+
+BigNumbers can be created from values in bases from 2 to 36. See [`ALPHABET`](http://mikemcl.github.io/bignumber.js/#alphabet) to extend this range.
+
+```javascript
+a = new BigNumber(1011, 2) // "11"
+b = new BigNumber('zz.9', 36) // "1295.25"
+c = a.plus(b) // "1306.25"
+```
+
+Performance is better if base 10 is NOT specified for decimal values. Only specify base 10 when it is desired that the number of decimal places of the input value be limited to the current [`DECIMAL_PLACES`](http://mikemcl.github.io/bignumber.js/#decimal-places) setting.
+
+A BigNumber is immutable in the sense that it is not changed by its methods.
+
+```javascript
+0.3 - 0.1 // 0.19999999999999998
+x = new BigNumber(0.3)
+x.minus(0.1) // "0.2"
+x // "0.3"
+```
+
+The methods that return a BigNumber can be chained.
+
+```javascript
+x.dividedBy(y).plus(z).times(9)
+x.times('1.23456780123456789e+9').plus(9876.5432321).dividedBy('4444562598.111772').integerValue()
+```
+
+Some of the longer method names have a shorter alias.
+
+```javascript
+x.squareRoot().dividedBy(y).exponentiatedBy(3).isEqualTo(x.sqrt().div(y).pow(3)) // true
+x.modulo(y).multipliedBy(z).eq(x.mod(y).times(z)) // true
+```
+
+As with JavaScript's Number type, there are [`toExponential`](http://mikemcl.github.io/bignumber.js/#toE), [`toFixed`](http://mikemcl.github.io/bignumber.js/#toFix) and [`toPrecision`](http://mikemcl.github.io/bignumber.js/#toP) methods.
+
+```javascript
+x = new BigNumber(255.5)
+x.toExponential(5) // "2.55500e+2"
+x.toFixed(5) // "255.50000"
+x.toPrecision(5) // "255.50"
+x.toNumber() // 255.5
+```
+
+ A base can be specified for [`toString`](http://mikemcl.github.io/bignumber.js/#toS). Performance is better if base 10 is NOT specified, i.e. use `toString()` not `toString(10)`. Only specify base 10 when it is desired that the number of decimal places be limited to the current [`DECIMAL_PLACES`](http://mikemcl.github.io/bignumber.js/#decimal-places) setting.
+
+ ```javascript
+ x.toString(16) // "ff.8"
+ ```
+
+There is a [`toFormat`](http://mikemcl.github.io/bignumber.js/#toFor) method which may be useful for internationalisation.
+
+```javascript
+y = new BigNumber('1234567.898765')
+y.toFormat(2) // "1,234,567.90"
+```
+
+The maximum number of decimal places of the result of an operation involving division (i.e. a division, square root, base conversion or negative power operation) is set using the `set` or `config` method of the `BigNumber` constructor.
+
+The other arithmetic operations always give the exact result.
+
+```javascript
+BigNumber.set({ DECIMAL_PLACES: 10, ROUNDING_MODE: 4 })
+
+x = new BigNumber(2)
+y = new BigNumber(3)
+z = x.dividedBy(y) // "0.6666666667"
+z.squareRoot() // "0.8164965809"
+z.exponentiatedBy(-3) // "3.3749999995"
+z.toString(2) // "0.1010101011"
+z.multipliedBy(z) // "0.44444444448888888889"
+z.multipliedBy(z).decimalPlaces(10) // "0.4444444445"
+```
+
+There is a [`toFraction`](http://mikemcl.github.io/bignumber.js/#toFr) method with an optional *maximum denominator* argument
+
+```javascript
+y = new BigNumber(355)
+pi = y.dividedBy(113) // "3.1415929204"
+pi.toFraction() // [ "7853982301", "2500000000" ]
+pi.toFraction(1000) // [ "355", "113" ]
+```
+
+and [`isNaN`](http://mikemcl.github.io/bignumber.js/#isNaN) and [`isFinite`](http://mikemcl.github.io/bignumber.js/#isF) methods, as `NaN` and `Infinity` are valid `BigNumber` values.
+
+```javascript
+x = new BigNumber(NaN) // "NaN"
+y = new BigNumber(Infinity) // "Infinity"
+x.isNaN() && !y.isNaN() && !x.isFinite() && !y.isFinite() // true
+```
+
+The value of a BigNumber is stored in a decimal floating point format in terms of a coefficient, exponent and sign.
+
+```javascript
+x = new BigNumber(-123.456);
+x.c // [ 123, 45600000000000 ] coefficient (i.e. significand)
+x.e // 2 exponent
+x.s // -1 sign
+```
+
+For advanced usage, multiple BigNumber constructors can be created, each with their own independent configuration.
+
+```javascript
+// Set DECIMAL_PLACES for the original BigNumber constructor
+BigNumber.set({ DECIMAL_PLACES: 10 })
+
+// Create another BigNumber constructor, optionally passing in a configuration object
+BN = BigNumber.clone({ DECIMAL_PLACES: 5 })
+
+x = new BigNumber(1)
+y = new BN(1)
+
+x.div(3) // '0.3333333333'
+y.div(3) // '0.33333'
+```
+
+For further information see the [API](http://mikemcl.github.io/bignumber.js/) reference in the *doc* directory.
+
+## Test
+
+The *test/modules* directory contains the test scripts for each method.
+
+The tests can be run with Node.js or a browser. For Node.js use
+
+ $ npm test
+
+or
+
+ $ node test/test
+
+To test a single method, use, for example
+
+ $ node test/methods/toFraction
+
+For the browser, open *test/test.html*.
+
+## Build
+
+For Node, if [uglify-js](https://github.com/mishoo/UglifyJS2) is installed
+
+ npm install uglify-js -g
+
+then
+
+ npm run build
+
+will create *bignumber.min.js*.
+
+A source map will also be created in the root directory.
+
+## Feedback
+
+Open an issue, or email
+
+Michael
+
+M8ch88l@gmail.com
+
+## Licence
+
+The MIT Licence.
+
+See [LICENCE](https://github.com/MikeMcl/bignumber.js/blob/master/LICENCE).
diff --git a/node_modules/bignumber.js/bignumber.d.ts b/node_modules/bignumber.js/bignumber.d.ts
new file mode 100644
index 0000000..dc9b0b1
--- /dev/null
+++ b/node_modules/bignumber.js/bignumber.d.ts
@@ -0,0 +1,1829 @@
+// Type definitions for bignumber.js >=8.1.0
+// Project: https://github.com/MikeMcl/bignumber.js
+// Definitions by: Michael Mclaughlin
+// Definitions: https://github.com/MikeMcl/bignumber.js
+
+// Documentation: http://mikemcl.github.io/bignumber.js/
+//
+// Exports:
+//
+// class BigNumber (default export)
+// type BigNumber.Constructor
+// type BigNumber.ModuloMode
+// type BigNumber.RoundingMOde
+// type BigNumber.Value
+// interface BigNumber.Config
+// interface BigNumber.Format
+// interface BigNumber.Instance
+//
+// Example:
+//
+// import {BigNumber} from "bignumber.js"
+// //import BigNumber from "bignumber.js"
+//
+// let rm: BigNumber.RoundingMode = BigNumber.ROUND_UP;
+// let f: BigNumber.Format = { decimalSeparator: ',' };
+// let c: BigNumber.Config = { DECIMAL_PLACES: 4, ROUNDING_MODE: rm, FORMAT: f };
+// BigNumber.config(c);
+//
+// let v: BigNumber.Value = '12345.6789';
+// let b: BigNumber = new BigNumber(v);
+//
+// The use of compiler option `--strictNullChecks` is recommended.
+
+export default BigNumber;
+
+export namespace BigNumber {
+
+ /** See `BigNumber.config` (alias `BigNumber.set`) and `BigNumber.clone`. */
+ interface Config {
+
+ /**
+ * An integer, 0 to 1e+9. Default value: 20.
+ *
+ * The maximum number of decimal places of the result of operations involving division, i.e.
+ * division, square root and base conversion operations, and exponentiation when the exponent is
+ * negative.
+ *
+ * ```ts
+ * BigNumber.config({ DECIMAL_PLACES: 5 })
+ * BigNumber.set({ DECIMAL_PLACES: 5 })
+ * ```
+ */
+ DECIMAL_PLACES?: number;
+
+ /**
+ * An integer, 0 to 8. Default value: `BigNumber.ROUND_HALF_UP` (4).
+ *
+ * The rounding mode used in operations that involve division (see `DECIMAL_PLACES`) and the
+ * default rounding mode of the `decimalPlaces`, `precision`, `toExponential`, `toFixed`,
+ * `toFormat` and `toPrecision` methods.
+ *
+ * The modes are available as enumerated properties of the BigNumber constructor.
+ *
+ * ```ts
+ * BigNumber.config({ ROUNDING_MODE: 0 })
+ * BigNumber.set({ ROUNDING_MODE: BigNumber.ROUND_UP })
+ * ```
+ */
+ ROUNDING_MODE?: BigNumber.RoundingMode;
+
+ /**
+ * An integer, 0 to 1e+9, or an array, [-1e+9 to 0, 0 to 1e+9].
+ * Default value: `[-7, 20]`.
+ *
+ * The exponent value(s) at which `toString` returns exponential notation.
+ *
+ * If a single number is assigned, the value is the exponent magnitude.
+ *
+ * If an array of two numbers is assigned then the first number is the negative exponent value at
+ * and beneath which exponential notation is used, and the second number is the positive exponent
+ * value at and above which exponential notation is used.
+ *
+ * For example, to emulate JavaScript numbers in terms of the exponent values at which they begin
+ * to use exponential notation, use `[-7, 20]`.
+ *
+ * ```ts
+ * BigNumber.config({ EXPONENTIAL_AT: 2 })
+ * new BigNumber(12.3) // '12.3' e is only 1
+ * new BigNumber(123) // '1.23e+2'
+ * new BigNumber(0.123) // '0.123' e is only -1
+ * new BigNumber(0.0123) // '1.23e-2'
+ *
+ * BigNumber.config({ EXPONENTIAL_AT: [-7, 20] })
+ * new BigNumber(123456789) // '123456789' e is only 8
+ * new BigNumber(0.000000123) // '1.23e-7'
+ *
+ * // Almost never return exponential notation:
+ * BigNumber.config({ EXPONENTIAL_AT: 1e+9 })
+ *
+ * // Always return exponential notation:
+ * BigNumber.config({ EXPONENTIAL_AT: 0 })
+ * ```
+ *
+ * Regardless of the value of `EXPONENTIAL_AT`, the `toFixed` method will always return a value in
+ * normal notation and the `toExponential` method will always return a value in exponential form.
+ * Calling `toString` with a base argument, e.g. `toString(10)`, will also always return normal
+ * notation.
+ */
+ EXPONENTIAL_AT?: number | [number, number];
+
+ /**
+ * An integer, magnitude 1 to 1e+9, or an array, [-1e+9 to -1, 1 to 1e+9].
+ * Default value: `[-1e+9, 1e+9]`.
+ *
+ * The exponent value(s) beyond which overflow to Infinity and underflow to zero occurs.
+ *
+ * If a single number is assigned, it is the maximum exponent magnitude: values wth a positive
+ * exponent of greater magnitude become Infinity and those with a negative exponent of greater
+ * magnitude become zero.
+ *
+ * If an array of two numbers is assigned then the first number is the negative exponent limit and
+ * the second number is the positive exponent limit.
+ *
+ * For example, to emulate JavaScript numbers in terms of the exponent values at which they
+ * become zero and Infinity, use [-324, 308].
+ *
+ * ```ts
+ * BigNumber.config({ RANGE: 500 })
+ * BigNumber.config().RANGE // [ -500, 500 ]
+ * new BigNumber('9.999e499') // '9.999e+499'
+ * new BigNumber('1e500') // 'Infinity'
+ * new BigNumber('1e-499') // '1e-499'
+ * new BigNumber('1e-500') // '0'
+ *
+ * BigNumber.config({ RANGE: [-3, 4] })
+ * new BigNumber(99999) // '99999' e is only 4
+ * new BigNumber(100000) // 'Infinity' e is 5
+ * new BigNumber(0.001) // '0.01' e is only -3
+ * new BigNumber(0.0001) // '0' e is -4
+ * ```
+ * The largest possible magnitude of a finite BigNumber is 9.999...e+1000000000.
+ * The smallest possible magnitude of a non-zero BigNumber is 1e-1000000000.
+ */
+ RANGE?: number | [number, number];
+
+ /**
+ * A boolean: `true` or `false`. Default value: `false`.
+ *
+ * The value that determines whether cryptographically-secure pseudo-random number generation is
+ * used. If `CRYPTO` is set to true then the random method will generate random digits using
+ * `crypto.getRandomValues` in browsers that support it, or `crypto.randomBytes` if using a
+ * version of Node.js that supports it.
+ *
+ * If neither function is supported by the host environment then attempting to set `CRYPTO` to
+ * `true` will fail and an exception will be thrown.
+ *
+ * If `CRYPTO` is `false` then the source of randomness used will be `Math.random` (which is
+ * assumed to generate at least 30 bits of randomness).
+ *
+ * See `BigNumber.random`.
+ *
+ * ```ts
+ * // Node.js
+ * global.crypto = require('crypto')
+ *
+ * BigNumber.config({ CRYPTO: true })
+ * BigNumber.config().CRYPTO // true
+ * BigNumber.random() // 0.54340758610486147524
+ * ```
+ */
+ CRYPTO?: boolean;
+
+ /**
+ * An integer, 0, 1, 3, 6 or 9. Default value: `BigNumber.ROUND_DOWN` (1).
+ *
+ * The modulo mode used when calculating the modulus: `a mod n`.
+ * The quotient, `q = a / n`, is calculated according to the `ROUNDING_MODE` that corresponds to
+ * the chosen `MODULO_MODE`.
+ * The remainder, `r`, is calculated as: `r = a - n * q`.
+ *
+ * The modes that are most commonly used for the modulus/remainder operation are shown in the
+ * following table. Although the other rounding modes can be used, they may not give useful
+ * results.
+ *
+ * Property | Value | Description
+ * :------------------|:------|:------------------------------------------------------------------
+ * `ROUND_UP` | 0 | The remainder is positive if the dividend is negative.
+ * `ROUND_DOWN` | 1 | The remainder has the same sign as the dividend.
+ * | | Uses 'truncating division' and matches JavaScript's `%` operator .
+ * `ROUND_FLOOR` | 3 | The remainder has the same sign as the divisor.
+ * | | This matches Python's `%` operator.
+ * `ROUND_HALF_EVEN` | 6 | The IEEE 754 remainder function.
+ * `EUCLID` | 9 | The remainder is always positive.
+ * | | Euclidian division: `q = sign(n) * floor(a / abs(n))`
+ *
+ * The rounding/modulo modes are available as enumerated properties of the BigNumber constructor.
+ *
+ * See `modulo`.
+ *
+ * ```ts
+ * BigNumber.config({ MODULO_MODE: BigNumber.EUCLID })
+ * BigNumber.set({ MODULO_MODE: 9 }) // equivalent
+ * ```
+ */
+ MODULO_MODE?: BigNumber.ModuloMode;
+
+ /**
+ * An integer, 0 to 1e+9. Default value: 0.
+ *
+ * The maximum precision, i.e. number of significant digits, of the result of the power operation
+ * - unless a modulus is specified.
+ *
+ * If set to 0, the number of significant digits will not be limited.
+ *
+ * See `exponentiatedBy`.
+ *
+ * ```ts
+ * BigNumber.config({ POW_PRECISION: 100 })
+ * ```
+ */
+ POW_PRECISION?: number;
+
+ /**
+ * An object including any number of the properties shown below.
+ *
+ * The object configures the format of the string returned by the `toFormat` method.
+ * The example below shows the properties of the object that are recognised, and
+ * their default values.
+ *
+ * Unlike the other configuration properties, the values of the properties of the `FORMAT` object
+ * will not be checked for validity - the existing object will simply be replaced by the object
+ * that is passed in.
+ *
+ * See `toFormat`.
+ *
+ * ```ts
+ * BigNumber.config({
+ * FORMAT: {
+ * // string to prepend
+ * prefix: '',
+ * // the decimal separator
+ * decimalSeparator: '.',
+ * // the grouping separator of the integer part
+ * groupSeparator: ',',
+ * // the primary grouping size of the integer part
+ * groupSize: 3,
+ * // the secondary grouping size of the integer part
+ * secondaryGroupSize: 0,
+ * // the grouping separator of the fraction part
+ * fractionGroupSeparator: ' ',
+ * // the grouping size of the fraction part
+ * fractionGroupSize: 0,
+ * // string to append
+ * suffix: ''
+ * }
+ * })
+ * ```
+ */
+ FORMAT?: BigNumber.Format;
+
+ /**
+ * The alphabet used for base conversion. The length of the alphabet corresponds to the maximum
+ * value of the base argument that can be passed to the BigNumber constructor or `toString`.
+ *
+ * Default value: `'0123456789abcdefghijklmnopqrstuvwxyz'`.
+ *
+ * There is no maximum length for the alphabet, but it must be at least 2 characters long,
+ * and it must not contain whitespace or a repeated character, or the sign indicators '+' and
+ * '-', or the decimal separator '.'.
+ *
+ * ```ts
+ * // duodecimal (base 12)
+ * BigNumber.config({ ALPHABET: '0123456789TE' })
+ * x = new BigNumber('T', 12)
+ * x.toString() // '10'
+ * x.toString(12) // 'T'
+ * ```
+ */
+ ALPHABET?: string;
+ }
+
+ /** See `FORMAT` and `toFormat`. */
+ interface Format {
+
+ /** The string to prepend. */
+ prefix?: string;
+
+ /** The decimal separator. */
+ decimalSeparator?: string;
+
+ /** The grouping separator of the integer part. */
+ groupSeparator?: string;
+
+ /** The primary grouping size of the integer part. */
+ groupSize?: number;
+
+ /** The secondary grouping size of the integer part. */
+ secondaryGroupSize?: number;
+
+ /** The grouping separator of the fraction part. */
+ fractionGroupSeparator?: string;
+
+ /** The grouping size of the fraction part. */
+ fractionGroupSize?: number;
+
+ /** The string to append. */
+ suffix?: string;
+ }
+
+ interface Instance {
+
+ /** The coefficient of the value of this BigNumber, an array of base 1e14 integer numbers, or null. */
+ readonly c: number[] | null;
+
+ /** The exponent of the value of this BigNumber, an integer number, -1000000000 to 1000000000, or null. */
+ readonly e: number | null;
+
+ /** The sign of the value of this BigNumber, -1, 1, or null. */
+ readonly s: number | null;
+
+ [key: string]: any;
+ }
+
+ type Constructor = typeof BigNumber;
+ type ModuloMode = 0 | 1 | 3 | 6 | 9;
+ type RoundingMode = 0 | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8;
+ type Value = string | number | Instance;
+}
+
+export declare class BigNumber implements BigNumber.Instance {
+
+ /** Used internally to identify a BigNumber instance. */
+ private readonly _isBigNumber: true;
+
+ /** The coefficient of the value of this BigNumber, an array of base 1e14 integer numbers, or null. */
+ readonly c: number[] | null;
+
+ /** The exponent of the value of this BigNumber, an integer number, -1000000000 to 1000000000, or null. */
+ readonly e: number | null;
+
+ /** The sign of the value of this BigNumber, -1, 1, or null. */
+ readonly s: number | null;
+
+ /**
+ * Returns a new instance of a BigNumber object with value `n`, where `n` is a numeric value in
+ * the specified `base`, or base 10 if `base` is omitted or is `null` or `undefined`.
+ *
+ * ```ts
+ * x = new BigNumber(123.4567) // '123.4567'
+ * // 'new' is optional
+ * y = BigNumber(x) // '123.4567'
+ * ```
+ *
+ * If `n` is a base 10 value it can be in normal (fixed-point) or exponential notation.
+ * Values in other bases must be in normal notation. Values in any base can have fraction digits,
+ * i.e. digits after the decimal point.
+ *
+ * ```ts
+ * new BigNumber(43210) // '43210'
+ * new BigNumber('4.321e+4') // '43210'
+ * new BigNumber('-735.0918e-430') // '-7.350918e-428'
+ * new BigNumber('123412421.234324', 5) // '607236.557696'
+ * ```
+ *
+ * Signed `0`, signed `Infinity` and `NaN` are supported.
+ *
+ * ```ts
+ * new BigNumber('-Infinity') // '-Infinity'
+ * new BigNumber(NaN) // 'NaN'
+ * new BigNumber(-0) // '0'
+ * new BigNumber('.5') // '0.5'
+ * new BigNumber('+2') // '2'
+ * ```
+ *
+ * String values in hexadecimal literal form, e.g. `'0xff'`, are valid, as are string values with
+ * the octal and binary prefixs `'0o'` and `'0b'`. String values in octal literal form without the
+ * prefix will be interpreted as decimals, e.g. `'011'` is interpreted as 11, not 9.
+ *
+ * ```ts
+ * new BigNumber(-10110100.1, 2) // '-180.5'
+ * new BigNumber('-0b10110100.1') // '-180.5'
+ * new BigNumber('ff.8', 16) // '255.5'
+ * new BigNumber('0xff.8') // '255.5'
+ * ```
+ *
+ * If a base is specified, `n` is rounded according to the current `DECIMAL_PLACES` and
+ * `ROUNDING_MODE` settings. This includes base 10, so don't include a `base` parameter for decimal
+ * values unless this behaviour is desired.
+ *
+ * ```ts
+ * BigNumber.config({ DECIMAL_PLACES: 5 })
+ * new BigNumber(1.23456789) // '1.23456789'
+ * new BigNumber(1.23456789, 10) // '1.23457'
+ * ```
+ *
+ * An error is thrown if `base` is invalid.
+ *
+ * There is no limit to the number of digits of a value of type string (other than that of
+ * JavaScript's maximum array size). See `RANGE` to set the maximum and minimum possible exponent
+ * value of a BigNumber.
+ *
+ * ```ts
+ * new BigNumber('5032485723458348569331745.33434346346912144534543')
+ * new BigNumber('4.321e10000000')
+ * ```
+ *
+ * BigNumber `NaN` is returned if `n` is invalid (unless `BigNumber.DEBUG` is `true`, see below).
+ *
+ * ```ts
+ * new BigNumber('.1*') // 'NaN'
+ * new BigNumber('blurgh') // 'NaN'
+ * new BigNumber(9, 2) // 'NaN'
+ * ```
+ *
+ * To aid in debugging, if `BigNumber.DEBUG` is `true` then an error will be thrown on an
+ * invalid `n`. An error will also be thrown if `n` is of type number with more than 15
+ * significant digits, as calling `toString` or `valueOf` on these numbers may not result in the
+ * intended value.
+ *
+ * ```ts
+ * console.log(823456789123456.3) // 823456789123456.2
+ * new BigNumber(823456789123456.3) // '823456789123456.2'
+ * BigNumber.DEBUG = true
+ * // 'Error: Number has more than 15 significant digits'
+ * new BigNumber(823456789123456.3)
+ * // 'Error: Not a base 2 number'
+ * new BigNumber(9, 2)
+ * ```
+ *
+ * A BigNumber can also be created from an object literal.
+ * Use `isBigNumber` to check that it is well-formed.
+ *
+ * ```ts
+ * new BigNumber({ s: 1, e: 2, c: [ 777, 12300000000000 ], _isBigNumber: true }) // '777.123'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param base The base of `n`, integer, 2 to 36 (or `ALPHABET.length`, see `ALPHABET`).
+ */
+ constructor(n: BigNumber.Value, base?: number);
+
+ /**
+ * Returns a BigNumber whose value is the absolute value, i.e. the magnitude, of the value of this
+ * BigNumber.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber(-0.8)
+ * x.absoluteValue() // '0.8'
+ * ```
+ */
+ absoluteValue(): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the absolute value, i.e. the magnitude, of the value of this
+ * BigNumber.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber(-0.8)
+ * x.abs() // '0.8'
+ * ```
+ */
+ abs(): BigNumber;
+
+ /**
+ * Returns | |
+ * :-------:|:--------------------------------------------------------------|
+ * 1 | If the value of this BigNumber is greater than the value of `n`
+ * -1 | If the value of this BigNumber is less than the value of `n`
+ * 0 | If this BigNumber and `n` have the same value
+ * `null` | If the value of either this BigNumber or `n` is `NaN`
+ *
+ * ```ts
+ *
+ * x = new BigNumber(Infinity)
+ * y = new BigNumber(5)
+ * x.comparedTo(y) // 1
+ * x.comparedTo(x.minus(1)) // 0
+ * y.comparedTo(NaN) // null
+ * y.comparedTo('110', 2) // -1
+ * ```
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ comparedTo(n: BigNumber.Value, base?: number): number;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber rounded by rounding mode
+ * `roundingMode` to a maximum of `decimalPlaces` decimal places.
+ *
+ * If `decimalPlaces` is omitted, or is `null` or `undefined`, the return value is the number of
+ * decimal places of the value of this BigNumber, or `null` if the value of this BigNumber is
+ * ±`Infinity` or `NaN`.
+ *
+ * If `roundingMode` is omitted, or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * Throws if `decimalPlaces` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(1234.56)
+ * x.decimalPlaces() // 2
+ * x.decimalPlaces(1) // '1234.6'
+ * x.decimalPlaces(2) // '1234.56'
+ * x.decimalPlaces(10) // '1234.56'
+ * x.decimalPlaces(0, 1) // '1234'
+ * x.decimalPlaces(0, 6) // '1235'
+ * x.decimalPlaces(1, 1) // '1234.5'
+ * x.decimalPlaces(1, BigNumber.ROUND_HALF_EVEN) // '1234.6'
+ * x // '1234.56'
+ * y = new BigNumber('9.9e-101')
+ * y.decimalPlaces() // 102
+ * ```
+ *
+ * @param [decimalPlaces] Decimal places, integer, 0 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ */
+ decimalPlaces(): number;
+ decimalPlaces(decimalPlaces: number, roundingMode?: BigNumber.RoundingMode): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber rounded by rounding mode
+ * `roundingMode` to a maximum of `decimalPlaces` decimal places.
+ *
+ * If `decimalPlaces` is omitted, or is `null` or `undefined`, the return value is the number of
+ * decimal places of the value of this BigNumber, or `null` if the value of this BigNumber is
+ * ±`Infinity` or `NaN`.
+ *
+ * If `roundingMode` is omitted, or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * Throws if `decimalPlaces` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(1234.56)
+ * x.dp() // 2
+ * x.dp(1) // '1234.6'
+ * x.dp(2) // '1234.56'
+ * x.dp(10) // '1234.56'
+ * x.dp(0, 1) // '1234'
+ * x.dp(0, 6) // '1235'
+ * x.dp(1, 1) // '1234.5'
+ * x.dp(1, BigNumber.ROUND_HALF_EVEN) // '1234.6'
+ * x // '1234.56'
+ * y = new BigNumber('9.9e-101')
+ * y.dp() // 102
+ * ```
+ *
+ * @param [decimalPlaces] Decimal places, integer, 0 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ */
+ dp(): number;
+ dp(decimalPlaces: number, roundingMode?: BigNumber.RoundingMode): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber divided by `n`, rounded
+ * according to the current `DECIMAL_PLACES` and `ROUNDING_MODE` settings.
+ *
+ * ```ts
+ * x = new BigNumber(355)
+ * y = new BigNumber(113)
+ * x.dividedBy(y) // '3.14159292035398230088'
+ * x.dividedBy(5) // '71'
+ * x.dividedBy(47, 16) // '5'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ dividedBy(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber divided by `n`, rounded
+ * according to the current `DECIMAL_PLACES` and `ROUNDING_MODE` settings.
+ *
+ * ```ts
+ * x = new BigNumber(355)
+ * y = new BigNumber(113)
+ * x.div(y) // '3.14159292035398230088'
+ * x.div(5) // '71'
+ * x.div(47, 16) // '5'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ div(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the integer part of dividing the value of this BigNumber by
+ * `n`.
+ *
+ * ```ts
+ * x = new BigNumber(5)
+ * y = new BigNumber(3)
+ * x.dividedToIntegerBy(y) // '1'
+ * x.dividedToIntegerBy(0.7) // '7'
+ * x.dividedToIntegerBy('0.f', 16) // '5'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ dividedToIntegerBy(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the integer part of dividing the value of this BigNumber by
+ * `n`.
+ *
+ * ```ts
+ * x = new BigNumber(5)
+ * y = new BigNumber(3)
+ * x.idiv(y) // '1'
+ * x.idiv(0.7) // '7'
+ * x.idiv('0.f', 16) // '5'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ idiv(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber exponentiated by `n`, i.e.
+ * raised to the power `n`, and optionally modulo a modulus `m`.
+ *
+ * If `n` is negative the result is rounded according to the current `DECIMAL_PLACES` and
+ * `ROUNDING_MODE` settings.
+ *
+ * As the number of digits of the result of the power operation can grow so large so quickly,
+ * e.g. 123.456**10000 has over 50000 digits, the number of significant digits calculated is
+ * limited to the value of the `POW_PRECISION` setting (unless a modulus `m` is specified).
+ *
+ * By default `POW_PRECISION` is set to 0. This means that an unlimited number of significant
+ * digits will be calculated, and that the method's performance will decrease dramatically for
+ * larger exponents.
+ *
+ * If `m` is specified and the value of `m`, `n` and this BigNumber are integers and `n` is
+ * positive, then a fast modular exponentiation algorithm is used, otherwise the operation will
+ * be performed as `x.exponentiatedBy(n).modulo(m)` with a `POW_PRECISION` of 0.
+ *
+ * Throws if `n` is not an integer.
+ *
+ * ```ts
+ * Math.pow(0.7, 2) // 0.48999999999999994
+ * x = new BigNumber(0.7)
+ * x.exponentiatedBy(2) // '0.49'
+ * BigNumber(3).exponentiatedBy(-2) // '0.11111111111111111111'
+ * ```
+ *
+ * @param n The exponent, an integer.
+ * @param [m] The modulus.
+ */
+ exponentiatedBy(n: BigNumber.Value, m?: BigNumber.Value): BigNumber;
+ exponentiatedBy(n: number, m?: BigNumber.Value): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber exponentiated by `n`, i.e.
+ * raised to the power `n`, and optionally modulo a modulus `m`.
+ *
+ * If `n` is negative the result is rounded according to the current `DECIMAL_PLACES` and
+ * `ROUNDING_MODE` settings.
+ *
+ * As the number of digits of the result of the power operation can grow so large so quickly,
+ * e.g. 123.456**10000 has over 50000 digits, the number of significant digits calculated is
+ * limited to the value of the `POW_PRECISION` setting (unless a modulus `m` is specified).
+ *
+ * By default `POW_PRECISION` is set to 0. This means that an unlimited number of significant
+ * digits will be calculated, and that the method's performance will decrease dramatically for
+ * larger exponents.
+ *
+ * If `m` is specified and the value of `m`, `n` and this BigNumber are integers and `n` is
+ * positive, then a fast modular exponentiation algorithm is used, otherwise the operation will
+ * be performed as `x.pow(n).modulo(m)` with a `POW_PRECISION` of 0.
+ *
+ * Throws if `n` is not an integer.
+ *
+ * ```ts
+ * Math.pow(0.7, 2) // 0.48999999999999994
+ * x = new BigNumber(0.7)
+ * x.pow(2) // '0.49'
+ * BigNumber(3).pow(-2) // '0.11111111111111111111'
+ * ```
+ *
+ * @param n The exponent, an integer.
+ * @param [m] The modulus.
+ */
+ pow(n: BigNumber.Value, m?: BigNumber.Value): BigNumber;
+ pow(n: number, m?: BigNumber.Value): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber rounded to an integer using
+ * rounding mode `rm`.
+ *
+ * If `rm` is omitted, or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * Throws if `rm` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(123.456)
+ * x.integerValue() // '123'
+ * x.integerValue(BigNumber.ROUND_CEIL) // '124'
+ * y = new BigNumber(-12.7)
+ * y.integerValue() // '-13'
+ * x.integerValue(BigNumber.ROUND_DOWN) // '-12'
+ * ```
+ *
+ * @param {BigNumber.RoundingMode} [rm] The roundng mode, an integer, 0 to 8.
+ */
+ integerValue(rm?: BigNumber.RoundingMode): BigNumber;
+
+ /**
+ * Returns `true` if the value of this BigNumber is equal to the value of `n`, otherwise returns
+ * `false`.
+ *
+ * As with JavaScript, `NaN` does not equal `NaN`.
+ *
+ * ```ts
+ * 0 === 1e-324 // true
+ * x = new BigNumber(0)
+ * x.isEqualTo('1e-324') // false
+ * BigNumber(-0).isEqualTo(x) // true ( -0 === 0 )
+ * BigNumber(255).isEqualTo('ff', 16) // true
+ *
+ * y = new BigNumber(NaN)
+ * y.isEqualTo(NaN) // false
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ isEqualTo(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is equal to the value of `n`, otherwise returns
+ * `false`.
+ *
+ * As with JavaScript, `NaN` does not equal `NaN`.
+ *
+ * ```ts
+ * 0 === 1e-324 // true
+ * x = new BigNumber(0)
+ * x.eq('1e-324') // false
+ * BigNumber(-0).eq(x) // true ( -0 === 0 )
+ * BigNumber(255).eq('ff', 16) // true
+ *
+ * y = new BigNumber(NaN)
+ * y.eq(NaN) // false
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ eq(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is a finite number, otherwise returns `false`.
+ *
+ * The only possible non-finite values of a BigNumber are `NaN`, `Infinity` and `-Infinity`.
+ *
+ * ```ts
+ * x = new BigNumber(1)
+ * x.isFinite() // true
+ * y = new BigNumber(Infinity)
+ * y.isFinite() // false
+ * ```
+ */
+ isFinite(): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is greater than the value of `n`, otherwise
+ * returns `false`.
+ *
+ * ```ts
+ * 0.1 > (0.3 - 0.2) // true
+ * x = new BigNumber(0.1)
+ * x.isGreaterThan(BigNumber(0.3).minus(0.2)) // false
+ * BigNumber(0).isGreaterThan(x) // false
+ * BigNumber(11, 3).isGreaterThan(11.1, 2) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ isGreaterThan(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is greater than the value of `n`, otherwise
+ * returns `false`.
+ *
+ * ```ts
+ * 0.1 > (0.3 - 0 // true
+ * x = new BigNumber(0.1)
+ * x.gt(BigNumber(0.3).minus(0.2)) // false
+ * BigNumber(0).gt(x) // false
+ * BigNumber(11, 3).gt(11.1, 2) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ gt(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is greater than or equal to the value of `n`,
+ * otherwise returns `false`.
+ *
+ * ```ts
+ * (0.3 - 0.2) >= 0.1 // false
+ * x = new BigNumber(0.3).minus(0.2)
+ * x.isGreaterThanOrEqualTo(0.1) // true
+ * BigNumber(1).isGreaterThanOrEqualTo(x) // true
+ * BigNumber(10, 18).isGreaterThanOrEqualTo('i', 36) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ isGreaterThanOrEqualTo(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is greater than or equal to the value of `n`,
+ * otherwise returns `false`.
+ *
+ * ```ts
+ * (0.3 - 0.2) >= 0.1 // false
+ * x = new BigNumber(0.3).minus(0.2)
+ * x.gte(0.1) // true
+ * BigNumber(1).gte(x) // true
+ * BigNumber(10, 18).gte('i', 36) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ gte(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is an integer, otherwise returns `false`.
+ *
+ * ```ts
+ * x = new BigNumber(1)
+ * x.isInteger() // true
+ * y = new BigNumber(123.456)
+ * y.isInteger() // false
+ * ```
+ */
+ isInteger(): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is less than the value of `n`, otherwise returns
+ * `false`.
+ *
+ * ```ts
+ * (0.3 - 0.2) < 0.1 // true
+ * x = new BigNumber(0.3).minus(0.2)
+ * x.isLessThan(0.1) // false
+ * BigNumber(0).isLessThan(x) // true
+ * BigNumber(11.1, 2).isLessThan(11, 3) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ isLessThan(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is less than the value of `n`, otherwise returns
+ * `false`.
+ *
+ * ```ts
+ * (0.3 - 0.2) < 0.1 // true
+ * x = new BigNumber(0.3).minus(0.2)
+ * x.lt(0.1) // false
+ * BigNumber(0).lt(x) // true
+ * BigNumber(11.1, 2).lt(11, 3) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ lt(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is less than or equal to the value of `n`,
+ * otherwise returns `false`.
+ *
+ * ```ts
+ * 0.1 <= (0.3 - 0.2) // false
+ * x = new BigNumber(0.1)
+ * x.isLessThanOrEqualTo(BigNumber(0.3).minus(0.2)) // true
+ * BigNumber(-1).isLessThanOrEqualTo(x) // true
+ * BigNumber(10, 18).isLessThanOrEqualTo('i', 36) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ isLessThanOrEqualTo(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is less than or equal to the value of `n`,
+ * otherwise returns `false`.
+ *
+ * ```ts
+ * 0.1 <= (0.3 - 0.2) // false
+ * x = new BigNumber(0.1)
+ * x.lte(BigNumber(0.3).minus(0.2)) // true
+ * BigNumber(-1).lte(x) // true
+ * BigNumber(10, 18).lte('i', 36) // true
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ lte(n: BigNumber.Value, base?: number): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is `NaN`, otherwise returns `false`.
+ *
+ * ```ts
+ * x = new BigNumber(NaN)
+ * x.isNaN() // true
+ * y = new BigNumber('Infinity')
+ * y.isNaN() // false
+ * ```
+ */
+ isNaN(): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is negative, otherwise returns `false`.
+ *
+ * ```ts
+ * x = new BigNumber(-0)
+ * x.isNegative() // true
+ * y = new BigNumber(2)
+ * y.isNegative() // false
+ * ```
+ */
+ isNegative(): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is positive, otherwise returns `false`.
+ *
+ * ```ts
+ * x = new BigNumber(-0)
+ * x.isPositive() // false
+ * y = new BigNumber(2)
+ * y.isPositive() // true
+ * ```
+ */
+ isPositive(): boolean;
+
+ /**
+ * Returns `true` if the value of this BigNumber is zero or minus zero, otherwise returns `false`.
+ *
+ * ```ts
+ * x = new BigNumber(-0)
+ * x.isZero() // true
+ * ```
+ */
+ isZero(): boolean;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber minus `n`.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * 0.3 - 0.1 // 0.19999999999999998
+ * x = new BigNumber(0.3)
+ * x.minus(0.1) // '0.2'
+ * x.minus(0.6, 20) // '0'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ minus(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber modulo `n`, i.e. the integer
+ * remainder of dividing this BigNumber by `n`.
+ *
+ * The value returned, and in particular its sign, is dependent on the value of the `MODULO_MODE`
+ * setting of this BigNumber constructor. If it is 1 (default value), the result will have the
+ * same sign as this BigNumber, and it will match that of Javascript's `%` operator (within the
+ * limits of double precision) and BigDecimal's `remainder` method.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * See `MODULO_MODE` for a description of the other modulo modes.
+ *
+ * ```ts
+ * 1 % 0.9 // 0.09999999999999998
+ * x = new BigNumber(1)
+ * x.modulo(0.9) // '0.1'
+ * y = new BigNumber(33)
+ * y.modulo('a', 33) // '3'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ modulo(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber modulo `n`, i.e. the integer
+ * remainder of dividing this BigNumber by `n`.
+ *
+ * The value returned, and in particular its sign, is dependent on the value of the `MODULO_MODE`
+ * setting of this BigNumber constructor. If it is 1 (default value), the result will have the
+ * same sign as this BigNumber, and it will match that of Javascript's `%` operator (within the
+ * limits of double precision) and BigDecimal's `remainder` method.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * See `MODULO_MODE` for a description of the other modulo modes.
+ *
+ * ```ts
+ * 1 % 0.9 // 0.09999999999999998
+ * x = new BigNumber(1)
+ * x.mod(0.9) // '0.1'
+ * y = new BigNumber(33)
+ * y.mod('a', 33) // '3'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ mod(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber multiplied by `n`.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * 0.6 * 3 // 1.7999999999999998
+ * x = new BigNumber(0.6)
+ * y = x.multipliedBy(3) // '1.8'
+ * BigNumber('7e+500').multipliedBy(y) // '1.26e+501'
+ * x.multipliedBy('-a', 16) // '-6'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ multipliedBy(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber multiplied by `n`.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * 0.6 * 3 // 1.7999999999999998
+ * x = new BigNumber(0.6)
+ * y = x.times(3) // '1.8'
+ * BigNumber('7e+500').times(y) // '1.26e+501'
+ * x.times('-a', 16) // '-6'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ times(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber negated, i.e. multiplied by -1.
+ *
+ * ```ts
+ * x = new BigNumber(1.8)
+ * x.negated() // '-1.8'
+ * y = new BigNumber(-1.3)
+ * y.negated() // '1.3'
+ * ```
+ */
+ negated(): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber plus `n`.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * 0.1 + 0.2 // 0.30000000000000004
+ * x = new BigNumber(0.1)
+ * y = x.plus(0.2) // '0.3'
+ * BigNumber(0.7).plus(x).plus(y) // '1'
+ * x.plus('0.1', 8) // '0.225'
+ * ```
+ *
+ * @param n A numeric value.
+ * @param [base] The base of n.
+ */
+ plus(n: BigNumber.Value, base?: number): BigNumber;
+
+ /**
+ * Returns the number of significant digits of the value of this BigNumber, or `null` if the value
+ * of this BigNumber is ±`Infinity` or `NaN`.
+ *
+ * If `includeZeros` is true then any trailing zeros of the integer part of the value of this
+ * BigNumber are counted as significant digits, otherwise they are not.
+ *
+ * Throws if `includeZeros` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(9876.54321)
+ * x.precision() // 9
+ * y = new BigNumber(987000)
+ * y.precision(false) // 3
+ * y.precision(true) // 6
+ * ```
+ *
+ * @param [includeZeros] Whether to include integer trailing zeros in the significant digit count.
+ */
+ precision(includeZeros?: boolean): number;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber rounded to a precision of
+ * `significantDigits` significant digits using rounding mode `roundingMode`.
+ *
+ * If `roundingMode` is omitted or is `null` or `undefined`, `ROUNDING_MODE` will be used.
+ *
+ * Throws if `significantDigits` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(9876.54321)
+ * x.precision(6) // '9876.54'
+ * x.precision(6, BigNumber.ROUND_UP) // '9876.55'
+ * x.precision(2) // '9900'
+ * x.precision(2, 1) // '9800'
+ * x // '9876.54321'
+ * ```
+ *
+ * @param significantDigits Significant digits, integer, 1 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ */
+ precision(significantDigits: number, roundingMode?: BigNumber.RoundingMode): BigNumber;
+
+ /**
+ * Returns the number of significant digits of the value of this BigNumber,
+ * or `null` if the value of this BigNumber is ±`Infinity` or `NaN`.
+ *
+ * If `includeZeros` is true then any trailing zeros of the integer part of
+ * the value of this BigNumber are counted as significant digits, otherwise
+ * they are not.
+ *
+ * Throws if `includeZeros` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(9876.54321)
+ * x.sd() // 9
+ * y = new BigNumber(987000)
+ * y.sd(false) // 3
+ * y.sd(true) // 6
+ * ```
+ *
+ * @param [includeZeros] Whether to include integer trailing zeros in the significant digit count.
+ */
+ sd(includeZeros?: boolean): number;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber rounded to a precision of
+ * `significantDigits` significant digits using rounding mode `roundingMode`.
+ *
+ * If `roundingMode` is omitted or is `null` or `undefined`, `ROUNDING_MODE` will be used.
+ *
+ * Throws if `significantDigits` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(9876.54321)
+ * x.sd(6) // '9876.54'
+ * x.sd(6, BigNumber.ROUND_UP) // '9876.55'
+ * x.sd(2) // '9900'
+ * x.sd(2, 1) // '9800'
+ * x // '9876.54321'
+ * ```
+ *
+ * @param significantDigits Significant digits, integer, 1 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ */
+ sd(significantDigits: number, roundingMode?: BigNumber.RoundingMode): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the value of this BigNumber shifted by `n` places.
+ *
+ * The shift is of the decimal point, i.e. of powers of ten, and is to the left if `n` is negative
+ * or to the right if `n` is positive.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * Throws if `n` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(1.23)
+ * x.shiftedBy(3) // '1230'
+ * x.shiftedBy(-3) // '0.00123'
+ * ```
+ *
+ * @param n The shift value, integer, -9007199254740991 to 9007199254740991.
+ */
+ shiftedBy(n: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the square root of the value of this BigNumber, rounded
+ * according to the current `DECIMAL_PLACES` and `ROUNDING_MODE` settings.
+ *
+ * The return value will be correctly rounded, i.e. rounded as if the result was first calculated
+ * to an infinite number of correct digits before rounding.
+ *
+ * ```ts
+ * x = new BigNumber(16)
+ * x.squareRoot() // '4'
+ * y = new BigNumber(3)
+ * y.squareRoot() // '1.73205080756887729353'
+ * ```
+ */
+ squareRoot(): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the square root of the value of this BigNumber, rounded
+ * according to the current `DECIMAL_PLACES` and `ROUNDING_MODE` settings.
+ *
+ * The return value will be correctly rounded, i.e. rounded as if the result was first calculated
+ * to an infinite number of correct digits before rounding.
+ *
+ * ```ts
+ * x = new BigNumber(16)
+ * x.sqrt() // '4'
+ * y = new BigNumber(3)
+ * y.sqrt() // '1.73205080756887729353'
+ * ```
+ */
+ sqrt(): BigNumber;
+
+ /**
+ * Returns a string representing the value of this BigNumber in exponential notation rounded using
+ * rounding mode `roundingMode` to `decimalPlaces` decimal places, i.e with one digit before the
+ * decimal point and `decimalPlaces` digits after it.
+ *
+ * If the value of this BigNumber in exponential notation has fewer than `decimalPlaces` fraction
+ * digits, the return value will be appended with zeros accordingly.
+ *
+ * If `decimalPlaces` is omitted, or is `null` or `undefined`, the number of digits after the
+ * decimal point defaults to the minimum number of digits necessary to represent the value
+ * exactly.
+ *
+ * If `roundingMode` is omitted or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * Throws if `decimalPlaces` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = 45.6
+ * y = new BigNumber(x)
+ * x.toExponential() // '4.56e+1'
+ * y.toExponential() // '4.56e+1'
+ * x.toExponential(0) // '5e+1'
+ * y.toExponential(0) // '5e+1'
+ * x.toExponential(1) // '4.6e+1'
+ * y.toExponential(1) // '4.6e+1'
+ * y.toExponential(1, 1) // '4.5e+1' (ROUND_DOWN)
+ * x.toExponential(3) // '4.560e+1'
+ * y.toExponential(3) // '4.560e+1'
+ * ```
+ *
+ * @param [decimalPlaces] Decimal places, integer, 0 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ */
+ toExponential(decimalPlaces: number, roundingMode?: BigNumber.RoundingMode): string;
+ toExponential(): string;
+
+ /**
+ * Returns a string representing the value of this BigNumber in normal (fixed-point) notation
+ * rounded to `decimalPlaces` decimal places using rounding mode `roundingMode`.
+ *
+ * If the value of this BigNumber in normal notation has fewer than `decimalPlaces` fraction
+ * digits, the return value will be appended with zeros accordingly.
+ *
+ * Unlike `Number.prototype.toFixed`, which returns exponential notation if a number is greater or
+ * equal to 10**21, this method will always return normal notation.
+ *
+ * If `decimalPlaces` is omitted or is `null` or `undefined`, the return value will be unrounded
+ * and in normal notation. This is also unlike `Number.prototype.toFixed`, which returns the value
+ * to zero decimal places. It is useful when normal notation is required and the current
+ * `EXPONENTIAL_AT` setting causes `toString` to return exponential notation.
+ *
+ * If `roundingMode` is omitted or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * Throws if `decimalPlaces` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = 3.456
+ * y = new BigNumber(x)
+ * x.toFixed() // '3'
+ * y.toFixed() // '3.456'
+ * y.toFixed(0) // '3'
+ * x.toFixed(2) // '3.46'
+ * y.toFixed(2) // '3.46'
+ * y.toFixed(2, 1) // '3.45' (ROUND_DOWN)
+ * x.toFixed(5) // '3.45600'
+ * y.toFixed(5) // '3.45600'
+ * ```
+ *
+ * @param [decimalPlaces] Decimal places, integer, 0 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ */
+ toFixed(decimalPlaces: number, roundingMode?: BigNumber.RoundingMode): string;
+ toFixed(): string;
+
+ /**
+ * Returns a string representing the value of this BigNumber in normal (fixed-point) notation
+ * rounded to `decimalPlaces` decimal places using rounding mode `roundingMode`, and formatted
+ * according to the properties of the `format` or `FORMAT` object.
+ *
+ * The formatting object may contain some or all of the properties shown in the examples below.
+ *
+ * If `decimalPlaces` is omitted or is `null` or `undefined`, then the return value is not
+ * rounded to a fixed number of decimal places.
+ *
+ * If `roundingMode` is omitted or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * If `format` is omitted or is `null` or `undefined`, `FORMAT` is used.
+ *
+ * Throws if `decimalPlaces`, `roundingMode`, or `format` is invalid.
+ *
+ * ```ts
+ * fmt = {
+ * decimalSeparator: '.',
+ * groupSeparator: ',',
+ * groupSize: 3,
+ * secondaryGroupSize: 0,
+ * fractionGroupSeparator: ' ',
+ * fractionGroupSize: 0
+ * }
+ *
+ * x = new BigNumber('123456789.123456789')
+ *
+ * // Set the global formatting options
+ * BigNumber.config({ FORMAT: fmt })
+ *
+ * x.toFormat() // '123,456,789.123456789'
+ * x.toFormat(3) // '123,456,789.123'
+ *
+ * // If a reference to the object assigned to FORMAT has been retained,
+ * // the format properties can be changed directly
+ * fmt.groupSeparator = ' '
+ * fmt.fractionGroupSize = 5
+ * x.toFormat() // '123 456 789.12345 6789'
+ *
+ * // Alternatively, pass the formatting options as an argument
+ * fmt = {
+ * decimalSeparator: ',',
+ * groupSeparator: '.',
+ * groupSize: 3,
+ * secondaryGroupSize: 2
+ * }
+ *
+ * x.toFormat() // '123 456 789.12345 6789'
+ * x.toFormat(fmt) // '12.34.56.789,123456789'
+ * x.toFormat(2, fmt) // '12.34.56.789,12'
+ * x.toFormat(3, BigNumber.ROUND_UP, fmt) // '12.34.56.789,124'
+ * ```
+ *
+ * @param [decimalPlaces] Decimal places, integer, 0 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer, 0 to 8.
+ * @param [format] Formatting options object. See `BigNumber.Format`.
+ */
+ toFormat(decimalPlaces: number, roundingMode: BigNumber.RoundingMode, format?: BigNumber.Format): string;
+ toFormat(decimalPlaces: number, roundingMode?: BigNumber.RoundingMode): string;
+ toFormat(decimalPlaces?: number): string;
+ toFormat(decimalPlaces: number, format: BigNumber.Format): string;
+ toFormat(format: BigNumber.Format): string;
+
+ /**
+ * Returns an array of two BigNumbers representing the value of this BigNumber as a simple
+ * fraction with an integer numerator and an integer denominator.
+ * The denominator will be a positive non-zero value less than or equal to `max_denominator`.
+ * If a maximum denominator, `max_denominator`, is not specified, or is `null` or `undefined`, the
+ * denominator will be the lowest value necessary to represent the number exactly.
+ *
+ * Throws if `max_denominator` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(1.75)
+ * x.toFraction() // '7, 4'
+ *
+ * pi = new BigNumber('3.14159265358')
+ * pi.toFraction() // '157079632679,50000000000'
+ * pi.toFraction(100000) // '312689, 99532'
+ * pi.toFraction(10000) // '355, 113'
+ * pi.toFraction(100) // '311, 99'
+ * pi.toFraction(10) // '22, 7'
+ * pi.toFraction(1) // '3, 1'
+ * ```
+ *
+ * @param [max_denominator] The maximum denominator, integer > 0, or Infinity.
+ */
+ toFraction(max_denominator?: BigNumber.Value): [BigNumber, BigNumber];
+
+ /** As `valueOf`. */
+ toJSON(): string;
+
+ /**
+ * Returns the value of this BigNumber as a JavaScript primitive number.
+ *
+ * Using the unary plus operator gives the same result.
+ *
+ * ```ts
+ * x = new BigNumber(456.789)
+ * x.toNumber() // 456.789
+ * +x // 456.789
+ *
+ * y = new BigNumber('45987349857634085409857349856430985')
+ * y.toNumber() // 4.598734985763409e+34
+ *
+ * z = new BigNumber(-0)
+ * 1 / z.toNumber() // -Infinity
+ * 1 / +z // -Infinity
+ * ```
+ */
+ toNumber(): number;
+
+ /**
+ * Returns a string representing the value of this BigNumber rounded to `significantDigits`
+ * significant digits using rounding mode `roundingMode`.
+ *
+ * If `significantDigits` is less than the number of digits necessary to represent the integer
+ * part of the value in normal (fixed-point) notation, then exponential notation is used.
+ *
+ * If `significantDigits` is omitted, or is `null` or `undefined`, then the return value is the
+ * same as `n.toString()`.
+ *
+ * If `roundingMode` is omitted or is `null` or `undefined`, `ROUNDING_MODE` is used.
+ *
+ * Throws if `significantDigits` or `roundingMode` is invalid.
+ *
+ * ```ts
+ * x = 45.6
+ * y = new BigNumber(x)
+ * x.toPrecision() // '45.6'
+ * y.toPrecision() // '45.6'
+ * x.toPrecision(1) // '5e+1'
+ * y.toPrecision(1) // '5e+1'
+ * y.toPrecision(2, 0) // '4.6e+1' (ROUND_UP)
+ * y.toPrecision(2, 1) // '4.5e+1' (ROUND_DOWN)
+ * x.toPrecision(5) // '45.600'
+ * y.toPrecision(5) // '45.600'
+ * ```
+ *
+ * @param [significantDigits] Significant digits, integer, 1 to 1e+9.
+ * @param [roundingMode] Rounding mode, integer 0 to 8.
+ */
+ toPrecision(significantDigits: number, roundingMode?: BigNumber.RoundingMode): string;
+ toPrecision(): string;
+
+ /**
+ * Returns a string representing the value of this BigNumber in base `base`, or base 10 if `base`
+ * is omitted or is `null` or `undefined`.
+ *
+ * For bases above 10, and using the default base conversion alphabet (see `ALPHABET`), values
+ * from 10 to 35 are represented by a-z (the same as `Number.prototype.toString`).
+ *
+ * If a base is specified the value is rounded according to the current `DECIMAL_PLACES` and
+ * `ROUNDING_MODE` settings, otherwise it is not.
+ *
+ * If a base is not specified, and this BigNumber has a positive exponent that is equal to or
+ * greater than the positive component of the current `EXPONENTIAL_AT` setting, or a negative
+ * exponent equal to or less than the negative component of the setting, then exponential notation
+ * is returned.
+ *
+ * If `base` is `null` or `undefined` it is ignored.
+ *
+ * Throws if `base` is invalid.
+ *
+ * ```ts
+ * x = new BigNumber(750000)
+ * x.toString() // '750000'
+ * BigNumber.config({ EXPONENTIAL_AT: 5 })
+ * x.toString() // '7.5e+5'
+ *
+ * y = new BigNumber(362.875)
+ * y.toString(2) // '101101010.111'
+ * y.toString(9) // '442.77777777777777777778'
+ * y.toString(32) // 'ba.s'
+ *
+ * BigNumber.config({ DECIMAL_PLACES: 4 });
+ * z = new BigNumber('1.23456789')
+ * z.toString() // '1.23456789'
+ * z.toString(10) // '1.2346'
+ * ```
+ *
+ * @param [base] The base, integer, 2 to 36 (or `ALPHABET.length`, see `ALPHABET`).
+ */
+ toString(base?: number): string;
+
+ /**
+ * As `toString`, but does not accept a base argument and includes the minus sign for negative
+ * zero.
+ *
+ * ``ts
+ * x = new BigNumber('-0')
+ * x.toString() // '0'
+ * x.valueOf() // '-0'
+ * y = new BigNumber('1.777e+457')
+ * y.valueOf() // '1.777e+457'
+ * ```
+ */
+ valueOf(): string;
+
+ /** Helps ES6 import. */
+ private static readonly default?: BigNumber.Constructor;
+
+ /** Helps ES6 import. */
+ private static readonly BigNumber?: BigNumber.Constructor;
+
+ /** Rounds away from zero. */
+ static readonly ROUND_UP: 0;
+
+ /** Rounds towards zero. */
+ static readonly ROUND_DOWN: 1;
+
+ /** Rounds towards Infinity. */
+ static readonly ROUND_CEIL: 2;
+
+ /** Rounds towards -Infinity. */
+ static readonly ROUND_FLOOR: 3;
+
+ /** Rounds towards nearest neighbour. If equidistant, rounds away from zero . */
+ static readonly ROUND_HALF_UP: 4;
+
+ /** Rounds towards nearest neighbour. If equidistant, rounds towards zero. */
+ static readonly ROUND_HALF_DOWN: 5;
+
+ /** Rounds towards nearest neighbour. If equidistant, rounds towards even neighbour. */
+ static readonly ROUND_HALF_EVEN: 6;
+
+ /** Rounds towards nearest neighbour. If equidistant, rounds towards Infinity. */
+ static readonly ROUND_HALF_CEIL: 7;
+
+ /** Rounds towards nearest neighbour. If equidistant, rounds towards -Infinity. */
+ static readonly ROUND_HALF_FLOOR: 8;
+
+ /** See `MODULO_MODE`. */
+ static readonly EUCLID: 9;
+
+ /**
+ * To aid in debugging, if a `BigNumber.DEBUG` property is `true` then an error will be thrown
+ * if the BigNumber constructor receives an invalid `BigNumber.Value`, or if `BigNumber.isBigNumber`
+ * receives a BigNumber instance that is malformed.
+ *
+ * ```ts
+ * // No error, and BigNumber NaN is returned.
+ * new BigNumber('blurgh') // 'NaN'
+ * new BigNumber(9, 2) // 'NaN'
+ * BigNumber.DEBUG = true
+ * new BigNumber('blurgh') // '[BigNumber Error] Not a number'
+ * new BigNumber(9, 2) // '[BigNumber Error] Not a base 2 number'
+ * ```
+ *
+ * An error will also be thrown if a `BigNumber.Value` is of type number with more than 15
+ * significant digits, as calling `toString` or `valueOf` on such numbers may not result
+ * in the intended value.
+ *
+ * ```ts
+ * console.log(823456789123456.3) // 823456789123456.2
+ * // No error, and the returned BigNumber does not have the same value as the number literal.
+ * new BigNumber(823456789123456.3) // '823456789123456.2'
+ * BigNumber.DEBUG = true
+ * new BigNumber(823456789123456.3)
+ * // '[BigNumber Error] Number primitive has more than 15 significant digits'
+ * ```
+ *
+ * Check that a BigNumber instance is well-formed:
+ *
+ * ```ts
+ * x = new BigNumber(10)
+ *
+ * BigNumber.DEBUG = false
+ * // Change x.c to an illegitimate value.
+ * x.c = NaN
+ * // No error, as BigNumber.DEBUG is false.
+ * BigNumber.isBigNumber(x) // true
+ *
+ * BigNumber.DEBUG = true
+ * BigNumber.isBigNumber(x) // '[BigNumber Error] Invalid BigNumber'
+ * ```
+ */
+ static DEBUG?: boolean;
+
+ /**
+ * Returns a new independent BigNumber constructor with configuration as described by `object`, or
+ * with the default configuration if object is `null` or `undefined`.
+ *
+ * Throws if `object` is not an object.
+ *
+ * ```ts
+ * BigNumber.config({ DECIMAL_PLACES: 5 })
+ * BN = BigNumber.clone({ DECIMAL_PLACES: 9 })
+ *
+ * x = new BigNumber(1)
+ * y = new BN(1)
+ *
+ * x.div(3) // 0.33333
+ * y.div(3) // 0.333333333
+ *
+ * // BN = BigNumber.clone({ DECIMAL_PLACES: 9 }) is equivalent to:
+ * BN = BigNumber.clone()
+ * BN.config({ DECIMAL_PLACES: 9 })
+ * ```
+ *
+ * @param [object] The configuration object.
+ */
+ static clone(object?: BigNumber.Config): BigNumber.Constructor;
+
+ /**
+ * Configures the settings that apply to this BigNumber constructor.
+ *
+ * The configuration object, `object`, contains any number of the properties shown in the example
+ * below.
+ *
+ * Returns an object with the above properties and their current values.
+ *
+ * Throws if `object` is not an object, or if an invalid value is assigned to one or more of the
+ * properties.
+ *
+ * ```ts
+ * BigNumber.config({
+ * DECIMAL_PLACES: 40,
+ * ROUNDING_MODE: BigNumber.ROUND_HALF_CEIL,
+ * EXPONENTIAL_AT: [-10, 20],
+ * RANGE: [-500, 500],
+ * CRYPTO: true,
+ * MODULO_MODE: BigNumber.ROUND_FLOOR,
+ * POW_PRECISION: 80,
+ * FORMAT: {
+ * groupSize: 3,
+ * groupSeparator: ' ',
+ * decimalSeparator: ','
+ * },
+ * ALPHABET: '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_'
+ * });
+ *
+ * BigNumber.config().DECIMAL_PLACES // 40
+ * ```
+ *
+ * @param object The configuration object.
+ */
+ static config(object: BigNumber.Config): BigNumber.Config;
+
+ /**
+ * Returns `true` if `value` is a BigNumber instance, otherwise returns `false`.
+ *
+ * If `BigNumber.DEBUG` is `true`, throws if a BigNumber instance is not well-formed.
+ *
+ * ```ts
+ * x = 42
+ * y = new BigNumber(x)
+ *
+ * BigNumber.isBigNumber(x) // false
+ * y instanceof BigNumber // true
+ * BigNumber.isBigNumber(y) // true
+ *
+ * BN = BigNumber.clone();
+ * z = new BN(x)
+ * z instanceof BigNumber // false
+ * BigNumber.isBigNumber(z) // true
+ * ```
+ *
+ * @param value The value to test.
+ */
+ static isBigNumber(value: any): value is BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the maximum of the arguments.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber('3257869345.0378653')
+ * BigNumber.maximum(4e9, x, '123456789.9') // '4000000000'
+ *
+ * arr = [12, '13', new BigNumber(14)]
+ * BigNumber.maximum.apply(null, arr) // '14'
+ * ```
+ *
+ * @param n A numeric value.
+ */
+ static maximum(...n: BigNumber.Value[]): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the maximum of the arguments.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber('3257869345.0378653')
+ * BigNumber.max(4e9, x, '123456789.9') // '4000000000'
+ *
+ * arr = [12, '13', new BigNumber(14)]
+ * BigNumber.max.apply(null, arr) // '14'
+ * ```
+ *
+ * @param n A numeric value.
+ */
+ static max(...n: BigNumber.Value[]): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the minimum of the arguments.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber('3257869345.0378653')
+ * BigNumber.minimum(4e9, x, '123456789.9') // '123456789.9'
+ *
+ * arr = [2, new BigNumber(-14), '-15.9999', -12]
+ * BigNumber.minimum.apply(null, arr) // '-15.9999'
+ * ```
+ *
+ * @param n A numeric value.
+ */
+ static minimum(...n: BigNumber.Value[]): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the minimum of the arguments.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber('3257869345.0378653')
+ * BigNumber.min(4e9, x, '123456789.9') // '123456789.9'
+ *
+ * arr = [2, new BigNumber(-14), '-15.9999', -12]
+ * BigNumber.min.apply(null, arr) // '-15.9999'
+ * ```
+ *
+ * @param n A numeric value.
+ */
+ static min(...n: BigNumber.Value[]): BigNumber;
+
+ /**
+ * Returns a new BigNumber with a pseudo-random value equal to or greater than 0 and less than 1.
+ *
+ * The return value will have `decimalPlaces` decimal places, or less if trailing zeros are
+ * produced. If `decimalPlaces` is omitted, the current `DECIMAL_PLACES` setting will be used.
+ *
+ * Depending on the value of this BigNumber constructor's `CRYPTO` setting and the support for the
+ * `crypto` object in the host environment, the random digits of the return value are generated by
+ * either `Math.random` (fastest), `crypto.getRandomValues` (Web Cryptography API in recent
+ * browsers) or `crypto.randomBytes` (Node.js).
+ *
+ * To be able to set `CRYPTO` to true when using Node.js, the `crypto` object must be available
+ * globally:
+ *
+ * ```ts
+ * global.crypto = require('crypto')
+ * ```
+ *
+ * If `CRYPTO` is true, i.e. one of the `crypto` methods is to be used, the value of a returned
+ * BigNumber should be cryptographically secure and statistically indistinguishable from a random
+ * value.
+ *
+ * Throws if `decimalPlaces` is invalid.
+ *
+ * ```ts
+ * BigNumber.config({ DECIMAL_PLACES: 10 })
+ * BigNumber.random() // '0.4117936847'
+ * BigNumber.random(20) // '0.78193327636914089009'
+ * ```
+ *
+ * @param [decimalPlaces] Decimal places, integer, 0 to 1e+9.
+ */
+ static random(decimalPlaces?: number): BigNumber;
+
+ /**
+ * Returns a BigNumber whose value is the sum of the arguments.
+ *
+ * The return value is always exact and unrounded.
+ *
+ * ```ts
+ * x = new BigNumber('3257869345.0378653')
+ * BigNumber.sum(4e9, x, '123456789.9') // '7381326134.9378653'
+ *
+ * arr = [2, new BigNumber(14), '15.9999', 12]
+ * BigNumber.sum.apply(null, arr) // '43.9999'
+ * ```
+ *
+ * @param n A numeric value.
+ */
+ static sum(...n: BigNumber.Value[]): BigNumber;
+
+ /**
+ * Configures the settings that apply to this BigNumber constructor.
+ *
+ * The configuration object, `object`, contains any number of the properties shown in the example
+ * below.
+ *
+ * Returns an object with the above properties and their current values.
+ *
+ * Throws if `object` is not an object, or if an invalid value is assigned to one or more of the
+ * properties.
+ *
+ * ```ts
+ * BigNumber.set({
+ * DECIMAL_PLACES: 40,
+ * ROUNDING_MODE: BigNumber.ROUND_HALF_CEIL,
+ * EXPONENTIAL_AT: [-10, 20],
+ * RANGE: [-500, 500],
+ * CRYPTO: true,
+ * MODULO_MODE: BigNumber.ROUND_FLOOR,
+ * POW_PRECISION: 80,
+ * FORMAT: {
+ * groupSize: 3,
+ * groupSeparator: ' ',
+ * decimalSeparator: ','
+ * },
+ * ALPHABET: '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_'
+ * });
+ *
+ * BigNumber.set().DECIMAL_PLACES // 40
+ * ```
+ *
+ * @param object The configuration object.
+ */
+ static set(object: BigNumber.Config): BigNumber.Config;
+}
diff --git a/node_modules/bignumber.js/bignumber.js b/node_modules/bignumber.js/bignumber.js
new file mode 100644
index 0000000..1ffc9f9
--- /dev/null
+++ b/node_modules/bignumber.js/bignumber.js
@@ -0,0 +1,2902 @@
+;(function (globalObject) {
+ 'use strict';
+
+/*
+ * bignumber.js v9.0.0
+ * A JavaScript library for arbitrary-precision arithmetic.
+ * https://github.com/MikeMcl/bignumber.js
+ * Copyright (c) 2019 Michael Mclaughlin
+ * MIT Licensed.
+ *
+ * BigNumber.prototype methods | BigNumber methods
+ * |
+ * absoluteValue abs | clone
+ * comparedTo | config set
+ * decimalPlaces dp | DECIMAL_PLACES
+ * dividedBy div | ROUNDING_MODE
+ * dividedToIntegerBy idiv | EXPONENTIAL_AT
+ * exponentiatedBy pow | RANGE
+ * integerValue | CRYPTO
+ * isEqualTo eq | MODULO_MODE
+ * isFinite | POW_PRECISION
+ * isGreaterThan gt | FORMAT
+ * isGreaterThanOrEqualTo gte | ALPHABET
+ * isInteger | isBigNumber
+ * isLessThan lt | maximum max
+ * isLessThanOrEqualTo lte | minimum min
+ * isNaN | random
+ * isNegative | sum
+ * isPositive |
+ * isZero |
+ * minus |
+ * modulo mod |
+ * multipliedBy times |
+ * negated |
+ * plus |
+ * precision sd |
+ * shiftedBy |
+ * squareRoot sqrt |
+ * toExponential |
+ * toFixed |
+ * toFormat |
+ * toFraction |
+ * toJSON |
+ * toNumber |
+ * toPrecision |
+ * toString |
+ * valueOf |
+ *
+ */
+
+
+ var BigNumber,
+ isNumeric = /^-?(?:\d+(?:\.\d*)?|\.\d+)(?:e[+-]?\d+)?$/i,
+ mathceil = Math.ceil,
+ mathfloor = Math.floor,
+
+ bignumberError = '[BigNumber Error] ',
+ tooManyDigits = bignumberError + 'Number primitive has more than 15 significant digits: ',
+
+ BASE = 1e14,
+ LOG_BASE = 14,
+ MAX_SAFE_INTEGER = 0x1fffffffffffff, // 2^53 - 1
+ // MAX_INT32 = 0x7fffffff, // 2^31 - 1
+ POWS_TEN = [1, 10, 100, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, 1e10, 1e11, 1e12, 1e13],
+ SQRT_BASE = 1e7,
+
+ // EDITABLE
+ // The limit on the value of DECIMAL_PLACES, TO_EXP_NEG, TO_EXP_POS, MIN_EXP, MAX_EXP, and
+ // the arguments to toExponential, toFixed, toFormat, and toPrecision.
+ MAX = 1E9; // 0 to MAX_INT32
+
+
+ /*
+ * Create and return a BigNumber constructor.
+ */
+ function clone(configObject) {
+ var div, convertBase, parseNumeric,
+ P = BigNumber.prototype = { constructor: BigNumber, toString: null, valueOf: null },
+ ONE = new BigNumber(1),
+
+
+ //----------------------------- EDITABLE CONFIG DEFAULTS -------------------------------
+
+
+ // The default values below must be integers within the inclusive ranges stated.
+ // The values can also be changed at run-time using BigNumber.set.
+
+ // The maximum number of decimal places for operations involving division.
+ DECIMAL_PLACES = 20, // 0 to MAX
+
+ // The rounding mode used when rounding to the above decimal places, and when using
+ // toExponential, toFixed, toFormat and toPrecision, and round (default value).
+ // UP 0 Away from zero.
+ // DOWN 1 Towards zero.
+ // CEIL 2 Towards +Infinity.
+ // FLOOR 3 Towards -Infinity.
+ // HALF_UP 4 Towards nearest neighbour. If equidistant, up.
+ // HALF_DOWN 5 Towards nearest neighbour. If equidistant, down.
+ // HALF_EVEN 6 Towards nearest neighbour. If equidistant, towards even neighbour.
+ // HALF_CEIL 7 Towards nearest neighbour. If equidistant, towards +Infinity.
+ // HALF_FLOOR 8 Towards nearest neighbour. If equidistant, towards -Infinity.
+ ROUNDING_MODE = 4, // 0 to 8
+
+ // EXPONENTIAL_AT : [TO_EXP_NEG , TO_EXP_POS]
+
+ // The exponent value at and beneath which toString returns exponential notation.
+ // Number type: -7
+ TO_EXP_NEG = -7, // 0 to -MAX
+
+ // The exponent value at and above which toString returns exponential notation.
+ // Number type: 21
+ TO_EXP_POS = 21, // 0 to MAX
+
+ // RANGE : [MIN_EXP, MAX_EXP]
+
+ // The minimum exponent value, beneath which underflow to zero occurs.
+ // Number type: -324 (5e-324)
+ MIN_EXP = -1e7, // -1 to -MAX
+
+ // The maximum exponent value, above which overflow to Infinity occurs.
+ // Number type: 308 (1.7976931348623157e+308)
+ // For MAX_EXP > 1e7, e.g. new BigNumber('1e100000000').plus(1) may be slow.
+ MAX_EXP = 1e7, // 1 to MAX
+
+ // Whether to use cryptographically-secure random number generation, if available.
+ CRYPTO = false, // true or false
+
+ // The modulo mode used when calculating the modulus: a mod n.
+ // The quotient (q = a / n) is calculated according to the corresponding rounding mode.
+ // The remainder (r) is calculated as: r = a - n * q.
+ //
+ // UP 0 The remainder is positive if the dividend is negative, else is negative.
+ // DOWN 1 The remainder has the same sign as the dividend.
+ // This modulo mode is commonly known as 'truncated division' and is
+ // equivalent to (a % n) in JavaScript.
+ // FLOOR 3 The remainder has the same sign as the divisor (Python %).
+ // HALF_EVEN 6 This modulo mode implements the IEEE 754 remainder function.
+ // EUCLID 9 Euclidian division. q = sign(n) * floor(a / abs(n)).
+ // The remainder is always positive.
+ //
+ // The truncated division, floored division, Euclidian division and IEEE 754 remainder
+ // modes are commonly used for the modulus operation.
+ // Although the other rounding modes can also be used, they may not give useful results.
+ MODULO_MODE = 1, // 0 to 9
+
+ // The maximum number of significant digits of the result of the exponentiatedBy operation.
+ // If POW_PRECISION is 0, there will be unlimited significant digits.
+ POW_PRECISION = 0, // 0 to MAX
+
+ // The format specification used by the BigNumber.prototype.toFormat method.
+ FORMAT = {
+ prefix: '',
+ groupSize: 3,
+ secondaryGroupSize: 0,
+ groupSeparator: ',',
+ decimalSeparator: '.',
+ fractionGroupSize: 0,
+ fractionGroupSeparator: '\xA0', // non-breaking space
+ suffix: ''
+ },
+
+ // The alphabet used for base conversion. It must be at least 2 characters long, with no '+',
+ // '-', '.', whitespace, or repeated character.
+ // '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_'
+ ALPHABET = '0123456789abcdefghijklmnopqrstuvwxyz';
+
+
+ //------------------------------------------------------------------------------------------
+
+
+ // CONSTRUCTOR
+
+
+ /*
+ * The BigNumber constructor and exported function.
+ * Create and return a new instance of a BigNumber object.
+ *
+ * v {number|string|BigNumber} A numeric value.
+ * [b] {number} The base of v. Integer, 2 to ALPHABET.length inclusive.
+ */
+ function BigNumber(v, b) {
+ var alphabet, c, caseChanged, e, i, isNum, len, str,
+ x = this;
+
+ // Enable constructor call without `new`.
+ if (!(x instanceof BigNumber)) return new BigNumber(v, b);
+
+ if (b == null) {
+
+ if (v && v._isBigNumber === true) {
+ x.s = v.s;
+
+ if (!v.c || v.e > MAX_EXP) {
+ x.c = x.e = null;
+ } else if (v.e < MIN_EXP) {
+ x.c = [x.e = 0];
+ } else {
+ x.e = v.e;
+ x.c = v.c.slice();
+ }
+
+ return;
+ }
+
+ if ((isNum = typeof v == 'number') && v * 0 == 0) {
+
+ // Use `1 / n` to handle minus zero also.
+ x.s = 1 / v < 0 ? (v = -v, -1) : 1;
+
+ // Fast path for integers, where n < 2147483648 (2**31).
+ if (v === ~~v) {
+ for (e = 0, i = v; i >= 10; i /= 10, e++);
+
+ if (e > MAX_EXP) {
+ x.c = x.e = null;
+ } else {
+ x.e = e;
+ x.c = [v];
+ }
+
+ return;
+ }
+
+ str = String(v);
+ } else {
+
+ if (!isNumeric.test(str = String(v))) return parseNumeric(x, str, isNum);
+
+ x.s = str.charCodeAt(0) == 45 ? (str = str.slice(1), -1) : 1;
+ }
+
+ // Decimal point?
+ if ((e = str.indexOf('.')) > -1) str = str.replace('.', '');
+
+ // Exponential form?
+ if ((i = str.search(/e/i)) > 0) {
+
+ // Determine exponent.
+ if (e < 0) e = i;
+ e += +str.slice(i + 1);
+ str = str.substring(0, i);
+ } else if (e < 0) {
+
+ // Integer.
+ e = str.length;
+ }
+
+ } else {
+
+ // '[BigNumber Error] Base {not a primitive number|not an integer|out of range}: {b}'
+ intCheck(b, 2, ALPHABET.length, 'Base');
+
+ // Allow exponential notation to be used with base 10 argument, while
+ // also rounding to DECIMAL_PLACES as with other bases.
+ if (b == 10) {
+ x = new BigNumber(v);
+ return round(x, DECIMAL_PLACES + x.e + 1, ROUNDING_MODE);
+ }
+
+ str = String(v);
+
+ if (isNum = typeof v == 'number') {
+
+ // Avoid potential interpretation of Infinity and NaN as base 44+ values.
+ if (v * 0 != 0) return parseNumeric(x, str, isNum, b);
+
+ x.s = 1 / v < 0 ? (str = str.slice(1), -1) : 1;
+
+ // '[BigNumber Error] Number primitive has more than 15 significant digits: {n}'
+ if (BigNumber.DEBUG && str.replace(/^0\.0*|\./, '').length > 15) {
+ throw Error
+ (tooManyDigits + v);
+ }
+ } else {
+ x.s = str.charCodeAt(0) === 45 ? (str = str.slice(1), -1) : 1;
+ }
+
+ alphabet = ALPHABET.slice(0, b);
+ e = i = 0;
+
+ // Check that str is a valid base b number.
+ // Don't use RegExp, so alphabet can contain special characters.
+ for (len = str.length; i < len; i++) {
+ if (alphabet.indexOf(c = str.charAt(i)) < 0) {
+ if (c == '.') {
+
+ // If '.' is not the first character and it has not be found before.
+ if (i > e) {
+ e = len;
+ continue;
+ }
+ } else if (!caseChanged) {
+
+ // Allow e.g. hexadecimal 'FF' as well as 'ff'.
+ if (str == str.toUpperCase() && (str = str.toLowerCase()) ||
+ str == str.toLowerCase() && (str = str.toUpperCase())) {
+ caseChanged = true;
+ i = -1;
+ e = 0;
+ continue;
+ }
+ }
+
+ return parseNumeric(x, String(v), isNum, b);
+ }
+ }
+
+ // Prevent later check for length on converted number.
+ isNum = false;
+ str = convertBase(str, b, 10, x.s);
+
+ // Decimal point?
+ if ((e = str.indexOf('.')) > -1) str = str.replace('.', '');
+ else e = str.length;
+ }
+
+ // Determine leading zeros.
+ for (i = 0; str.charCodeAt(i) === 48; i++);
+
+ // Determine trailing zeros.
+ for (len = str.length; str.charCodeAt(--len) === 48;);
+
+ if (str = str.slice(i, ++len)) {
+ len -= i;
+
+ // '[BigNumber Error] Number primitive has more than 15 significant digits: {n}'
+ if (isNum && BigNumber.DEBUG &&
+ len > 15 && (v > MAX_SAFE_INTEGER || v !== mathfloor(v))) {
+ throw Error
+ (tooManyDigits + (x.s * v));
+ }
+
+ // Overflow?
+ if ((e = e - i - 1) > MAX_EXP) {
+
+ // Infinity.
+ x.c = x.e = null;
+
+ // Underflow?
+ } else if (e < MIN_EXP) {
+
+ // Zero.
+ x.c = [x.e = 0];
+ } else {
+ x.e = e;
+ x.c = [];
+
+ // Transform base
+
+ // e is the base 10 exponent.
+ // i is where to slice str to get the first element of the coefficient array.
+ i = (e + 1) % LOG_BASE;
+ if (e < 0) i += LOG_BASE; // i < 1
+
+ if (i < len) {
+ if (i) x.c.push(+str.slice(0, i));
+
+ for (len -= LOG_BASE; i < len;) {
+ x.c.push(+str.slice(i, i += LOG_BASE));
+ }
+
+ i = LOG_BASE - (str = str.slice(i)).length;
+ } else {
+ i -= len;
+ }
+
+ for (; i--; str += '0');
+ x.c.push(+str);
+ }
+ } else {
+
+ // Zero.
+ x.c = [x.e = 0];
+ }
+ }
+
+
+ // CONSTRUCTOR PROPERTIES
+
+
+ BigNumber.clone = clone;
+
+ BigNumber.ROUND_UP = 0;
+ BigNumber.ROUND_DOWN = 1;
+ BigNumber.ROUND_CEIL = 2;
+ BigNumber.ROUND_FLOOR = 3;
+ BigNumber.ROUND_HALF_UP = 4;
+ BigNumber.ROUND_HALF_DOWN = 5;
+ BigNumber.ROUND_HALF_EVEN = 6;
+ BigNumber.ROUND_HALF_CEIL = 7;
+ BigNumber.ROUND_HALF_FLOOR = 8;
+ BigNumber.EUCLID = 9;
+
+
+ /*
+ * Configure infrequently-changing library-wide settings.
+ *
+ * Accept an object with the following optional properties (if the value of a property is
+ * a number, it must be an integer within the inclusive range stated):
+ *
+ * DECIMAL_PLACES {number} 0 to MAX
+ * ROUNDING_MODE {number} 0 to 8
+ * EXPONENTIAL_AT {number|number[]} -MAX to MAX or [-MAX to 0, 0 to MAX]
+ * RANGE {number|number[]} -MAX to MAX (not zero) or [-MAX to -1, 1 to MAX]
+ * CRYPTO {boolean} true or false
+ * MODULO_MODE {number} 0 to 9
+ * POW_PRECISION {number} 0 to MAX
+ * ALPHABET {string} A string of two or more unique characters which does
+ * not contain '.'.
+ * FORMAT {object} An object with some of the following properties:
+ * prefix {string}
+ * groupSize {number}
+ * secondaryGroupSize {number}
+ * groupSeparator {string}
+ * decimalSeparator {string}
+ * fractionGroupSize {number}
+ * fractionGroupSeparator {string}
+ * suffix {string}
+ *
+ * (The values assigned to the above FORMAT object properties are not checked for validity.)
+ *
+ * E.g.
+ * BigNumber.config({ DECIMAL_PLACES : 20, ROUNDING_MODE : 4 })
+ *
+ * Ignore properties/parameters set to null or undefined, except for ALPHABET.
+ *
+ * Return an object with the properties current values.
+ */
+ BigNumber.config = BigNumber.set = function (obj) {
+ var p, v;
+
+ if (obj != null) {
+
+ if (typeof obj == 'object') {
+
+ // DECIMAL_PLACES {number} Integer, 0 to MAX inclusive.
+ // '[BigNumber Error] DECIMAL_PLACES {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'DECIMAL_PLACES')) {
+ v = obj[p];
+ intCheck(v, 0, MAX, p);
+ DECIMAL_PLACES = v;
+ }
+
+ // ROUNDING_MODE {number} Integer, 0 to 8 inclusive.
+ // '[BigNumber Error] ROUNDING_MODE {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'ROUNDING_MODE')) {
+ v = obj[p];
+ intCheck(v, 0, 8, p);
+ ROUNDING_MODE = v;
+ }
+
+ // EXPONENTIAL_AT {number|number[]}
+ // Integer, -MAX to MAX inclusive or
+ // [integer -MAX to 0 inclusive, 0 to MAX inclusive].
+ // '[BigNumber Error] EXPONENTIAL_AT {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'EXPONENTIAL_AT')) {
+ v = obj[p];
+ if (v && v.pop) {
+ intCheck(v[0], -MAX, 0, p);
+ intCheck(v[1], 0, MAX, p);
+ TO_EXP_NEG = v[0];
+ TO_EXP_POS = v[1];
+ } else {
+ intCheck(v, -MAX, MAX, p);
+ TO_EXP_NEG = -(TO_EXP_POS = v < 0 ? -v : v);
+ }
+ }
+
+ // RANGE {number|number[]} Non-zero integer, -MAX to MAX inclusive or
+ // [integer -MAX to -1 inclusive, integer 1 to MAX inclusive].
+ // '[BigNumber Error] RANGE {not a primitive number|not an integer|out of range|cannot be zero}: {v}'
+ if (obj.hasOwnProperty(p = 'RANGE')) {
+ v = obj[p];
+ if (v && v.pop) {
+ intCheck(v[0], -MAX, -1, p);
+ intCheck(v[1], 1, MAX, p);
+ MIN_EXP = v[0];
+ MAX_EXP = v[1];
+ } else {
+ intCheck(v, -MAX, MAX, p);
+ if (v) {
+ MIN_EXP = -(MAX_EXP = v < 0 ? -v : v);
+ } else {
+ throw Error
+ (bignumberError + p + ' cannot be zero: ' + v);
+ }
+ }
+ }
+
+ // CRYPTO {boolean} true or false.
+ // '[BigNumber Error] CRYPTO not true or false: {v}'
+ // '[BigNumber Error] crypto unavailable'
+ if (obj.hasOwnProperty(p = 'CRYPTO')) {
+ v = obj[p];
+ if (v === !!v) {
+ if (v) {
+ if (typeof crypto != 'undefined' && crypto &&
+ (crypto.getRandomValues || crypto.randomBytes)) {
+ CRYPTO = v;
+ } else {
+ CRYPTO = !v;
+ throw Error
+ (bignumberError + 'crypto unavailable');
+ }
+ } else {
+ CRYPTO = v;
+ }
+ } else {
+ throw Error
+ (bignumberError + p + ' not true or false: ' + v);
+ }
+ }
+
+ // MODULO_MODE {number} Integer, 0 to 9 inclusive.
+ // '[BigNumber Error] MODULO_MODE {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'MODULO_MODE')) {
+ v = obj[p];
+ intCheck(v, 0, 9, p);
+ MODULO_MODE = v;
+ }
+
+ // POW_PRECISION {number} Integer, 0 to MAX inclusive.
+ // '[BigNumber Error] POW_PRECISION {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'POW_PRECISION')) {
+ v = obj[p];
+ intCheck(v, 0, MAX, p);
+ POW_PRECISION = v;
+ }
+
+ // FORMAT {object}
+ // '[BigNumber Error] FORMAT not an object: {v}'
+ if (obj.hasOwnProperty(p = 'FORMAT')) {
+ v = obj[p];
+ if (typeof v == 'object') FORMAT = v;
+ else throw Error
+ (bignumberError + p + ' not an object: ' + v);
+ }
+
+ // ALPHABET {string}
+ // '[BigNumber Error] ALPHABET invalid: {v}'
+ if (obj.hasOwnProperty(p = 'ALPHABET')) {
+ v = obj[p];
+
+ // Disallow if only one character,
+ // or if it contains '+', '-', '.', whitespace, or a repeated character.
+ if (typeof v == 'string' && !/^.$|[+-.\s]|(.).*\1/.test(v)) {
+ ALPHABET = v;
+ } else {
+ throw Error
+ (bignumberError + p + ' invalid: ' + v);
+ }
+ }
+
+ } else {
+
+ // '[BigNumber Error] Object expected: {v}'
+ throw Error
+ (bignumberError + 'Object expected: ' + obj);
+ }
+ }
+
+ return {
+ DECIMAL_PLACES: DECIMAL_PLACES,
+ ROUNDING_MODE: ROUNDING_MODE,
+ EXPONENTIAL_AT: [TO_EXP_NEG, TO_EXP_POS],
+ RANGE: [MIN_EXP, MAX_EXP],
+ CRYPTO: CRYPTO,
+ MODULO_MODE: MODULO_MODE,
+ POW_PRECISION: POW_PRECISION,
+ FORMAT: FORMAT,
+ ALPHABET: ALPHABET
+ };
+ };
+
+
+ /*
+ * Return true if v is a BigNumber instance, otherwise return false.
+ *
+ * If BigNumber.DEBUG is true, throw if a BigNumber instance is not well-formed.
+ *
+ * v {any}
+ *
+ * '[BigNumber Error] Invalid BigNumber: {v}'
+ */
+ BigNumber.isBigNumber = function (v) {
+ if (!v || v._isBigNumber !== true) return false;
+ if (!BigNumber.DEBUG) return true;
+
+ var i, n,
+ c = v.c,
+ e = v.e,
+ s = v.s;
+
+ out: if ({}.toString.call(c) == '[object Array]') {
+
+ if ((s === 1 || s === -1) && e >= -MAX && e <= MAX && e === mathfloor(e)) {
+
+ // If the first element is zero, the BigNumber value must be zero.
+ if (c[0] === 0) {
+ if (e === 0 && c.length === 1) return true;
+ break out;
+ }
+
+ // Calculate number of digits that c[0] should have, based on the exponent.
+ i = (e + 1) % LOG_BASE;
+ if (i < 1) i += LOG_BASE;
+
+ // Calculate number of digits of c[0].
+ //if (Math.ceil(Math.log(c[0] + 1) / Math.LN10) == i) {
+ if (String(c[0]).length == i) {
+
+ for (i = 0; i < c.length; i++) {
+ n = c[i];
+ if (n < 0 || n >= BASE || n !== mathfloor(n)) break out;
+ }
+
+ // Last element cannot be zero, unless it is the only element.
+ if (n !== 0) return true;
+ }
+ }
+
+ // Infinity/NaN
+ } else if (c === null && e === null && (s === null || s === 1 || s === -1)) {
+ return true;
+ }
+
+ throw Error
+ (bignumberError + 'Invalid BigNumber: ' + v);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the maximum of the arguments.
+ *
+ * arguments {number|string|BigNumber}
+ */
+ BigNumber.maximum = BigNumber.max = function () {
+ return maxOrMin(arguments, P.lt);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the minimum of the arguments.
+ *
+ * arguments {number|string|BigNumber}
+ */
+ BigNumber.minimum = BigNumber.min = function () {
+ return maxOrMin(arguments, P.gt);
+ };
+
+
+ /*
+ * Return a new BigNumber with a random value equal to or greater than 0 and less than 1,
+ * and with dp, or DECIMAL_PLACES if dp is omitted, decimal places (or less if trailing
+ * zeros are produced).
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp}'
+ * '[BigNumber Error] crypto unavailable'
+ */
+ BigNumber.random = (function () {
+ var pow2_53 = 0x20000000000000;
+
+ // Return a 53 bit integer n, where 0 <= n < 9007199254740992.
+ // Check if Math.random() produces more than 32 bits of randomness.
+ // If it does, assume at least 53 bits are produced, otherwise assume at least 30 bits.
+ // 0x40000000 is 2^30, 0x800000 is 2^23, 0x1fffff is 2^21 - 1.
+ var random53bitInt = (Math.random() * pow2_53) & 0x1fffff
+ ? function () { return mathfloor(Math.random() * pow2_53); }
+ : function () { return ((Math.random() * 0x40000000 | 0) * 0x800000) +
+ (Math.random() * 0x800000 | 0); };
+
+ return function (dp) {
+ var a, b, e, k, v,
+ i = 0,
+ c = [],
+ rand = new BigNumber(ONE);
+
+ if (dp == null) dp = DECIMAL_PLACES;
+ else intCheck(dp, 0, MAX);
+
+ k = mathceil(dp / LOG_BASE);
+
+ if (CRYPTO) {
+
+ // Browsers supporting crypto.getRandomValues.
+ if (crypto.getRandomValues) {
+
+ a = crypto.getRandomValues(new Uint32Array(k *= 2));
+
+ for (; i < k;) {
+
+ // 53 bits:
+ // ((Math.pow(2, 32) - 1) * Math.pow(2, 21)).toString(2)
+ // 11111 11111111 11111111 11111111 11100000 00000000 00000000
+ // ((Math.pow(2, 32) - 1) >>> 11).toString(2)
+ // 11111 11111111 11111111
+ // 0x20000 is 2^21.
+ v = a[i] * 0x20000 + (a[i + 1] >>> 11);
+
+ // Rejection sampling:
+ // 0 <= v < 9007199254740992
+ // Probability that v >= 9e15, is
+ // 7199254740992 / 9007199254740992 ~= 0.0008, i.e. 1 in 1251
+ if (v >= 9e15) {
+ b = crypto.getRandomValues(new Uint32Array(2));
+ a[i] = b[0];
+ a[i + 1] = b[1];
+ } else {
+
+ // 0 <= v <= 8999999999999999
+ // 0 <= (v % 1e14) <= 99999999999999
+ c.push(v % 1e14);
+ i += 2;
+ }
+ }
+ i = k / 2;
+
+ // Node.js supporting crypto.randomBytes.
+ } else if (crypto.randomBytes) {
+
+ // buffer
+ a = crypto.randomBytes(k *= 7);
+
+ for (; i < k;) {
+
+ // 0x1000000000000 is 2^48, 0x10000000000 is 2^40
+ // 0x100000000 is 2^32, 0x1000000 is 2^24
+ // 11111 11111111 11111111 11111111 11111111 11111111 11111111
+ // 0 <= v < 9007199254740992
+ v = ((a[i] & 31) * 0x1000000000000) + (a[i + 1] * 0x10000000000) +
+ (a[i + 2] * 0x100000000) + (a[i + 3] * 0x1000000) +
+ (a[i + 4] << 16) + (a[i + 5] << 8) + a[i + 6];
+
+ if (v >= 9e15) {
+ crypto.randomBytes(7).copy(a, i);
+ } else {
+
+ // 0 <= (v % 1e14) <= 99999999999999
+ c.push(v % 1e14);
+ i += 7;
+ }
+ }
+ i = k / 7;
+ } else {
+ CRYPTO = false;
+ throw Error
+ (bignumberError + 'crypto unavailable');
+ }
+ }
+
+ // Use Math.random.
+ if (!CRYPTO) {
+
+ for (; i < k;) {
+ v = random53bitInt();
+ if (v < 9e15) c[i++] = v % 1e14;
+ }
+ }
+
+ k = c[--i];
+ dp %= LOG_BASE;
+
+ // Convert trailing digits to zeros according to dp.
+ if (k && dp) {
+ v = POWS_TEN[LOG_BASE - dp];
+ c[i] = mathfloor(k / v) * v;
+ }
+
+ // Remove trailing elements which are zero.
+ for (; c[i] === 0; c.pop(), i--);
+
+ // Zero?
+ if (i < 0) {
+ c = [e = 0];
+ } else {
+
+ // Remove leading elements which are zero and adjust exponent accordingly.
+ for (e = -1 ; c[0] === 0; c.splice(0, 1), e -= LOG_BASE);
+
+ // Count the digits of the first element of c to determine leading zeros, and...
+ for (i = 1, v = c[0]; v >= 10; v /= 10, i++);
+
+ // adjust the exponent accordingly.
+ if (i < LOG_BASE) e -= LOG_BASE - i;
+ }
+
+ rand.e = e;
+ rand.c = c;
+ return rand;
+ };
+ })();
+
+
+ /*
+ * Return a BigNumber whose value is the sum of the arguments.
+ *
+ * arguments {number|string|BigNumber}
+ */
+ BigNumber.sum = function () {
+ var i = 1,
+ args = arguments,
+ sum = new BigNumber(args[0]);
+ for (; i < args.length;) sum = sum.plus(args[i++]);
+ return sum;
+ };
+
+
+ // PRIVATE FUNCTIONS
+
+
+ // Called by BigNumber and BigNumber.prototype.toString.
+ convertBase = (function () {
+ var decimal = '0123456789';
+
+ /*
+ * Convert string of baseIn to an array of numbers of baseOut.
+ * Eg. toBaseOut('255', 10, 16) returns [15, 15].
+ * Eg. toBaseOut('ff', 16, 10) returns [2, 5, 5].
+ */
+ function toBaseOut(str, baseIn, baseOut, alphabet) {
+ var j,
+ arr = [0],
+ arrL,
+ i = 0,
+ len = str.length;
+
+ for (; i < len;) {
+ for (arrL = arr.length; arrL--; arr[arrL] *= baseIn);
+
+ arr[0] += alphabet.indexOf(str.charAt(i++));
+
+ for (j = 0; j < arr.length; j++) {
+
+ if (arr[j] > baseOut - 1) {
+ if (arr[j + 1] == null) arr[j + 1] = 0;
+ arr[j + 1] += arr[j] / baseOut | 0;
+ arr[j] %= baseOut;
+ }
+ }
+ }
+
+ return arr.reverse();
+ }
+
+ // Convert a numeric string of baseIn to a numeric string of baseOut.
+ // If the caller is toString, we are converting from base 10 to baseOut.
+ // If the caller is BigNumber, we are converting from baseIn to base 10.
+ return function (str, baseIn, baseOut, sign, callerIsToString) {
+ var alphabet, d, e, k, r, x, xc, y,
+ i = str.indexOf('.'),
+ dp = DECIMAL_PLACES,
+ rm = ROUNDING_MODE;
+
+ // Non-integer.
+ if (i >= 0) {
+ k = POW_PRECISION;
+
+ // Unlimited precision.
+ POW_PRECISION = 0;
+ str = str.replace('.', '');
+ y = new BigNumber(baseIn);
+ x = y.pow(str.length - i);
+ POW_PRECISION = k;
+
+ // Convert str as if an integer, then restore the fraction part by dividing the
+ // result by its base raised to a power.
+
+ y.c = toBaseOut(toFixedPoint(coeffToString(x.c), x.e, '0'),
+ 10, baseOut, decimal);
+ y.e = y.c.length;
+ }
+
+ // Convert the number as integer.
+
+ xc = toBaseOut(str, baseIn, baseOut, callerIsToString
+ ? (alphabet = ALPHABET, decimal)
+ : (alphabet = decimal, ALPHABET));
+
+ // xc now represents str as an integer and converted to baseOut. e is the exponent.
+ e = k = xc.length;
+
+ // Remove trailing zeros.
+ for (; xc[--k] == 0; xc.pop());
+
+ // Zero?
+ if (!xc[0]) return alphabet.charAt(0);
+
+ // Does str represent an integer? If so, no need for the division.
+ if (i < 0) {
+ --e;
+ } else {
+ x.c = xc;
+ x.e = e;
+
+ // The sign is needed for correct rounding.
+ x.s = sign;
+ x = div(x, y, dp, rm, baseOut);
+ xc = x.c;
+ r = x.r;
+ e = x.e;
+ }
+
+ // xc now represents str converted to baseOut.
+
+ // THe index of the rounding digit.
+ d = e + dp + 1;
+
+ // The rounding digit: the digit to the right of the digit that may be rounded up.
+ i = xc[d];
+
+ // Look at the rounding digits and mode to determine whether to round up.
+
+ k = baseOut / 2;
+ r = r || d < 0 || xc[d + 1] != null;
+
+ r = rm < 4 ? (i != null || r) && (rm == 0 || rm == (x.s < 0 ? 3 : 2))
+ : i > k || i == k &&(rm == 4 || r || rm == 6 && xc[d - 1] & 1 ||
+ rm == (x.s < 0 ? 8 : 7));
+
+ // If the index of the rounding digit is not greater than zero, or xc represents
+ // zero, then the result of the base conversion is zero or, if rounding up, a value
+ // such as 0.00001.
+ if (d < 1 || !xc[0]) {
+
+ // 1^-dp or 0
+ str = r ? toFixedPoint(alphabet.charAt(1), -dp, alphabet.charAt(0)) : alphabet.charAt(0);
+ } else {
+
+ // Truncate xc to the required number of decimal places.
+ xc.length = d;
+
+ // Round up?
+ if (r) {
+
+ // Rounding up may mean the previous digit has to be rounded up and so on.
+ for (--baseOut; ++xc[--d] > baseOut;) {
+ xc[d] = 0;
+
+ if (!d) {
+ ++e;
+ xc = [1].concat(xc);
+ }
+ }
+ }
+
+ // Determine trailing zeros.
+ for (k = xc.length; !xc[--k];);
+
+ // E.g. [4, 11, 15] becomes 4bf.
+ for (i = 0, str = ''; i <= k; str += alphabet.charAt(xc[i++]));
+
+ // Add leading zeros, decimal point and trailing zeros as required.
+ str = toFixedPoint(str, e, alphabet.charAt(0));
+ }
+
+ // The caller will add the sign.
+ return str;
+ };
+ })();
+
+
+ // Perform division in the specified base. Called by div and convertBase.
+ div = (function () {
+
+ // Assume non-zero x and k.
+ function multiply(x, k, base) {
+ var m, temp, xlo, xhi,
+ carry = 0,
+ i = x.length,
+ klo = k % SQRT_BASE,
+ khi = k / SQRT_BASE | 0;
+
+ for (x = x.slice(); i--;) {
+ xlo = x[i] % SQRT_BASE;
+ xhi = x[i] / SQRT_BASE | 0;
+ m = khi * xlo + xhi * klo;
+ temp = klo * xlo + ((m % SQRT_BASE) * SQRT_BASE) + carry;
+ carry = (temp / base | 0) + (m / SQRT_BASE | 0) + khi * xhi;
+ x[i] = temp % base;
+ }
+
+ if (carry) x = [carry].concat(x);
+
+ return x;
+ }
+
+ function compare(a, b, aL, bL) {
+ var i, cmp;
+
+ if (aL != bL) {
+ cmp = aL > bL ? 1 : -1;
+ } else {
+
+ for (i = cmp = 0; i < aL; i++) {
+
+ if (a[i] != b[i]) {
+ cmp = a[i] > b[i] ? 1 : -1;
+ break;
+ }
+ }
+ }
+
+ return cmp;
+ }
+
+ function subtract(a, b, aL, base) {
+ var i = 0;
+
+ // Subtract b from a.
+ for (; aL--;) {
+ a[aL] -= i;
+ i = a[aL] < b[aL] ? 1 : 0;
+ a[aL] = i * base + a[aL] - b[aL];
+ }
+
+ // Remove leading zeros.
+ for (; !a[0] && a.length > 1; a.splice(0, 1));
+ }
+
+ // x: dividend, y: divisor.
+ return function (x, y, dp, rm, base) {
+ var cmp, e, i, more, n, prod, prodL, q, qc, rem, remL, rem0, xi, xL, yc0,
+ yL, yz,
+ s = x.s == y.s ? 1 : -1,
+ xc = x.c,
+ yc = y.c;
+
+ // Either NaN, Infinity or 0?
+ if (!xc || !xc[0] || !yc || !yc[0]) {
+
+ return new BigNumber(
+
+ // Return NaN if either NaN, or both Infinity or 0.
+ !x.s || !y.s || (xc ? yc && xc[0] == yc[0] : !yc) ? NaN :
+
+ // Return ±0 if x is ±0 or y is ±Infinity, or return ±Infinity as y is ±0.
+ xc && xc[0] == 0 || !yc ? s * 0 : s / 0
+ );
+ }
+
+ q = new BigNumber(s);
+ qc = q.c = [];
+ e = x.e - y.e;
+ s = dp + e + 1;
+
+ if (!base) {
+ base = BASE;
+ e = bitFloor(x.e / LOG_BASE) - bitFloor(y.e / LOG_BASE);
+ s = s / LOG_BASE | 0;
+ }
+
+ // Result exponent may be one less then the current value of e.
+ // The coefficients of the BigNumbers from convertBase may have trailing zeros.
+ for (i = 0; yc[i] == (xc[i] || 0); i++);
+
+ if (yc[i] > (xc[i] || 0)) e--;
+
+ if (s < 0) {
+ qc.push(1);
+ more = true;
+ } else {
+ xL = xc.length;
+ yL = yc.length;
+ i = 0;
+ s += 2;
+
+ // Normalise xc and yc so highest order digit of yc is >= base / 2.
+
+ n = mathfloor(base / (yc[0] + 1));
+
+ // Not necessary, but to handle odd bases where yc[0] == (base / 2) - 1.
+ // if (n > 1 || n++ == 1 && yc[0] < base / 2) {
+ if (n > 1) {
+ yc = multiply(yc, n, base);
+ xc = multiply(xc, n, base);
+ yL = yc.length;
+ xL = xc.length;
+ }
+
+ xi = yL;
+ rem = xc.slice(0, yL);
+ remL = rem.length;
+
+ // Add zeros to make remainder as long as divisor.
+ for (; remL < yL; rem[remL++] = 0);
+ yz = yc.slice();
+ yz = [0].concat(yz);
+ yc0 = yc[0];
+ if (yc[1] >= base / 2) yc0++;
+ // Not necessary, but to prevent trial digit n > base, when using base 3.
+ // else if (base == 3 && yc0 == 1) yc0 = 1 + 1e-15;
+
+ do {
+ n = 0;
+
+ // Compare divisor and remainder.
+ cmp = compare(yc, rem, yL, remL);
+
+ // If divisor < remainder.
+ if (cmp < 0) {
+
+ // Calculate trial digit, n.
+
+ rem0 = rem[0];
+ if (yL != remL) rem0 = rem0 * base + (rem[1] || 0);
+
+ // n is how many times the divisor goes into the current remainder.
+ n = mathfloor(rem0 / yc0);
+
+ // Algorithm:
+ // product = divisor multiplied by trial digit (n).
+ // Compare product and remainder.
+ // If product is greater than remainder:
+ // Subtract divisor from product, decrement trial digit.
+ // Subtract product from remainder.
+ // If product was less than remainder at the last compare:
+ // Compare new remainder and divisor.
+ // If remainder is greater than divisor:
+ // Subtract divisor from remainder, increment trial digit.
+
+ if (n > 1) {
+
+ // n may be > base only when base is 3.
+ if (n >= base) n = base - 1;
+
+ // product = divisor * trial digit.
+ prod = multiply(yc, n, base);
+ prodL = prod.length;
+ remL = rem.length;
+
+ // Compare product and remainder.
+ // If product > remainder then trial digit n too high.
+ // n is 1 too high about 5% of the time, and is not known to have
+ // ever been more than 1 too high.
+ while (compare(prod, rem, prodL, remL) == 1) {
+ n--;
+
+ // Subtract divisor from product.
+ subtract(prod, yL < prodL ? yz : yc, prodL, base);
+ prodL = prod.length;
+ cmp = 1;
+ }
+ } else {
+
+ // n is 0 or 1, cmp is -1.
+ // If n is 0, there is no need to compare yc and rem again below,
+ // so change cmp to 1 to avoid it.
+ // If n is 1, leave cmp as -1, so yc and rem are compared again.
+ if (n == 0) {
+
+ // divisor < remainder, so n must be at least 1.
+ cmp = n = 1;
+ }
+
+ // product = divisor
+ prod = yc.slice();
+ prodL = prod.length;
+ }
+
+ if (prodL < remL) prod = [0].concat(prod);
+
+ // Subtract product from remainder.
+ subtract(rem, prod, remL, base);
+ remL = rem.length;
+
+ // If product was < remainder.
+ if (cmp == -1) {
+
+ // Compare divisor and new remainder.
+ // If divisor < new remainder, subtract divisor from remainder.
+ // Trial digit n too low.
+ // n is 1 too low about 5% of the time, and very rarely 2 too low.
+ while (compare(yc, rem, yL, remL) < 1) {
+ n++;
+
+ // Subtract divisor from remainder.
+ subtract(rem, yL < remL ? yz : yc, remL, base);
+ remL = rem.length;
+ }
+ }
+ } else if (cmp === 0) {
+ n++;
+ rem = [0];
+ } // else cmp === 1 and n will be 0
+
+ // Add the next digit, n, to the result array.
+ qc[i++] = n;
+
+ // Update the remainder.
+ if (rem[0]) {
+ rem[remL++] = xc[xi] || 0;
+ } else {
+ rem = [xc[xi]];
+ remL = 1;
+ }
+ } while ((xi++ < xL || rem[0] != null) && s--);
+
+ more = rem[0] != null;
+
+ // Leading zero?
+ if (!qc[0]) qc.splice(0, 1);
+ }
+
+ if (base == BASE) {
+
+ // To calculate q.e, first get the number of digits of qc[0].
+ for (i = 1, s = qc[0]; s >= 10; s /= 10, i++);
+
+ round(q, dp + (q.e = i + e * LOG_BASE - 1) + 1, rm, more);
+
+ // Caller is convertBase.
+ } else {
+ q.e = e;
+ q.r = +more;
+ }
+
+ return q;
+ };
+ })();
+
+
+ /*
+ * Return a string representing the value of BigNumber n in fixed-point or exponential
+ * notation rounded to the specified decimal places or significant digits.
+ *
+ * n: a BigNumber.
+ * i: the index of the last digit required (i.e. the digit that may be rounded up).
+ * rm: the rounding mode.
+ * id: 1 (toExponential) or 2 (toPrecision).
+ */
+ function format(n, i, rm, id) {
+ var c0, e, ne, len, str;
+
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+
+ if (!n.c) return n.toString();
+
+ c0 = n.c[0];
+ ne = n.e;
+
+ if (i == null) {
+ str = coeffToString(n.c);
+ str = id == 1 || id == 2 && (ne <= TO_EXP_NEG || ne >= TO_EXP_POS)
+ ? toExponential(str, ne)
+ : toFixedPoint(str, ne, '0');
+ } else {
+ n = round(new BigNumber(n), i, rm);
+
+ // n.e may have changed if the value was rounded up.
+ e = n.e;
+
+ str = coeffToString(n.c);
+ len = str.length;
+
+ // toPrecision returns exponential notation if the number of significant digits
+ // specified is less than the number of digits necessary to represent the integer
+ // part of the value in fixed-point notation.
+
+ // Exponential notation.
+ if (id == 1 || id == 2 && (i <= e || e <= TO_EXP_NEG)) {
+
+ // Append zeros?
+ for (; len < i; str += '0', len++);
+ str = toExponential(str, e);
+
+ // Fixed-point notation.
+ } else {
+ i -= ne;
+ str = toFixedPoint(str, e, '0');
+
+ // Append zeros?
+ if (e + 1 > len) {
+ if (--i > 0) for (str += '.'; i--; str += '0');
+ } else {
+ i += e - len;
+ if (i > 0) {
+ if (e + 1 == len) str += '.';
+ for (; i--; str += '0');
+ }
+ }
+ }
+ }
+
+ return n.s < 0 && c0 ? '-' + str : str;
+ }
+
+
+ // Handle BigNumber.max and BigNumber.min.
+ function maxOrMin(args, method) {
+ var n,
+ i = 1,
+ m = new BigNumber(args[0]);
+
+ for (; i < args.length; i++) {
+ n = new BigNumber(args[i]);
+
+ // If any number is NaN, return NaN.
+ if (!n.s) {
+ m = n;
+ break;
+ } else if (method.call(m, n)) {
+ m = n;
+ }
+ }
+
+ return m;
+ }
+
+
+ /*
+ * Strip trailing zeros, calculate base 10 exponent and check against MIN_EXP and MAX_EXP.
+ * Called by minus, plus and times.
+ */
+ function normalise(n, c, e) {
+ var i = 1,
+ j = c.length;
+
+ // Remove trailing zeros.
+ for (; !c[--j]; c.pop());
+
+ // Calculate the base 10 exponent. First get the number of digits of c[0].
+ for (j = c[0]; j >= 10; j /= 10, i++);
+
+ // Overflow?
+ if ((e = i + e * LOG_BASE - 1) > MAX_EXP) {
+
+ // Infinity.
+ n.c = n.e = null;
+
+ // Underflow?
+ } else if (e < MIN_EXP) {
+
+ // Zero.
+ n.c = [n.e = 0];
+ } else {
+ n.e = e;
+ n.c = c;
+ }
+
+ return n;
+ }
+
+
+ // Handle values that fail the validity test in BigNumber.
+ parseNumeric = (function () {
+ var basePrefix = /^(-?)0([xbo])(?=\w[\w.]*$)/i,
+ dotAfter = /^([^.]+)\.$/,
+ dotBefore = /^\.([^.]+)$/,
+ isInfinityOrNaN = /^-?(Infinity|NaN)$/,
+ whitespaceOrPlus = /^\s*\+(?=[\w.])|^\s+|\s+$/g;
+
+ return function (x, str, isNum, b) {
+ var base,
+ s = isNum ? str : str.replace(whitespaceOrPlus, '');
+
+ // No exception on ±Infinity or NaN.
+ if (isInfinityOrNaN.test(s)) {
+ x.s = isNaN(s) ? null : s < 0 ? -1 : 1;
+ } else {
+ if (!isNum) {
+
+ // basePrefix = /^(-?)0([xbo])(?=\w[\w.]*$)/i
+ s = s.replace(basePrefix, function (m, p1, p2) {
+ base = (p2 = p2.toLowerCase()) == 'x' ? 16 : p2 == 'b' ? 2 : 8;
+ return !b || b == base ? p1 : m;
+ });
+
+ if (b) {
+ base = b;
+
+ // E.g. '1.' to '1', '.1' to '0.1'
+ s = s.replace(dotAfter, '$1').replace(dotBefore, '0.$1');
+ }
+
+ if (str != s) return new BigNumber(s, base);
+ }
+
+ // '[BigNumber Error] Not a number: {n}'
+ // '[BigNumber Error] Not a base {b} number: {n}'
+ if (BigNumber.DEBUG) {
+ throw Error
+ (bignumberError + 'Not a' + (b ? ' base ' + b : '') + ' number: ' + str);
+ }
+
+ // NaN
+ x.s = null;
+ }
+
+ x.c = x.e = null;
+ }
+ })();
+
+
+ /*
+ * Round x to sd significant digits using rounding mode rm. Check for over/under-flow.
+ * If r is truthy, it is known that there are more digits after the rounding digit.
+ */
+ function round(x, sd, rm, r) {
+ var d, i, j, k, n, ni, rd,
+ xc = x.c,
+ pows10 = POWS_TEN;
+
+ // if x is not Infinity or NaN...
+ if (xc) {
+
+ // rd is the rounding digit, i.e. the digit after the digit that may be rounded up.
+ // n is a base 1e14 number, the value of the element of array x.c containing rd.
+ // ni is the index of n within x.c.
+ // d is the number of digits of n.
+ // i is the index of rd within n including leading zeros.
+ // j is the actual index of rd within n (if < 0, rd is a leading zero).
+ out: {
+
+ // Get the number of digits of the first element of xc.
+ for (d = 1, k = xc[0]; k >= 10; k /= 10, d++);
+ i = sd - d;
+
+ // If the rounding digit is in the first element of xc...
+ if (i < 0) {
+ i += LOG_BASE;
+ j = sd;
+ n = xc[ni = 0];
+
+ // Get the rounding digit at index j of n.
+ rd = n / pows10[d - j - 1] % 10 | 0;
+ } else {
+ ni = mathceil((i + 1) / LOG_BASE);
+
+ if (ni >= xc.length) {
+
+ if (r) {
+
+ // Needed by sqrt.
+ for (; xc.length <= ni; xc.push(0));
+ n = rd = 0;
+ d = 1;
+ i %= LOG_BASE;
+ j = i - LOG_BASE + 1;
+ } else {
+ break out;
+ }
+ } else {
+ n = k = xc[ni];
+
+ // Get the number of digits of n.
+ for (d = 1; k >= 10; k /= 10, d++);
+
+ // Get the index of rd within n.
+ i %= LOG_BASE;
+
+ // Get the index of rd within n, adjusted for leading zeros.
+ // The number of leading zeros of n is given by LOG_BASE - d.
+ j = i - LOG_BASE + d;
+
+ // Get the rounding digit at index j of n.
+ rd = j < 0 ? 0 : n / pows10[d - j - 1] % 10 | 0;
+ }
+ }
+
+ r = r || sd < 0 ||
+
+ // Are there any non-zero digits after the rounding digit?
+ // The expression n % pows10[d - j - 1] returns all digits of n to the right
+ // of the digit at j, e.g. if n is 908714 and j is 2, the expression gives 714.
+ xc[ni + 1] != null || (j < 0 ? n : n % pows10[d - j - 1]);
+
+ r = rm < 4
+ ? (rd || r) && (rm == 0 || rm == (x.s < 0 ? 3 : 2))
+ : rd > 5 || rd == 5 && (rm == 4 || r || rm == 6 &&
+
+ // Check whether the digit to the left of the rounding digit is odd.
+ ((i > 0 ? j > 0 ? n / pows10[d - j] : 0 : xc[ni - 1]) % 10) & 1 ||
+ rm == (x.s < 0 ? 8 : 7));
+
+ if (sd < 1 || !xc[0]) {
+ xc.length = 0;
+
+ if (r) {
+
+ // Convert sd to decimal places.
+ sd -= x.e + 1;
+
+ // 1, 0.1, 0.01, 0.001, 0.0001 etc.
+ xc[0] = pows10[(LOG_BASE - sd % LOG_BASE) % LOG_BASE];
+ x.e = -sd || 0;
+ } else {
+
+ // Zero.
+ xc[0] = x.e = 0;
+ }
+
+ return x;
+ }
+
+ // Remove excess digits.
+ if (i == 0) {
+ xc.length = ni;
+ k = 1;
+ ni--;
+ } else {
+ xc.length = ni + 1;
+ k = pows10[LOG_BASE - i];
+
+ // E.g. 56700 becomes 56000 if 7 is the rounding digit.
+ // j > 0 means i > number of leading zeros of n.
+ xc[ni] = j > 0 ? mathfloor(n / pows10[d - j] % pows10[j]) * k : 0;
+ }
+
+ // Round up?
+ if (r) {
+
+ for (; ;) {
+
+ // If the digit to be rounded up is in the first element of xc...
+ if (ni == 0) {
+
+ // i will be the length of xc[0] before k is added.
+ for (i = 1, j = xc[0]; j >= 10; j /= 10, i++);
+ j = xc[0] += k;
+ for (k = 1; j >= 10; j /= 10, k++);
+
+ // if i != k the length has increased.
+ if (i != k) {
+ x.e++;
+ if (xc[0] == BASE) xc[0] = 1;
+ }
+
+ break;
+ } else {
+ xc[ni] += k;
+ if (xc[ni] != BASE) break;
+ xc[ni--] = 0;
+ k = 1;
+ }
+ }
+ }
+
+ // Remove trailing zeros.
+ for (i = xc.length; xc[--i] === 0; xc.pop());
+ }
+
+ // Overflow? Infinity.
+ if (x.e > MAX_EXP) {
+ x.c = x.e = null;
+
+ // Underflow? Zero.
+ } else if (x.e < MIN_EXP) {
+ x.c = [x.e = 0];
+ }
+ }
+
+ return x;
+ }
+
+
+ function valueOf(n) {
+ var str,
+ e = n.e;
+
+ if (e === null) return n.toString();
+
+ str = coeffToString(n.c);
+
+ str = e <= TO_EXP_NEG || e >= TO_EXP_POS
+ ? toExponential(str, e)
+ : toFixedPoint(str, e, '0');
+
+ return n.s < 0 ? '-' + str : str;
+ }
+
+
+ // PROTOTYPE/INSTANCE METHODS
+
+
+ /*
+ * Return a new BigNumber whose value is the absolute value of this BigNumber.
+ */
+ P.absoluteValue = P.abs = function () {
+ var x = new BigNumber(this);
+ if (x.s < 0) x.s = 1;
+ return x;
+ };
+
+
+ /*
+ * Return
+ * 1 if the value of this BigNumber is greater than the value of BigNumber(y, b),
+ * -1 if the value of this BigNumber is less than the value of BigNumber(y, b),
+ * 0 if they have the same value,
+ * or null if the value of either is NaN.
+ */
+ P.comparedTo = function (y, b) {
+ return compare(this, new BigNumber(y, b));
+ };
+
+
+ /*
+ * If dp is undefined or null or true or false, return the number of decimal places of the
+ * value of this BigNumber, or null if the value of this BigNumber is ±Infinity or NaN.
+ *
+ * Otherwise, if dp is a number, return a new BigNumber whose value is the value of this
+ * BigNumber rounded to a maximum of dp decimal places using rounding mode rm, or
+ * ROUNDING_MODE if rm is omitted.
+ *
+ * [dp] {number} Decimal places: integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ */
+ P.decimalPlaces = P.dp = function (dp, rm) {
+ var c, n, v,
+ x = this;
+
+ if (dp != null) {
+ intCheck(dp, 0, MAX);
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+
+ return round(new BigNumber(x), dp + x.e + 1, rm);
+ }
+
+ if (!(c = x.c)) return null;
+ n = ((v = c.length - 1) - bitFloor(this.e / LOG_BASE)) * LOG_BASE;
+
+ // Subtract the number of trailing zeros of the last number.
+ if (v = c[v]) for (; v % 10 == 0; v /= 10, n--);
+ if (n < 0) n = 0;
+
+ return n;
+ };
+
+
+ /*
+ * n / 0 = I
+ * n / N = N
+ * n / I = 0
+ * 0 / n = 0
+ * 0 / 0 = N
+ * 0 / N = N
+ * 0 / I = 0
+ * N / n = N
+ * N / 0 = N
+ * N / N = N
+ * N / I = N
+ * I / n = I
+ * I / 0 = I
+ * I / N = N
+ * I / I = N
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber divided by the value of
+ * BigNumber(y, b), rounded according to DECIMAL_PLACES and ROUNDING_MODE.
+ */
+ P.dividedBy = P.div = function (y, b) {
+ return div(this, new BigNumber(y, b), DECIMAL_PLACES, ROUNDING_MODE);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the integer part of dividing the value of this
+ * BigNumber by the value of BigNumber(y, b).
+ */
+ P.dividedToIntegerBy = P.idiv = function (y, b) {
+ return div(this, new BigNumber(y, b), 0, 1);
+ };
+
+
+ /*
+ * Return a BigNumber whose value is the value of this BigNumber exponentiated by n.
+ *
+ * If m is present, return the result modulo m.
+ * If n is negative round according to DECIMAL_PLACES and ROUNDING_MODE.
+ * If POW_PRECISION is non-zero and m is not present, round to POW_PRECISION using ROUNDING_MODE.
+ *
+ * The modular power operation works efficiently when x, n, and m are integers, otherwise it
+ * is equivalent to calculating x.exponentiatedBy(n).modulo(m) with a POW_PRECISION of 0.
+ *
+ * n {number|string|BigNumber} The exponent. An integer.
+ * [m] {number|string|BigNumber} The modulus.
+ *
+ * '[BigNumber Error] Exponent not an integer: {n}'
+ */
+ P.exponentiatedBy = P.pow = function (n, m) {
+ var half, isModExp, i, k, more, nIsBig, nIsNeg, nIsOdd, y,
+ x = this;
+
+ n = new BigNumber(n);
+
+ // Allow NaN and ±Infinity, but not other non-integers.
+ if (n.c && !n.isInteger()) {
+ throw Error
+ (bignumberError + 'Exponent not an integer: ' + valueOf(n));
+ }
+
+ if (m != null) m = new BigNumber(m);
+
+ // Exponent of MAX_SAFE_INTEGER is 15.
+ nIsBig = n.e > 14;
+
+ // If x is NaN, ±Infinity, ±0 or ±1, or n is ±Infinity, NaN or ±0.
+ if (!x.c || !x.c[0] || x.c[0] == 1 && !x.e && x.c.length == 1 || !n.c || !n.c[0]) {
+
+ // The sign of the result of pow when x is negative depends on the evenness of n.
+ // If +n overflows to ±Infinity, the evenness of n would be not be known.
+ y = new BigNumber(Math.pow(+valueOf(x), nIsBig ? 2 - isOdd(n) : +valueOf(n)));
+ return m ? y.mod(m) : y;
+ }
+
+ nIsNeg = n.s < 0;
+
+ if (m) {
+
+ // x % m returns NaN if abs(m) is zero, or m is NaN.
+ if (m.c ? !m.c[0] : !m.s) return new BigNumber(NaN);
+
+ isModExp = !nIsNeg && x.isInteger() && m.isInteger();
+
+ if (isModExp) x = x.mod(m);
+
+ // Overflow to ±Infinity: >=2**1e10 or >=1.0000024**1e15.
+ // Underflow to ±0: <=0.79**1e10 or <=0.9999975**1e15.
+ } else if (n.e > 9 && (x.e > 0 || x.e < -1 || (x.e == 0
+ // [1, 240000000]
+ ? x.c[0] > 1 || nIsBig && x.c[1] >= 24e7
+ // [80000000000000] [99999750000000]
+ : x.c[0] < 8e13 || nIsBig && x.c[0] <= 9999975e7))) {
+
+ // If x is negative and n is odd, k = -0, else k = 0.
+ k = x.s < 0 && isOdd(n) ? -0 : 0;
+
+ // If x >= 1, k = ±Infinity.
+ if (x.e > -1) k = 1 / k;
+
+ // If n is negative return ±0, else return ±Infinity.
+ return new BigNumber(nIsNeg ? 1 / k : k);
+
+ } else if (POW_PRECISION) {
+
+ // Truncating each coefficient array to a length of k after each multiplication
+ // equates to truncating significant digits to POW_PRECISION + [28, 41],
+ // i.e. there will be a minimum of 28 guard digits retained.
+ k = mathceil(POW_PRECISION / LOG_BASE + 2);
+ }
+
+ if (nIsBig) {
+ half = new BigNumber(0.5);
+ if (nIsNeg) n.s = 1;
+ nIsOdd = isOdd(n);
+ } else {
+ i = Math.abs(+valueOf(n));
+ nIsOdd = i % 2;
+ }
+
+ y = new BigNumber(ONE);
+
+ // Performs 54 loop iterations for n of 9007199254740991.
+ for (; ;) {
+
+ if (nIsOdd) {
+ y = y.times(x);
+ if (!y.c) break;
+
+ if (k) {
+ if (y.c.length > k) y.c.length = k;
+ } else if (isModExp) {
+ y = y.mod(m); //y = y.minus(div(y, m, 0, MODULO_MODE).times(m));
+ }
+ }
+
+ if (i) {
+ i = mathfloor(i / 2);
+ if (i === 0) break;
+ nIsOdd = i % 2;
+ } else {
+ n = n.times(half);
+ round(n, n.e + 1, 1);
+
+ if (n.e > 14) {
+ nIsOdd = isOdd(n);
+ } else {
+ i = +valueOf(n);
+ if (i === 0) break;
+ nIsOdd = i % 2;
+ }
+ }
+
+ x = x.times(x);
+
+ if (k) {
+ if (x.c && x.c.length > k) x.c.length = k;
+ } else if (isModExp) {
+ x = x.mod(m); //x = x.minus(div(x, m, 0, MODULO_MODE).times(m));
+ }
+ }
+
+ if (isModExp) return y;
+ if (nIsNeg) y = ONE.div(y);
+
+ return m ? y.mod(m) : k ? round(y, POW_PRECISION, ROUNDING_MODE, more) : y;
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the value of this BigNumber rounded to an integer
+ * using rounding mode rm, or ROUNDING_MODE if rm is omitted.
+ *
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {rm}'
+ */
+ P.integerValue = function (rm) {
+ var n = new BigNumber(this);
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+ return round(n, n.e + 1, rm);
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is equal to the value of BigNumber(y, b),
+ * otherwise return false.
+ */
+ P.isEqualTo = P.eq = function (y, b) {
+ return compare(this, new BigNumber(y, b)) === 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is a finite number, otherwise return false.
+ */
+ P.isFinite = function () {
+ return !!this.c;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is greater than the value of BigNumber(y, b),
+ * otherwise return false.
+ */
+ P.isGreaterThan = P.gt = function (y, b) {
+ return compare(this, new BigNumber(y, b)) > 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is greater than or equal to the value of
+ * BigNumber(y, b), otherwise return false.
+ */
+ P.isGreaterThanOrEqualTo = P.gte = function (y, b) {
+ return (b = compare(this, new BigNumber(y, b))) === 1 || b === 0;
+
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is an integer, otherwise return false.
+ */
+ P.isInteger = function () {
+ return !!this.c && bitFloor(this.e / LOG_BASE) > this.c.length - 2;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is less than the value of BigNumber(y, b),
+ * otherwise return false.
+ */
+ P.isLessThan = P.lt = function (y, b) {
+ return compare(this, new BigNumber(y, b)) < 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is less than or equal to the value of
+ * BigNumber(y, b), otherwise return false.
+ */
+ P.isLessThanOrEqualTo = P.lte = function (y, b) {
+ return (b = compare(this, new BigNumber(y, b))) === -1 || b === 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is NaN, otherwise return false.
+ */
+ P.isNaN = function () {
+ return !this.s;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is negative, otherwise return false.
+ */
+ P.isNegative = function () {
+ return this.s < 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is positive, otherwise return false.
+ */
+ P.isPositive = function () {
+ return this.s > 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is 0 or -0, otherwise return false.
+ */
+ P.isZero = function () {
+ return !!this.c && this.c[0] == 0;
+ };
+
+
+ /*
+ * n - 0 = n
+ * n - N = N
+ * n - I = -I
+ * 0 - n = -n
+ * 0 - 0 = 0
+ * 0 - N = N
+ * 0 - I = -I
+ * N - n = N
+ * N - 0 = N
+ * N - N = N
+ * N - I = N
+ * I - n = I
+ * I - 0 = I
+ * I - N = N
+ * I - I = N
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber minus the value of
+ * BigNumber(y, b).
+ */
+ P.minus = function (y, b) {
+ var i, j, t, xLTy,
+ x = this,
+ a = x.s;
+
+ y = new BigNumber(y, b);
+ b = y.s;
+
+ // Either NaN?
+ if (!a || !b) return new BigNumber(NaN);
+
+ // Signs differ?
+ if (a != b) {
+ y.s = -b;
+ return x.plus(y);
+ }
+
+ var xe = x.e / LOG_BASE,
+ ye = y.e / LOG_BASE,
+ xc = x.c,
+ yc = y.c;
+
+ if (!xe || !ye) {
+
+ // Either Infinity?
+ if (!xc || !yc) return xc ? (y.s = -b, y) : new BigNumber(yc ? x : NaN);
+
+ // Either zero?
+ if (!xc[0] || !yc[0]) {
+
+ // Return y if y is non-zero, x if x is non-zero, or zero if both are zero.
+ return yc[0] ? (y.s = -b, y) : new BigNumber(xc[0] ? x :
+
+ // IEEE 754 (2008) 6.3: n - n = -0 when rounding to -Infinity
+ ROUNDING_MODE == 3 ? -0 : 0);
+ }
+ }
+
+ xe = bitFloor(xe);
+ ye = bitFloor(ye);
+ xc = xc.slice();
+
+ // Determine which is the bigger number.
+ if (a = xe - ye) {
+
+ if (xLTy = a < 0) {
+ a = -a;
+ t = xc;
+ } else {
+ ye = xe;
+ t = yc;
+ }
+
+ t.reverse();
+
+ // Prepend zeros to equalise exponents.
+ for (b = a; b--; t.push(0));
+ t.reverse();
+ } else {
+
+ // Exponents equal. Check digit by digit.
+ j = (xLTy = (a = xc.length) < (b = yc.length)) ? a : b;
+
+ for (a = b = 0; b < j; b++) {
+
+ if (xc[b] != yc[b]) {
+ xLTy = xc[b] < yc[b];
+ break;
+ }
+ }
+ }
+
+ // x < y? Point xc to the array of the bigger number.
+ if (xLTy) t = xc, xc = yc, yc = t, y.s = -y.s;
+
+ b = (j = yc.length) - (i = xc.length);
+
+ // Append zeros to xc if shorter.
+ // No need to add zeros to yc if shorter as subtract only needs to start at yc.length.
+ if (b > 0) for (; b--; xc[i++] = 0);
+ b = BASE - 1;
+
+ // Subtract yc from xc.
+ for (; j > a;) {
+
+ if (xc[--j] < yc[j]) {
+ for (i = j; i && !xc[--i]; xc[i] = b);
+ --xc[i];
+ xc[j] += BASE;
+ }
+
+ xc[j] -= yc[j];
+ }
+
+ // Remove leading zeros and adjust exponent accordingly.
+ for (; xc[0] == 0; xc.splice(0, 1), --ye);
+
+ // Zero?
+ if (!xc[0]) {
+
+ // Following IEEE 754 (2008) 6.3,
+ // n - n = +0 but n - n = -0 when rounding towards -Infinity.
+ y.s = ROUNDING_MODE == 3 ? -1 : 1;
+ y.c = [y.e = 0];
+ return y;
+ }
+
+ // No need to check for Infinity as +x - +y != Infinity && -x - -y != Infinity
+ // for finite x and y.
+ return normalise(y, xc, ye);
+ };
+
+
+ /*
+ * n % 0 = N
+ * n % N = N
+ * n % I = n
+ * 0 % n = 0
+ * -0 % n = -0
+ * 0 % 0 = N
+ * 0 % N = N
+ * 0 % I = 0
+ * N % n = N
+ * N % 0 = N
+ * N % N = N
+ * N % I = N
+ * I % n = N
+ * I % 0 = N
+ * I % N = N
+ * I % I = N
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber modulo the value of
+ * BigNumber(y, b). The result depends on the value of MODULO_MODE.
+ */
+ P.modulo = P.mod = function (y, b) {
+ var q, s,
+ x = this;
+
+ y = new BigNumber(y, b);
+
+ // Return NaN if x is Infinity or NaN, or y is NaN or zero.
+ if (!x.c || !y.s || y.c && !y.c[0]) {
+ return new BigNumber(NaN);
+
+ // Return x if y is Infinity or x is zero.
+ } else if (!y.c || x.c && !x.c[0]) {
+ return new BigNumber(x);
+ }
+
+ if (MODULO_MODE == 9) {
+
+ // Euclidian division: q = sign(y) * floor(x / abs(y))
+ // r = x - qy where 0 <= r < abs(y)
+ s = y.s;
+ y.s = 1;
+ q = div(x, y, 0, 3);
+ y.s = s;
+ q.s *= s;
+ } else {
+ q = div(x, y, 0, MODULO_MODE);
+ }
+
+ y = x.minus(q.times(y));
+
+ // To match JavaScript %, ensure sign of zero is sign of dividend.
+ if (!y.c[0] && MODULO_MODE == 1) y.s = x.s;
+
+ return y;
+ };
+
+
+ /*
+ * n * 0 = 0
+ * n * N = N
+ * n * I = I
+ * 0 * n = 0
+ * 0 * 0 = 0
+ * 0 * N = N
+ * 0 * I = N
+ * N * n = N
+ * N * 0 = N
+ * N * N = N
+ * N * I = N
+ * I * n = I
+ * I * 0 = N
+ * I * N = N
+ * I * I = I
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber multiplied by the value
+ * of BigNumber(y, b).
+ */
+ P.multipliedBy = P.times = function (y, b) {
+ var c, e, i, j, k, m, xcL, xlo, xhi, ycL, ylo, yhi, zc,
+ base, sqrtBase,
+ x = this,
+ xc = x.c,
+ yc = (y = new BigNumber(y, b)).c;
+
+ // Either NaN, ±Infinity or ±0?
+ if (!xc || !yc || !xc[0] || !yc[0]) {
+
+ // Return NaN if either is NaN, or one is 0 and the other is Infinity.
+ if (!x.s || !y.s || xc && !xc[0] && !yc || yc && !yc[0] && !xc) {
+ y.c = y.e = y.s = null;
+ } else {
+ y.s *= x.s;
+
+ // Return ±Infinity if either is ±Infinity.
+ if (!xc || !yc) {
+ y.c = y.e = null;
+
+ // Return ±0 if either is ±0.
+ } else {
+ y.c = [0];
+ y.e = 0;
+ }
+ }
+
+ return y;
+ }
+
+ e = bitFloor(x.e / LOG_BASE) + bitFloor(y.e / LOG_BASE);
+ y.s *= x.s;
+ xcL = xc.length;
+ ycL = yc.length;
+
+ // Ensure xc points to longer array and xcL to its length.
+ if (xcL < ycL) zc = xc, xc = yc, yc = zc, i = xcL, xcL = ycL, ycL = i;
+
+ // Initialise the result array with zeros.
+ for (i = xcL + ycL, zc = []; i--; zc.push(0));
+
+ base = BASE;
+ sqrtBase = SQRT_BASE;
+
+ for (i = ycL; --i >= 0;) {
+ c = 0;
+ ylo = yc[i] % sqrtBase;
+ yhi = yc[i] / sqrtBase | 0;
+
+ for (k = xcL, j = i + k; j > i;) {
+ xlo = xc[--k] % sqrtBase;
+ xhi = xc[k] / sqrtBase | 0;
+ m = yhi * xlo + xhi * ylo;
+ xlo = ylo * xlo + ((m % sqrtBase) * sqrtBase) + zc[j] + c;
+ c = (xlo / base | 0) + (m / sqrtBase | 0) + yhi * xhi;
+ zc[j--] = xlo % base;
+ }
+
+ zc[j] = c;
+ }
+
+ if (c) {
+ ++e;
+ } else {
+ zc.splice(0, 1);
+ }
+
+ return normalise(y, zc, e);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the value of this BigNumber negated,
+ * i.e. multiplied by -1.
+ */
+ P.negated = function () {
+ var x = new BigNumber(this);
+ x.s = -x.s || null;
+ return x;
+ };
+
+
+ /*
+ * n + 0 = n
+ * n + N = N
+ * n + I = I
+ * 0 + n = n
+ * 0 + 0 = 0
+ * 0 + N = N
+ * 0 + I = I
+ * N + n = N
+ * N + 0 = N
+ * N + N = N
+ * N + I = N
+ * I + n = I
+ * I + 0 = I
+ * I + N = N
+ * I + I = I
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber plus the value of
+ * BigNumber(y, b).
+ */
+ P.plus = function (y, b) {
+ var t,
+ x = this,
+ a = x.s;
+
+ y = new BigNumber(y, b);
+ b = y.s;
+
+ // Either NaN?
+ if (!a || !b) return new BigNumber(NaN);
+
+ // Signs differ?
+ if (a != b) {
+ y.s = -b;
+ return x.minus(y);
+ }
+
+ var xe = x.e / LOG_BASE,
+ ye = y.e / LOG_BASE,
+ xc = x.c,
+ yc = y.c;
+
+ if (!xe || !ye) {
+
+ // Return ±Infinity if either ±Infinity.
+ if (!xc || !yc) return new BigNumber(a / 0);
+
+ // Either zero?
+ // Return y if y is non-zero, x if x is non-zero, or zero if both are zero.
+ if (!xc[0] || !yc[0]) return yc[0] ? y : new BigNumber(xc[0] ? x : a * 0);
+ }
+
+ xe = bitFloor(xe);
+ ye = bitFloor(ye);
+ xc = xc.slice();
+
+ // Prepend zeros to equalise exponents. Faster to use reverse then do unshifts.
+ if (a = xe - ye) {
+ if (a > 0) {
+ ye = xe;
+ t = yc;
+ } else {
+ a = -a;
+ t = xc;
+ }
+
+ t.reverse();
+ for (; a--; t.push(0));
+ t.reverse();
+ }
+
+ a = xc.length;
+ b = yc.length;
+
+ // Point xc to the longer array, and b to the shorter length.
+ if (a - b < 0) t = yc, yc = xc, xc = t, b = a;
+
+ // Only start adding at yc.length - 1 as the further digits of xc can be ignored.
+ for (a = 0; b;) {
+ a = (xc[--b] = xc[b] + yc[b] + a) / BASE | 0;
+ xc[b] = BASE === xc[b] ? 0 : xc[b] % BASE;
+ }
+
+ if (a) {
+ xc = [a].concat(xc);
+ ++ye;
+ }
+
+ // No need to check for zero, as +x + +y != 0 && -x + -y != 0
+ // ye = MAX_EXP + 1 possible
+ return normalise(y, xc, ye);
+ };
+
+
+ /*
+ * If sd is undefined or null or true or false, return the number of significant digits of
+ * the value of this BigNumber, or null if the value of this BigNumber is ±Infinity or NaN.
+ * If sd is true include integer-part trailing zeros in the count.
+ *
+ * Otherwise, if sd is a number, return a new BigNumber whose value is the value of this
+ * BigNumber rounded to a maximum of sd significant digits using rounding mode rm, or
+ * ROUNDING_MODE if rm is omitted.
+ *
+ * sd {number|boolean} number: significant digits: integer, 1 to MAX inclusive.
+ * boolean: whether to count integer-part trailing zeros: true or false.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {sd|rm}'
+ */
+ P.precision = P.sd = function (sd, rm) {
+ var c, n, v,
+ x = this;
+
+ if (sd != null && sd !== !!sd) {
+ intCheck(sd, 1, MAX);
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+
+ return round(new BigNumber(x), sd, rm);
+ }
+
+ if (!(c = x.c)) return null;
+ v = c.length - 1;
+ n = v * LOG_BASE + 1;
+
+ if (v = c[v]) {
+
+ // Subtract the number of trailing zeros of the last element.
+ for (; v % 10 == 0; v /= 10, n--);
+
+ // Add the number of digits of the first element.
+ for (v = c[0]; v >= 10; v /= 10, n++);
+ }
+
+ if (sd && x.e + 1 > n) n = x.e + 1;
+
+ return n;
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the value of this BigNumber shifted by k places
+ * (powers of 10). Shift to the right if n > 0, and to the left if n < 0.
+ *
+ * k {number} Integer, -MAX_SAFE_INTEGER to MAX_SAFE_INTEGER inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {k}'
+ */
+ P.shiftedBy = function (k) {
+ intCheck(k, -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER);
+ return this.times('1e' + k);
+ };
+
+
+ /*
+ * sqrt(-n) = N
+ * sqrt(N) = N
+ * sqrt(-I) = N
+ * sqrt(I) = I
+ * sqrt(0) = 0
+ * sqrt(-0) = -0
+ *
+ * Return a new BigNumber whose value is the square root of the value of this BigNumber,
+ * rounded according to DECIMAL_PLACES and ROUNDING_MODE.
+ */
+ P.squareRoot = P.sqrt = function () {
+ var m, n, r, rep, t,
+ x = this,
+ c = x.c,
+ s = x.s,
+ e = x.e,
+ dp = DECIMAL_PLACES + 4,
+ half = new BigNumber('0.5');
+
+ // Negative/NaN/Infinity/zero?
+ if (s !== 1 || !c || !c[0]) {
+ return new BigNumber(!s || s < 0 && (!c || c[0]) ? NaN : c ? x : 1 / 0);
+ }
+
+ // Initial estimate.
+ s = Math.sqrt(+valueOf(x));
+
+ // Math.sqrt underflow/overflow?
+ // Pass x to Math.sqrt as integer, then adjust the exponent of the result.
+ if (s == 0 || s == 1 / 0) {
+ n = coeffToString(c);
+ if ((n.length + e) % 2 == 0) n += '0';
+ s = Math.sqrt(+n);
+ e = bitFloor((e + 1) / 2) - (e < 0 || e % 2);
+
+ if (s == 1 / 0) {
+ n = '1e' + e;
+ } else {
+ n = s.toExponential();
+ n = n.slice(0, n.indexOf('e') + 1) + e;
+ }
+
+ r = new BigNumber(n);
+ } else {
+ r = new BigNumber(s + '');
+ }
+
+ // Check for zero.
+ // r could be zero if MIN_EXP is changed after the this value was created.
+ // This would cause a division by zero (x/t) and hence Infinity below, which would cause
+ // coeffToString to throw.
+ if (r.c[0]) {
+ e = r.e;
+ s = e + dp;
+ if (s < 3) s = 0;
+
+ // Newton-Raphson iteration.
+ for (; ;) {
+ t = r;
+ r = half.times(t.plus(div(x, t, dp, 1)));
+
+ if (coeffToString(t.c).slice(0, s) === (n = coeffToString(r.c)).slice(0, s)) {
+
+ // The exponent of r may here be one less than the final result exponent,
+ // e.g 0.0009999 (e-4) --> 0.001 (e-3), so adjust s so the rounding digits
+ // are indexed correctly.
+ if (r.e < e) --s;
+ n = n.slice(s - 3, s + 1);
+
+ // The 4th rounding digit may be in error by -1 so if the 4 rounding digits
+ // are 9999 or 4999 (i.e. approaching a rounding boundary) continue the
+ // iteration.
+ if (n == '9999' || !rep && n == '4999') {
+
+ // On the first iteration only, check to see if rounding up gives the
+ // exact result as the nines may infinitely repeat.
+ if (!rep) {
+ round(t, t.e + DECIMAL_PLACES + 2, 0);
+
+ if (t.times(t).eq(x)) {
+ r = t;
+ break;
+ }
+ }
+
+ dp += 4;
+ s += 4;
+ rep = 1;
+ } else {
+
+ // If rounding digits are null, 0{0,4} or 50{0,3}, check for exact
+ // result. If not, then there are further digits and m will be truthy.
+ if (!+n || !+n.slice(1) && n.charAt(0) == '5') {
+
+ // Truncate to the first rounding digit.
+ round(r, r.e + DECIMAL_PLACES + 2, 1);
+ m = !r.times(r).eq(x);
+ }
+
+ break;
+ }
+ }
+ }
+ }
+
+ return round(r, r.e + DECIMAL_PLACES + 1, ROUNDING_MODE, m);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in exponential notation and
+ * rounded using ROUNDING_MODE to dp fixed decimal places.
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ */
+ P.toExponential = function (dp, rm) {
+ if (dp != null) {
+ intCheck(dp, 0, MAX);
+ dp++;
+ }
+ return format(this, dp, rm, 1);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in fixed-point notation rounding
+ * to dp fixed decimal places using rounding mode rm, or ROUNDING_MODE if rm is omitted.
+ *
+ * Note: as with JavaScript's number type, (-0).toFixed(0) is '0',
+ * but e.g. (-0.00001).toFixed(0) is '-0'.
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ */
+ P.toFixed = function (dp, rm) {
+ if (dp != null) {
+ intCheck(dp, 0, MAX);
+ dp = dp + this.e + 1;
+ }
+ return format(this, dp, rm);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in fixed-point notation rounded
+ * using rm or ROUNDING_MODE to dp decimal places, and formatted according to the properties
+ * of the format or FORMAT object (see BigNumber.set).
+ *
+ * The formatting object may contain some or all of the properties shown below.
+ *
+ * FORMAT = {
+ * prefix: '',
+ * groupSize: 3,
+ * secondaryGroupSize: 0,
+ * groupSeparator: ',',
+ * decimalSeparator: '.',
+ * fractionGroupSize: 0,
+ * fractionGroupSeparator: '\xA0', // non-breaking space
+ * suffix: ''
+ * };
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ * [format] {object} Formatting options. See FORMAT pbject above.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ * '[BigNumber Error] Argument not an object: {format}'
+ */
+ P.toFormat = function (dp, rm, format) {
+ var str,
+ x = this;
+
+ if (format == null) {
+ if (dp != null && rm && typeof rm == 'object') {
+ format = rm;
+ rm = null;
+ } else if (dp && typeof dp == 'object') {
+ format = dp;
+ dp = rm = null;
+ } else {
+ format = FORMAT;
+ }
+ } else if (typeof format != 'object') {
+ throw Error
+ (bignumberError + 'Argument not an object: ' + format);
+ }
+
+ str = x.toFixed(dp, rm);
+
+ if (x.c) {
+ var i,
+ arr = str.split('.'),
+ g1 = +format.groupSize,
+ g2 = +format.secondaryGroupSize,
+ groupSeparator = format.groupSeparator || '',
+ intPart = arr[0],
+ fractionPart = arr[1],
+ isNeg = x.s < 0,
+ intDigits = isNeg ? intPart.slice(1) : intPart,
+ len = intDigits.length;
+
+ if (g2) i = g1, g1 = g2, g2 = i, len -= i;
+
+ if (g1 > 0 && len > 0) {
+ i = len % g1 || g1;
+ intPart = intDigits.substr(0, i);
+ for (; i < len; i += g1) intPart += groupSeparator + intDigits.substr(i, g1);
+ if (g2 > 0) intPart += groupSeparator + intDigits.slice(i);
+ if (isNeg) intPart = '-' + intPart;
+ }
+
+ str = fractionPart
+ ? intPart + (format.decimalSeparator || '') + ((g2 = +format.fractionGroupSize)
+ ? fractionPart.replace(new RegExp('\\d{' + g2 + '}\\B', 'g'),
+ '$&' + (format.fractionGroupSeparator || ''))
+ : fractionPart)
+ : intPart;
+ }
+
+ return (format.prefix || '') + str + (format.suffix || '');
+ };
+
+
+ /*
+ * Return an array of two BigNumbers representing the value of this BigNumber as a simple
+ * fraction with an integer numerator and an integer denominator.
+ * The denominator will be a positive non-zero value less than or equal to the specified
+ * maximum denominator. If a maximum denominator is not specified, the denominator will be
+ * the lowest value necessary to represent the number exactly.
+ *
+ * [md] {number|string|BigNumber} Integer >= 1, or Infinity. The maximum denominator.
+ *
+ * '[BigNumber Error] Argument {not an integer|out of range} : {md}'
+ */
+ P.toFraction = function (md) {
+ var d, d0, d1, d2, e, exp, n, n0, n1, q, r, s,
+ x = this,
+ xc = x.c;
+
+ if (md != null) {
+ n = new BigNumber(md);
+
+ // Throw if md is less than one or is not an integer, unless it is Infinity.
+ if (!n.isInteger() && (n.c || n.s !== 1) || n.lt(ONE)) {
+ throw Error
+ (bignumberError + 'Argument ' +
+ (n.isInteger() ? 'out of range: ' : 'not an integer: ') + valueOf(n));
+ }
+ }
+
+ if (!xc) return new BigNumber(x);
+
+ d = new BigNumber(ONE);
+ n1 = d0 = new BigNumber(ONE);
+ d1 = n0 = new BigNumber(ONE);
+ s = coeffToString(xc);
+
+ // Determine initial denominator.
+ // d is a power of 10 and the minimum max denominator that specifies the value exactly.
+ e = d.e = s.length - x.e - 1;
+ d.c[0] = POWS_TEN[(exp = e % LOG_BASE) < 0 ? LOG_BASE + exp : exp];
+ md = !md || n.comparedTo(d) > 0 ? (e > 0 ? d : n1) : n;
+
+ exp = MAX_EXP;
+ MAX_EXP = 1 / 0;
+ n = new BigNumber(s);
+
+ // n0 = d1 = 0
+ n0.c[0] = 0;
+
+ for (; ;) {
+ q = div(n, d, 0, 1);
+ d2 = d0.plus(q.times(d1));
+ if (d2.comparedTo(md) == 1) break;
+ d0 = d1;
+ d1 = d2;
+ n1 = n0.plus(q.times(d2 = n1));
+ n0 = d2;
+ d = n.minus(q.times(d2 = d));
+ n = d2;
+ }
+
+ d2 = div(md.minus(d0), d1, 0, 1);
+ n0 = n0.plus(d2.times(n1));
+ d0 = d0.plus(d2.times(d1));
+ n0.s = n1.s = x.s;
+ e = e * 2;
+
+ // Determine which fraction is closer to x, n0/d0 or n1/d1
+ r = div(n1, d1, e, ROUNDING_MODE).minus(x).abs().comparedTo(
+ div(n0, d0, e, ROUNDING_MODE).minus(x).abs()) < 1 ? [n1, d1] : [n0, d0];
+
+ MAX_EXP = exp;
+
+ return r;
+ };
+
+
+ /*
+ * Return the value of this BigNumber converted to a number primitive.
+ */
+ P.toNumber = function () {
+ return +valueOf(this);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber rounded to sd significant digits
+ * using rounding mode rm or ROUNDING_MODE. If sd is less than the number of digits
+ * necessary to represent the integer part of the value in fixed-point notation, then use
+ * exponential notation.
+ *
+ * [sd] {number} Significant digits. Integer, 1 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {sd|rm}'
+ */
+ P.toPrecision = function (sd, rm) {
+ if (sd != null) intCheck(sd, 1, MAX);
+ return format(this, sd, rm, 2);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in base b, or base 10 if b is
+ * omitted. If a base is specified, including base 10, round according to DECIMAL_PLACES and
+ * ROUNDING_MODE. If a base is not specified, and this BigNumber has a positive exponent
+ * that is equal to or greater than TO_EXP_POS, or a negative exponent equal to or less than
+ * TO_EXP_NEG, return exponential notation.
+ *
+ * [b] {number} Integer, 2 to ALPHABET.length inclusive.
+ *
+ * '[BigNumber Error] Base {not a primitive number|not an integer|out of range}: {b}'
+ */
+ P.toString = function (b) {
+ var str,
+ n = this,
+ s = n.s,
+ e = n.e;
+
+ // Infinity or NaN?
+ if (e === null) {
+ if (s) {
+ str = 'Infinity';
+ if (s < 0) str = '-' + str;
+ } else {
+ str = 'NaN';
+ }
+ } else {
+ if (b == null) {
+ str = e <= TO_EXP_NEG || e >= TO_EXP_POS
+ ? toExponential(coeffToString(n.c), e)
+ : toFixedPoint(coeffToString(n.c), e, '0');
+ } else if (b === 10) {
+ n = round(new BigNumber(n), DECIMAL_PLACES + e + 1, ROUNDING_MODE);
+ str = toFixedPoint(coeffToString(n.c), n.e, '0');
+ } else {
+ intCheck(b, 2, ALPHABET.length, 'Base');
+ str = convertBase(toFixedPoint(coeffToString(n.c), e, '0'), 10, b, s, true);
+ }
+
+ if (s < 0 && n.c[0]) str = '-' + str;
+ }
+
+ return str;
+ };
+
+
+ /*
+ * Return as toString, but do not accept a base argument, and include the minus sign for
+ * negative zero.
+ */
+ P.valueOf = P.toJSON = function () {
+ return valueOf(this);
+ };
+
+
+ P._isBigNumber = true;
+
+ if (configObject != null) BigNumber.set(configObject);
+
+ return BigNumber;
+ }
+
+
+ // PRIVATE HELPER FUNCTIONS
+
+ // These functions don't need access to variables,
+ // e.g. DECIMAL_PLACES, in the scope of the `clone` function above.
+
+
+ function bitFloor(n) {
+ var i = n | 0;
+ return n > 0 || n === i ? i : i - 1;
+ }
+
+
+ // Return a coefficient array as a string of base 10 digits.
+ function coeffToString(a) {
+ var s, z,
+ i = 1,
+ j = a.length,
+ r = a[0] + '';
+
+ for (; i < j;) {
+ s = a[i++] + '';
+ z = LOG_BASE - s.length;
+ for (; z--; s = '0' + s);
+ r += s;
+ }
+
+ // Determine trailing zeros.
+ for (j = r.length; r.charCodeAt(--j) === 48;);
+
+ return r.slice(0, j + 1 || 1);
+ }
+
+
+ // Compare the value of BigNumbers x and y.
+ function compare(x, y) {
+ var a, b,
+ xc = x.c,
+ yc = y.c,
+ i = x.s,
+ j = y.s,
+ k = x.e,
+ l = y.e;
+
+ // Either NaN?
+ if (!i || !j) return null;
+
+ a = xc && !xc[0];
+ b = yc && !yc[0];
+
+ // Either zero?
+ if (a || b) return a ? b ? 0 : -j : i;
+
+ // Signs differ?
+ if (i != j) return i;
+
+ a = i < 0;
+ b = k == l;
+
+ // Either Infinity?
+ if (!xc || !yc) return b ? 0 : !xc ^ a ? 1 : -1;
+
+ // Compare exponents.
+ if (!b) return k > l ^ a ? 1 : -1;
+
+ j = (k = xc.length) < (l = yc.length) ? k : l;
+
+ // Compare digit by digit.
+ for (i = 0; i < j; i++) if (xc[i] != yc[i]) return xc[i] > yc[i] ^ a ? 1 : -1;
+
+ // Compare lengths.
+ return k == l ? 0 : k > l ^ a ? 1 : -1;
+ }
+
+
+ /*
+ * Check that n is a primitive number, an integer, and in range, otherwise throw.
+ */
+ function intCheck(n, min, max, name) {
+ if (n < min || n > max || n !== mathfloor(n)) {
+ throw Error
+ (bignumberError + (name || 'Argument') + (typeof n == 'number'
+ ? n < min || n > max ? ' out of range: ' : ' not an integer: '
+ : ' not a primitive number: ') + String(n));
+ }
+ }
+
+
+ // Assumes finite n.
+ function isOdd(n) {
+ var k = n.c.length - 1;
+ return bitFloor(n.e / LOG_BASE) == k && n.c[k] % 2 != 0;
+ }
+
+
+ function toExponential(str, e) {
+ return (str.length > 1 ? str.charAt(0) + '.' + str.slice(1) : str) +
+ (e < 0 ? 'e' : 'e+') + e;
+ }
+
+
+ function toFixedPoint(str, e, z) {
+ var len, zs;
+
+ // Negative exponent?
+ if (e < 0) {
+
+ // Prepend zeros.
+ for (zs = z + '.'; ++e; zs += z);
+ str = zs + str;
+
+ // Positive exponent
+ } else {
+ len = str.length;
+
+ // Append zeros.
+ if (++e > len) {
+ for (zs = z, e -= len; --e; zs += z);
+ str += zs;
+ } else if (e < len) {
+ str = str.slice(0, e) + '.' + str.slice(e);
+ }
+ }
+
+ return str;
+ }
+
+
+ // EXPORT
+
+
+ BigNumber = clone();
+ BigNumber['default'] = BigNumber.BigNumber = BigNumber;
+
+ // AMD.
+ if (typeof define == 'function' && define.amd) {
+ define(function () { return BigNumber; });
+
+ // Node.js and other environments that support module.exports.
+ } else if (typeof module != 'undefined' && module.exports) {
+ module.exports = BigNumber;
+
+ // Browser.
+ } else {
+ if (!globalObject) {
+ globalObject = typeof self != 'undefined' && self ? self : window;
+ }
+
+ globalObject.BigNumber = BigNumber;
+ }
+})(this);
diff --git a/node_modules/bignumber.js/bignumber.min.js b/node_modules/bignumber.js/bignumber.min.js
new file mode 100644
index 0000000..2610072
--- /dev/null
+++ b/node_modules/bignumber.js/bignumber.min.js
@@ -0,0 +1 @@
+/* bignumber.js v9.0.0 https://github.com/MikeMcl/bignumber.js/LICENCE */!function(e){"use strict";var r,x=/^-?(?:\d+(?:\.\d*)?|\.\d+)(?:e[+-]?\d+)?$/i,L=Math.ceil,U=Math.floor,I="[BigNumber Error] ",T=I+"Number primitive has more than 15 significant digits: ",C=1e14,M=14,G=9007199254740991,k=[1,10,100,1e3,1e4,1e5,1e6,1e7,1e8,1e9,1e10,1e11,1e12,1e13],F=1e7,q=1e9;function j(e){var r=0|e;return 0o[s]^n?1:-1;return u==l?0:l(t=e.length)){for(i=n,r-=t;--r;i+=n);e+=i}else ry?c.c=c.e=null:e.ey)c.c=c.e=null;else if(oy?e.c=e.e=null:e.c=n=a.length){if(!t)break e;for(;a.length<=l;a.push(0));u=c=0,s=(o%=M)-M+(i=1)}else{for(u=f=a[l],i=1;10<=f;f/=10,i++);c=(s=(o%=M)-M+i)<0?0:u/h[i-s-1]%10|0}if(t=t||r<0||null!=a[l+1]||(s<0?u:u%h[i-s-1]),t=n<4?(c||t)&&(0==n||n==(e.s<0?3:2)):5y?e.c=e.e=null:e.e>>11))?(n=crypto.getRandomValues(new Uint32Array(2)),r[s]=n[0],r[s+1]=n[1]):(f.push(o%1e14),s+=2);s=i/2}else{if(!crypto.randomBytes)throw b=!1,Error(I+"crypto unavailable");for(r=crypto.randomBytes(i*=7);sn-1&&(null==s[i+1]&&(s[i+1]=0),s[i+1]+=s[i]/n|0,s[i]%=n)}return s.reverse()}return function(e,r,n,t,i){var o,s,f,u,l,c,a,h,g=e.indexOf("."),p=N,w=O;for(0<=g&&(u=E,E=0,e=e.replace(".",""),c=(h=new B(r)).pow(e.length-g),E=u,h.c=m(X($(c.c),c.e,"0"),10,n,d),h.e=h.c.length),f=u=(a=m(e,r,n,i?(o=S,d):(o=d,S))).length;0==a[--u];a.pop());if(!a[0])return o.charAt(0);if(g<0?--f:(c.c=a,c.e=f,c.s=t,a=(c=v(c,h,p,w,n)).c,l=c.r,f=c.e),g=a[s=f+p+1],u=n/2,l=l||s<0||null!=a[s+1],l=w<4?(null!=g||l)&&(0==w||w==(c.s<0?3:2)):un;)a[s]=0,s||(++f,a=[1].concat(a));for(u=a.length;!a[--u];);for(g=0,e="";g<=u;e+=o.charAt(a[g++]));e=X(e,f,o.charAt(0))}return e}}(),v=function(){function S(e,r,n){var t,i,o,s,f=0,u=e.length,l=r%F,c=r/F|0;for(e=e.slice();u--;)f=((i=l*(o=e[u]%F)+(t=c*o+(s=e[u]/F|0)*l)%F*F+f)/n|0)+(t/F|0)+c*s,e[u]=i%n;return f&&(e=[f].concat(e)),e}function R(e,r,n,t){var i,o;if(n!=t)o=tr[i]?1:-1;break}return o}function _(e,r,n,t){for(var i=0;n--;)e[n]-=i,i=e[n](E[f]||0)&&s--,b<0)g.push(1),u=!0;else{for(v=E.length,O=A.length,b+=2,1<(l=U(i/(A[f=0]+1)))&&(A=S(A,l,i),E=S(E,l,i),O=A.length,v=E.length),m=O,w=(p=E.slice(0,O)).length;w=i/2&&N++;do{if(l=0,(o=R(A,p,O,w))<0){if(d=p[0],O!=w&&(d=d*i+(p[1]||0)),1<(l=U(d/N)))for(i<=l&&(l=i-1),a=(c=S(A,l,i)).length,w=p.length;1==R(c,p,a,w);)l--,_(c,Oo&&(l.c.length=o):t&&(l=l.mod(r))}if(i){if(0===(i=U(i/2)))break;u=i%2}else if(D(e=e.times(n),e.e+1,1),14o&&(c.c.length=o):t&&(c=c.mod(r))}return t?l:(f&&(l=w.div(l)),r?l.mod(r):o?D(l,E,O,void 0):l)},t.integerValue=function(e){var r=new B(this);return null==e?e=O:H(e,0,8),D(r,r.e+1,e)},t.isEqualTo=t.eq=function(e,r){return 0===z(this,new B(e,r))},t.isFinite=function(){return!!this.c},t.isGreaterThan=t.gt=function(e,r){return 0this.c.length-2},t.isLessThan=t.lt=function(e,r){return z(this,new B(e,r))<0},t.isLessThanOrEqualTo=t.lte=function(e,r){return-1===(r=z(this,new B(e,r)))||0===r},t.isNaN=function(){return!this.s},t.isNegative=function(){return this.s<0},t.isPositive=function(){return 0t&&(t=this.e+1),t},t.shiftedBy=function(e){return H(e,-G,G),this.times("1e"+e)},t.squareRoot=t.sqrt=function(){var e,r,n,t,i,o=this,s=o.c,f=o.s,u=o.e,l=N+4,c=new B("0.5");if(1!==f||!s||!s[0])return new B(!f||f<0&&(!s||s[0])?NaN:s?o:1/0);if((n=0==(f=Math.sqrt(+P(o)))||f==1/0?(((r=$(s)).length+u)%2==0&&(r+="0"),f=Math.sqrt(+r),u=j((u+1)/2)-(u<0||u%2),new B(r=f==1/0?"1e"+u:(r=f.toExponential()).slice(0,r.indexOf("e")+1)+u)):new B(f+"")).c[0])for((f=(u=n.e)+l)<3&&(f=0);;)if(i=n,n=c.times(i.plus(v(o,i,l,1))),$(i.c).slice(0,f)===(r=$(n.c)).slice(0,f)){if(n.e
+ * MIT Licensed.
+ *
+ * BigNumber.prototype methods | BigNumber methods
+ * |
+ * absoluteValue abs | clone
+ * comparedTo | config set
+ * decimalPlaces dp | DECIMAL_PLACES
+ * dividedBy div | ROUNDING_MODE
+ * dividedToIntegerBy idiv | EXPONENTIAL_AT
+ * exponentiatedBy pow | RANGE
+ * integerValue | CRYPTO
+ * isEqualTo eq | MODULO_MODE
+ * isFinite | POW_PRECISION
+ * isGreaterThan gt | FORMAT
+ * isGreaterThanOrEqualTo gte | ALPHABET
+ * isInteger | isBigNumber
+ * isLessThan lt | maximum max
+ * isLessThanOrEqualTo lte | minimum min
+ * isNaN | random
+ * isNegative | sum
+ * isPositive |
+ * isZero |
+ * minus |
+ * modulo mod |
+ * multipliedBy times |
+ * negated |
+ * plus |
+ * precision sd |
+ * shiftedBy |
+ * squareRoot sqrt |
+ * toExponential |
+ * toFixed |
+ * toFormat |
+ * toFraction |
+ * toJSON |
+ * toNumber |
+ * toPrecision |
+ * toString |
+ * valueOf |
+ *
+ */
+
+
+var
+ isNumeric = /^-?(?:\d+(?:\.\d*)?|\.\d+)(?:e[+-]?\d+)?$/i,
+
+ mathceil = Math.ceil,
+ mathfloor = Math.floor,
+
+ bignumberError = '[BigNumber Error] ',
+ tooManyDigits = bignumberError + 'Number primitive has more than 15 significant digits: ',
+
+ BASE = 1e14,
+ LOG_BASE = 14,
+ MAX_SAFE_INTEGER = 0x1fffffffffffff, // 2^53 - 1
+ // MAX_INT32 = 0x7fffffff, // 2^31 - 1
+ POWS_TEN = [1, 10, 100, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, 1e10, 1e11, 1e12, 1e13],
+ SQRT_BASE = 1e7,
+
+ // EDITABLE
+ // The limit on the value of DECIMAL_PLACES, TO_EXP_NEG, TO_EXP_POS, MIN_EXP, MAX_EXP, and
+ // the arguments to toExponential, toFixed, toFormat, and toPrecision.
+ MAX = 1E9; // 0 to MAX_INT32
+
+
+/*
+ * Create and return a BigNumber constructor.
+ */
+function clone(configObject) {
+ var div, convertBase, parseNumeric,
+ P = BigNumber.prototype = { constructor: BigNumber, toString: null, valueOf: null },
+ ONE = new BigNumber(1),
+
+
+ //----------------------------- EDITABLE CONFIG DEFAULTS -------------------------------
+
+
+ // The default values below must be integers within the inclusive ranges stated.
+ // The values can also be changed at run-time using BigNumber.set.
+
+ // The maximum number of decimal places for operations involving division.
+ DECIMAL_PLACES = 20, // 0 to MAX
+
+ // The rounding mode used when rounding to the above decimal places, and when using
+ // toExponential, toFixed, toFormat and toPrecision, and round (default value).
+ // UP 0 Away from zero.
+ // DOWN 1 Towards zero.
+ // CEIL 2 Towards +Infinity.
+ // FLOOR 3 Towards -Infinity.
+ // HALF_UP 4 Towards nearest neighbour. If equidistant, up.
+ // HALF_DOWN 5 Towards nearest neighbour. If equidistant, down.
+ // HALF_EVEN 6 Towards nearest neighbour. If equidistant, towards even neighbour.
+ // HALF_CEIL 7 Towards nearest neighbour. If equidistant, towards +Infinity.
+ // HALF_FLOOR 8 Towards nearest neighbour. If equidistant, towards -Infinity.
+ ROUNDING_MODE = 4, // 0 to 8
+
+ // EXPONENTIAL_AT : [TO_EXP_NEG , TO_EXP_POS]
+
+ // The exponent value at and beneath which toString returns exponential notation.
+ // Number type: -7
+ TO_EXP_NEG = -7, // 0 to -MAX
+
+ // The exponent value at and above which toString returns exponential notation.
+ // Number type: 21
+ TO_EXP_POS = 21, // 0 to MAX
+
+ // RANGE : [MIN_EXP, MAX_EXP]
+
+ // The minimum exponent value, beneath which underflow to zero occurs.
+ // Number type: -324 (5e-324)
+ MIN_EXP = -1e7, // -1 to -MAX
+
+ // The maximum exponent value, above which overflow to Infinity occurs.
+ // Number type: 308 (1.7976931348623157e+308)
+ // For MAX_EXP > 1e7, e.g. new BigNumber('1e100000000').plus(1) may be slow.
+ MAX_EXP = 1e7, // 1 to MAX
+
+ // Whether to use cryptographically-secure random number generation, if available.
+ CRYPTO = false, // true or false
+
+ // The modulo mode used when calculating the modulus: a mod n.
+ // The quotient (q = a / n) is calculated according to the corresponding rounding mode.
+ // The remainder (r) is calculated as: r = a - n * q.
+ //
+ // UP 0 The remainder is positive if the dividend is negative, else is negative.
+ // DOWN 1 The remainder has the same sign as the dividend.
+ // This modulo mode is commonly known as 'truncated division' and is
+ // equivalent to (a % n) in JavaScript.
+ // FLOOR 3 The remainder has the same sign as the divisor (Python %).
+ // HALF_EVEN 6 This modulo mode implements the IEEE 754 remainder function.
+ // EUCLID 9 Euclidian division. q = sign(n) * floor(a / abs(n)).
+ // The remainder is always positive.
+ //
+ // The truncated division, floored division, Euclidian division and IEEE 754 remainder
+ // modes are commonly used for the modulus operation.
+ // Although the other rounding modes can also be used, they may not give useful results.
+ MODULO_MODE = 1, // 0 to 9
+
+ // The maximum number of significant digits of the result of the exponentiatedBy operation.
+ // If POW_PRECISION is 0, there will be unlimited significant digits.
+ POW_PRECISION = 0, // 0 to MAX
+
+ // The format specification used by the BigNumber.prototype.toFormat method.
+ FORMAT = {
+ prefix: '',
+ groupSize: 3,
+ secondaryGroupSize: 0,
+ groupSeparator: ',',
+ decimalSeparator: '.',
+ fractionGroupSize: 0,
+ fractionGroupSeparator: '\xA0', // non-breaking space
+ suffix: ''
+ },
+
+ // The alphabet used for base conversion. It must be at least 2 characters long, with no '+',
+ // '-', '.', whitespace, or repeated character.
+ // '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_'
+ ALPHABET = '0123456789abcdefghijklmnopqrstuvwxyz';
+
+
+ //------------------------------------------------------------------------------------------
+
+
+ // CONSTRUCTOR
+
+
+ /*
+ * The BigNumber constructor and exported function.
+ * Create and return a new instance of a BigNumber object.
+ *
+ * v {number|string|BigNumber} A numeric value.
+ * [b] {number} The base of v. Integer, 2 to ALPHABET.length inclusive.
+ */
+ function BigNumber(v, b) {
+ var alphabet, c, caseChanged, e, i, isNum, len, str,
+ x = this;
+
+ // Enable constructor call without `new`.
+ if (!(x instanceof BigNumber)) return new BigNumber(v, b);
+
+ if (b == null) {
+
+ if (v && v._isBigNumber === true) {
+ x.s = v.s;
+
+ if (!v.c || v.e > MAX_EXP) {
+ x.c = x.e = null;
+ } else if (v.e < MIN_EXP) {
+ x.c = [x.e = 0];
+ } else {
+ x.e = v.e;
+ x.c = v.c.slice();
+ }
+
+ return;
+ }
+
+ if ((isNum = typeof v == 'number') && v * 0 == 0) {
+
+ // Use `1 / n` to handle minus zero also.
+ x.s = 1 / v < 0 ? (v = -v, -1) : 1;
+
+ // Fast path for integers, where n < 2147483648 (2**31).
+ if (v === ~~v) {
+ for (e = 0, i = v; i >= 10; i /= 10, e++);
+
+ if (e > MAX_EXP) {
+ x.c = x.e = null;
+ } else {
+ x.e = e;
+ x.c = [v];
+ }
+
+ return;
+ }
+
+ str = String(v);
+ } else {
+
+ if (!isNumeric.test(str = String(v))) return parseNumeric(x, str, isNum);
+
+ x.s = str.charCodeAt(0) == 45 ? (str = str.slice(1), -1) : 1;
+ }
+
+ // Decimal point?
+ if ((e = str.indexOf('.')) > -1) str = str.replace('.', '');
+
+ // Exponential form?
+ if ((i = str.search(/e/i)) > 0) {
+
+ // Determine exponent.
+ if (e < 0) e = i;
+ e += +str.slice(i + 1);
+ str = str.substring(0, i);
+ } else if (e < 0) {
+
+ // Integer.
+ e = str.length;
+ }
+
+ } else {
+
+ // '[BigNumber Error] Base {not a primitive number|not an integer|out of range}: {b}'
+ intCheck(b, 2, ALPHABET.length, 'Base');
+
+ // Allow exponential notation to be used with base 10 argument, while
+ // also rounding to DECIMAL_PLACES as with other bases.
+ if (b == 10) {
+ x = new BigNumber(v);
+ return round(x, DECIMAL_PLACES + x.e + 1, ROUNDING_MODE);
+ }
+
+ str = String(v);
+
+ if (isNum = typeof v == 'number') {
+
+ // Avoid potential interpretation of Infinity and NaN as base 44+ values.
+ if (v * 0 != 0) return parseNumeric(x, str, isNum, b);
+
+ x.s = 1 / v < 0 ? (str = str.slice(1), -1) : 1;
+
+ // '[BigNumber Error] Number primitive has more than 15 significant digits: {n}'
+ if (BigNumber.DEBUG && str.replace(/^0\.0*|\./, '').length > 15) {
+ throw Error
+ (tooManyDigits + v);
+ }
+ } else {
+ x.s = str.charCodeAt(0) === 45 ? (str = str.slice(1), -1) : 1;
+ }
+
+ alphabet = ALPHABET.slice(0, b);
+ e = i = 0;
+
+ // Check that str is a valid base b number.
+ // Don't use RegExp, so alphabet can contain special characters.
+ for (len = str.length; i < len; i++) {
+ if (alphabet.indexOf(c = str.charAt(i)) < 0) {
+ if (c == '.') {
+
+ // If '.' is not the first character and it has not be found before.
+ if (i > e) {
+ e = len;
+ continue;
+ }
+ } else if (!caseChanged) {
+
+ // Allow e.g. hexadecimal 'FF' as well as 'ff'.
+ if (str == str.toUpperCase() && (str = str.toLowerCase()) ||
+ str == str.toLowerCase() && (str = str.toUpperCase())) {
+ caseChanged = true;
+ i = -1;
+ e = 0;
+ continue;
+ }
+ }
+
+ return parseNumeric(x, String(v), isNum, b);
+ }
+ }
+
+ // Prevent later check for length on converted number.
+ isNum = false;
+ str = convertBase(str, b, 10, x.s);
+
+ // Decimal point?
+ if ((e = str.indexOf('.')) > -1) str = str.replace('.', '');
+ else e = str.length;
+ }
+
+ // Determine leading zeros.
+ for (i = 0; str.charCodeAt(i) === 48; i++);
+
+ // Determine trailing zeros.
+ for (len = str.length; str.charCodeAt(--len) === 48;);
+
+ if (str = str.slice(i, ++len)) {
+ len -= i;
+
+ // '[BigNumber Error] Number primitive has more than 15 significant digits: {n}'
+ if (isNum && BigNumber.DEBUG &&
+ len > 15 && (v > MAX_SAFE_INTEGER || v !== mathfloor(v))) {
+ throw Error
+ (tooManyDigits + (x.s * v));
+ }
+
+ // Overflow?
+ if ((e = e - i - 1) > MAX_EXP) {
+
+ // Infinity.
+ x.c = x.e = null;
+
+ // Underflow?
+ } else if (e < MIN_EXP) {
+
+ // Zero.
+ x.c = [x.e = 0];
+ } else {
+ x.e = e;
+ x.c = [];
+
+ // Transform base
+
+ // e is the base 10 exponent.
+ // i is where to slice str to get the first element of the coefficient array.
+ i = (e + 1) % LOG_BASE;
+ if (e < 0) i += LOG_BASE; // i < 1
+
+ if (i < len) {
+ if (i) x.c.push(+str.slice(0, i));
+
+ for (len -= LOG_BASE; i < len;) {
+ x.c.push(+str.slice(i, i += LOG_BASE));
+ }
+
+ i = LOG_BASE - (str = str.slice(i)).length;
+ } else {
+ i -= len;
+ }
+
+ for (; i--; str += '0');
+ x.c.push(+str);
+ }
+ } else {
+
+ // Zero.
+ x.c = [x.e = 0];
+ }
+ }
+
+
+ // CONSTRUCTOR PROPERTIES
+
+
+ BigNumber.clone = clone;
+
+ BigNumber.ROUND_UP = 0;
+ BigNumber.ROUND_DOWN = 1;
+ BigNumber.ROUND_CEIL = 2;
+ BigNumber.ROUND_FLOOR = 3;
+ BigNumber.ROUND_HALF_UP = 4;
+ BigNumber.ROUND_HALF_DOWN = 5;
+ BigNumber.ROUND_HALF_EVEN = 6;
+ BigNumber.ROUND_HALF_CEIL = 7;
+ BigNumber.ROUND_HALF_FLOOR = 8;
+ BigNumber.EUCLID = 9;
+
+
+ /*
+ * Configure infrequently-changing library-wide settings.
+ *
+ * Accept an object with the following optional properties (if the value of a property is
+ * a number, it must be an integer within the inclusive range stated):
+ *
+ * DECIMAL_PLACES {number} 0 to MAX
+ * ROUNDING_MODE {number} 0 to 8
+ * EXPONENTIAL_AT {number|number[]} -MAX to MAX or [-MAX to 0, 0 to MAX]
+ * RANGE {number|number[]} -MAX to MAX (not zero) or [-MAX to -1, 1 to MAX]
+ * CRYPTO {boolean} true or false
+ * MODULO_MODE {number} 0 to 9
+ * POW_PRECISION {number} 0 to MAX
+ * ALPHABET {string} A string of two or more unique characters which does
+ * not contain '.'.
+ * FORMAT {object} An object with some of the following properties:
+ * prefix {string}
+ * groupSize {number}
+ * secondaryGroupSize {number}
+ * groupSeparator {string}
+ * decimalSeparator {string}
+ * fractionGroupSize {number}
+ * fractionGroupSeparator {string}
+ * suffix {string}
+ *
+ * (The values assigned to the above FORMAT object properties are not checked for validity.)
+ *
+ * E.g.
+ * BigNumber.config({ DECIMAL_PLACES : 20, ROUNDING_MODE : 4 })
+ *
+ * Ignore properties/parameters set to null or undefined, except for ALPHABET.
+ *
+ * Return an object with the properties current values.
+ */
+ BigNumber.config = BigNumber.set = function (obj) {
+ var p, v;
+
+ if (obj != null) {
+
+ if (typeof obj == 'object') {
+
+ // DECIMAL_PLACES {number} Integer, 0 to MAX inclusive.
+ // '[BigNumber Error] DECIMAL_PLACES {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'DECIMAL_PLACES')) {
+ v = obj[p];
+ intCheck(v, 0, MAX, p);
+ DECIMAL_PLACES = v;
+ }
+
+ // ROUNDING_MODE {number} Integer, 0 to 8 inclusive.
+ // '[BigNumber Error] ROUNDING_MODE {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'ROUNDING_MODE')) {
+ v = obj[p];
+ intCheck(v, 0, 8, p);
+ ROUNDING_MODE = v;
+ }
+
+ // EXPONENTIAL_AT {number|number[]}
+ // Integer, -MAX to MAX inclusive or
+ // [integer -MAX to 0 inclusive, 0 to MAX inclusive].
+ // '[BigNumber Error] EXPONENTIAL_AT {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'EXPONENTIAL_AT')) {
+ v = obj[p];
+ if (v && v.pop) {
+ intCheck(v[0], -MAX, 0, p);
+ intCheck(v[1], 0, MAX, p);
+ TO_EXP_NEG = v[0];
+ TO_EXP_POS = v[1];
+ } else {
+ intCheck(v, -MAX, MAX, p);
+ TO_EXP_NEG = -(TO_EXP_POS = v < 0 ? -v : v);
+ }
+ }
+
+ // RANGE {number|number[]} Non-zero integer, -MAX to MAX inclusive or
+ // [integer -MAX to -1 inclusive, integer 1 to MAX inclusive].
+ // '[BigNumber Error] RANGE {not a primitive number|not an integer|out of range|cannot be zero}: {v}'
+ if (obj.hasOwnProperty(p = 'RANGE')) {
+ v = obj[p];
+ if (v && v.pop) {
+ intCheck(v[0], -MAX, -1, p);
+ intCheck(v[1], 1, MAX, p);
+ MIN_EXP = v[0];
+ MAX_EXP = v[1];
+ } else {
+ intCheck(v, -MAX, MAX, p);
+ if (v) {
+ MIN_EXP = -(MAX_EXP = v < 0 ? -v : v);
+ } else {
+ throw Error
+ (bignumberError + p + ' cannot be zero: ' + v);
+ }
+ }
+ }
+
+ // CRYPTO {boolean} true or false.
+ // '[BigNumber Error] CRYPTO not true or false: {v}'
+ // '[BigNumber Error] crypto unavailable'
+ if (obj.hasOwnProperty(p = 'CRYPTO')) {
+ v = obj[p];
+ if (v === !!v) {
+ if (v) {
+ if (typeof crypto != 'undefined' && crypto &&
+ (crypto.getRandomValues || crypto.randomBytes)) {
+ CRYPTO = v;
+ } else {
+ CRYPTO = !v;
+ throw Error
+ (bignumberError + 'crypto unavailable');
+ }
+ } else {
+ CRYPTO = v;
+ }
+ } else {
+ throw Error
+ (bignumberError + p + ' not true or false: ' + v);
+ }
+ }
+
+ // MODULO_MODE {number} Integer, 0 to 9 inclusive.
+ // '[BigNumber Error] MODULO_MODE {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'MODULO_MODE')) {
+ v = obj[p];
+ intCheck(v, 0, 9, p);
+ MODULO_MODE = v;
+ }
+
+ // POW_PRECISION {number} Integer, 0 to MAX inclusive.
+ // '[BigNumber Error] POW_PRECISION {not a primitive number|not an integer|out of range}: {v}'
+ if (obj.hasOwnProperty(p = 'POW_PRECISION')) {
+ v = obj[p];
+ intCheck(v, 0, MAX, p);
+ POW_PRECISION = v;
+ }
+
+ // FORMAT {object}
+ // '[BigNumber Error] FORMAT not an object: {v}'
+ if (obj.hasOwnProperty(p = 'FORMAT')) {
+ v = obj[p];
+ if (typeof v == 'object') FORMAT = v;
+ else throw Error
+ (bignumberError + p + ' not an object: ' + v);
+ }
+
+ // ALPHABET {string}
+ // '[BigNumber Error] ALPHABET invalid: {v}'
+ if (obj.hasOwnProperty(p = 'ALPHABET')) {
+ v = obj[p];
+
+ // Disallow if only one character,
+ // or if it contains '+', '-', '.', whitespace, or a repeated character.
+ if (typeof v == 'string' && !/^.$|[+-.\s]|(.).*\1/.test(v)) {
+ ALPHABET = v;
+ } else {
+ throw Error
+ (bignumberError + p + ' invalid: ' + v);
+ }
+ }
+
+ } else {
+
+ // '[BigNumber Error] Object expected: {v}'
+ throw Error
+ (bignumberError + 'Object expected: ' + obj);
+ }
+ }
+
+ return {
+ DECIMAL_PLACES: DECIMAL_PLACES,
+ ROUNDING_MODE: ROUNDING_MODE,
+ EXPONENTIAL_AT: [TO_EXP_NEG, TO_EXP_POS],
+ RANGE: [MIN_EXP, MAX_EXP],
+ CRYPTO: CRYPTO,
+ MODULO_MODE: MODULO_MODE,
+ POW_PRECISION: POW_PRECISION,
+ FORMAT: FORMAT,
+ ALPHABET: ALPHABET
+ };
+ };
+
+
+ /*
+ * Return true if v is a BigNumber instance, otherwise return false.
+ *
+ * If BigNumber.DEBUG is true, throw if a BigNumber instance is not well-formed.
+ *
+ * v {any}
+ *
+ * '[BigNumber Error] Invalid BigNumber: {v}'
+ */
+ BigNumber.isBigNumber = function (v) {
+ if (!v || v._isBigNumber !== true) return false;
+ if (!BigNumber.DEBUG) return true;
+
+ var i, n,
+ c = v.c,
+ e = v.e,
+ s = v.s;
+
+ out: if ({}.toString.call(c) == '[object Array]') {
+
+ if ((s === 1 || s === -1) && e >= -MAX && e <= MAX && e === mathfloor(e)) {
+
+ // If the first element is zero, the BigNumber value must be zero.
+ if (c[0] === 0) {
+ if (e === 0 && c.length === 1) return true;
+ break out;
+ }
+
+ // Calculate number of digits that c[0] should have, based on the exponent.
+ i = (e + 1) % LOG_BASE;
+ if (i < 1) i += LOG_BASE;
+
+ // Calculate number of digits of c[0].
+ //if (Math.ceil(Math.log(c[0] + 1) / Math.LN10) == i) {
+ if (String(c[0]).length == i) {
+
+ for (i = 0; i < c.length; i++) {
+ n = c[i];
+ if (n < 0 || n >= BASE || n !== mathfloor(n)) break out;
+ }
+
+ // Last element cannot be zero, unless it is the only element.
+ if (n !== 0) return true;
+ }
+ }
+
+ // Infinity/NaN
+ } else if (c === null && e === null && (s === null || s === 1 || s === -1)) {
+ return true;
+ }
+
+ throw Error
+ (bignumberError + 'Invalid BigNumber: ' + v);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the maximum of the arguments.
+ *
+ * arguments {number|string|BigNumber}
+ */
+ BigNumber.maximum = BigNumber.max = function () {
+ return maxOrMin(arguments, P.lt);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the minimum of the arguments.
+ *
+ * arguments {number|string|BigNumber}
+ */
+ BigNumber.minimum = BigNumber.min = function () {
+ return maxOrMin(arguments, P.gt);
+ };
+
+
+ /*
+ * Return a new BigNumber with a random value equal to or greater than 0 and less than 1,
+ * and with dp, or DECIMAL_PLACES if dp is omitted, decimal places (or less if trailing
+ * zeros are produced).
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp}'
+ * '[BigNumber Error] crypto unavailable'
+ */
+ BigNumber.random = (function () {
+ var pow2_53 = 0x20000000000000;
+
+ // Return a 53 bit integer n, where 0 <= n < 9007199254740992.
+ // Check if Math.random() produces more than 32 bits of randomness.
+ // If it does, assume at least 53 bits are produced, otherwise assume at least 30 bits.
+ // 0x40000000 is 2^30, 0x800000 is 2^23, 0x1fffff is 2^21 - 1.
+ var random53bitInt = (Math.random() * pow2_53) & 0x1fffff
+ ? function () { return mathfloor(Math.random() * pow2_53); }
+ : function () { return ((Math.random() * 0x40000000 | 0) * 0x800000) +
+ (Math.random() * 0x800000 | 0); };
+
+ return function (dp) {
+ var a, b, e, k, v,
+ i = 0,
+ c = [],
+ rand = new BigNumber(ONE);
+
+ if (dp == null) dp = DECIMAL_PLACES;
+ else intCheck(dp, 0, MAX);
+
+ k = mathceil(dp / LOG_BASE);
+
+ if (CRYPTO) {
+
+ // Browsers supporting crypto.getRandomValues.
+ if (crypto.getRandomValues) {
+
+ a = crypto.getRandomValues(new Uint32Array(k *= 2));
+
+ for (; i < k;) {
+
+ // 53 bits:
+ // ((Math.pow(2, 32) - 1) * Math.pow(2, 21)).toString(2)
+ // 11111 11111111 11111111 11111111 11100000 00000000 00000000
+ // ((Math.pow(2, 32) - 1) >>> 11).toString(2)
+ // 11111 11111111 11111111
+ // 0x20000 is 2^21.
+ v = a[i] * 0x20000 + (a[i + 1] >>> 11);
+
+ // Rejection sampling:
+ // 0 <= v < 9007199254740992
+ // Probability that v >= 9e15, is
+ // 7199254740992 / 9007199254740992 ~= 0.0008, i.e. 1 in 1251
+ if (v >= 9e15) {
+ b = crypto.getRandomValues(new Uint32Array(2));
+ a[i] = b[0];
+ a[i + 1] = b[1];
+ } else {
+
+ // 0 <= v <= 8999999999999999
+ // 0 <= (v % 1e14) <= 99999999999999
+ c.push(v % 1e14);
+ i += 2;
+ }
+ }
+ i = k / 2;
+
+ // Node.js supporting crypto.randomBytes.
+ } else if (crypto.randomBytes) {
+
+ // buffer
+ a = crypto.randomBytes(k *= 7);
+
+ for (; i < k;) {
+
+ // 0x1000000000000 is 2^48, 0x10000000000 is 2^40
+ // 0x100000000 is 2^32, 0x1000000 is 2^24
+ // 11111 11111111 11111111 11111111 11111111 11111111 11111111
+ // 0 <= v < 9007199254740992
+ v = ((a[i] & 31) * 0x1000000000000) + (a[i + 1] * 0x10000000000) +
+ (a[i + 2] * 0x100000000) + (a[i + 3] * 0x1000000) +
+ (a[i + 4] << 16) + (a[i + 5] << 8) + a[i + 6];
+
+ if (v >= 9e15) {
+ crypto.randomBytes(7).copy(a, i);
+ } else {
+
+ // 0 <= (v % 1e14) <= 99999999999999
+ c.push(v % 1e14);
+ i += 7;
+ }
+ }
+ i = k / 7;
+ } else {
+ CRYPTO = false;
+ throw Error
+ (bignumberError + 'crypto unavailable');
+ }
+ }
+
+ // Use Math.random.
+ if (!CRYPTO) {
+
+ for (; i < k;) {
+ v = random53bitInt();
+ if (v < 9e15) c[i++] = v % 1e14;
+ }
+ }
+
+ k = c[--i];
+ dp %= LOG_BASE;
+
+ // Convert trailing digits to zeros according to dp.
+ if (k && dp) {
+ v = POWS_TEN[LOG_BASE - dp];
+ c[i] = mathfloor(k / v) * v;
+ }
+
+ // Remove trailing elements which are zero.
+ for (; c[i] === 0; c.pop(), i--);
+
+ // Zero?
+ if (i < 0) {
+ c = [e = 0];
+ } else {
+
+ // Remove leading elements which are zero and adjust exponent accordingly.
+ for (e = -1 ; c[0] === 0; c.splice(0, 1), e -= LOG_BASE);
+
+ // Count the digits of the first element of c to determine leading zeros, and...
+ for (i = 1, v = c[0]; v >= 10; v /= 10, i++);
+
+ // adjust the exponent accordingly.
+ if (i < LOG_BASE) e -= LOG_BASE - i;
+ }
+
+ rand.e = e;
+ rand.c = c;
+ return rand;
+ };
+ })();
+
+
+ /*
+ * Return a BigNumber whose value is the sum of the arguments.
+ *
+ * arguments {number|string|BigNumber}
+ */
+ BigNumber.sum = function () {
+ var i = 1,
+ args = arguments,
+ sum = new BigNumber(args[0]);
+ for (; i < args.length;) sum = sum.plus(args[i++]);
+ return sum;
+ };
+
+
+ // PRIVATE FUNCTIONS
+
+
+ // Called by BigNumber and BigNumber.prototype.toString.
+ convertBase = (function () {
+ var decimal = '0123456789';
+
+ /*
+ * Convert string of baseIn to an array of numbers of baseOut.
+ * Eg. toBaseOut('255', 10, 16) returns [15, 15].
+ * Eg. toBaseOut('ff', 16, 10) returns [2, 5, 5].
+ */
+ function toBaseOut(str, baseIn, baseOut, alphabet) {
+ var j,
+ arr = [0],
+ arrL,
+ i = 0,
+ len = str.length;
+
+ for (; i < len;) {
+ for (arrL = arr.length; arrL--; arr[arrL] *= baseIn);
+
+ arr[0] += alphabet.indexOf(str.charAt(i++));
+
+ for (j = 0; j < arr.length; j++) {
+
+ if (arr[j] > baseOut - 1) {
+ if (arr[j + 1] == null) arr[j + 1] = 0;
+ arr[j + 1] += arr[j] / baseOut | 0;
+ arr[j] %= baseOut;
+ }
+ }
+ }
+
+ return arr.reverse();
+ }
+
+ // Convert a numeric string of baseIn to a numeric string of baseOut.
+ // If the caller is toString, we are converting from base 10 to baseOut.
+ // If the caller is BigNumber, we are converting from baseIn to base 10.
+ return function (str, baseIn, baseOut, sign, callerIsToString) {
+ var alphabet, d, e, k, r, x, xc, y,
+ i = str.indexOf('.'),
+ dp = DECIMAL_PLACES,
+ rm = ROUNDING_MODE;
+
+ // Non-integer.
+ if (i >= 0) {
+ k = POW_PRECISION;
+
+ // Unlimited precision.
+ POW_PRECISION = 0;
+ str = str.replace('.', '');
+ y = new BigNumber(baseIn);
+ x = y.pow(str.length - i);
+ POW_PRECISION = k;
+
+ // Convert str as if an integer, then restore the fraction part by dividing the
+ // result by its base raised to a power.
+
+ y.c = toBaseOut(toFixedPoint(coeffToString(x.c), x.e, '0'),
+ 10, baseOut, decimal);
+ y.e = y.c.length;
+ }
+
+ // Convert the number as integer.
+
+ xc = toBaseOut(str, baseIn, baseOut, callerIsToString
+ ? (alphabet = ALPHABET, decimal)
+ : (alphabet = decimal, ALPHABET));
+
+ // xc now represents str as an integer and converted to baseOut. e is the exponent.
+ e = k = xc.length;
+
+ // Remove trailing zeros.
+ for (; xc[--k] == 0; xc.pop());
+
+ // Zero?
+ if (!xc[0]) return alphabet.charAt(0);
+
+ // Does str represent an integer? If so, no need for the division.
+ if (i < 0) {
+ --e;
+ } else {
+ x.c = xc;
+ x.e = e;
+
+ // The sign is needed for correct rounding.
+ x.s = sign;
+ x = div(x, y, dp, rm, baseOut);
+ xc = x.c;
+ r = x.r;
+ e = x.e;
+ }
+
+ // xc now represents str converted to baseOut.
+
+ // THe index of the rounding digit.
+ d = e + dp + 1;
+
+ // The rounding digit: the digit to the right of the digit that may be rounded up.
+ i = xc[d];
+
+ // Look at the rounding digits and mode to determine whether to round up.
+
+ k = baseOut / 2;
+ r = r || d < 0 || xc[d + 1] != null;
+
+ r = rm < 4 ? (i != null || r) && (rm == 0 || rm == (x.s < 0 ? 3 : 2))
+ : i > k || i == k &&(rm == 4 || r || rm == 6 && xc[d - 1] & 1 ||
+ rm == (x.s < 0 ? 8 : 7));
+
+ // If the index of the rounding digit is not greater than zero, or xc represents
+ // zero, then the result of the base conversion is zero or, if rounding up, a value
+ // such as 0.00001.
+ if (d < 1 || !xc[0]) {
+
+ // 1^-dp or 0
+ str = r ? toFixedPoint(alphabet.charAt(1), -dp, alphabet.charAt(0)) : alphabet.charAt(0);
+ } else {
+
+ // Truncate xc to the required number of decimal places.
+ xc.length = d;
+
+ // Round up?
+ if (r) {
+
+ // Rounding up may mean the previous digit has to be rounded up and so on.
+ for (--baseOut; ++xc[--d] > baseOut;) {
+ xc[d] = 0;
+
+ if (!d) {
+ ++e;
+ xc = [1].concat(xc);
+ }
+ }
+ }
+
+ // Determine trailing zeros.
+ for (k = xc.length; !xc[--k];);
+
+ // E.g. [4, 11, 15] becomes 4bf.
+ for (i = 0, str = ''; i <= k; str += alphabet.charAt(xc[i++]));
+
+ // Add leading zeros, decimal point and trailing zeros as required.
+ str = toFixedPoint(str, e, alphabet.charAt(0));
+ }
+
+ // The caller will add the sign.
+ return str;
+ };
+ })();
+
+
+ // Perform division in the specified base. Called by div and convertBase.
+ div = (function () {
+
+ // Assume non-zero x and k.
+ function multiply(x, k, base) {
+ var m, temp, xlo, xhi,
+ carry = 0,
+ i = x.length,
+ klo = k % SQRT_BASE,
+ khi = k / SQRT_BASE | 0;
+
+ for (x = x.slice(); i--;) {
+ xlo = x[i] % SQRT_BASE;
+ xhi = x[i] / SQRT_BASE | 0;
+ m = khi * xlo + xhi * klo;
+ temp = klo * xlo + ((m % SQRT_BASE) * SQRT_BASE) + carry;
+ carry = (temp / base | 0) + (m / SQRT_BASE | 0) + khi * xhi;
+ x[i] = temp % base;
+ }
+
+ if (carry) x = [carry].concat(x);
+
+ return x;
+ }
+
+ function compare(a, b, aL, bL) {
+ var i, cmp;
+
+ if (aL != bL) {
+ cmp = aL > bL ? 1 : -1;
+ } else {
+
+ for (i = cmp = 0; i < aL; i++) {
+
+ if (a[i] != b[i]) {
+ cmp = a[i] > b[i] ? 1 : -1;
+ break;
+ }
+ }
+ }
+
+ return cmp;
+ }
+
+ function subtract(a, b, aL, base) {
+ var i = 0;
+
+ // Subtract b from a.
+ for (; aL--;) {
+ a[aL] -= i;
+ i = a[aL] < b[aL] ? 1 : 0;
+ a[aL] = i * base + a[aL] - b[aL];
+ }
+
+ // Remove leading zeros.
+ for (; !a[0] && a.length > 1; a.splice(0, 1));
+ }
+
+ // x: dividend, y: divisor.
+ return function (x, y, dp, rm, base) {
+ var cmp, e, i, more, n, prod, prodL, q, qc, rem, remL, rem0, xi, xL, yc0,
+ yL, yz,
+ s = x.s == y.s ? 1 : -1,
+ xc = x.c,
+ yc = y.c;
+
+ // Either NaN, Infinity or 0?
+ if (!xc || !xc[0] || !yc || !yc[0]) {
+
+ return new BigNumber(
+
+ // Return NaN if either NaN, or both Infinity or 0.
+ !x.s || !y.s || (xc ? yc && xc[0] == yc[0] : !yc) ? NaN :
+
+ // Return ±0 if x is ±0 or y is ±Infinity, or return ±Infinity as y is ±0.
+ xc && xc[0] == 0 || !yc ? s * 0 : s / 0
+ );
+ }
+
+ q = new BigNumber(s);
+ qc = q.c = [];
+ e = x.e - y.e;
+ s = dp + e + 1;
+
+ if (!base) {
+ base = BASE;
+ e = bitFloor(x.e / LOG_BASE) - bitFloor(y.e / LOG_BASE);
+ s = s / LOG_BASE | 0;
+ }
+
+ // Result exponent may be one less then the current value of e.
+ // The coefficients of the BigNumbers from convertBase may have trailing zeros.
+ for (i = 0; yc[i] == (xc[i] || 0); i++);
+
+ if (yc[i] > (xc[i] || 0)) e--;
+
+ if (s < 0) {
+ qc.push(1);
+ more = true;
+ } else {
+ xL = xc.length;
+ yL = yc.length;
+ i = 0;
+ s += 2;
+
+ // Normalise xc and yc so highest order digit of yc is >= base / 2.
+
+ n = mathfloor(base / (yc[0] + 1));
+
+ // Not necessary, but to handle odd bases where yc[0] == (base / 2) - 1.
+ // if (n > 1 || n++ == 1 && yc[0] < base / 2) {
+ if (n > 1) {
+ yc = multiply(yc, n, base);
+ xc = multiply(xc, n, base);
+ yL = yc.length;
+ xL = xc.length;
+ }
+
+ xi = yL;
+ rem = xc.slice(0, yL);
+ remL = rem.length;
+
+ // Add zeros to make remainder as long as divisor.
+ for (; remL < yL; rem[remL++] = 0);
+ yz = yc.slice();
+ yz = [0].concat(yz);
+ yc0 = yc[0];
+ if (yc[1] >= base / 2) yc0++;
+ // Not necessary, but to prevent trial digit n > base, when using base 3.
+ // else if (base == 3 && yc0 == 1) yc0 = 1 + 1e-15;
+
+ do {
+ n = 0;
+
+ // Compare divisor and remainder.
+ cmp = compare(yc, rem, yL, remL);
+
+ // If divisor < remainder.
+ if (cmp < 0) {
+
+ // Calculate trial digit, n.
+
+ rem0 = rem[0];
+ if (yL != remL) rem0 = rem0 * base + (rem[1] || 0);
+
+ // n is how many times the divisor goes into the current remainder.
+ n = mathfloor(rem0 / yc0);
+
+ // Algorithm:
+ // product = divisor multiplied by trial digit (n).
+ // Compare product and remainder.
+ // If product is greater than remainder:
+ // Subtract divisor from product, decrement trial digit.
+ // Subtract product from remainder.
+ // If product was less than remainder at the last compare:
+ // Compare new remainder and divisor.
+ // If remainder is greater than divisor:
+ // Subtract divisor from remainder, increment trial digit.
+
+ if (n > 1) {
+
+ // n may be > base only when base is 3.
+ if (n >= base) n = base - 1;
+
+ // product = divisor * trial digit.
+ prod = multiply(yc, n, base);
+ prodL = prod.length;
+ remL = rem.length;
+
+ // Compare product and remainder.
+ // If product > remainder then trial digit n too high.
+ // n is 1 too high about 5% of the time, and is not known to have
+ // ever been more than 1 too high.
+ while (compare(prod, rem, prodL, remL) == 1) {
+ n--;
+
+ // Subtract divisor from product.
+ subtract(prod, yL < prodL ? yz : yc, prodL, base);
+ prodL = prod.length;
+ cmp = 1;
+ }
+ } else {
+
+ // n is 0 or 1, cmp is -1.
+ // If n is 0, there is no need to compare yc and rem again below,
+ // so change cmp to 1 to avoid it.
+ // If n is 1, leave cmp as -1, so yc and rem are compared again.
+ if (n == 0) {
+
+ // divisor < remainder, so n must be at least 1.
+ cmp = n = 1;
+ }
+
+ // product = divisor
+ prod = yc.slice();
+ prodL = prod.length;
+ }
+
+ if (prodL < remL) prod = [0].concat(prod);
+
+ // Subtract product from remainder.
+ subtract(rem, prod, remL, base);
+ remL = rem.length;
+
+ // If product was < remainder.
+ if (cmp == -1) {
+
+ // Compare divisor and new remainder.
+ // If divisor < new remainder, subtract divisor from remainder.
+ // Trial digit n too low.
+ // n is 1 too low about 5% of the time, and very rarely 2 too low.
+ while (compare(yc, rem, yL, remL) < 1) {
+ n++;
+
+ // Subtract divisor from remainder.
+ subtract(rem, yL < remL ? yz : yc, remL, base);
+ remL = rem.length;
+ }
+ }
+ } else if (cmp === 0) {
+ n++;
+ rem = [0];
+ } // else cmp === 1 and n will be 0
+
+ // Add the next digit, n, to the result array.
+ qc[i++] = n;
+
+ // Update the remainder.
+ if (rem[0]) {
+ rem[remL++] = xc[xi] || 0;
+ } else {
+ rem = [xc[xi]];
+ remL = 1;
+ }
+ } while ((xi++ < xL || rem[0] != null) && s--);
+
+ more = rem[0] != null;
+
+ // Leading zero?
+ if (!qc[0]) qc.splice(0, 1);
+ }
+
+ if (base == BASE) {
+
+ // To calculate q.e, first get the number of digits of qc[0].
+ for (i = 1, s = qc[0]; s >= 10; s /= 10, i++);
+
+ round(q, dp + (q.e = i + e * LOG_BASE - 1) + 1, rm, more);
+
+ // Caller is convertBase.
+ } else {
+ q.e = e;
+ q.r = +more;
+ }
+
+ return q;
+ };
+ })();
+
+
+ /*
+ * Return a string representing the value of BigNumber n in fixed-point or exponential
+ * notation rounded to the specified decimal places or significant digits.
+ *
+ * n: a BigNumber.
+ * i: the index of the last digit required (i.e. the digit that may be rounded up).
+ * rm: the rounding mode.
+ * id: 1 (toExponential) or 2 (toPrecision).
+ */
+ function format(n, i, rm, id) {
+ var c0, e, ne, len, str;
+
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+
+ if (!n.c) return n.toString();
+
+ c0 = n.c[0];
+ ne = n.e;
+
+ if (i == null) {
+ str = coeffToString(n.c);
+ str = id == 1 || id == 2 && (ne <= TO_EXP_NEG || ne >= TO_EXP_POS)
+ ? toExponential(str, ne)
+ : toFixedPoint(str, ne, '0');
+ } else {
+ n = round(new BigNumber(n), i, rm);
+
+ // n.e may have changed if the value was rounded up.
+ e = n.e;
+
+ str = coeffToString(n.c);
+ len = str.length;
+
+ // toPrecision returns exponential notation if the number of significant digits
+ // specified is less than the number of digits necessary to represent the integer
+ // part of the value in fixed-point notation.
+
+ // Exponential notation.
+ if (id == 1 || id == 2 && (i <= e || e <= TO_EXP_NEG)) {
+
+ // Append zeros?
+ for (; len < i; str += '0', len++);
+ str = toExponential(str, e);
+
+ // Fixed-point notation.
+ } else {
+ i -= ne;
+ str = toFixedPoint(str, e, '0');
+
+ // Append zeros?
+ if (e + 1 > len) {
+ if (--i > 0) for (str += '.'; i--; str += '0');
+ } else {
+ i += e - len;
+ if (i > 0) {
+ if (e + 1 == len) str += '.';
+ for (; i--; str += '0');
+ }
+ }
+ }
+ }
+
+ return n.s < 0 && c0 ? '-' + str : str;
+ }
+
+
+ // Handle BigNumber.max and BigNumber.min.
+ function maxOrMin(args, method) {
+ var n,
+ i = 1,
+ m = new BigNumber(args[0]);
+
+ for (; i < args.length; i++) {
+ n = new BigNumber(args[i]);
+
+ // If any number is NaN, return NaN.
+ if (!n.s) {
+ m = n;
+ break;
+ } else if (method.call(m, n)) {
+ m = n;
+ }
+ }
+
+ return m;
+ }
+
+
+ /*
+ * Strip trailing zeros, calculate base 10 exponent and check against MIN_EXP and MAX_EXP.
+ * Called by minus, plus and times.
+ */
+ function normalise(n, c, e) {
+ var i = 1,
+ j = c.length;
+
+ // Remove trailing zeros.
+ for (; !c[--j]; c.pop());
+
+ // Calculate the base 10 exponent. First get the number of digits of c[0].
+ for (j = c[0]; j >= 10; j /= 10, i++);
+
+ // Overflow?
+ if ((e = i + e * LOG_BASE - 1) > MAX_EXP) {
+
+ // Infinity.
+ n.c = n.e = null;
+
+ // Underflow?
+ } else if (e < MIN_EXP) {
+
+ // Zero.
+ n.c = [n.e = 0];
+ } else {
+ n.e = e;
+ n.c = c;
+ }
+
+ return n;
+ }
+
+
+ // Handle values that fail the validity test in BigNumber.
+ parseNumeric = (function () {
+ var basePrefix = /^(-?)0([xbo])(?=\w[\w.]*$)/i,
+ dotAfter = /^([^.]+)\.$/,
+ dotBefore = /^\.([^.]+)$/,
+ isInfinityOrNaN = /^-?(Infinity|NaN)$/,
+ whitespaceOrPlus = /^\s*\+(?=[\w.])|^\s+|\s+$/g;
+
+ return function (x, str, isNum, b) {
+ var base,
+ s = isNum ? str : str.replace(whitespaceOrPlus, '');
+
+ // No exception on ±Infinity or NaN.
+ if (isInfinityOrNaN.test(s)) {
+ x.s = isNaN(s) ? null : s < 0 ? -1 : 1;
+ } else {
+ if (!isNum) {
+
+ // basePrefix = /^(-?)0([xbo])(?=\w[\w.]*$)/i
+ s = s.replace(basePrefix, function (m, p1, p2) {
+ base = (p2 = p2.toLowerCase()) == 'x' ? 16 : p2 == 'b' ? 2 : 8;
+ return !b || b == base ? p1 : m;
+ });
+
+ if (b) {
+ base = b;
+
+ // E.g. '1.' to '1', '.1' to '0.1'
+ s = s.replace(dotAfter, '$1').replace(dotBefore, '0.$1');
+ }
+
+ if (str != s) return new BigNumber(s, base);
+ }
+
+ // '[BigNumber Error] Not a number: {n}'
+ // '[BigNumber Error] Not a base {b} number: {n}'
+ if (BigNumber.DEBUG) {
+ throw Error
+ (bignumberError + 'Not a' + (b ? ' base ' + b : '') + ' number: ' + str);
+ }
+
+ // NaN
+ x.s = null;
+ }
+
+ x.c = x.e = null;
+ }
+ })();
+
+
+ /*
+ * Round x to sd significant digits using rounding mode rm. Check for over/under-flow.
+ * If r is truthy, it is known that there are more digits after the rounding digit.
+ */
+ function round(x, sd, rm, r) {
+ var d, i, j, k, n, ni, rd,
+ xc = x.c,
+ pows10 = POWS_TEN;
+
+ // if x is not Infinity or NaN...
+ if (xc) {
+
+ // rd is the rounding digit, i.e. the digit after the digit that may be rounded up.
+ // n is a base 1e14 number, the value of the element of array x.c containing rd.
+ // ni is the index of n within x.c.
+ // d is the number of digits of n.
+ // i is the index of rd within n including leading zeros.
+ // j is the actual index of rd within n (if < 0, rd is a leading zero).
+ out: {
+
+ // Get the number of digits of the first element of xc.
+ for (d = 1, k = xc[0]; k >= 10; k /= 10, d++);
+ i = sd - d;
+
+ // If the rounding digit is in the first element of xc...
+ if (i < 0) {
+ i += LOG_BASE;
+ j = sd;
+ n = xc[ni = 0];
+
+ // Get the rounding digit at index j of n.
+ rd = n / pows10[d - j - 1] % 10 | 0;
+ } else {
+ ni = mathceil((i + 1) / LOG_BASE);
+
+ if (ni >= xc.length) {
+
+ if (r) {
+
+ // Needed by sqrt.
+ for (; xc.length <= ni; xc.push(0));
+ n = rd = 0;
+ d = 1;
+ i %= LOG_BASE;
+ j = i - LOG_BASE + 1;
+ } else {
+ break out;
+ }
+ } else {
+ n = k = xc[ni];
+
+ // Get the number of digits of n.
+ for (d = 1; k >= 10; k /= 10, d++);
+
+ // Get the index of rd within n.
+ i %= LOG_BASE;
+
+ // Get the index of rd within n, adjusted for leading zeros.
+ // The number of leading zeros of n is given by LOG_BASE - d.
+ j = i - LOG_BASE + d;
+
+ // Get the rounding digit at index j of n.
+ rd = j < 0 ? 0 : n / pows10[d - j - 1] % 10 | 0;
+ }
+ }
+
+ r = r || sd < 0 ||
+
+ // Are there any non-zero digits after the rounding digit?
+ // The expression n % pows10[d - j - 1] returns all digits of n to the right
+ // of the digit at j, e.g. if n is 908714 and j is 2, the expression gives 714.
+ xc[ni + 1] != null || (j < 0 ? n : n % pows10[d - j - 1]);
+
+ r = rm < 4
+ ? (rd || r) && (rm == 0 || rm == (x.s < 0 ? 3 : 2))
+ : rd > 5 || rd == 5 && (rm == 4 || r || rm == 6 &&
+
+ // Check whether the digit to the left of the rounding digit is odd.
+ ((i > 0 ? j > 0 ? n / pows10[d - j] : 0 : xc[ni - 1]) % 10) & 1 ||
+ rm == (x.s < 0 ? 8 : 7));
+
+ if (sd < 1 || !xc[0]) {
+ xc.length = 0;
+
+ if (r) {
+
+ // Convert sd to decimal places.
+ sd -= x.e + 1;
+
+ // 1, 0.1, 0.01, 0.001, 0.0001 etc.
+ xc[0] = pows10[(LOG_BASE - sd % LOG_BASE) % LOG_BASE];
+ x.e = -sd || 0;
+ } else {
+
+ // Zero.
+ xc[0] = x.e = 0;
+ }
+
+ return x;
+ }
+
+ // Remove excess digits.
+ if (i == 0) {
+ xc.length = ni;
+ k = 1;
+ ni--;
+ } else {
+ xc.length = ni + 1;
+ k = pows10[LOG_BASE - i];
+
+ // E.g. 56700 becomes 56000 if 7 is the rounding digit.
+ // j > 0 means i > number of leading zeros of n.
+ xc[ni] = j > 0 ? mathfloor(n / pows10[d - j] % pows10[j]) * k : 0;
+ }
+
+ // Round up?
+ if (r) {
+
+ for (; ;) {
+
+ // If the digit to be rounded up is in the first element of xc...
+ if (ni == 0) {
+
+ // i will be the length of xc[0] before k is added.
+ for (i = 1, j = xc[0]; j >= 10; j /= 10, i++);
+ j = xc[0] += k;
+ for (k = 1; j >= 10; j /= 10, k++);
+
+ // if i != k the length has increased.
+ if (i != k) {
+ x.e++;
+ if (xc[0] == BASE) xc[0] = 1;
+ }
+
+ break;
+ } else {
+ xc[ni] += k;
+ if (xc[ni] != BASE) break;
+ xc[ni--] = 0;
+ k = 1;
+ }
+ }
+ }
+
+ // Remove trailing zeros.
+ for (i = xc.length; xc[--i] === 0; xc.pop());
+ }
+
+ // Overflow? Infinity.
+ if (x.e > MAX_EXP) {
+ x.c = x.e = null;
+
+ // Underflow? Zero.
+ } else if (x.e < MIN_EXP) {
+ x.c = [x.e = 0];
+ }
+ }
+
+ return x;
+ }
+
+
+ function valueOf(n) {
+ var str,
+ e = n.e;
+
+ if (e === null) return n.toString();
+
+ str = coeffToString(n.c);
+
+ str = e <= TO_EXP_NEG || e >= TO_EXP_POS
+ ? toExponential(str, e)
+ : toFixedPoint(str, e, '0');
+
+ return n.s < 0 ? '-' + str : str;
+ }
+
+
+ // PROTOTYPE/INSTANCE METHODS
+
+
+ /*
+ * Return a new BigNumber whose value is the absolute value of this BigNumber.
+ */
+ P.absoluteValue = P.abs = function () {
+ var x = new BigNumber(this);
+ if (x.s < 0) x.s = 1;
+ return x;
+ };
+
+
+ /*
+ * Return
+ * 1 if the value of this BigNumber is greater than the value of BigNumber(y, b),
+ * -1 if the value of this BigNumber is less than the value of BigNumber(y, b),
+ * 0 if they have the same value,
+ * or null if the value of either is NaN.
+ */
+ P.comparedTo = function (y, b) {
+ return compare(this, new BigNumber(y, b));
+ };
+
+
+ /*
+ * If dp is undefined or null or true or false, return the number of decimal places of the
+ * value of this BigNumber, or null if the value of this BigNumber is ±Infinity or NaN.
+ *
+ * Otherwise, if dp is a number, return a new BigNumber whose value is the value of this
+ * BigNumber rounded to a maximum of dp decimal places using rounding mode rm, or
+ * ROUNDING_MODE if rm is omitted.
+ *
+ * [dp] {number} Decimal places: integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ */
+ P.decimalPlaces = P.dp = function (dp, rm) {
+ var c, n, v,
+ x = this;
+
+ if (dp != null) {
+ intCheck(dp, 0, MAX);
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+
+ return round(new BigNumber(x), dp + x.e + 1, rm);
+ }
+
+ if (!(c = x.c)) return null;
+ n = ((v = c.length - 1) - bitFloor(this.e / LOG_BASE)) * LOG_BASE;
+
+ // Subtract the number of trailing zeros of the last number.
+ if (v = c[v]) for (; v % 10 == 0; v /= 10, n--);
+ if (n < 0) n = 0;
+
+ return n;
+ };
+
+
+ /*
+ * n / 0 = I
+ * n / N = N
+ * n / I = 0
+ * 0 / n = 0
+ * 0 / 0 = N
+ * 0 / N = N
+ * 0 / I = 0
+ * N / n = N
+ * N / 0 = N
+ * N / N = N
+ * N / I = N
+ * I / n = I
+ * I / 0 = I
+ * I / N = N
+ * I / I = N
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber divided by the value of
+ * BigNumber(y, b), rounded according to DECIMAL_PLACES and ROUNDING_MODE.
+ */
+ P.dividedBy = P.div = function (y, b) {
+ return div(this, new BigNumber(y, b), DECIMAL_PLACES, ROUNDING_MODE);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the integer part of dividing the value of this
+ * BigNumber by the value of BigNumber(y, b).
+ */
+ P.dividedToIntegerBy = P.idiv = function (y, b) {
+ return div(this, new BigNumber(y, b), 0, 1);
+ };
+
+
+ /*
+ * Return a BigNumber whose value is the value of this BigNumber exponentiated by n.
+ *
+ * If m is present, return the result modulo m.
+ * If n is negative round according to DECIMAL_PLACES and ROUNDING_MODE.
+ * If POW_PRECISION is non-zero and m is not present, round to POW_PRECISION using ROUNDING_MODE.
+ *
+ * The modular power operation works efficiently when x, n, and m are integers, otherwise it
+ * is equivalent to calculating x.exponentiatedBy(n).modulo(m) with a POW_PRECISION of 0.
+ *
+ * n {number|string|BigNumber} The exponent. An integer.
+ * [m] {number|string|BigNumber} The modulus.
+ *
+ * '[BigNumber Error] Exponent not an integer: {n}'
+ */
+ P.exponentiatedBy = P.pow = function (n, m) {
+ var half, isModExp, i, k, more, nIsBig, nIsNeg, nIsOdd, y,
+ x = this;
+
+ n = new BigNumber(n);
+
+ // Allow NaN and ±Infinity, but not other non-integers.
+ if (n.c && !n.isInteger()) {
+ throw Error
+ (bignumberError + 'Exponent not an integer: ' + valueOf(n));
+ }
+
+ if (m != null) m = new BigNumber(m);
+
+ // Exponent of MAX_SAFE_INTEGER is 15.
+ nIsBig = n.e > 14;
+
+ // If x is NaN, ±Infinity, ±0 or ±1, or n is ±Infinity, NaN or ±0.
+ if (!x.c || !x.c[0] || x.c[0] == 1 && !x.e && x.c.length == 1 || !n.c || !n.c[0]) {
+
+ // The sign of the result of pow when x is negative depends on the evenness of n.
+ // If +n overflows to ±Infinity, the evenness of n would be not be known.
+ y = new BigNumber(Math.pow(+valueOf(x), nIsBig ? 2 - isOdd(n) : +valueOf(n)));
+ return m ? y.mod(m) : y;
+ }
+
+ nIsNeg = n.s < 0;
+
+ if (m) {
+
+ // x % m returns NaN if abs(m) is zero, or m is NaN.
+ if (m.c ? !m.c[0] : !m.s) return new BigNumber(NaN);
+
+ isModExp = !nIsNeg && x.isInteger() && m.isInteger();
+
+ if (isModExp) x = x.mod(m);
+
+ // Overflow to ±Infinity: >=2**1e10 or >=1.0000024**1e15.
+ // Underflow to ±0: <=0.79**1e10 or <=0.9999975**1e15.
+ } else if (n.e > 9 && (x.e > 0 || x.e < -1 || (x.e == 0
+ // [1, 240000000]
+ ? x.c[0] > 1 || nIsBig && x.c[1] >= 24e7
+ // [80000000000000] [99999750000000]
+ : x.c[0] < 8e13 || nIsBig && x.c[0] <= 9999975e7))) {
+
+ // If x is negative and n is odd, k = -0, else k = 0.
+ k = x.s < 0 && isOdd(n) ? -0 : 0;
+
+ // If x >= 1, k = ±Infinity.
+ if (x.e > -1) k = 1 / k;
+
+ // If n is negative return ±0, else return ±Infinity.
+ return new BigNumber(nIsNeg ? 1 / k : k);
+
+ } else if (POW_PRECISION) {
+
+ // Truncating each coefficient array to a length of k after each multiplication
+ // equates to truncating significant digits to POW_PRECISION + [28, 41],
+ // i.e. there will be a minimum of 28 guard digits retained.
+ k = mathceil(POW_PRECISION / LOG_BASE + 2);
+ }
+
+ if (nIsBig) {
+ half = new BigNumber(0.5);
+ if (nIsNeg) n.s = 1;
+ nIsOdd = isOdd(n);
+ } else {
+ i = Math.abs(+valueOf(n));
+ nIsOdd = i % 2;
+ }
+
+ y = new BigNumber(ONE);
+
+ // Performs 54 loop iterations for n of 9007199254740991.
+ for (; ;) {
+
+ if (nIsOdd) {
+ y = y.times(x);
+ if (!y.c) break;
+
+ if (k) {
+ if (y.c.length > k) y.c.length = k;
+ } else if (isModExp) {
+ y = y.mod(m); //y = y.minus(div(y, m, 0, MODULO_MODE).times(m));
+ }
+ }
+
+ if (i) {
+ i = mathfloor(i / 2);
+ if (i === 0) break;
+ nIsOdd = i % 2;
+ } else {
+ n = n.times(half);
+ round(n, n.e + 1, 1);
+
+ if (n.e > 14) {
+ nIsOdd = isOdd(n);
+ } else {
+ i = +valueOf(n);
+ if (i === 0) break;
+ nIsOdd = i % 2;
+ }
+ }
+
+ x = x.times(x);
+
+ if (k) {
+ if (x.c && x.c.length > k) x.c.length = k;
+ } else if (isModExp) {
+ x = x.mod(m); //x = x.minus(div(x, m, 0, MODULO_MODE).times(m));
+ }
+ }
+
+ if (isModExp) return y;
+ if (nIsNeg) y = ONE.div(y);
+
+ return m ? y.mod(m) : k ? round(y, POW_PRECISION, ROUNDING_MODE, more) : y;
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the value of this BigNumber rounded to an integer
+ * using rounding mode rm, or ROUNDING_MODE if rm is omitted.
+ *
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {rm}'
+ */
+ P.integerValue = function (rm) {
+ var n = new BigNumber(this);
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+ return round(n, n.e + 1, rm);
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is equal to the value of BigNumber(y, b),
+ * otherwise return false.
+ */
+ P.isEqualTo = P.eq = function (y, b) {
+ return compare(this, new BigNumber(y, b)) === 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is a finite number, otherwise return false.
+ */
+ P.isFinite = function () {
+ return !!this.c;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is greater than the value of BigNumber(y, b),
+ * otherwise return false.
+ */
+ P.isGreaterThan = P.gt = function (y, b) {
+ return compare(this, new BigNumber(y, b)) > 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is greater than or equal to the value of
+ * BigNumber(y, b), otherwise return false.
+ */
+ P.isGreaterThanOrEqualTo = P.gte = function (y, b) {
+ return (b = compare(this, new BigNumber(y, b))) === 1 || b === 0;
+
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is an integer, otherwise return false.
+ */
+ P.isInteger = function () {
+ return !!this.c && bitFloor(this.e / LOG_BASE) > this.c.length - 2;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is less than the value of BigNumber(y, b),
+ * otherwise return false.
+ */
+ P.isLessThan = P.lt = function (y, b) {
+ return compare(this, new BigNumber(y, b)) < 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is less than or equal to the value of
+ * BigNumber(y, b), otherwise return false.
+ */
+ P.isLessThanOrEqualTo = P.lte = function (y, b) {
+ return (b = compare(this, new BigNumber(y, b))) === -1 || b === 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is NaN, otherwise return false.
+ */
+ P.isNaN = function () {
+ return !this.s;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is negative, otherwise return false.
+ */
+ P.isNegative = function () {
+ return this.s < 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is positive, otherwise return false.
+ */
+ P.isPositive = function () {
+ return this.s > 0;
+ };
+
+
+ /*
+ * Return true if the value of this BigNumber is 0 or -0, otherwise return false.
+ */
+ P.isZero = function () {
+ return !!this.c && this.c[0] == 0;
+ };
+
+
+ /*
+ * n - 0 = n
+ * n - N = N
+ * n - I = -I
+ * 0 - n = -n
+ * 0 - 0 = 0
+ * 0 - N = N
+ * 0 - I = -I
+ * N - n = N
+ * N - 0 = N
+ * N - N = N
+ * N - I = N
+ * I - n = I
+ * I - 0 = I
+ * I - N = N
+ * I - I = N
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber minus the value of
+ * BigNumber(y, b).
+ */
+ P.minus = function (y, b) {
+ var i, j, t, xLTy,
+ x = this,
+ a = x.s;
+
+ y = new BigNumber(y, b);
+ b = y.s;
+
+ // Either NaN?
+ if (!a || !b) return new BigNumber(NaN);
+
+ // Signs differ?
+ if (a != b) {
+ y.s = -b;
+ return x.plus(y);
+ }
+
+ var xe = x.e / LOG_BASE,
+ ye = y.e / LOG_BASE,
+ xc = x.c,
+ yc = y.c;
+
+ if (!xe || !ye) {
+
+ // Either Infinity?
+ if (!xc || !yc) return xc ? (y.s = -b, y) : new BigNumber(yc ? x : NaN);
+
+ // Either zero?
+ if (!xc[0] || !yc[0]) {
+
+ // Return y if y is non-zero, x if x is non-zero, or zero if both are zero.
+ return yc[0] ? (y.s = -b, y) : new BigNumber(xc[0] ? x :
+
+ // IEEE 754 (2008) 6.3: n - n = -0 when rounding to -Infinity
+ ROUNDING_MODE == 3 ? -0 : 0);
+ }
+ }
+
+ xe = bitFloor(xe);
+ ye = bitFloor(ye);
+ xc = xc.slice();
+
+ // Determine which is the bigger number.
+ if (a = xe - ye) {
+
+ if (xLTy = a < 0) {
+ a = -a;
+ t = xc;
+ } else {
+ ye = xe;
+ t = yc;
+ }
+
+ t.reverse();
+
+ // Prepend zeros to equalise exponents.
+ for (b = a; b--; t.push(0));
+ t.reverse();
+ } else {
+
+ // Exponents equal. Check digit by digit.
+ j = (xLTy = (a = xc.length) < (b = yc.length)) ? a : b;
+
+ for (a = b = 0; b < j; b++) {
+
+ if (xc[b] != yc[b]) {
+ xLTy = xc[b] < yc[b];
+ break;
+ }
+ }
+ }
+
+ // x < y? Point xc to the array of the bigger number.
+ if (xLTy) t = xc, xc = yc, yc = t, y.s = -y.s;
+
+ b = (j = yc.length) - (i = xc.length);
+
+ // Append zeros to xc if shorter.
+ // No need to add zeros to yc if shorter as subtract only needs to start at yc.length.
+ if (b > 0) for (; b--; xc[i++] = 0);
+ b = BASE - 1;
+
+ // Subtract yc from xc.
+ for (; j > a;) {
+
+ if (xc[--j] < yc[j]) {
+ for (i = j; i && !xc[--i]; xc[i] = b);
+ --xc[i];
+ xc[j] += BASE;
+ }
+
+ xc[j] -= yc[j];
+ }
+
+ // Remove leading zeros and adjust exponent accordingly.
+ for (; xc[0] == 0; xc.splice(0, 1), --ye);
+
+ // Zero?
+ if (!xc[0]) {
+
+ // Following IEEE 754 (2008) 6.3,
+ // n - n = +0 but n - n = -0 when rounding towards -Infinity.
+ y.s = ROUNDING_MODE == 3 ? -1 : 1;
+ y.c = [y.e = 0];
+ return y;
+ }
+
+ // No need to check for Infinity as +x - +y != Infinity && -x - -y != Infinity
+ // for finite x and y.
+ return normalise(y, xc, ye);
+ };
+
+
+ /*
+ * n % 0 = N
+ * n % N = N
+ * n % I = n
+ * 0 % n = 0
+ * -0 % n = -0
+ * 0 % 0 = N
+ * 0 % N = N
+ * 0 % I = 0
+ * N % n = N
+ * N % 0 = N
+ * N % N = N
+ * N % I = N
+ * I % n = N
+ * I % 0 = N
+ * I % N = N
+ * I % I = N
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber modulo the value of
+ * BigNumber(y, b). The result depends on the value of MODULO_MODE.
+ */
+ P.modulo = P.mod = function (y, b) {
+ var q, s,
+ x = this;
+
+ y = new BigNumber(y, b);
+
+ // Return NaN if x is Infinity or NaN, or y is NaN or zero.
+ if (!x.c || !y.s || y.c && !y.c[0]) {
+ return new BigNumber(NaN);
+
+ // Return x if y is Infinity or x is zero.
+ } else if (!y.c || x.c && !x.c[0]) {
+ return new BigNumber(x);
+ }
+
+ if (MODULO_MODE == 9) {
+
+ // Euclidian division: q = sign(y) * floor(x / abs(y))
+ // r = x - qy where 0 <= r < abs(y)
+ s = y.s;
+ y.s = 1;
+ q = div(x, y, 0, 3);
+ y.s = s;
+ q.s *= s;
+ } else {
+ q = div(x, y, 0, MODULO_MODE);
+ }
+
+ y = x.minus(q.times(y));
+
+ // To match JavaScript %, ensure sign of zero is sign of dividend.
+ if (!y.c[0] && MODULO_MODE == 1) y.s = x.s;
+
+ return y;
+ };
+
+
+ /*
+ * n * 0 = 0
+ * n * N = N
+ * n * I = I
+ * 0 * n = 0
+ * 0 * 0 = 0
+ * 0 * N = N
+ * 0 * I = N
+ * N * n = N
+ * N * 0 = N
+ * N * N = N
+ * N * I = N
+ * I * n = I
+ * I * 0 = N
+ * I * N = N
+ * I * I = I
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber multiplied by the value
+ * of BigNumber(y, b).
+ */
+ P.multipliedBy = P.times = function (y, b) {
+ var c, e, i, j, k, m, xcL, xlo, xhi, ycL, ylo, yhi, zc,
+ base, sqrtBase,
+ x = this,
+ xc = x.c,
+ yc = (y = new BigNumber(y, b)).c;
+
+ // Either NaN, ±Infinity or ±0?
+ if (!xc || !yc || !xc[0] || !yc[0]) {
+
+ // Return NaN if either is NaN, or one is 0 and the other is Infinity.
+ if (!x.s || !y.s || xc && !xc[0] && !yc || yc && !yc[0] && !xc) {
+ y.c = y.e = y.s = null;
+ } else {
+ y.s *= x.s;
+
+ // Return ±Infinity if either is ±Infinity.
+ if (!xc || !yc) {
+ y.c = y.e = null;
+
+ // Return ±0 if either is ±0.
+ } else {
+ y.c = [0];
+ y.e = 0;
+ }
+ }
+
+ return y;
+ }
+
+ e = bitFloor(x.e / LOG_BASE) + bitFloor(y.e / LOG_BASE);
+ y.s *= x.s;
+ xcL = xc.length;
+ ycL = yc.length;
+
+ // Ensure xc points to longer array and xcL to its length.
+ if (xcL < ycL) zc = xc, xc = yc, yc = zc, i = xcL, xcL = ycL, ycL = i;
+
+ // Initialise the result array with zeros.
+ for (i = xcL + ycL, zc = []; i--; zc.push(0));
+
+ base = BASE;
+ sqrtBase = SQRT_BASE;
+
+ for (i = ycL; --i >= 0;) {
+ c = 0;
+ ylo = yc[i] % sqrtBase;
+ yhi = yc[i] / sqrtBase | 0;
+
+ for (k = xcL, j = i + k; j > i;) {
+ xlo = xc[--k] % sqrtBase;
+ xhi = xc[k] / sqrtBase | 0;
+ m = yhi * xlo + xhi * ylo;
+ xlo = ylo * xlo + ((m % sqrtBase) * sqrtBase) + zc[j] + c;
+ c = (xlo / base | 0) + (m / sqrtBase | 0) + yhi * xhi;
+ zc[j--] = xlo % base;
+ }
+
+ zc[j] = c;
+ }
+
+ if (c) {
+ ++e;
+ } else {
+ zc.splice(0, 1);
+ }
+
+ return normalise(y, zc, e);
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the value of this BigNumber negated,
+ * i.e. multiplied by -1.
+ */
+ P.negated = function () {
+ var x = new BigNumber(this);
+ x.s = -x.s || null;
+ return x;
+ };
+
+
+ /*
+ * n + 0 = n
+ * n + N = N
+ * n + I = I
+ * 0 + n = n
+ * 0 + 0 = 0
+ * 0 + N = N
+ * 0 + I = I
+ * N + n = N
+ * N + 0 = N
+ * N + N = N
+ * N + I = N
+ * I + n = I
+ * I + 0 = I
+ * I + N = N
+ * I + I = I
+ *
+ * Return a new BigNumber whose value is the value of this BigNumber plus the value of
+ * BigNumber(y, b).
+ */
+ P.plus = function (y, b) {
+ var t,
+ x = this,
+ a = x.s;
+
+ y = new BigNumber(y, b);
+ b = y.s;
+
+ // Either NaN?
+ if (!a || !b) return new BigNumber(NaN);
+
+ // Signs differ?
+ if (a != b) {
+ y.s = -b;
+ return x.minus(y);
+ }
+
+ var xe = x.e / LOG_BASE,
+ ye = y.e / LOG_BASE,
+ xc = x.c,
+ yc = y.c;
+
+ if (!xe || !ye) {
+
+ // Return ±Infinity if either ±Infinity.
+ if (!xc || !yc) return new BigNumber(a / 0);
+
+ // Either zero?
+ // Return y if y is non-zero, x if x is non-zero, or zero if both are zero.
+ if (!xc[0] || !yc[0]) return yc[0] ? y : new BigNumber(xc[0] ? x : a * 0);
+ }
+
+ xe = bitFloor(xe);
+ ye = bitFloor(ye);
+ xc = xc.slice();
+
+ // Prepend zeros to equalise exponents. Faster to use reverse then do unshifts.
+ if (a = xe - ye) {
+ if (a > 0) {
+ ye = xe;
+ t = yc;
+ } else {
+ a = -a;
+ t = xc;
+ }
+
+ t.reverse();
+ for (; a--; t.push(0));
+ t.reverse();
+ }
+
+ a = xc.length;
+ b = yc.length;
+
+ // Point xc to the longer array, and b to the shorter length.
+ if (a - b < 0) t = yc, yc = xc, xc = t, b = a;
+
+ // Only start adding at yc.length - 1 as the further digits of xc can be ignored.
+ for (a = 0; b;) {
+ a = (xc[--b] = xc[b] + yc[b] + a) / BASE | 0;
+ xc[b] = BASE === xc[b] ? 0 : xc[b] % BASE;
+ }
+
+ if (a) {
+ xc = [a].concat(xc);
+ ++ye;
+ }
+
+ // No need to check for zero, as +x + +y != 0 && -x + -y != 0
+ // ye = MAX_EXP + 1 possible
+ return normalise(y, xc, ye);
+ };
+
+
+ /*
+ * If sd is undefined or null or true or false, return the number of significant digits of
+ * the value of this BigNumber, or null if the value of this BigNumber is ±Infinity or NaN.
+ * If sd is true include integer-part trailing zeros in the count.
+ *
+ * Otherwise, if sd is a number, return a new BigNumber whose value is the value of this
+ * BigNumber rounded to a maximum of sd significant digits using rounding mode rm, or
+ * ROUNDING_MODE if rm is omitted.
+ *
+ * sd {number|boolean} number: significant digits: integer, 1 to MAX inclusive.
+ * boolean: whether to count integer-part trailing zeros: true or false.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {sd|rm}'
+ */
+ P.precision = P.sd = function (sd, rm) {
+ var c, n, v,
+ x = this;
+
+ if (sd != null && sd !== !!sd) {
+ intCheck(sd, 1, MAX);
+ if (rm == null) rm = ROUNDING_MODE;
+ else intCheck(rm, 0, 8);
+
+ return round(new BigNumber(x), sd, rm);
+ }
+
+ if (!(c = x.c)) return null;
+ v = c.length - 1;
+ n = v * LOG_BASE + 1;
+
+ if (v = c[v]) {
+
+ // Subtract the number of trailing zeros of the last element.
+ for (; v % 10 == 0; v /= 10, n--);
+
+ // Add the number of digits of the first element.
+ for (v = c[0]; v >= 10; v /= 10, n++);
+ }
+
+ if (sd && x.e + 1 > n) n = x.e + 1;
+
+ return n;
+ };
+
+
+ /*
+ * Return a new BigNumber whose value is the value of this BigNumber shifted by k places
+ * (powers of 10). Shift to the right if n > 0, and to the left if n < 0.
+ *
+ * k {number} Integer, -MAX_SAFE_INTEGER to MAX_SAFE_INTEGER inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {k}'
+ */
+ P.shiftedBy = function (k) {
+ intCheck(k, -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER);
+ return this.times('1e' + k);
+ };
+
+
+ /*
+ * sqrt(-n) = N
+ * sqrt(N) = N
+ * sqrt(-I) = N
+ * sqrt(I) = I
+ * sqrt(0) = 0
+ * sqrt(-0) = -0
+ *
+ * Return a new BigNumber whose value is the square root of the value of this BigNumber,
+ * rounded according to DECIMAL_PLACES and ROUNDING_MODE.
+ */
+ P.squareRoot = P.sqrt = function () {
+ var m, n, r, rep, t,
+ x = this,
+ c = x.c,
+ s = x.s,
+ e = x.e,
+ dp = DECIMAL_PLACES + 4,
+ half = new BigNumber('0.5');
+
+ // Negative/NaN/Infinity/zero?
+ if (s !== 1 || !c || !c[0]) {
+ return new BigNumber(!s || s < 0 && (!c || c[0]) ? NaN : c ? x : 1 / 0);
+ }
+
+ // Initial estimate.
+ s = Math.sqrt(+valueOf(x));
+
+ // Math.sqrt underflow/overflow?
+ // Pass x to Math.sqrt as integer, then adjust the exponent of the result.
+ if (s == 0 || s == 1 / 0) {
+ n = coeffToString(c);
+ if ((n.length + e) % 2 == 0) n += '0';
+ s = Math.sqrt(+n);
+ e = bitFloor((e + 1) / 2) - (e < 0 || e % 2);
+
+ if (s == 1 / 0) {
+ n = '1e' + e;
+ } else {
+ n = s.toExponential();
+ n = n.slice(0, n.indexOf('e') + 1) + e;
+ }
+
+ r = new BigNumber(n);
+ } else {
+ r = new BigNumber(s + '');
+ }
+
+ // Check for zero.
+ // r could be zero if MIN_EXP is changed after the this value was created.
+ // This would cause a division by zero (x/t) and hence Infinity below, which would cause
+ // coeffToString to throw.
+ if (r.c[0]) {
+ e = r.e;
+ s = e + dp;
+ if (s < 3) s = 0;
+
+ // Newton-Raphson iteration.
+ for (; ;) {
+ t = r;
+ r = half.times(t.plus(div(x, t, dp, 1)));
+
+ if (coeffToString(t.c).slice(0, s) === (n = coeffToString(r.c)).slice(0, s)) {
+
+ // The exponent of r may here be one less than the final result exponent,
+ // e.g 0.0009999 (e-4) --> 0.001 (e-3), so adjust s so the rounding digits
+ // are indexed correctly.
+ if (r.e < e) --s;
+ n = n.slice(s - 3, s + 1);
+
+ // The 4th rounding digit may be in error by -1 so if the 4 rounding digits
+ // are 9999 or 4999 (i.e. approaching a rounding boundary) continue the
+ // iteration.
+ if (n == '9999' || !rep && n == '4999') {
+
+ // On the first iteration only, check to see if rounding up gives the
+ // exact result as the nines may infinitely repeat.
+ if (!rep) {
+ round(t, t.e + DECIMAL_PLACES + 2, 0);
+
+ if (t.times(t).eq(x)) {
+ r = t;
+ break;
+ }
+ }
+
+ dp += 4;
+ s += 4;
+ rep = 1;
+ } else {
+
+ // If rounding digits are null, 0{0,4} or 50{0,3}, check for exact
+ // result. If not, then there are further digits and m will be truthy.
+ if (!+n || !+n.slice(1) && n.charAt(0) == '5') {
+
+ // Truncate to the first rounding digit.
+ round(r, r.e + DECIMAL_PLACES + 2, 1);
+ m = !r.times(r).eq(x);
+ }
+
+ break;
+ }
+ }
+ }
+ }
+
+ return round(r, r.e + DECIMAL_PLACES + 1, ROUNDING_MODE, m);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in exponential notation and
+ * rounded using ROUNDING_MODE to dp fixed decimal places.
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ */
+ P.toExponential = function (dp, rm) {
+ if (dp != null) {
+ intCheck(dp, 0, MAX);
+ dp++;
+ }
+ return format(this, dp, rm, 1);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in fixed-point notation rounding
+ * to dp fixed decimal places using rounding mode rm, or ROUNDING_MODE if rm is omitted.
+ *
+ * Note: as with JavaScript's number type, (-0).toFixed(0) is '0',
+ * but e.g. (-0.00001).toFixed(0) is '-0'.
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ */
+ P.toFixed = function (dp, rm) {
+ if (dp != null) {
+ intCheck(dp, 0, MAX);
+ dp = dp + this.e + 1;
+ }
+ return format(this, dp, rm);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in fixed-point notation rounded
+ * using rm or ROUNDING_MODE to dp decimal places, and formatted according to the properties
+ * of the format or FORMAT object (see BigNumber.set).
+ *
+ * The formatting object may contain some or all of the properties shown below.
+ *
+ * FORMAT = {
+ * prefix: '',
+ * groupSize: 3,
+ * secondaryGroupSize: 0,
+ * groupSeparator: ',',
+ * decimalSeparator: '.',
+ * fractionGroupSize: 0,
+ * fractionGroupSeparator: '\xA0', // non-breaking space
+ * suffix: ''
+ * };
+ *
+ * [dp] {number} Decimal places. Integer, 0 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ * [format] {object} Formatting options. See FORMAT pbject above.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {dp|rm}'
+ * '[BigNumber Error] Argument not an object: {format}'
+ */
+ P.toFormat = function (dp, rm, format) {
+ var str,
+ x = this;
+
+ if (format == null) {
+ if (dp != null && rm && typeof rm == 'object') {
+ format = rm;
+ rm = null;
+ } else if (dp && typeof dp == 'object') {
+ format = dp;
+ dp = rm = null;
+ } else {
+ format = FORMAT;
+ }
+ } else if (typeof format != 'object') {
+ throw Error
+ (bignumberError + 'Argument not an object: ' + format);
+ }
+
+ str = x.toFixed(dp, rm);
+
+ if (x.c) {
+ var i,
+ arr = str.split('.'),
+ g1 = +format.groupSize,
+ g2 = +format.secondaryGroupSize,
+ groupSeparator = format.groupSeparator || '',
+ intPart = arr[0],
+ fractionPart = arr[1],
+ isNeg = x.s < 0,
+ intDigits = isNeg ? intPart.slice(1) : intPart,
+ len = intDigits.length;
+
+ if (g2) i = g1, g1 = g2, g2 = i, len -= i;
+
+ if (g1 > 0 && len > 0) {
+ i = len % g1 || g1;
+ intPart = intDigits.substr(0, i);
+ for (; i < len; i += g1) intPart += groupSeparator + intDigits.substr(i, g1);
+ if (g2 > 0) intPart += groupSeparator + intDigits.slice(i);
+ if (isNeg) intPart = '-' + intPart;
+ }
+
+ str = fractionPart
+ ? intPart + (format.decimalSeparator || '') + ((g2 = +format.fractionGroupSize)
+ ? fractionPart.replace(new RegExp('\\d{' + g2 + '}\\B', 'g'),
+ '$&' + (format.fractionGroupSeparator || ''))
+ : fractionPart)
+ : intPart;
+ }
+
+ return (format.prefix || '') + str + (format.suffix || '');
+ };
+
+
+ /*
+ * Return an array of two BigNumbers representing the value of this BigNumber as a simple
+ * fraction with an integer numerator and an integer denominator.
+ * The denominator will be a positive non-zero value less than or equal to the specified
+ * maximum denominator. If a maximum denominator is not specified, the denominator will be
+ * the lowest value necessary to represent the number exactly.
+ *
+ * [md] {number|string|BigNumber} Integer >= 1, or Infinity. The maximum denominator.
+ *
+ * '[BigNumber Error] Argument {not an integer|out of range} : {md}'
+ */
+ P.toFraction = function (md) {
+ var d, d0, d1, d2, e, exp, n, n0, n1, q, r, s,
+ x = this,
+ xc = x.c;
+
+ if (md != null) {
+ n = new BigNumber(md);
+
+ // Throw if md is less than one or is not an integer, unless it is Infinity.
+ if (!n.isInteger() && (n.c || n.s !== 1) || n.lt(ONE)) {
+ throw Error
+ (bignumberError + 'Argument ' +
+ (n.isInteger() ? 'out of range: ' : 'not an integer: ') + valueOf(n));
+ }
+ }
+
+ if (!xc) return new BigNumber(x);
+
+ d = new BigNumber(ONE);
+ n1 = d0 = new BigNumber(ONE);
+ d1 = n0 = new BigNumber(ONE);
+ s = coeffToString(xc);
+
+ // Determine initial denominator.
+ // d is a power of 10 and the minimum max denominator that specifies the value exactly.
+ e = d.e = s.length - x.e - 1;
+ d.c[0] = POWS_TEN[(exp = e % LOG_BASE) < 0 ? LOG_BASE + exp : exp];
+ md = !md || n.comparedTo(d) > 0 ? (e > 0 ? d : n1) : n;
+
+ exp = MAX_EXP;
+ MAX_EXP = 1 / 0;
+ n = new BigNumber(s);
+
+ // n0 = d1 = 0
+ n0.c[0] = 0;
+
+ for (; ;) {
+ q = div(n, d, 0, 1);
+ d2 = d0.plus(q.times(d1));
+ if (d2.comparedTo(md) == 1) break;
+ d0 = d1;
+ d1 = d2;
+ n1 = n0.plus(q.times(d2 = n1));
+ n0 = d2;
+ d = n.minus(q.times(d2 = d));
+ n = d2;
+ }
+
+ d2 = div(md.minus(d0), d1, 0, 1);
+ n0 = n0.plus(d2.times(n1));
+ d0 = d0.plus(d2.times(d1));
+ n0.s = n1.s = x.s;
+ e = e * 2;
+
+ // Determine which fraction is closer to x, n0/d0 or n1/d1
+ r = div(n1, d1, e, ROUNDING_MODE).minus(x).abs().comparedTo(
+ div(n0, d0, e, ROUNDING_MODE).minus(x).abs()) < 1 ? [n1, d1] : [n0, d0];
+
+ MAX_EXP = exp;
+
+ return r;
+ };
+
+
+ /*
+ * Return the value of this BigNumber converted to a number primitive.
+ */
+ P.toNumber = function () {
+ return +valueOf(this);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber rounded to sd significant digits
+ * using rounding mode rm or ROUNDING_MODE. If sd is less than the number of digits
+ * necessary to represent the integer part of the value in fixed-point notation, then use
+ * exponential notation.
+ *
+ * [sd] {number} Significant digits. Integer, 1 to MAX inclusive.
+ * [rm] {number} Rounding mode. Integer, 0 to 8 inclusive.
+ *
+ * '[BigNumber Error] Argument {not a primitive number|not an integer|out of range}: {sd|rm}'
+ */
+ P.toPrecision = function (sd, rm) {
+ if (sd != null) intCheck(sd, 1, MAX);
+ return format(this, sd, rm, 2);
+ };
+
+
+ /*
+ * Return a string representing the value of this BigNumber in base b, or base 10 if b is
+ * omitted. If a base is specified, including base 10, round according to DECIMAL_PLACES and
+ * ROUNDING_MODE. If a base is not specified, and this BigNumber has a positive exponent
+ * that is equal to or greater than TO_EXP_POS, or a negative exponent equal to or less than
+ * TO_EXP_NEG, return exponential notation.
+ *
+ * [b] {number} Integer, 2 to ALPHABET.length inclusive.
+ *
+ * '[BigNumber Error] Base {not a primitive number|not an integer|out of range}: {b}'
+ */
+ P.toString = function (b) {
+ var str,
+ n = this,
+ s = n.s,
+ e = n.e;
+
+ // Infinity or NaN?
+ if (e === null) {
+ if (s) {
+ str = 'Infinity';
+ if (s < 0) str = '-' + str;
+ } else {
+ str = 'NaN';
+ }
+ } else {
+ if (b == null) {
+ str = e <= TO_EXP_NEG || e >= TO_EXP_POS
+ ? toExponential(coeffToString(n.c), e)
+ : toFixedPoint(coeffToString(n.c), e, '0');
+ } else if (b === 10) {
+ n = round(new BigNumber(n), DECIMAL_PLACES + e + 1, ROUNDING_MODE);
+ str = toFixedPoint(coeffToString(n.c), n.e, '0');
+ } else {
+ intCheck(b, 2, ALPHABET.length, 'Base');
+ str = convertBase(toFixedPoint(coeffToString(n.c), e, '0'), 10, b, s, true);
+ }
+
+ if (s < 0 && n.c[0]) str = '-' + str;
+ }
+
+ return str;
+ };
+
+
+ /*
+ * Return as toString, but do not accept a base argument, and include the minus sign for
+ * negative zero.
+ */
+ P.valueOf = P.toJSON = function () {
+ return valueOf(this);
+ };
+
+
+ P._isBigNumber = true;
+
+ P[Symbol.toStringTag] = 'BigNumber';
+
+ // Node.js v10.12.0+
+ P[Symbol.for('nodejs.util.inspect.custom')] = P.valueOf;
+
+ if (configObject != null) BigNumber.set(configObject);
+
+ return BigNumber;
+}
+
+
+// PRIVATE HELPER FUNCTIONS
+
+// These functions don't need access to variables,
+// e.g. DECIMAL_PLACES, in the scope of the `clone` function above.
+
+
+function bitFloor(n) {
+ var i = n | 0;
+ return n > 0 || n === i ? i : i - 1;
+}
+
+
+// Return a coefficient array as a string of base 10 digits.
+function coeffToString(a) {
+ var s, z,
+ i = 1,
+ j = a.length,
+ r = a[0] + '';
+
+ for (; i < j;) {
+ s = a[i++] + '';
+ z = LOG_BASE - s.length;
+ for (; z--; s = '0' + s);
+ r += s;
+ }
+
+ // Determine trailing zeros.
+ for (j = r.length; r.charCodeAt(--j) === 48;);
+
+ return r.slice(0, j + 1 || 1);
+}
+
+
+// Compare the value of BigNumbers x and y.
+function compare(x, y) {
+ var a, b,
+ xc = x.c,
+ yc = y.c,
+ i = x.s,
+ j = y.s,
+ k = x.e,
+ l = y.e;
+
+ // Either NaN?
+ if (!i || !j) return null;
+
+ a = xc && !xc[0];
+ b = yc && !yc[0];
+
+ // Either zero?
+ if (a || b) return a ? b ? 0 : -j : i;
+
+ // Signs differ?
+ if (i != j) return i;
+
+ a = i < 0;
+ b = k == l;
+
+ // Either Infinity?
+ if (!xc || !yc) return b ? 0 : !xc ^ a ? 1 : -1;
+
+ // Compare exponents.
+ if (!b) return k > l ^ a ? 1 : -1;
+
+ j = (k = xc.length) < (l = yc.length) ? k : l;
+
+ // Compare digit by digit.
+ for (i = 0; i < j; i++) if (xc[i] != yc[i]) return xc[i] > yc[i] ^ a ? 1 : -1;
+
+ // Compare lengths.
+ return k == l ? 0 : k > l ^ a ? 1 : -1;
+}
+
+
+/*
+ * Check that n is a primitive number, an integer, and in range, otherwise throw.
+ */
+function intCheck(n, min, max, name) {
+ if (n < min || n > max || n !== mathfloor(n)) {
+ throw Error
+ (bignumberError + (name || 'Argument') + (typeof n == 'number'
+ ? n < min || n > max ? ' out of range: ' : ' not an integer: '
+ : ' not a primitive number: ') + String(n));
+ }
+}
+
+
+// Assumes finite n.
+function isOdd(n) {
+ var k = n.c.length - 1;
+ return bitFloor(n.e / LOG_BASE) == k && n.c[k] % 2 != 0;
+}
+
+
+function toExponential(str, e) {
+ return (str.length > 1 ? str.charAt(0) + '.' + str.slice(1) : str) +
+ (e < 0 ? 'e' : 'e+') + e;
+}
+
+
+function toFixedPoint(str, e, z) {
+ var len, zs;
+
+ // Negative exponent?
+ if (e < 0) {
+
+ // Prepend zeros.
+ for (zs = z + '.'; ++e; zs += z);
+ str = zs + str;
+
+ // Positive exponent
+ } else {
+ len = str.length;
+
+ // Append zeros.
+ if (++e > len) {
+ for (zs = z, e -= len; --e; zs += z);
+ str += zs;
+ } else if (e < len) {
+ str = str.slice(0, e) + '.' + str.slice(e);
+ }
+ }
+
+ return str;
+}
+
+
+// EXPORT
+
+
+export var BigNumber = clone();
+
+export default BigNumber;
diff --git a/node_modules/bignumber.js/doc/API.html b/node_modules/bignumber.js/doc/API.html
new file mode 100644
index 0000000..424a914
--- /dev/null
+++ b/node_modules/bignumber.js/doc/API.html
@@ -0,0 +1,2237 @@
+
+
+
+
+
+
+bignumber.js API
+
+
+
+
+
+
+
+
+
bignumber.js
+
+
A JavaScript library for arbitrary-precision arithmetic.
+
Hosted on GitHub .
+
+
API
+
+
+ See the README on GitHub for a
+ quick-start introduction.
+
+
+ In all examples below, var and semicolons are not shown, and if a commented-out
+ value is in quotes it means toString has been called on the preceding expression.
+
+
+
+
CONSTRUCTOR
+
+
+
+ BigNumberBigNumber(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number : integer, 2 to 36 inclusive. (See
+ ALPHABET to extend this range).
+
+
+ Returns a new instance of a BigNumber object with value n, where n
+ is a numeric value in the specified base, or base 10 if
+ base is omitted or is null or undefined.
+
+
+x = new BigNumber(123.4567) // '123.4567'
+// 'new' is optional
+y = BigNumber(x) // '123.4567'
+
+ If n is a base 10 value it can be in normal (fixed-point) or
+ exponential notation. Values in other bases must be in normal notation. Values in any base can
+ have fraction digits, i.e. digits after the decimal point.
+
+
+new BigNumber(43210) // '43210'
+new BigNumber('4.321e+4') // '43210'
+new BigNumber('-735.0918e-430') // '-7.350918e-428'
+new BigNumber('123412421.234324', 5) // '607236.557696'
+
+ Signed 0, signed Infinity and NaN are supported.
+
+
+new BigNumber('-Infinity') // '-Infinity'
+new BigNumber(NaN) // 'NaN'
+new BigNumber(-0) // '0'
+new BigNumber('.5') // '0.5'
+new BigNumber('+2') // '2'
+
+ String values in hexadecimal literal form, e.g. '0xff', are valid, as are
+ string values with the octal and binary prefixs '0o' and '0b'.
+ String values in octal literal form without the prefix will be interpreted as
+ decimals, e.g. '011' is interpreted as 11, not 9.
+
+
+new BigNumber(-10110100.1, 2) // '-180.5'
+new BigNumber('-0b10110100.1') // '-180.5'
+new BigNumber('ff.8', 16) // '255.5'
+new BigNumber('0xff.8') // '255.5'
+
+ If a base is specified, n is rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings. This includes base
+ 10 so don't include a base parameter for decimal values unless
+ this behaviour is wanted.
+
+
BigNumber.config({ DECIMAL_PLACES: 5 })
+new BigNumber(1.23456789) // '1.23456789'
+new BigNumber(1.23456789, 10) // '1.23457'
+
An error is thrown if base is invalid. See Errors .
+
+ There is no limit to the number of digits of a value of type string (other than
+ that of JavaScript's maximum array size). See RANGE to set
+ the maximum and minimum possible exponent value of a BigNumber.
+
+
+new BigNumber('5032485723458348569331745.33434346346912144534543')
+new BigNumber('4.321e10000000')
+
BigNumber NaN is returned if n is invalid
+ (unless BigNumber.DEBUG is true, see below).
+
+new BigNumber('.1*') // 'NaN'
+new BigNumber('blurgh') // 'NaN'
+new BigNumber(9, 2) // 'NaN'
+
+ To aid in debugging, if BigNumber.DEBUG is true then an error will
+ be thrown on an invalid n. An error will also be thrown if n is of
+ type number with more than 15 significant digits, as calling
+ toString or valueOf on
+ these numbers may not result in the intended value.
+
+
+console.log(823456789123456.3) // 823456789123456.2
+new BigNumber(823456789123456.3) // '823456789123456.2'
+BigNumber.DEBUG = true
+// '[BigNumber Error] Number primitive has more than 15 significant digits'
+new BigNumber(823456789123456.3)
+// '[BigNumber Error] Not a base 2 number'
+new BigNumber(9, 2)
+
+ A BigNumber can also be created from an object literal.
+ Use isBigNumber to check that it is well-formed.
+
+
new BigNumber({ s: 1, e: 2, c: [ 777, 12300000000000 ], _isBigNumber: true }) // '777.123'
+
+
+
+
+
Methods
+
The static methods of a BigNumber constructor.
+
+
+
+
+
clone
+ .clone([object]) ⇒ BigNumber constructor
+
+
object: object
+
+ Returns a new independent BigNumber constructor with configuration as described by
+ object (see config ), or with the default
+ configuration if object is null or undefined.
+
+
+ Throws if object is not an object. See Errors .
+
+
BigNumber.config({ DECIMAL_PLACES: 5 })
+BN = BigNumber.clone({ DECIMAL_PLACES: 9 })
+
+x = new BigNumber(1)
+y = new BN(1)
+
+x.div(3) // 0.33333
+y.div(3) // 0.333333333
+
+// BN = BigNumber.clone({ DECIMAL_PLACES: 9 }) is equivalent to:
+BN = BigNumber.clone()
+BN.config({ DECIMAL_PLACES: 9 })
+
+
+
+
configset([object]) ⇒ object
+
+ object: object : an object that contains some or all of the following
+ properties.
+
+
Configures the settings for this particular BigNumber constructor.
+
+
+ DECIMAL_PLACES
+
+ number : integer, 0 to 1e+9 inclusive
+ Default value: 20
+
+
+ The maximum number of decimal places of the results of operations involving
+ division, i.e. division, square root and base conversion operations, and power
+ operations with negative exponents.
+
+
+ BigNumber.config({ DECIMAL_PLACES: 5 })
+BigNumber.set({ DECIMAL_PLACES: 5 }) // equivalent
+
+
+
+
+ ROUNDING_MODE
+
+ number : integer, 0 to 8 inclusive
+ Default value: 4 (ROUND_HALF_UP)
+
+
+ The rounding mode used in the above operations and the default rounding mode of
+ decimalPlaces ,
+ precision ,
+ toExponential ,
+ toFixed ,
+ toFormat and
+ toPrecision .
+
+ The modes are available as enumerated properties of the BigNumber constructor.
+
+ BigNumber.config({ ROUNDING_MODE: 0 })
+BigNumber.set({ ROUNDING_MODE: BigNumber.ROUND_UP }) // equivalent
+
+
+
+
+ EXPONENTIAL_AT
+
+ number : integer, magnitude 0 to 1e+9 inclusive, or
+
+ number []: [ integer -1e+9 to 0 inclusive, integer
+ 0 to 1e+9 inclusive ]
+ Default value: [-7, 20]
+
+
+ The exponent value(s) at which toString returns exponential notation.
+
+
+ If a single number is assigned, the value is the exponent magnitude.
+ If an array of two numbers is assigned then the first number is the negative exponent
+ value at and beneath which exponential notation is used, and the second number is the
+ positive exponent value at and above which the same.
+
+
+ For example, to emulate JavaScript numbers in terms of the exponent values at which they
+ begin to use exponential notation, use [-7, 20].
+
+
+ BigNumber.config({ EXPONENTIAL_AT: 2 })
+new BigNumber(12.3) // '12.3' e is only 1
+new BigNumber(123) // '1.23e+2'
+new BigNumber(0.123) // '0.123' e is only -1
+new BigNumber(0.0123) // '1.23e-2'
+
+BigNumber.config({ EXPONENTIAL_AT: [-7, 20] })
+new BigNumber(123456789) // '123456789' e is only 8
+new BigNumber(0.000000123) // '1.23e-7'
+
+// Almost never return exponential notation:
+BigNumber.config({ EXPONENTIAL_AT: 1e+9 })
+
+// Always return exponential notation:
+BigNumber.config({ EXPONENTIAL_AT: 0 })
+
+
+ Regardless of the value of EXPONENTIAL_AT, the toFixed method
+ will always return a value in normal notation and the toExponential method
+ will always return a value in exponential form.
+
+
+ Calling toString with a base argument, e.g. toString(10), will
+ also always return normal notation.
+
+
+
+
+ RANGE
+
+ number : integer, magnitude 1 to 1e+9 inclusive, or
+
+ number []: [ integer -1e+9 to -1 inclusive, integer
+ 1 to 1e+9 inclusive ]
+ Default value: [-1e+9, 1e+9]
+
+
+ The exponent value(s) beyond which overflow to Infinity and underflow to
+ zero occurs.
+
+
+ If a single number is assigned, it is the maximum exponent magnitude: values wth a
+ positive exponent of greater magnitude become Infinity and those with a
+ negative exponent of greater magnitude become zero.
+
+ If an array of two numbers is assigned then the first number is the negative exponent
+ limit and the second number is the positive exponent limit.
+
+
+ For example, to emulate JavaScript numbers in terms of the exponent values at which they
+ become zero and Infinity, use [-324, 308].
+
+
+ BigNumber.config({ RANGE: 500 })
+BigNumber.config().RANGE // [ -500, 500 ]
+new BigNumber('9.999e499') // '9.999e+499'
+new BigNumber('1e500') // 'Infinity'
+new BigNumber('1e-499') // '1e-499'
+new BigNumber('1e-500') // '0'
+
+BigNumber.config({ RANGE: [-3, 4] })
+new BigNumber(99999) // '99999' e is only 4
+new BigNumber(100000) // 'Infinity' e is 5
+new BigNumber(0.001) // '0.01' e is only -3
+new BigNumber(0.0001) // '0' e is -4
+
+
+ The largest possible magnitude of a finite BigNumber is
+ 9.999...e+1000000000.
+ The smallest possible magnitude of a non-zero BigNumber is 1e-1000000000.
+
+
+
+
+ CRYPTO
+
+ boolean : true or false.
+ Default value: false
+
+
+ The value that determines whether cryptographically-secure pseudo-random number
+ generation is used.
+
+
+ If CRYPTO is set to true then the
+ random method will generate random digits using
+ crypto.getRandomValues in browsers that support it, or
+ crypto.randomBytes if using Node.js.
+
+
+ If neither function is supported by the host environment then attempting to set
+ CRYPTO to true will fail and an exception will be thrown.
+
+
+ If CRYPTO is false then the source of randomness used will be
+ Math.random (which is assumed to generate at least 30 bits of
+ randomness).
+
+ See random .
+
+
+// Node.js
+global.crypto = require('crypto')
+
+BigNumber.config({ CRYPTO: true })
+BigNumber.config().CRYPTO // true
+BigNumber.random() // 0.54340758610486147524
+
+
+
+
+ MODULO_MODE
+
+ number : integer, 0 to 9 inclusive
+ Default value: 1 (ROUND_DOWN )
+
+ The modulo mode used when calculating the modulus: a mod n.
+
+ The quotient, q = a / n, is calculated according to the
+ ROUNDING_MODE that corresponds to the chosen
+ MODULO_MODE.
+
+ The remainder, r, is calculated as: r = a - n * q.
+
+ The modes that are most commonly used for the modulus/remainder operation are shown in
+ the following table. Although the other rounding modes can be used, they may not give
+ useful results.
+
+
+
+ Property Value Description
+
+ ROUND_UP 0
+
+ The remainder is positive if the dividend is negative, otherwise it is negative.
+
+
+
+ ROUND_DOWN 1
+
+ The remainder has the same sign as the dividend.
+ This uses 'truncating division' and matches the behaviour of JavaScript's
+ remainder operator %.
+
+
+
+ ROUND_FLOOR 3
+
+ The remainder has the same sign as the divisor.
+ This matches Python's % operator.
+
+
+
+ ROUND_HALF_EVEN 6
+ The IEEE 754 remainder function.
+
+
+ EUCLID 9
+
+ The remainder is always positive. Euclidian division:
+ q = sign(n) * floor(a / abs(n))
+
+
+
+
+
+ The rounding/modulo modes are available as enumerated properties of the BigNumber
+ constructor.
+
+ See modulo .
+
+ BigNumber.config({ MODULO_MODE: BigNumber.EUCLID })
+BigNumber.config({ MODULO_MODE: 9 }) // equivalent
+
+
+
+
+ POW_PRECISION
+
+ number : integer, 0 to 1e+9 inclusive.
+ Default value: 0
+
+
+ The maximum precision, i.e. number of significant digits, of the result of the power
+ operation (unless a modulus is specified).
+
+ If set to 0, the number of significant digits will not be limited.
+ See exponentiatedBy .
+ BigNumber.config({ POW_PRECISION: 100 })
+
+
+
+ FORMAT
+ object
+
+ The FORMAT object configures the format of the string returned by the
+ toFormat method.
+
+
+ The example below shows the properties of the FORMAT object that are
+ recognised, and their default values.
+
+
+ Unlike the other configuration properties, the values of the properties of the
+ FORMAT object will not be checked for validity. The existing
+ FORMAT object will simply be replaced by the object that is passed in.
+ The object can include any number of the properties shown below.
+
+ See toFormat for examples of usage.
+
+
+BigNumber.config({
+ FORMAT: {
+ // string to prepend
+ prefix: '',
+ // decimal separator
+ decimalSeparator: '.',
+ // grouping separator of the integer part
+ groupSeparator: ',',
+ // primary grouping size of the integer part
+ groupSize: 3,
+ // secondary grouping size of the integer part
+ secondaryGroupSize: 0,
+ // grouping separator of the fraction part
+ fractionGroupSeparator: ' ',
+ // grouping size of the fraction part
+ fractionGroupSize: 0,
+ // string to append
+ suffix: ''
+ }
+});
+
+
+
+
+ ALPHABET
+
+ string
+ Default value: '0123456789abcdefghijklmnopqrstuvwxyz'
+
+
+ The alphabet used for base conversion. The length of the alphabet corresponds to the
+ maximum value of the base argument that can be passed to the
+ BigNumber constructor or
+ toString .
+
+
+ There is no maximum length for the alphabet, but it must be at least 2 characters long, and
+ it must not contain whitespace or a repeated character, or the sign indicators
+ '+' and '-', or the decimal separator '.'.
+
+
+ // duodecimal (base 12)
+BigNumber.config({ ALPHABET: '0123456789TE' })
+x = new BigNumber('T', 12)
+x.toString() // '10'
+x.toString(12) // 'T'
+
+
+
+
+
+
+
Returns an object with the above properties and their current values.
+
+ Throws if object is not an object, or if an invalid value is assigned to
+ one or more of the above properties. See Errors .
+
+
+BigNumber.config({
+ DECIMAL_PLACES: 40,
+ ROUNDING_MODE: BigNumber.ROUND_HALF_CEIL,
+ EXPONENTIAL_AT: [-10, 20],
+ RANGE: [-500, 500],
+ CRYPTO: true,
+ MODULO_MODE: BigNumber.ROUND_FLOOR,
+ POW_PRECISION: 80,
+ FORMAT: {
+ groupSize: 3,
+ groupSeparator: ' ',
+ decimalSeparator: ','
+ },
+ ALPHABET: '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_'
+});
+
+obj = BigNumber.config();
+obj.DECIMAL_PLACES // 40
+obj.RANGE // [-500, 500]
+
+
+
+
+ isBigNumber.isBigNumber(value) ⇒ boolean
+
+
value: any
+
+ Returns true if value is a BigNumber instance, otherwise returns
+ false.
+
+
x = 42
+y = new BigNumber(x)
+
+BigNumber.isBigNumber(x) // false
+y instanceof BigNumber // true
+BigNumber.isBigNumber(y) // true
+
+BN = BigNumber.clone();
+z = new BN(x)
+z instanceof BigNumber // false
+BigNumber.isBigNumber(z) // true
+
+ If value is a BigNumber instance and BigNumber.DEBUG is true,
+ then this method will also check if value is well-formed, and throw if it is not.
+ See Errors .
+
+
+ The check can be useful if creating a BigNumber from an object literal.
+ See BigNumber .
+
+
+x = new BigNumber(10)
+
+// Change x.c to an illegitimate value.
+x.c = NaN
+
+BigNumber.DEBUG = false
+
+// No error.
+BigNumber.isBigNumber(x) // true
+
+BigNumber.DEBUG = true
+
+// Error.
+BigNumber.isBigNumber(x) // '[BigNumber Error] Invalid BigNumber'
+
+
+
+
maximum.max(n...) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ See BigNumber for further parameter details.
+
+
+ Returns a BigNumber whose value is the maximum of the arguments.
+
+
The return value is always exact and unrounded.
+
x = new BigNumber('3257869345.0378653')
+BigNumber.maximum(4e9, x, '123456789.9') // '4000000000'
+
+arr = [12, '13', new BigNumber(14)]
+BigNumber.max.apply(null, arr) // '14'
+
+
+
+
minimum.min(n...) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ See BigNumber for further parameter details.
+
+
+ Returns a BigNumber whose value is the minimum of the arguments.
+
+
The return value is always exact and unrounded.
+
x = new BigNumber('3257869345.0378653')
+BigNumber.minimum(4e9, x, '123456789.9') // '123456789.9'
+
+arr = [2, new BigNumber(-14), '-15.9999', -12]
+BigNumber.min.apply(null, arr) // '-15.9999'
+
+
+
+
+ random.random([dp]) ⇒ BigNumber
+
+
dp: number : integer, 0 to 1e+9 inclusive
+
+ Returns a new BigNumber with a pseudo-random value equal to or greater than 0 and
+ less than 1.
+
+
+ The return value will have dp decimal places (or less if trailing zeros are
+ produced).
+ If dp is omitted then the number of decimal places will default to the current
+ DECIMAL_PLACES setting.
+
+
+ Depending on the value of this BigNumber constructor's
+ CRYPTO setting and the support for the
+ crypto object in the host environment, the random digits of the return value are
+ generated by either Math.random (fastest), crypto.getRandomValues
+ (Web Cryptography API in recent browsers) or crypto.randomBytes (Node.js).
+
+
+ To be able to set CRYPTO to true when using
+ Node.js, the crypto object must be available globally:
+
+
global.crypto = require('crypto')
+
+ If CRYPTO is true, i.e. one of the
+ crypto methods is to be used, the value of a returned BigNumber should be
+ cryptographically-secure and statistically indistinguishable from a random value.
+
+
+ Throws if dp is invalid. See Errors .
+
+
BigNumber.config({ DECIMAL_PLACES: 10 })
+BigNumber.random() // '0.4117936847'
+BigNumber.random(20) // '0.78193327636914089009'
+
+
+
+
sum.sum(n...) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ See BigNumber for further parameter details.
+
+
Returns a BigNumber whose value is the sum of the arguments.
+
The return value is always exact and unrounded.
+
x = new BigNumber('3257869345.0378653')
+BigNumber.sum(4e9, x, '123456789.9') // '7381326134.9378653'
+
+arr = [2, new BigNumber(14), '15.9999', 12]
+BigNumber.sum.apply(null, arr) // '43.9999'
+
+
+
+
Properties
+
+ The library's enumerated rounding modes are stored as properties of the constructor.
+ (They are not referenced internally by the library itself.)
+
+
+ Rounding modes 0 to 6 (inclusive) are the same as those of Java's
+ BigDecimal class.
+
+
+
+ Property
+ Value
+ Description
+
+
+ ROUND_UP
+ 0
+ Rounds away from zero
+
+
+ ROUND_DOWN
+ 1
+ Rounds towards zero
+
+
+ ROUND_CEIL
+ 2
+ Rounds towards Infinity
+
+
+ ROUND_FLOOR
+ 3
+ Rounds towards -Infinity
+
+
+ ROUND_HALF_UP
+ 4
+
+ Rounds towards nearest neighbour.
+ If equidistant, rounds away from zero
+
+
+
+ ROUND_HALF_DOWN
+ 5
+
+ Rounds towards nearest neighbour.
+ If equidistant, rounds towards zero
+
+
+
+ ROUND_HALF_EVEN
+ 6
+
+ Rounds towards nearest neighbour.
+ If equidistant, rounds towards even neighbour
+
+
+
+ ROUND_HALF_CEIL
+ 7
+
+ Rounds towards nearest neighbour.
+ If equidistant, rounds towards Infinity
+
+
+
+ ROUND_HALF_FLOOR
+ 8
+
+ Rounds towards nearest neighbour.
+ If equidistant, rounds towards -Infinity
+
+
+
+
+BigNumber.config({ ROUNDING_MODE: BigNumber.ROUND_CEIL })
+BigNumber.config({ ROUNDING_MODE: 2 }) // equivalent
+
+
DEBUG
+
undefined|false|true
+
+ If BigNumber.DEBUG is set true then an error will be thrown
+ if this BigNumber constructor receives an invalid value, such as
+ a value of type number with more than 15 significant digits.
+ See BigNumber .
+
+
+ An error will also be thrown if the isBigNumber
+ method receives a BigNumber that is not well-formed.
+ See isBigNumber .
+
+
BigNumber.DEBUG = true
+
+
+
INSTANCE
+
+
+
Methods
+
The methods inherited by a BigNumber instance from its constructor's prototype object.
+
A BigNumber is immutable in the sense that it is not changed by its methods.
+
+ The treatment of ±0, ±Infinity and NaN is
+ consistent with how JavaScript treats these values.
+
+
Many method names have a shorter alias.
+
+
+
+
absoluteValue.abs() ⇒ BigNumber
+
+ Returns a BigNumber whose value is the absolute value, i.e. the magnitude, of the value of
+ this BigNumber.
+
+
The return value is always exact and unrounded.
+
+x = new BigNumber(-0.8)
+y = x.absoluteValue() // '0.8'
+z = y.abs() // '0.8'
+
+
+
+
+ comparedTo.comparedTo(n [, base]) ⇒ number
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns
+
+ 1
+ If the value of this BigNumber is greater than the value of n
+
+
+ -1
+ If the value of this BigNumber is less than the value of n
+
+
+ 0
+ If this BigNumber and n have the same value
+
+
+ null
+ If the value of either this BigNumber or n is NaN
+
+
+
+x = new BigNumber(Infinity)
+y = new BigNumber(5)
+x.comparedTo(y) // 1
+x.comparedTo(x.minus(1)) // 0
+y.comparedTo(NaN) // null
+y.comparedTo('110', 2) // -1
+
+
+
+
+ decimalPlaces.dp([dp [, rm]]) ⇒ BigNumber|number
+
+
+ dp: number : integer, 0 to 1e+9 inclusive
+ rm: number : integer, 0 to 8 inclusive
+
+
+ If dp is a number, returns a BigNumber whose value is the value of this BigNumber
+ rounded by rounding mode rm to a maximum of dp decimal places.
+
+
+ If dp is omitted, or is null or undefined, the return
+ value is the number of decimal places of the value of this BigNumber, or null if
+ the value of this BigNumber is ±Infinity or NaN.
+
+
+ If rm is omitted, or is null or undefined,
+ ROUNDING_MODE is used.
+
+
+ Throws if dp or rm is invalid. See Errors .
+
+
+x = new BigNumber(1234.56)
+x.decimalPlaces(1) // '1234.6'
+x.dp() // 2
+x.decimalPlaces(2) // '1234.56'
+x.dp(10) // '1234.56'
+x.decimalPlaces(0, 1) // '1234'
+x.dp(0, 6) // '1235'
+x.decimalPlaces(1, 1) // '1234.5'
+x.dp(1, BigNumber.ROUND_HALF_EVEN) // '1234.6'
+x // '1234.56'
+y = new BigNumber('9.9e-101')
+y.dp() // 102
+
+
+
+
dividedBy.div(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns a BigNumber whose value is the value of this BigNumber divided by
+ n, rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings.
+
+
+x = new BigNumber(355)
+y = new BigNumber(113)
+x.dividedBy(y) // '3.14159292035398230088'
+x.div(5) // '71'
+x.div(47, 16) // '5'
+
+
+
+
+ dividedToIntegerBy.idiv(n [, base]) ⇒
+ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns a BigNumber whose value is the integer part of dividing the value of this BigNumber by
+ n.
+
+
+x = new BigNumber(5)
+y = new BigNumber(3)
+x.dividedToIntegerBy(y) // '1'
+x.idiv(0.7) // '7'
+x.idiv('0.f', 16) // '5'
+
+
+
+
+ exponentiatedBy.pow(n [, m]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber : integer
+ m: number|string|BigNumber
+
+
+ Returns a BigNumber whose value is the value of this BigNumber exponentiated by
+ n, i.e. raised to the power n, and optionally modulo a modulus
+ m.
+
+
+ Throws if n is not an integer. See Errors .
+
+
+ If n is negative the result is rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings.
+
+
+ As the number of digits of the result of the power operation can grow so large so quickly,
+ e.g. 123.45610000 has over 50000 digits, the number of significant
+ digits calculated is limited to the value of the
+ POW_PRECISION setting (unless a modulus
+ m is specified).
+
+
+ By default POW_PRECISION is set to 0.
+ This means that an unlimited number of significant digits will be calculated, and that the
+ method's performance will decrease dramatically for larger exponents.
+
+
+ If m is specified and the value of m, n and this
+ BigNumber are integers, and n is positive, then a fast modular exponentiation
+ algorithm is used, otherwise the operation will be performed as
+ x.exponentiatedBy(n).modulo(m) with a
+ POW_PRECISION of 0.
+
+
+Math.pow(0.7, 2) // 0.48999999999999994
+x = new BigNumber(0.7)
+x.exponentiatedBy(2) // '0.49'
+BigNumber(3).pow(-2) // '0.11111111111111111111'
+
+
+
+
+ integerValue.integerValue([rm]) ⇒ BigNumber
+
+
+ rm: number : integer, 0 to 8 inclusive
+
+
+ Returns a BigNumber whose value is the value of this BigNumber rounded to an integer using
+ rounding mode rm.
+
+
+ If rm is omitted, or is null or undefined,
+ ROUNDING_MODE is used.
+
+
+ Throws if rm is invalid. See Errors .
+
+
+x = new BigNumber(123.456)
+x.integerValue() // '123'
+x.integerValue(BigNumber.ROUND_CEIL) // '124'
+y = new BigNumber(-12.7)
+y.integerValue() // '-13'
+y.integerValue(BigNumber.ROUND_DOWN) // '-12'
+
+ The following is an example of how to add a prototype method that emulates JavaScript's
+ Math.round function. Math.ceil, Math.floor and
+ Math.trunc can be emulated in the same way with
+ BigNumber.ROUND_CEIL, BigNumber.ROUND_FLOOR and
+ BigNumber.ROUND_DOWN respectively.
+
+
+BigNumber.prototype.round = function (n) {
+ return n.integerValue(BigNumber.ROUND_HALF_CEIL);
+};
+x.round() // '123'
+
+
+
+
isEqualTo.eq(n [, base]) ⇒ boolean
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns true if the value of this BigNumber is equal to the value of
+ n, otherwise returns false.
+ As with JavaScript, NaN does not equal NaN.
+
+
Note: This method uses the comparedTo method internally.
+
+0 === 1e-324 // true
+x = new BigNumber(0)
+x.isEqualTo('1e-324') // false
+BigNumber(-0).eq(x) // true ( -0 === 0 )
+BigNumber(255).eq('ff', 16) // true
+
+y = new BigNumber(NaN)
+y.isEqualTo(NaN) // false
+
+
+
+
isFinite.isFinite() ⇒ boolean
+
+ Returns true if the value of this BigNumber is a finite number, otherwise
+ returns false.
+
+
+ The only possible non-finite values of a BigNumber are NaN, Infinity
+ and -Infinity.
+
+
+x = new BigNumber(1)
+x.isFinite() // true
+y = new BigNumber(Infinity)
+y.isFinite() // false
+
+ Note: The native method isFinite() can be used if
+ n <= Number.MAX_VALUE.
+
+
+
+
+
isGreaterThan.gt(n [, base]) ⇒ boolean
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns true if the value of this BigNumber is greater than the value of
+ n, otherwise returns false.
+
+
Note: This method uses the comparedTo method internally.
+
+0.1 > (0.3 - 0.2) // true
+x = new BigNumber(0.1)
+x.isGreaterThan(BigNumber(0.3).minus(0.2)) // false
+BigNumber(0).gt(x) // false
+BigNumber(11, 3).gt(11.1, 2) // true
+
+
+
+
+ isGreaterThanOrEqualTo.gte(n [, base]) ⇒ boolean
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns true if the value of this BigNumber is greater than or equal to the value
+ of n, otherwise returns false.
+
+
Note: This method uses the comparedTo method internally.
+
+(0.3 - 0.2) >= 0.1 // false
+x = new BigNumber(0.3).minus(0.2)
+x.isGreaterThanOrEqualTo(0.1) // true
+BigNumber(1).gte(x) // true
+BigNumber(10, 18).gte('i', 36) // true
+
+
+
+
isInteger.isInteger() ⇒ boolean
+
+ Returns true if the value of this BigNumber is an integer, otherwise returns
+ false.
+
+
+x = new BigNumber(1)
+x.isInteger() // true
+y = new BigNumber(123.456)
+y.isInteger() // false
+
+
+
+
isLessThan.lt(n [, base]) ⇒ boolean
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns true if the value of this BigNumber is less than the value of
+ n, otherwise returns false.
+
+
Note: This method uses the comparedTo method internally.
+
+(0.3 - 0.2) < 0.1 // true
+x = new BigNumber(0.3).minus(0.2)
+x.isLessThan(0.1) // false
+BigNumber(0).lt(x) // true
+BigNumber(11.1, 2).lt(11, 3) // true
+
+
+
+
+ isLessThanOrEqualTo.lte(n [, base]) ⇒ boolean
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns true if the value of this BigNumber is less than or equal to the value of
+ n, otherwise returns false.
+
+
Note: This method uses the comparedTo method internally.
+
+0.1 <= (0.3 - 0.2) // false
+x = new BigNumber(0.1)
+x.isLessThanOrEqualTo(BigNumber(0.3).minus(0.2)) // true
+BigNumber(-1).lte(x) // true
+BigNumber(10, 18).lte('i', 36) // true
+
+
+
+
isNaN.isNaN() ⇒ boolean
+
+ Returns true if the value of this BigNumber is NaN, otherwise
+ returns false.
+
+
+x = new BigNumber(NaN)
+x.isNaN() // true
+y = new BigNumber('Infinity')
+y.isNaN() // false
+
Note: The native method isNaN() can also be used.
+
+
+
+
isNegative.isNegative() ⇒ boolean
+
+ Returns true if the sign of this BigNumber is negative, otherwise returns
+ false.
+
+
+x = new BigNumber(-0)
+x.isNegative() // true
+y = new BigNumber(2)
+y.isNegative() // false
+
Note: n < 0 can be used if n <= -Number.MIN_VALUE.
+
+
+
+
isPositive.isPositive() ⇒ boolean
+
+ Returns true if the sign of this BigNumber is positive, otherwise returns
+ false.
+
+
+x = new BigNumber(-0)
+x.isPositive() // false
+y = new BigNumber(2)
+y.isPositive() // true
+
+
+
+
isZero.isZero() ⇒ boolean
+
+ Returns true if the value of this BigNumber is zero or minus zero, otherwise
+ returns false.
+
+
+x = new BigNumber(-0)
+x.isZero() && x.isNegative() // true
+y = new BigNumber(Infinity)
+y.isZero() // false
+
Note: n == 0 can be used if n >= Number.MIN_VALUE.
+
+
+
+
+ minus.minus(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
Returns a BigNumber whose value is the value of this BigNumber minus n.
+
The return value is always exact and unrounded.
+
+0.3 - 0.1 // 0.19999999999999998
+x = new BigNumber(0.3)
+x.minus(0.1) // '0.2'
+x.minus(0.6, 20) // '0'
+
+
+
+
modulo.mod(n [, base]) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns a BigNumber whose value is the value of this BigNumber modulo n, i.e.
+ the integer remainder of dividing this BigNumber by n.
+
+
+ The value returned, and in particular its sign, is dependent on the value of the
+ MODULO_MODE setting of this BigNumber constructor.
+ If it is 1 (default value), the result will have the same sign as this BigNumber,
+ and it will match that of Javascript's % operator (within the limits of double
+ precision) and BigDecimal's remainder method.
+
+
The return value is always exact and unrounded.
+
+ See MODULO_MODE for a description of the other
+ modulo modes.
+
+
+1 % 0.9 // 0.09999999999999998
+x = new BigNumber(1)
+x.modulo(0.9) // '0.1'
+y = new BigNumber(33)
+y.mod('a', 33) // '3'
+
+
+
+
+ multipliedBy.times(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
+ Returns a BigNumber whose value is the value of this BigNumber multiplied by n.
+
+
The return value is always exact and unrounded.
+
+0.6 * 3 // 1.7999999999999998
+x = new BigNumber(0.6)
+y = x.multipliedBy(3) // '1.8'
+BigNumber('7e+500').times(y) // '1.26e+501'
+x.multipliedBy('-a', 16) // '-6'
+
+
+
+
negated.negated() ⇒ BigNumber
+
+ Returns a BigNumber whose value is the value of this BigNumber negated, i.e. multiplied by
+ -1.
+
+
+x = new BigNumber(1.8)
+x.negated() // '-1.8'
+y = new BigNumber(-1.3)
+y.negated() // '1.3'
+
+
+
+
plus.plus(n [, base]) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+
Returns a BigNumber whose value is the value of this BigNumber plus n.
+
The return value is always exact and unrounded.
+
+0.1 + 0.2 // 0.30000000000000004
+x = new BigNumber(0.1)
+y = x.plus(0.2) // '0.3'
+BigNumber(0.7).plus(x).plus(y) // '1'
+x.plus('0.1', 8) // '0.225'
+
+
+
+
+ precision.sd([d [, rm]]) ⇒ BigNumber|number
+
+
+ d: number|boolean : integer, 1 to 1e+9
+ inclusive, or true or false
+ rm: number : integer, 0 to 8 inclusive.
+
+
+ If d is a number, returns a BigNumber whose value is the value of this BigNumber
+ rounded to a precision of d significant digits using rounding mode
+ rm.
+
+
+ If d is omitted or is null or undefined, the return
+ value is the number of significant digits of the value of this BigNumber, or null
+ if the value of this BigNumber is ±Infinity or NaN.
+
+
+ If d is true then any trailing zeros of the integer
+ part of a number are counted as significant digits, otherwise they are not.
+
+
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE will be used.
+
+
+ Throws if d or rm is invalid. See Errors .
+
+
+x = new BigNumber(9876.54321)
+x.precision(6) // '9876.54'
+x.sd() // 9
+x.precision(6, BigNumber.ROUND_UP) // '9876.55'
+x.sd(2) // '9900'
+x.precision(2, 1) // '9800'
+x // '9876.54321'
+y = new BigNumber(987000)
+y.precision() // 3
+y.sd(true) // 6
+
+
+
+
shiftedBy.shiftedBy(n) ⇒ BigNumber
+
+ n: number : integer,
+ -9007199254740991 to 9007199254740991 inclusive
+
+
+ Returns a BigNumber whose value is the value of this BigNumber shifted by n
+ places.
+
+ The shift is of the decimal point, i.e. of powers of ten, and is to the left if n
+ is negative or to the right if n is positive.
+
+
The return value is always exact and unrounded.
+
+ Throws if n is invalid. See Errors .
+
+
+x = new BigNumber(1.23)
+x.shiftedBy(3) // '1230'
+x.shiftedBy(-3) // '0.00123'
+
+
+
+
squareRoot.sqrt() ⇒ BigNumber
+
+ Returns a BigNumber whose value is the square root of the value of this BigNumber,
+ rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings.
+
+
+ The return value will be correctly rounded, i.e. rounded as if the result was first calculated
+ to an infinite number of correct digits before rounding.
+
+
+x = new BigNumber(16)
+x.squareRoot() // '4'
+y = new BigNumber(3)
+y.sqrt() // '1.73205080756887729353'
+
+
+
+
+ toExponential.toExponential([dp [, rm]]) ⇒ string
+
+
+ dp: number : integer, 0 to 1e+9 inclusive
+ rm: number : integer, 0 to 8 inclusive
+
+
+ Returns a string representing the value of this BigNumber in exponential notation rounded
+ using rounding mode rm to dp decimal places, i.e with one digit
+ before the decimal point and dp digits after it.
+
+
+ If the value of this BigNumber in exponential notation has fewer than dp fraction
+ digits, the return value will be appended with zeros accordingly.
+
+
+ If dp is omitted, or is null or undefined, the number
+ of digits after the decimal point defaults to the minimum number of digits necessary to
+ represent the value exactly.
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+
+
+ Throws if dp or rm is invalid. See Errors .
+
+
+x = 45.6
+y = new BigNumber(x)
+x.toExponential() // '4.56e+1'
+y.toExponential() // '4.56e+1'
+x.toExponential(0) // '5e+1'
+y.toExponential(0) // '5e+1'
+x.toExponential(1) // '4.6e+1'
+y.toExponential(1) // '4.6e+1'
+y.toExponential(1, 1) // '4.5e+1' (ROUND_DOWN)
+x.toExponential(3) // '4.560e+1'
+y.toExponential(3) // '4.560e+1'
+
+
+
+
+ toFixed.toFixed([dp [, rm]]) ⇒ string
+
+
+ dp: number : integer, 0 to 1e+9 inclusive
+ rm: number : integer, 0 to 8 inclusive
+
+
+ Returns a string representing the value of this BigNumber in normal (fixed-point) notation
+ rounded to dp decimal places using rounding mode rm.
+
+
+ If the value of this BigNumber in normal notation has fewer than dp fraction
+ digits, the return value will be appended with zeros accordingly.
+
+
+ Unlike Number.prototype.toFixed, which returns exponential notation if a number
+ is greater or equal to 1021 , this method will always return normal
+ notation.
+
+
+ If dp is omitted or is null or undefined, the return
+ value will be unrounded and in normal notation. This is also unlike
+ Number.prototype.toFixed, which returns the value to zero decimal places.
+ It is useful when fixed-point notation is required and the current
+ EXPONENTIAL_AT setting causes
+ toString to return exponential notation.
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+
+
+ Throws if dp or rm is invalid. See Errors .
+
+
+x = 3.456
+y = new BigNumber(x)
+x.toFixed() // '3'
+y.toFixed() // '3.456'
+y.toFixed(0) // '3'
+x.toFixed(2) // '3.46'
+y.toFixed(2) // '3.46'
+y.toFixed(2, 1) // '3.45' (ROUND_DOWN)
+x.toFixed(5) // '3.45600'
+y.toFixed(5) // '3.45600'
+
+
+
+
+ toFormat.toFormat([dp [, rm[, format]]]) ⇒ string
+
+
+ dp: number : integer, 0 to 1e+9 inclusive
+ rm: number : integer, 0 to 8 inclusive
+ format: object : see FORMAT
+
+
+
+ Returns a string representing the value of this BigNumber in normal (fixed-point) notation
+ rounded to dp decimal places using rounding mode rm, and formatted
+ according to the properties of the format object.
+
+
+ See FORMAT and the examples below for the properties of the
+ format object, their types, and their usage. A formatting object may contain
+ some or all of the recognised properties.
+
+
+ If dp is omitted or is null or undefined, then the
+ return value is not rounded to a fixed number of decimal places.
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+ If format is omitted or is null or undefined, the
+ FORMAT object is used.
+
+
+ Throws if dp, rm or format is invalid. See
+ Errors .
+
+
+fmt = {
+ prefix = '',
+ decimalSeparator: '.',
+ groupSeparator: ',',
+ groupSize: 3,
+ secondaryGroupSize: 0,
+ fractionGroupSeparator: ' ',
+ fractionGroupSize: 0,
+ suffix = ''
+}
+
+x = new BigNumber('123456789.123456789')
+
+// Set the global formatting options
+BigNumber.config({ FORMAT: fmt })
+
+x.toFormat() // '123,456,789.123456789'
+x.toFormat(3) // '123,456,789.123'
+
+// If a reference to the object assigned to FORMAT has been retained,
+// the format properties can be changed directly
+fmt.groupSeparator = ' '
+fmt.fractionGroupSize = 5
+x.toFormat() // '123 456 789.12345 6789'
+
+// Alternatively, pass the formatting options as an argument
+fmt = {
+ prefix: '=> ',
+ decimalSeparator: ',',
+ groupSeparator: '.',
+ groupSize: 3,
+ secondaryGroupSize: 2
+}
+
+x.toFormat() // '123 456 789.12345 6789'
+x.toFormat(fmt) // '=> 12.34.56.789,123456789'
+x.toFormat(2, fmt) // '=> 12.34.56.789,12'
+x.toFormat(3, BigNumber.ROUND_UP, fmt) // '=> 12.34.56.789,124'
+
+
+
+
+ toFraction.toFraction([maximum_denominator])
+ ⇒ [BigNumber, BigNumber]
+
+
+ maximum_denominator:
+ number|string|BigNumber : integer >= 1 and <=
+ Infinity
+
+
+ Returns an array of two BigNumbers representing the value of this BigNumber as a simple
+ fraction with an integer numerator and an integer denominator. The denominator will be a
+ positive non-zero value less than or equal to maximum_denominator.
+
+
+ If a maximum_denominator is not specified, or is null or
+ undefined, the denominator will be the lowest value necessary to represent the
+ number exactly.
+
+
+ Throws if maximum_denominator is invalid. See Errors .
+
+
+x = new BigNumber(1.75)
+x.toFraction() // '7, 4'
+
+pi = new BigNumber('3.14159265358')
+pi.toFraction() // '157079632679,50000000000'
+pi.toFraction(100000) // '312689, 99532'
+pi.toFraction(10000) // '355, 113'
+pi.toFraction(100) // '311, 99'
+pi.toFraction(10) // '22, 7'
+pi.toFraction(1) // '3, 1'
+
+
+
+
toJSON.toJSON() ⇒ string
+
As valueOf .
+
+x = new BigNumber('177.7e+457')
+y = new BigNumber(235.4325)
+z = new BigNumber('0.0098074')
+
+// Serialize an array of three BigNumbers
+str = JSON.stringify( [x, y, z] )
+// "["1.777e+459","235.4325","0.0098074"]"
+
+// Return an array of three BigNumbers
+JSON.parse(str, function (key, val) {
+ return key === '' ? val : new BigNumber(val)
+})
+
+
+
+
toNumber.toNumber() ⇒ number
+
Returns the value of this BigNumber as a JavaScript number primitive.
+
+ This method is identical to using type coercion with the unary plus operator.
+
+
+x = new BigNumber(456.789)
+x.toNumber() // 456.789
++x // 456.789
+
+y = new BigNumber('45987349857634085409857349856430985')
+y.toNumber() // 4.598734985763409e+34
+
+z = new BigNumber(-0)
+1 / z.toNumber() // -Infinity
+1 / +z // -Infinity
+
+
+
+
+ toPrecision.toPrecision([sd [, rm]]) ⇒ string
+
+
+ sd: number : integer, 1 to 1e+9 inclusive
+ rm: number : integer, 0 to 8 inclusive
+
+
+ Returns a string representing the value of this BigNumber rounded to sd
+ significant digits using rounding mode rm.
+
+
+ If sd is less than the number of digits necessary to represent the integer part
+ of the value in normal (fixed-point) notation, then exponential notation is used.
+
+
+ If sd is omitted, or is null or undefined, then the
+ return value is the same as n.toString().
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+
+
+ Throws if sd or rm is invalid. See Errors .
+
+
+x = 45.6
+y = new BigNumber(x)
+x.toPrecision() // '45.6'
+y.toPrecision() // '45.6'
+x.toPrecision(1) // '5e+1'
+y.toPrecision(1) // '5e+1'
+y.toPrecision(2, 0) // '4.6e+1' (ROUND_UP)
+y.toPrecision(2, 1) // '4.5e+1' (ROUND_DOWN)
+x.toPrecision(5) // '45.600'
+y.toPrecision(5) // '45.600'
+
+
+
+
toString.toString([base]) ⇒ string
+
+ base: number : integer, 2 to ALPHABET.length
+ inclusive (see ALPHABET ).
+
+
+ Returns a string representing the value of this BigNumber in the specified base, or base
+ 10 if base is omitted or is null or
+ undefined.
+
+
+ For bases above 10, and using the default base conversion alphabet
+ (see ALPHABET ), values from 10 to
+ 35 are represented by a-z
+ (as with Number.prototype.toString).
+
+
+ If a base is specified the value is rounded according to the current
+ DECIMAL_PLACES
+ and ROUNDING_MODE settings.
+
+
+ If a base is not specified, and this BigNumber has a positive
+ exponent that is equal to or greater than the positive component of the
+ current EXPONENTIAL_AT setting,
+ or a negative exponent equal to or less than the negative component of the
+ setting, then exponential notation is returned.
+
+
If base is null or undefined it is ignored.
+
+ Throws if base is invalid. See Errors .
+
+
+x = new BigNumber(750000)
+x.toString() // '750000'
+BigNumber.config({ EXPONENTIAL_AT: 5 })
+x.toString() // '7.5e+5'
+
+y = new BigNumber(362.875)
+y.toString(2) // '101101010.111'
+y.toString(9) // '442.77777777777777777778'
+y.toString(32) // 'ba.s'
+
+BigNumber.config({ DECIMAL_PLACES: 4 });
+z = new BigNumber('1.23456789')
+z.toString() // '1.23456789'
+z.toString(10) // '1.2346'
+
+
+
+
valueOf.valueOf() ⇒ string
+
+ As toString , but does not accept a base argument and includes
+ the minus sign for negative zero.
+
+
+x = new BigNumber('-0')
+x.toString() // '0'
+x.valueOf() // '-0'
+y = new BigNumber('1.777e+457')
+y.valueOf() // '1.777e+457'
+
+
+
+
Properties
+
The properties of a BigNumber instance:
+
+
+ Property
+ Description
+ Type
+ Value
+
+
+ c
+ coefficient*
+ number []
+ Array of base 1e14 numbers
+
+
+ e
+ exponent
+ number
+ Integer, -1000000000 to 1000000000 inclusive
+
+
+ s
+ sign
+ number
+ -1 or 1
+
+
+
* significand
+
+ The value of any of the c, e and s properties may also
+ be null.
+
+
+ The above properties are best considered to be read-only. In early versions of this library it
+ was okay to change the exponent of a BigNumber by writing to its exponent property directly,
+ but this is no longer reliable as the value of the first element of the coefficient array is
+ now dependent on the exponent.
+
+
+ Note that, as with JavaScript numbers, the original exponent and fractional trailing zeros are
+ not necessarily preserved.
+
+
x = new BigNumber(0.123) // '0.123'
+x.toExponential() // '1.23e-1'
+x.c // '1,2,3'
+x.e // -1
+x.s // 1
+
+y = new Number(-123.4567000e+2) // '-12345.67'
+y.toExponential() // '-1.234567e+4'
+z = new BigNumber('-123.4567000e+2') // '-12345.67'
+z.toExponential() // '-1.234567e+4'
+z.c // '1,2,3,4,5,6,7'
+z.e // 4
+z.s // -1
+
+
+
+
Zero, NaN and Infinity
+
+ The table below shows how ±0, NaN and
+ ±Infinity are stored.
+
+
+
+
+ c
+ e
+ s
+
+
+ ±0
+ [0]
+ 0
+ ±1
+
+
+ NaN
+ null
+ null
+ null
+
+
+ ±Infinity
+ null
+ null
+ ±1
+
+
+
+x = new Number(-0) // 0
+1 / x == -Infinity // true
+
+y = new BigNumber(-0) // '0'
+y.c // '0' ( [0].toString() )
+y.e // 0
+y.s // -1
+
+
+
+
Errors
+
The table below shows the errors that are thrown.
+
+ The errors are generic Error objects whose message begins
+ '[BigNumber Error]'.
+
+
+
+ Method
+ Throws
+
+
+
+ BigNumber
+ comparedTo
+ dividedBy
+ dividedToIntegerBy
+ isEqualTo
+ isGreaterThan
+ isGreaterThanOrEqualTo
+ isLessThan
+ isLessThanOrEqualTo
+ minus
+ modulo
+ plus
+ multipliedBy
+
+ Base not a primitive number
+
+
+ Base not an integer
+
+
+ Base out of range
+
+
+ Number primitive has more than 15 significant digits*
+
+
+ Not a base... number*
+
+
+ Not a number*
+
+
+ clone
+ Object expected
+
+
+ config
+ Object expected
+
+
+ DECIMAL_PLACES not a primitive number
+
+
+ DECIMAL_PLACES not an integer
+
+
+ DECIMAL_PLACES out of range
+
+
+ ROUNDING_MODE not a primitive number
+
+
+ ROUNDING_MODE not an integer
+
+
+ ROUNDING_MODE out of range
+
+
+ EXPONENTIAL_AT not a primitive number
+
+
+ EXPONENTIAL_AT not an integer
+
+
+ EXPONENTIAL_AT out of range
+
+
+ RANGE not a primitive number
+
+
+ RANGE not an integer
+
+
+ RANGE cannot be zero
+
+
+ RANGE cannot be zero
+
+
+ CRYPTO not true or false
+
+
+ crypto unavailable
+
+
+ MODULO_MODE not a primitive number
+
+
+ MODULO_MODE not an integer
+
+
+ MODULO_MODE out of range
+
+
+ POW_PRECISION not a primitive number
+
+
+ POW_PRECISION not an integer
+
+
+ POW_PRECISION out of range
+
+
+ FORMAT not an object
+
+
+ ALPHABET invalid
+
+
+
+ decimalPlaces
+ precision
+ random
+ shiftedBy
+ toExponential
+ toFixed
+ toFormat
+ toPrecision
+
+ Argument not a primitive number
+
+
+ Argument not an integer
+
+
+ Argument out of range
+
+
+
+ decimalPlaces
+ precision
+
+ Argument not true or false
+
+
+ exponentiatedBy
+ Argument not an integer
+
+
+ isBigNumber
+ Invalid BigNumber*
+
+
+
+ minimum
+ maximum
+
+ Not a number*
+
+
+
+ random
+
+ crypto unavailable
+
+
+
+ toFormat
+
+ Argument not an object
+
+
+ toFraction
+ Argument not an integer
+
+
+ Argument out of range
+
+
+ toString
+ Base not a primitive number
+
+
+ Base not an integer
+
+
+ Base out of range
+
+
+
* Only thrown if BigNumber.DEBUG is true.
+
To determine if an exception is a BigNumber Error:
+
+try {
+ // ...
+} catch (e) {
+ if (e instanceof Error && e.message.indexOf('[BigNumber Error]') === 0) {
+ // ...
+ }
+}
+
+
+
+
Type coercion
+
+ To prevent the accidental use of a BigNumber in primitive number operations, or the
+ accidental addition of a BigNumber to a string, the valueOf method can be safely
+ overwritten as shown below.
+
+
+ The valueOf method is the same as the
+ toJSON method, and both are the same as the
+ toString method except they do not take a base
+ argument and they include the minus sign for negative zero.
+
+
+BigNumber.prototype.valueOf = function () {
+ throw Error('valueOf called!')
+}
+
+x = new BigNumber(1)
+x / 2 // '[BigNumber Error] valueOf called!'
+x + 'abc' // '[BigNumber Error] valueOf called!'
+
+
+
+
+
FAQ
+
+
Why are trailing fractional zeros removed from BigNumbers?
+
+ Some arbitrary-precision libraries retain trailing fractional zeros as they can indicate the
+ precision of a value. This can be useful but the results of arithmetic operations can be
+ misleading.
+
+
+x = new BigDecimal("1.0")
+y = new BigDecimal("1.1000")
+z = x.add(y) // 2.1000
+
+x = new BigDecimal("1.20")
+y = new BigDecimal("3.45000")
+z = x.multiply(y) // 4.1400000
+
+ To specify the precision of a value is to specify that the value lies
+ within a certain range.
+
+
+ In the first example, x has a value of 1.0. The trailing zero shows
+ the precision of the value, implying that it is in the range 0.95 to
+ 1.05. Similarly, the precision indicated by the trailing zeros of y
+ indicates that the value is in the range 1.09995 to 1.10005.
+
+
+ If we add the two lowest values in the ranges we have, 0.95 + 1.09995 = 2.04995,
+ and if we add the two highest values we have, 1.05 + 1.10005 = 2.15005, so the
+ range of the result of the addition implied by the precision of its operands is
+ 2.04995 to 2.15005.
+
+
+ The result given by BigDecimal of 2.1000 however, indicates that the value is in
+ the range 2.09995 to 2.10005 and therefore the precision implied by
+ its trailing zeros may be misleading.
+
+
+ In the second example, the true range is 4.122744 to 4.157256 yet
+ the BigDecimal answer of 4.1400000 indicates a range of 4.13999995
+ to 4.14000005. Again, the precision implied by the trailing zeros may be
+ misleading.
+
+
+ This library, like binary floating point and most calculators, does not retain trailing
+ fractional zeros. Instead, the toExponential, toFixed and
+ toPrecision methods enable trailing zeros to be added if and when required.
+
+
+
+
+
diff --git a/node_modules/bignumber.js/package.json b/node_modules/bignumber.js/package.json
new file mode 100644
index 0000000..475a813
--- /dev/null
+++ b/node_modules/bignumber.js/package.json
@@ -0,0 +1,40 @@
+{
+ "name": "bignumber.js",
+ "description": "A library for arbitrary-precision decimal and non-decimal arithmetic",
+ "version": "9.0.0",
+ "keywords": [
+ "arbitrary",
+ "precision",
+ "arithmetic",
+ "big",
+ "number",
+ "decimal",
+ "float",
+ "biginteger",
+ "bigdecimal",
+ "bignumber",
+ "bigint",
+ "bignum"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/MikeMcl/bignumber.js.git"
+ },
+ "main": "bignumber",
+ "module": "bignumber.mjs",
+ "browser": "bignumber.js",
+ "types": "bignumber.d.ts",
+ "author": {
+ "name": "Michael Mclaughlin",
+ "email": "M8ch88l@gmail.com"
+ },
+ "engines": {
+ "node": "*"
+ },
+ "license": "MIT",
+ "scripts": {
+ "test": "node test/test",
+ "build": "uglifyjs bignumber.js --source-map -c -m -o bignumber.min.js"
+ },
+ "dependencies": {}
+}
diff --git a/node_modules/binary-extensions/binary-extensions.json b/node_modules/binary-extensions/binary-extensions.json
new file mode 100644
index 0000000..ac08048
--- /dev/null
+++ b/node_modules/binary-extensions/binary-extensions.json
@@ -0,0 +1,263 @@
+[
+ "3dm",
+ "3ds",
+ "3g2",
+ "3gp",
+ "7z",
+ "a",
+ "aac",
+ "adp",
+ "afdesign",
+ "afphoto",
+ "afpub",
+ "ai",
+ "aif",
+ "aiff",
+ "alz",
+ "ape",
+ "apk",
+ "appimage",
+ "ar",
+ "arj",
+ "asf",
+ "au",
+ "avi",
+ "bak",
+ "baml",
+ "bh",
+ "bin",
+ "bk",
+ "bmp",
+ "btif",
+ "bz2",
+ "bzip2",
+ "cab",
+ "caf",
+ "cgm",
+ "class",
+ "cmx",
+ "cpio",
+ "cr2",
+ "cur",
+ "dat",
+ "dcm",
+ "deb",
+ "dex",
+ "djvu",
+ "dll",
+ "dmg",
+ "dng",
+ "doc",
+ "docm",
+ "docx",
+ "dot",
+ "dotm",
+ "dra",
+ "DS_Store",
+ "dsk",
+ "dts",
+ "dtshd",
+ "dvb",
+ "dwg",
+ "dxf",
+ "ecelp4800",
+ "ecelp7470",
+ "ecelp9600",
+ "egg",
+ "eol",
+ "eot",
+ "epub",
+ "exe",
+ "f4v",
+ "fbs",
+ "fh",
+ "fla",
+ "flac",
+ "flatpak",
+ "fli",
+ "flv",
+ "fpx",
+ "fst",
+ "fvt",
+ "g3",
+ "gh",
+ "gif",
+ "graffle",
+ "gz",
+ "gzip",
+ "h261",
+ "h263",
+ "h264",
+ "icns",
+ "ico",
+ "ief",
+ "img",
+ "ipa",
+ "iso",
+ "jar",
+ "jpeg",
+ "jpg",
+ "jpgv",
+ "jpm",
+ "jxr",
+ "key",
+ "ktx",
+ "lha",
+ "lib",
+ "lvp",
+ "lz",
+ "lzh",
+ "lzma",
+ "lzo",
+ "m3u",
+ "m4a",
+ "m4v",
+ "mar",
+ "mdi",
+ "mht",
+ "mid",
+ "midi",
+ "mj2",
+ "mka",
+ "mkv",
+ "mmr",
+ "mng",
+ "mobi",
+ "mov",
+ "movie",
+ "mp3",
+ "mp4",
+ "mp4a",
+ "mpeg",
+ "mpg",
+ "mpga",
+ "mxu",
+ "nef",
+ "npx",
+ "numbers",
+ "nupkg",
+ "o",
+ "odp",
+ "ods",
+ "odt",
+ "oga",
+ "ogg",
+ "ogv",
+ "otf",
+ "ott",
+ "pages",
+ "pbm",
+ "pcx",
+ "pdb",
+ "pdf",
+ "pea",
+ "pgm",
+ "pic",
+ "png",
+ "pnm",
+ "pot",
+ "potm",
+ "potx",
+ "ppa",
+ "ppam",
+ "ppm",
+ "pps",
+ "ppsm",
+ "ppsx",
+ "ppt",
+ "pptm",
+ "pptx",
+ "psd",
+ "pya",
+ "pyc",
+ "pyo",
+ "pyv",
+ "qt",
+ "rar",
+ "ras",
+ "raw",
+ "resources",
+ "rgb",
+ "rip",
+ "rlc",
+ "rmf",
+ "rmvb",
+ "rpm",
+ "rtf",
+ "rz",
+ "s3m",
+ "s7z",
+ "scpt",
+ "sgi",
+ "shar",
+ "snap",
+ "sil",
+ "sketch",
+ "slk",
+ "smv",
+ "snk",
+ "so",
+ "stl",
+ "suo",
+ "sub",
+ "swf",
+ "tar",
+ "tbz",
+ "tbz2",
+ "tga",
+ "tgz",
+ "thmx",
+ "tif",
+ "tiff",
+ "tlz",
+ "ttc",
+ "ttf",
+ "txz",
+ "udf",
+ "uvh",
+ "uvi",
+ "uvm",
+ "uvp",
+ "uvs",
+ "uvu",
+ "viv",
+ "vob",
+ "war",
+ "wav",
+ "wax",
+ "wbmp",
+ "wdp",
+ "weba",
+ "webm",
+ "webp",
+ "whl",
+ "wim",
+ "wm",
+ "wma",
+ "wmv",
+ "wmx",
+ "woff",
+ "woff2",
+ "wrm",
+ "wvx",
+ "xbm",
+ "xif",
+ "xla",
+ "xlam",
+ "xls",
+ "xlsb",
+ "xlsm",
+ "xlsx",
+ "xlt",
+ "xltm",
+ "xltx",
+ "xm",
+ "xmind",
+ "xpi",
+ "xpm",
+ "xwd",
+ "xz",
+ "z",
+ "zip",
+ "zipx"
+]
diff --git a/node_modules/binary-extensions/binary-extensions.json.d.ts b/node_modules/binary-extensions/binary-extensions.json.d.ts
new file mode 100644
index 0000000..94a248c
--- /dev/null
+++ b/node_modules/binary-extensions/binary-extensions.json.d.ts
@@ -0,0 +1,3 @@
+declare const binaryExtensionsJson: readonly string[];
+
+export = binaryExtensionsJson;
diff --git a/node_modules/binary-extensions/index.d.ts b/node_modules/binary-extensions/index.d.ts
new file mode 100644
index 0000000..f469ac5
--- /dev/null
+++ b/node_modules/binary-extensions/index.d.ts
@@ -0,0 +1,14 @@
+/**
+List of binary file extensions.
+
+@example
+```
+import binaryExtensions = require('binary-extensions');
+
+console.log(binaryExtensions);
+//=> ['3ds', '3g2', …]
+```
+*/
+declare const binaryExtensions: readonly string[];
+
+export = binaryExtensions;
diff --git a/node_modules/binary-extensions/index.js b/node_modules/binary-extensions/index.js
new file mode 100644
index 0000000..d46e468
--- /dev/null
+++ b/node_modules/binary-extensions/index.js
@@ -0,0 +1 @@
+module.exports = require('./binary-extensions.json');
diff --git a/node_modules/binary-extensions/license b/node_modules/binary-extensions/license
new file mode 100644
index 0000000..5493a1a
--- /dev/null
+++ b/node_modules/binary-extensions/license
@@ -0,0 +1,10 @@
+MIT License
+
+Copyright (c) Sindre Sorhus (https://sindresorhus.com)
+Copyright (c) Paul Miller (https://paulmillr.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/binary-extensions/package.json b/node_modules/binary-extensions/package.json
new file mode 100644
index 0000000..4710c33
--- /dev/null
+++ b/node_modules/binary-extensions/package.json
@@ -0,0 +1,40 @@
+{
+ "name": "binary-extensions",
+ "version": "2.3.0",
+ "description": "List of binary file extensions",
+ "license": "MIT",
+ "repository": "sindresorhus/binary-extensions",
+ "funding": "https://github.com/sponsors/sindresorhus",
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "https://sindresorhus.com"
+ },
+ "sideEffects": false,
+ "engines": {
+ "node": ">=8"
+ },
+ "scripts": {
+ "test": "xo && ava && tsd"
+ },
+ "files": [
+ "index.js",
+ "index.d.ts",
+ "binary-extensions.json",
+ "binary-extensions.json.d.ts"
+ ],
+ "keywords": [
+ "binary",
+ "extensions",
+ "extension",
+ "file",
+ "json",
+ "list",
+ "array"
+ ],
+ "devDependencies": {
+ "ava": "^1.4.1",
+ "tsd": "^0.7.2",
+ "xo": "^0.24.0"
+ }
+}
diff --git a/node_modules/binary-extensions/readme.md b/node_modules/binary-extensions/readme.md
new file mode 100644
index 0000000..88519b3
--- /dev/null
+++ b/node_modules/binary-extensions/readme.md
@@ -0,0 +1,25 @@
+# binary-extensions
+
+> List of binary file extensions
+
+The list is just a [JSON file](binary-extensions.json) and can be used anywhere.
+
+## Install
+
+```sh
+npm install binary-extensions
+```
+
+## Usage
+
+```js
+const binaryExtensions = require('binary-extensions');
+
+console.log(binaryExtensions);
+//=> ['3ds', '3g2', …]
+```
+
+## Related
+
+- [is-binary-path](https://github.com/sindresorhus/is-binary-path) - Check if a filepath is a binary file
+- [text-extensions](https://github.com/sindresorhus/text-extensions) - List of text file extensions
diff --git a/node_modules/body-parser/HISTORY.md b/node_modules/body-parser/HISTORY.md
new file mode 100644
index 0000000..81d23e0
--- /dev/null
+++ b/node_modules/body-parser/HISTORY.md
@@ -0,0 +1,672 @@
+1.20.3 / 2024-09-10
+===================
+
+ * deps: qs@6.13.0
+ * add `depth` option to customize the depth level in the parser
+ * IMPORTANT: The default `depth` level for parsing URL-encoded data is now `32` (previously was `Infinity`)
+
+1.20.2 / 2023-02-21
+===================
+
+ * Fix strict json error message on Node.js 19+
+ * deps: content-type@~1.0.5
+ - perf: skip value escaping when unnecessary
+ * deps: raw-body@2.5.2
+
+1.20.1 / 2022-10-06
+===================
+
+ * deps: qs@6.11.0
+ * perf: remove unnecessary object clone
+
+1.20.0 / 2022-04-02
+===================
+
+ * Fix error message for json parse whitespace in `strict`
+ * Fix internal error when inflated body exceeds limit
+ * Prevent loss of async hooks context
+ * Prevent hanging when request already read
+ * deps: depd@2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ * deps: http-errors@2.0.0
+ - deps: depd@2.0.0
+ - deps: statuses@2.0.1
+ * deps: on-finished@2.4.1
+ * deps: qs@6.10.3
+ * deps: raw-body@2.5.1
+ - deps: http-errors@2.0.0
+
+1.19.2 / 2022-02-15
+===================
+
+ * deps: bytes@3.1.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * deps: raw-body@2.4.3
+ - deps: bytes@3.1.2
+
+1.19.1 / 2021-12-10
+===================
+
+ * deps: bytes@3.1.1
+ * deps: http-errors@1.8.1
+ - deps: inherits@2.0.4
+ - deps: toidentifier@1.0.1
+ - deps: setprototypeof@1.2.0
+ * deps: qs@6.9.6
+ * deps: raw-body@2.4.2
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ * deps: safe-buffer@5.2.1
+ * deps: type-is@~1.6.18
+
+1.19.0 / 2019-04-25
+===================
+
+ * deps: bytes@3.1.0
+ - Add petabyte (`pb`) support
+ * deps: http-errors@1.7.2
+ - Set constructor name when possible
+ - deps: setprototypeof@1.1.1
+ - deps: statuses@'>= 1.5.0 < 2'
+ * deps: iconv-lite@0.4.24
+ - Added encoding MIK
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: raw-body@2.4.0
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ * deps: type-is@~1.6.17
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+1.18.3 / 2018-05-14
+===================
+
+ * Fix stack trace for strict json parse error
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: http-errors@~1.6.3
+ - deps: depd@~1.1.2
+ - deps: setprototypeof@1.1.0
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.23
+ - Fix loading encoding with year appended
+ - Fix deprecation warnings on Node.js 10+
+ * deps: qs@6.5.2
+ * deps: raw-body@2.3.3
+ - deps: http-errors@1.6.3
+ - deps: iconv-lite@0.4.23
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+1.18.2 / 2017-09-22
+===================
+
+ * deps: debug@2.6.9
+ * perf: remove argument reassignment
+
+1.18.1 / 2017-09-12
+===================
+
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: iconv-lite@0.4.19
+ - Fix ISO-8859-1 regression
+ - Update Windows-1255
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: raw-body@2.3.2
+ - deps: iconv-lite@0.4.19
+
+1.18.0 / 2017-09-08
+===================
+
+ * Fix JSON strict violation error to match native parse error
+ * Include the `body` property on verify errors
+ * Include the `type` property on all generated errors
+ * Use `http-errors` to set status code on errors
+ * deps: bytes@3.0.0
+ * deps: debug@2.6.8
+ * deps: depd@~1.1.1
+ - Remove unnecessary `Buffer` loading
+ * deps: http-errors@~1.6.2
+ - deps: depd@1.1.1
+ * deps: iconv-lite@0.4.18
+ - Add support for React Native
+ - Add a warning if not loaded as utf-8
+ - Fix CESU-8 decoding in Node.js 8
+ - Improve speed of ISO-8859-1 encoding
+ * deps: qs@6.5.0
+ * deps: raw-body@2.3.1
+ - Use `http-errors` for standard emitted errors
+ - deps: bytes@3.0.0
+ - deps: iconv-lite@0.4.18
+ - perf: skip buffer decoding on overage chunk
+ * perf: prevent internal `throw` when missing charset
+
+1.17.2 / 2017-05-17
+===================
+
+ * deps: debug@2.6.7
+ - Fix `DEBUG_MAX_ARRAY_LENGTH`
+ - deps: ms@2.0.0
+ * deps: type-is@~1.6.15
+ - deps: mime-types@~2.1.15
+
+1.17.1 / 2017-03-06
+===================
+
+ * deps: qs@6.4.0
+ - Fix regression parsing keys starting with `[`
+
+1.17.0 / 2017-03-01
+===================
+
+ * deps: http-errors@~1.6.1
+ - Make `message` property enumerable for `HttpError`s
+ - deps: setprototypeof@1.0.3
+ * deps: qs@6.3.1
+ - Fix compacting nested arrays
+
+1.16.1 / 2017-02-10
+===================
+
+ * deps: debug@2.6.1
+ - Fix deprecation messages in WebStorm and other editors
+ - Undeprecate `DEBUG_FD` set to `1` or `2`
+
+1.16.0 / 2017-01-17
+===================
+
+ * deps: debug@2.6.0
+ - Allow colors in workers
+ - Deprecated `DEBUG_FD` environment variable
+ - Fix error when running under React Native
+ - Use same color for same namespace
+ - deps: ms@0.7.2
+ * deps: http-errors@~1.5.1
+ - deps: inherits@2.0.3
+ - deps: setprototypeof@1.0.2
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.15
+ - Added encoding MS-31J
+ - Added encoding MS-932
+ - Added encoding MS-936
+ - Added encoding MS-949
+ - Added encoding MS-950
+ - Fix GBK/GB18030 handling of Euro character
+ * deps: qs@6.2.1
+ - Fix array parsing from skipping empty values
+ * deps: raw-body@~2.2.0
+ - deps: iconv-lite@0.4.15
+ * deps: type-is@~1.6.14
+ - deps: mime-types@~2.1.13
+
+1.15.2 / 2016-06-19
+===================
+
+ * deps: bytes@2.4.0
+ * deps: content-type@~1.0.2
+ - perf: enable strict mode
+ * deps: http-errors@~1.5.0
+ - Use `setprototypeof` module to replace `__proto__` setting
+ - deps: statuses@'>= 1.3.0 < 2'
+ - perf: enable strict mode
+ * deps: qs@6.2.0
+ * deps: raw-body@~2.1.7
+ - deps: bytes@2.4.0
+ - perf: remove double-cleanup on happy path
+ * deps: type-is@~1.6.13
+ - deps: mime-types@~2.1.11
+
+1.15.1 / 2016-05-05
+===================
+
+ * deps: bytes@2.3.0
+ - Drop partial bytes on all parsed units
+ - Fix parsing byte string that looks like hex
+ * deps: raw-body@~2.1.6
+ - deps: bytes@2.3.0
+ * deps: type-is@~1.6.12
+ - deps: mime-types@~2.1.10
+
+1.15.0 / 2016-02-10
+===================
+
+ * deps: http-errors@~1.4.0
+ - Add `HttpError` export, for `err instanceof createError.HttpError`
+ - deps: inherits@2.0.1
+ - deps: statuses@'>= 1.2.1 < 2'
+ * deps: qs@6.1.0
+ * deps: type-is@~1.6.11
+ - deps: mime-types@~2.1.9
+
+1.14.2 / 2015-12-16
+===================
+
+ * deps: bytes@2.2.0
+ * deps: iconv-lite@0.4.13
+ * deps: qs@5.2.0
+ * deps: raw-body@~2.1.5
+ - deps: bytes@2.2.0
+ - deps: iconv-lite@0.4.13
+ * deps: type-is@~1.6.10
+ - deps: mime-types@~2.1.8
+
+1.14.1 / 2015-09-27
+===================
+
+ * Fix issue where invalid charset results in 400 when `verify` used
+ * deps: iconv-lite@0.4.12
+ - Fix CESU-8 decoding in Node.js 4.x
+ * deps: raw-body@~2.1.4
+ - Fix masking critical errors from `iconv-lite`
+ - deps: iconv-lite@0.4.12
+ * deps: type-is@~1.6.9
+ - deps: mime-types@~2.1.7
+
+1.14.0 / 2015-09-16
+===================
+
+ * Fix JSON strict parse error to match syntax errors
+ * Provide static `require` analysis in `urlencoded` parser
+ * deps: depd@~1.1.0
+ - Support web browser loading
+ * deps: qs@5.1.0
+ * deps: raw-body@~2.1.3
+ - Fix sync callback when attaching data listener causes sync read
+ * deps: type-is@~1.6.8
+ - Fix type error when given invalid type to match against
+ - deps: mime-types@~2.1.6
+
+1.13.3 / 2015-07-31
+===================
+
+ * deps: type-is@~1.6.6
+ - deps: mime-types@~2.1.4
+
+1.13.2 / 2015-07-05
+===================
+
+ * deps: iconv-lite@0.4.11
+ * deps: qs@4.0.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix user-visible incompatibilities from 3.1.0
+ - Fix various parsing edge cases
+ * deps: raw-body@~2.1.2
+ - Fix error stack traces to skip `makeError`
+ - deps: iconv-lite@0.4.11
+ * deps: type-is@~1.6.4
+ - deps: mime-types@~2.1.2
+ - perf: enable strict mode
+ - perf: remove argument reassignment
+
+1.13.1 / 2015-06-16
+===================
+
+ * deps: qs@2.4.2
+ - Downgraded from 3.1.0 because of user-visible incompatibilities
+
+1.13.0 / 2015-06-14
+===================
+
+ * Add `statusCode` property on `Error`s, in addition to `status`
+ * Change `type` default to `application/json` for JSON parser
+ * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser
+ * Provide static `require` analysis
+ * Use the `http-errors` module to generate errors
+ * deps: bytes@2.1.0
+ - Slight optimizations
+ * deps: iconv-lite@0.4.10
+ - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails
+ - Leading BOM is now removed when decoding
+ * deps: on-finished@~2.3.0
+ - Add defined behavior for HTTP `CONNECT` requests
+ - Add defined behavior for HTTP `Upgrade` requests
+ - deps: ee-first@1.1.1
+ * deps: qs@3.1.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix various parsing edge cases
+ - Parsed object now has `null` prototype
+ * deps: raw-body@~2.1.1
+ - Use `unpipe` module for unpiping requests
+ - deps: iconv-lite@0.4.10
+ * deps: type-is@~1.6.3
+ - deps: mime-types@~2.1.1
+ - perf: reduce try block size
+ - perf: remove bitwise operations
+ * perf: enable strict mode
+ * perf: remove argument reassignment
+ * perf: remove delete call
+
+1.12.4 / 2015-05-10
+===================
+
+ * deps: debug@~2.2.0
+ * deps: qs@2.4.2
+ - Fix allowing parameters like `constructor`
+ * deps: on-finished@~2.2.1
+ * deps: raw-body@~2.0.1
+ - Fix a false-positive when unpiping in Node.js 0.8
+ - deps: bytes@2.0.1
+ * deps: type-is@~1.6.2
+ - deps: mime-types@~2.0.11
+
+1.12.3 / 2015-04-15
+===================
+
+ * Slight efficiency improvement when not debugging
+ * deps: depd@~1.0.1
+ * deps: iconv-lite@0.4.8
+ - Add encoding alias UNICODE-1-1-UTF-7
+ * deps: raw-body@1.3.4
+ - Fix hanging callback if request aborts during read
+ - deps: iconv-lite@0.4.8
+
+1.12.2 / 2015-03-16
+===================
+
+ * deps: qs@2.4.1
+ - Fix error when parameter `hasOwnProperty` is present
+
+1.12.1 / 2015-03-15
+===================
+
+ * deps: debug@~2.1.3
+ - Fix high intensity foreground color for bold
+ - deps: ms@0.7.0
+ * deps: type-is@~1.6.1
+ - deps: mime-types@~2.0.10
+
+1.12.0 / 2015-02-13
+===================
+
+ * add `debug` messages
+ * accept a function for the `type` option
+ * use `content-type` to parse `Content-Type` headers
+ * deps: iconv-lite@0.4.7
+ - Gracefully support enumerables on `Object.prototype`
+ * deps: raw-body@1.3.3
+ - deps: iconv-lite@0.4.7
+ * deps: type-is@~1.6.0
+ - fix argument reassignment
+ - fix false-positives in `hasBody` `Transfer-Encoding` check
+ - support wildcard for both type and subtype (`*/*`)
+ - deps: mime-types@~2.0.9
+
+1.11.0 / 2015-01-30
+===================
+
+ * make internal `extended: true` depth limit infinity
+ * deps: type-is@~1.5.6
+ - deps: mime-types@~2.0.8
+
+1.10.2 / 2015-01-20
+===================
+
+ * deps: iconv-lite@0.4.6
+ - Fix rare aliases of single-byte encodings
+ * deps: raw-body@1.3.2
+ - deps: iconv-lite@0.4.6
+
+1.10.1 / 2015-01-01
+===================
+
+ * deps: on-finished@~2.2.0
+ * deps: type-is@~1.5.5
+ - deps: mime-types@~2.0.7
+
+1.10.0 / 2014-12-02
+===================
+
+ * make internal `extended: true` array limit dynamic
+
+1.9.3 / 2014-11-21
+==================
+
+ * deps: iconv-lite@0.4.5
+ - Fix Windows-31J and X-SJIS encoding support
+ * deps: qs@2.3.3
+ - Fix `arrayLimit` behavior
+ * deps: raw-body@1.3.1
+ - deps: iconv-lite@0.4.5
+ * deps: type-is@~1.5.3
+ - deps: mime-types@~2.0.3
+
+1.9.2 / 2014-10-27
+==================
+
+ * deps: qs@2.3.2
+ - Fix parsing of mixed objects and values
+
+1.9.1 / 2014-10-22
+==================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+ * deps: qs@2.3.0
+ - Fix parsing of mixed implicit and explicit arrays
+ * deps: type-is@~1.5.2
+ - deps: mime-types@~2.0.2
+
+1.9.0 / 2014-09-24
+==================
+
+ * include the charset in "unsupported charset" error message
+ * include the encoding in "unsupported content encoding" error message
+ * deps: depd@~1.0.0
+
+1.8.4 / 2014-09-23
+==================
+
+ * fix content encoding to be case-insensitive
+
+1.8.3 / 2014-09-19
+==================
+
+ * deps: qs@2.2.4
+ - Fix issue with object keys starting with numbers truncated
+
+1.8.2 / 2014-09-15
+==================
+
+ * deps: depd@0.4.5
+
+1.8.1 / 2014-09-07
+==================
+
+ * deps: media-typer@0.3.0
+ * deps: type-is@~1.5.1
+
+1.8.0 / 2014-09-05
+==================
+
+ * make empty-body-handling consistent between chunked requests
+ - empty `json` produces `{}`
+ - empty `raw` produces `new Buffer(0)`
+ - empty `text` produces `''`
+ - empty `urlencoded` produces `{}`
+ * deps: qs@2.2.3
+ - Fix issue where first empty value in array is discarded
+ * deps: type-is@~1.5.0
+ - fix `hasbody` to be true for `content-length: 0`
+
+1.7.0 / 2014-09-01
+==================
+
+ * add `parameterLimit` option to `urlencoded` parser
+ * change `urlencoded` extended array limit to 100
+ * respond with 413 when over `parameterLimit` in `urlencoded`
+
+1.6.7 / 2014-08-29
+==================
+
+ * deps: qs@2.2.2
+ - Remove unnecessary cloning
+
+1.6.6 / 2014-08-27
+==================
+
+ * deps: qs@2.2.0
+ - Array parsing fix
+ - Performance improvements
+
+1.6.5 / 2014-08-16
+==================
+
+ * deps: on-finished@2.1.0
+
+1.6.4 / 2014-08-14
+==================
+
+ * deps: qs@1.2.2
+
+1.6.3 / 2014-08-10
+==================
+
+ * deps: qs@1.2.1
+
+1.6.2 / 2014-08-07
+==================
+
+ * deps: qs@1.2.0
+ - Fix parsing array of objects
+
+1.6.1 / 2014-08-06
+==================
+
+ * deps: qs@1.1.0
+ - Accept urlencoded square brackets
+ - Accept empty values in implicit array notation
+
+1.6.0 / 2014-08-05
+==================
+
+ * deps: qs@1.0.2
+ - Complete rewrite
+ - Limits array length to 20
+ - Limits object depth to 5
+ - Limits parameters to 1,000
+
+1.5.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+1.5.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+1.5.0 / 2014-07-20
+==================
+
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ * deps: raw-body@1.3.0
+ - deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ - Fix `Cannot switch to old mode now` error on Node.js 0.10+
+ * deps: type-is@~1.3.2
+
+1.4.3 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.1
+ - fix global variable leak
+
+1.4.2 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.0
+ - improve type parsing
+
+1.4.1 / 2014-06-19
+==================
+
+ * fix urlencoded extended deprecation message
+
+1.4.0 / 2014-06-19
+==================
+
+ * add `text` parser
+ * add `raw` parser
+ * check accepted charset in content-type (accepts utf-8)
+ * check accepted encoding in content-encoding (accepts identity)
+ * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed
+ * deprecate `urlencoded()` without provided `extended` option
+ * lazy-load urlencoded parsers
+ * parsers split into files for reduced mem usage
+ * support gzip and deflate bodies
+ - set `inflate: false` to turn off
+ * deps: raw-body@1.2.2
+ - Support all encodings from `iconv-lite`
+
+1.3.1 / 2014-06-11
+==================
+
+ * deps: type-is@1.2.1
+ - Switch dependency from mime to mime-types@1.0.0
+
+1.3.0 / 2014-05-31
+==================
+
+ * add `extended` option to urlencoded parser
+
+1.2.2 / 2014-05-27
+==================
+
+ * deps: raw-body@1.1.6
+ - assert stream encoding on node.js 0.8
+ - assert stream encoding on node.js < 0.10.6
+ - deps: bytes@1
+
+1.2.1 / 2014-05-26
+==================
+
+ * invoke `next(err)` after request fully read
+ - prevents hung responses and socket hang ups
+
+1.2.0 / 2014-05-11
+==================
+
+ * add `verify` option
+ * deps: type-is@1.2.0
+ - support suffix matching
+
+1.1.2 / 2014-05-11
+==================
+
+ * improve json parser speed
+
+1.1.1 / 2014-05-11
+==================
+
+ * fix repeated limit parsing with every request
+
+1.1.0 / 2014-05-10
+==================
+
+ * add `type` option
+ * deps: pin for safety and consistency
+
+1.0.2 / 2014-04-14
+==================
+
+ * use `type-is` module
+
+1.0.1 / 2014-03-20
+==================
+
+ * lower default limits to 100kb
diff --git a/node_modules/body-parser/LICENSE b/node_modules/body-parser/LICENSE
new file mode 100644
index 0000000..386b7b6
--- /dev/null
+++ b/node_modules/body-parser/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2014-2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/body-parser/README.md b/node_modules/body-parser/README.md
new file mode 100644
index 0000000..f6661b7
--- /dev/null
+++ b/node_modules/body-parser/README.md
@@ -0,0 +1,476 @@
+# body-parser
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+[![OpenSSF Scorecard Badge][ossf-scorecard-badge]][ossf-scorecard-visualizer]
+
+Node.js body parsing middleware.
+
+Parse incoming request bodies in a middleware before your handlers, available
+under the `req.body` property.
+
+**Note** As `req.body`'s shape is based on user-controlled input, all
+properties and values in this object are untrusted and should be validated
+before trusting. For example, `req.body.foo.toString()` may fail in multiple
+ways, for example the `foo` property may not be there or may not be a string,
+and `toString` may not be a function and instead a string or other user input.
+
+[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/).
+
+_This does not handle multipart bodies_, due to their complex and typically
+large nature. For multipart bodies, you may be interested in the following
+modules:
+
+ * [busboy](https://www.npmjs.org/package/busboy#readme) and
+ [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme)
+ * [multiparty](https://www.npmjs.org/package/multiparty#readme) and
+ [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme)
+ * [formidable](https://www.npmjs.org/package/formidable#readme)
+ * [multer](https://www.npmjs.org/package/multer#readme)
+
+This module provides the following parsers:
+
+ * [JSON body parser](#bodyparserjsonoptions)
+ * [Raw body parser](#bodyparserrawoptions)
+ * [Text body parser](#bodyparsertextoptions)
+ * [URL-encoded form body parser](#bodyparserurlencodedoptions)
+
+Other body parsers you might be interested in:
+
+- [body](https://www.npmjs.org/package/body#readme)
+- [co-body](https://www.npmjs.org/package/co-body#readme)
+
+## Installation
+
+```sh
+$ npm install body-parser
+```
+
+## API
+
+```js
+var bodyParser = require('body-parser')
+```
+
+The `bodyParser` object exposes various factories to create middlewares. All
+middlewares will populate the `req.body` property with the parsed body when
+the `Content-Type` request header matches the `type` option, or an empty
+object (`{}`) if there was no body to parse, the `Content-Type` was not matched,
+or an error occurred.
+
+The various errors returned by this module are described in the
+[errors section](#errors).
+
+### bodyParser.json([options])
+
+Returns middleware that only parses `json` and only looks at requests where
+the `Content-Type` header matches the `type` option. This parser accepts any
+Unicode encoding of the body and supports automatic inflation of `gzip` and
+`deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`).
+
+#### Options
+
+The `json` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### reviver
+
+The `reviver` option is passed directly to `JSON.parse` as the second
+argument. You can find more information on this argument
+[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter).
+
+##### strict
+
+When set to `true`, will only accept arrays and objects; when `false` will
+accept anything `JSON.parse` accepts. Defaults to `true`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not a
+function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `json`), a mime type (like `application/json`), or
+a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a truthy
+value. Defaults to `application/json`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.raw([options])
+
+Returns middleware that parses all bodies as a `Buffer` and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a `Buffer` object
+of the body.
+
+#### Options
+
+The `raw` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function.
+If not a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this
+can be an extension name (like `bin`), a mime type (like
+`application/octet-stream`), or a mime type with a wildcard (like `*/*` or
+`application/*`). If a function, the `type` option is called as `fn(req)`
+and the request is parsed if it returns a truthy value. Defaults to
+`application/octet-stream`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.text([options])
+
+Returns middleware that parses all bodies as a string and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` string containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a string of the
+body.
+
+#### Options
+
+The `text` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### defaultCharset
+
+Specify the default character set for the text content if the charset is not
+specified in the `Content-Type` header of the request. Defaults to `utf-8`.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `txt`), a mime type (like `text/plain`), or a mime
+type with a wildcard (like `*/*` or `text/*`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a
+truthy value. Defaults to `text/plain`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.urlencoded([options])
+
+Returns middleware that only parses `urlencoded` bodies and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser accepts only UTF-8 encoding of the body and supports automatic
+inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This object will contain
+key-value pairs, where the value can be a string or array (when `extended` is
+`false`), or any type (when `extended` is `true`).
+
+#### Options
+
+The `urlencoded` function takes an optional `options` object that may contain
+any of the following keys:
+
+##### extended
+
+The `extended` option allows to choose between parsing the URL-encoded data
+with the `querystring` library (when `false`) or the `qs` library (when
+`true`). The "extended" syntax allows for rich objects and arrays to be
+encoded into the URL-encoded format, allowing for a JSON-like experience
+with URL-encoded. For more information, please
+[see the qs library](https://www.npmjs.org/package/qs#readme).
+
+Defaults to `true`, but using the default has been deprecated. Please
+research into the difference between `qs` and `querystring` and choose the
+appropriate setting.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### parameterLimit
+
+The `parameterLimit` option controls the maximum number of parameters that
+are allowed in the URL-encoded data. If a request contains more parameters
+than this value, a 413 will be returned to the client. Defaults to `1000`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `urlencoded`), a mime type (like
+`application/x-www-form-urlencoded`), or a mime type with a wildcard (like
+`*/x-www-form-urlencoded`). If a function, the `type` option is called as
+`fn(req)` and the request is parsed if it returns a truthy value. Defaults
+to `application/x-www-form-urlencoded`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+#### depth
+
+The `depth` option is used to configure the maximum depth of the `qs` library when `extended` is `true`. This allows you to limit the amount of keys that are parsed and can be useful to prevent certain types of abuse. Defaults to `32`. It is recommended to keep this value as low as possible.
+
+## Errors
+
+The middlewares provided by this module create errors using the
+[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors
+will typically have a `status`/`statusCode` property that contains the suggested
+HTTP response code, an `expose` property to determine if the `message` property
+should be displayed to the client, a `type` property to determine the type of
+error without matching against the `message`, and a `body` property containing
+the read body, if available.
+
+The following are the common errors created, though any error can come through
+for various reasons.
+
+### content encoding unsupported
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an encoding but the "inflation" option was set to `false`. The
+`status` property is set to `415`, the `type` property is set to
+`'encoding.unsupported'`, and the `charset` property will be set to the
+encoding that is unsupported.
+
+### entity parse failed
+
+This error will occur when the request contained an entity that could not be
+parsed by the middleware. The `status` property is set to `400`, the `type`
+property is set to `'entity.parse.failed'`, and the `body` property is set to
+the entity value that failed parsing.
+
+### entity verify failed
+
+This error will occur when the request contained an entity that could not be
+failed verification by the defined `verify` option. The `status` property is
+set to `403`, the `type` property is set to `'entity.verify.failed'`, and the
+`body` property is set to the entity value that failed verification.
+
+### request aborted
+
+This error will occur when the request is aborted by the client before reading
+the body has finished. The `received` property will be set to the number of
+bytes received before the request was aborted and the `expected` property is
+set to the number of expected bytes. The `status` property is set to `400`
+and `type` property is set to `'request.aborted'`.
+
+### request entity too large
+
+This error will occur when the request body's size is larger than the "limit"
+option. The `limit` property will be set to the byte limit and the `length`
+property will be set to the request body's length. The `status` property is
+set to `413` and the `type` property is set to `'entity.too.large'`.
+
+### request size did not match content length
+
+This error will occur when the request's length did not match the length from
+the `Content-Length` header. This typically occurs when the request is malformed,
+typically when the `Content-Length` header was calculated based on characters
+instead of bytes. The `status` property is set to `400` and the `type` property
+is set to `'request.size.invalid'`.
+
+### stream encoding should not be set
+
+This error will occur when something called the `req.setEncoding` method prior
+to this middleware. This module operates directly on bytes only and you cannot
+call `req.setEncoding` when using this module. The `status` property is set to
+`500` and the `type` property is set to `'stream.encoding.set'`.
+
+### stream is not readable
+
+This error will occur when the request is no longer readable when this middleware
+attempts to read it. This typically means something other than a middleware from
+this module read the request body already and the middleware was also configured to
+read the same request. The `status` property is set to `500` and the `type`
+property is set to `'stream.not.readable'`.
+
+### too many parameters
+
+This error will occur when the content of the request exceeds the configured
+`parameterLimit` for the `urlencoded` parser. The `status` property is set to
+`413` and the `type` property is set to `'parameters.too.many'`.
+
+### unsupported charset "BOGUS"
+
+This error will occur when the request had a charset parameter in the
+`Content-Type` header, but the `iconv-lite` module does not support it OR the
+parser does not support it. The charset is contained in the message as well
+as in the `charset` property. The `status` property is set to `415`, the
+`type` property is set to `'charset.unsupported'`, and the `charset` property
+is set to the charset that is unsupported.
+
+### unsupported content encoding "bogus"
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an unsupported encoding. The encoding is contained in the message
+as well as in the `encoding` property. The `status` property is set to `415`,
+the `type` property is set to `'encoding.unsupported'`, and the `encoding`
+property is set to the encoding that is unsupported.
+
+### The input exceeded the depth
+
+This error occurs when using `bodyParser.urlencoded` with the `extended` property set to `true` and the input exceeds the configured `depth` option. The `status` property is set to `400`. It is recommended to review the `depth` option and evaluate if it requires a higher value. When the `depth` option is set to `32` (default value), the error will not be thrown.
+
+## Examples
+
+### Express/Connect top-level generic
+
+This example demonstrates adding a generic JSON and URL-encoded parser as a
+top-level middleware, which will parse the bodies of all incoming requests.
+This is the simplest setup.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse application/x-www-form-urlencoded
+app.use(bodyParser.urlencoded({ extended: false }))
+
+// parse application/json
+app.use(bodyParser.json())
+
+app.use(function (req, res) {
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('you posted:\n')
+ res.end(JSON.stringify(req.body, null, 2))
+})
+```
+
+### Express route-specific
+
+This example demonstrates adding body parsers specifically to the routes that
+need them. In general, this is the most recommended way to use body-parser with
+Express.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// create application/json parser
+var jsonParser = bodyParser.json()
+
+// create application/x-www-form-urlencoded parser
+var urlencodedParser = bodyParser.urlencoded({ extended: false })
+
+// POST /login gets urlencoded bodies
+app.post('/login', urlencodedParser, function (req, res) {
+ res.send('welcome, ' + req.body.username)
+})
+
+// POST /api/users gets JSON bodies
+app.post('/api/users', jsonParser, function (req, res) {
+ // create user in req.body
+})
+```
+
+### Change accepted type for parsers
+
+All the parsers accept a `type` option which allows you to change the
+`Content-Type` that the middleware will parse.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse various different custom JSON types as JSON
+app.use(bodyParser.json({ type: 'application/*+json' }))
+
+// parse some custom thing into a Buffer
+app.use(bodyParser.raw({ type: 'application/vnd.custom-type' }))
+
+// parse an HTML body into a string
+app.use(bodyParser.text({ type: 'text/html' }))
+```
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/expressjs/body-parser/master?label=ci
+[ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/body-parser/master
+[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master
+[node-version-image]: https://badgen.net/npm/node/body-parser
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/body-parser
+[npm-url]: https://npmjs.org/package/body-parser
+[npm-version-image]: https://badgen.net/npm/v/body-parser
+[ossf-scorecard-badge]: https://api.scorecard.dev/projects/github.com/expressjs/body-parser/badge
+[ossf-scorecard-visualizer]: https://ossf.github.io/scorecard-visualizer/#/projects/github.com/expressjs/body-parser
\ No newline at end of file
diff --git a/node_modules/body-parser/SECURITY.md b/node_modules/body-parser/SECURITY.md
new file mode 100644
index 0000000..9694d42
--- /dev/null
+++ b/node_modules/body-parser/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The Express team and community take all security bugs seriously. Thank you
+for improving the security of Express. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `body-parser`. This
+information can be found in the npm registry using the command
+`npm owner ls body-parser`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/expressjs/body-parser/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/node_modules/body-parser/index.js b/node_modules/body-parser/index.js
new file mode 100644
index 0000000..bb24d73
--- /dev/null
+++ b/node_modules/body-parser/index.js
@@ -0,0 +1,156 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var deprecate = require('depd')('body-parser')
+
+/**
+ * Cache of loaded parsers.
+ * @private
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * @typedef Parsers
+ * @type {function}
+ * @property {function} json
+ * @property {function} raw
+ * @property {function} text
+ * @property {function} urlencoded
+ */
+
+/**
+ * Module exports.
+ * @type {Parsers}
+ */
+
+exports = module.exports = deprecate.function(bodyParser,
+ 'bodyParser: use individual json/urlencoded middlewares')
+
+/**
+ * JSON parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'json', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('json')
+})
+
+/**
+ * Raw parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'raw', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('raw')
+})
+
+/**
+ * Text parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'text', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('text')
+})
+
+/**
+ * URL-encoded parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'urlencoded', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('urlencoded')
+})
+
+/**
+ * Create a middleware to parse json and urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @deprecated
+ * @public
+ */
+
+function bodyParser (options) {
+ // use default type for parsers
+ var opts = Object.create(options || null, {
+ type: {
+ configurable: true,
+ enumerable: true,
+ value: undefined,
+ writable: true
+ }
+ })
+
+ var _urlencoded = exports.urlencoded(opts)
+ var _json = exports.json(opts)
+
+ return function bodyParser (req, res, next) {
+ _json(req, res, function (err) {
+ if (err) return next(err)
+ _urlencoded(req, res, next)
+ })
+ }
+}
+
+/**
+ * Create a getter for loading a parser.
+ * @private
+ */
+
+function createParserGetter (name) {
+ return function get () {
+ return loadParser(name)
+ }
+}
+
+/**
+ * Load a parser module.
+ * @private
+ */
+
+function loadParser (parserName) {
+ var parser = parsers[parserName]
+
+ if (parser !== undefined) {
+ return parser
+ }
+
+ // this uses a switch for static require analysis
+ switch (parserName) {
+ case 'json':
+ parser = require('./lib/types/json')
+ break
+ case 'raw':
+ parser = require('./lib/types/raw')
+ break
+ case 'text':
+ parser = require('./lib/types/text')
+ break
+ case 'urlencoded':
+ parser = require('./lib/types/urlencoded')
+ break
+ }
+
+ // store to prevent invoking require()
+ return (parsers[parserName] = parser)
+}
diff --git a/node_modules/body-parser/lib/read.js b/node_modules/body-parser/lib/read.js
new file mode 100644
index 0000000..fce6283
--- /dev/null
+++ b/node_modules/body-parser/lib/read.js
@@ -0,0 +1,205 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var createError = require('http-errors')
+var destroy = require('destroy')
+var getBody = require('raw-body')
+var iconv = require('iconv-lite')
+var onFinished = require('on-finished')
+var unpipe = require('unpipe')
+var zlib = require('zlib')
+
+/**
+ * Module exports.
+ */
+
+module.exports = read
+
+/**
+ * Read a request into a buffer and parse.
+ *
+ * @param {object} req
+ * @param {object} res
+ * @param {function} next
+ * @param {function} parse
+ * @param {function} debug
+ * @param {object} options
+ * @private
+ */
+
+function read (req, res, next, parse, debug, options) {
+ var length
+ var opts = options
+ var stream
+
+ // flag as parsed
+ req._body = true
+
+ // read options
+ var encoding = opts.encoding !== null
+ ? opts.encoding
+ : null
+ var verify = opts.verify
+
+ try {
+ // get the content stream
+ stream = contentstream(req, debug, opts.inflate)
+ length = stream.length
+ stream.length = undefined
+ } catch (err) {
+ return next(err)
+ }
+
+ // set raw-body options
+ opts.length = length
+ opts.encoding = verify
+ ? null
+ : encoding
+
+ // assert charset is supported
+ if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) {
+ return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ }))
+ }
+
+ // read body
+ debug('read body')
+ getBody(stream, opts, function (error, body) {
+ if (error) {
+ var _error
+
+ if (error.type === 'encoding.unsupported') {
+ // echo back charset
+ _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ })
+ } else {
+ // set status code on error
+ _error = createError(400, error)
+ }
+
+ // unpipe from stream and destroy
+ if (stream !== req) {
+ unpipe(req)
+ destroy(stream, true)
+ }
+
+ // read off entire request
+ dump(req, function onfinished () {
+ next(createError(400, _error))
+ })
+ return
+ }
+
+ // verify
+ if (verify) {
+ try {
+ debug('verify body')
+ verify(req, res, body, encoding)
+ } catch (err) {
+ next(createError(403, err, {
+ body: body,
+ type: err.type || 'entity.verify.failed'
+ }))
+ return
+ }
+ }
+
+ // parse
+ var str = body
+ try {
+ debug('parse body')
+ str = typeof body !== 'string' && encoding !== null
+ ? iconv.decode(body, encoding)
+ : body
+ req.body = parse(str)
+ } catch (err) {
+ next(createError(400, err, {
+ body: str,
+ type: err.type || 'entity.parse.failed'
+ }))
+ return
+ }
+
+ next()
+ })
+}
+
+/**
+ * Get the content stream of the request.
+ *
+ * @param {object} req
+ * @param {function} debug
+ * @param {boolean} [inflate=true]
+ * @return {object}
+ * @api private
+ */
+
+function contentstream (req, debug, inflate) {
+ var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase()
+ var length = req.headers['content-length']
+ var stream
+
+ debug('content-encoding "%s"', encoding)
+
+ if (inflate === false && encoding !== 'identity') {
+ throw createError(415, 'content encoding unsupported', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ switch (encoding) {
+ case 'deflate':
+ stream = zlib.createInflate()
+ debug('inflate body')
+ req.pipe(stream)
+ break
+ case 'gzip':
+ stream = zlib.createGunzip()
+ debug('gunzip body')
+ req.pipe(stream)
+ break
+ case 'identity':
+ stream = req
+ stream.length = length
+ break
+ default:
+ throw createError(415, 'unsupported content encoding "' + encoding + '"', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ return stream
+}
+
+/**
+ * Dump the contents of a request.
+ *
+ * @param {object} req
+ * @param {function} callback
+ * @api private
+ */
+
+function dump (req, callback) {
+ if (onFinished.isFinished(req)) {
+ callback(null)
+ } else {
+ onFinished(req, callback)
+ req.resume()
+ }
+}
diff --git a/node_modules/body-parser/lib/types/json.js b/node_modules/body-parser/lib/types/json.js
new file mode 100644
index 0000000..59f3f7e
--- /dev/null
+++ b/node_modules/body-parser/lib/types/json.js
@@ -0,0 +1,247 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:json')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = json
+
+/**
+ * RegExp to match the first non-space in a string.
+ *
+ * Allowed whitespace is defined in RFC 7159:
+ *
+ * ws = *(
+ * %x20 / ; Space
+ * %x09 / ; Horizontal tab
+ * %x0A / ; Line feed or New line
+ * %x0D ) ; Carriage return
+ */
+
+var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex
+
+var JSON_SYNTAX_CHAR = '#'
+var JSON_SYNTAX_REGEXP = /#+/g
+
+/**
+ * Create a middleware to parse JSON bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function json (options) {
+ var opts = options || {}
+
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var inflate = opts.inflate !== false
+ var reviver = opts.reviver
+ var strict = opts.strict !== false
+ var type = opts.type || 'application/json'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ if (body.length === 0) {
+ // special-case empty json body, as it's a common client-side mistake
+ // TODO: maybe make this configurable or part of "strict" option
+ return {}
+ }
+
+ if (strict) {
+ var first = firstchar(body)
+
+ if (first !== '{' && first !== '[') {
+ debug('strict violation')
+ throw createStrictSyntaxError(body, first)
+ }
+ }
+
+ try {
+ debug('parse json')
+ return JSON.parse(body, reviver)
+ } catch (e) {
+ throw normalizeJsonSyntaxError(e, {
+ message: e.message,
+ stack: e.stack
+ })
+ }
+ }
+
+ return function jsonParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset per RFC 7159 sec 8.1
+ var charset = getCharset(req) || 'utf-8'
+ if (charset.slice(0, 4) !== 'utf-') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Create strict violation syntax error matching native error.
+ *
+ * @param {string} str
+ * @param {string} char
+ * @return {Error}
+ * @private
+ */
+
+function createStrictSyntaxError (str, char) {
+ var index = str.indexOf(char)
+ var partial = ''
+
+ if (index !== -1) {
+ partial = str.substring(0, index) + JSON_SYNTAX_CHAR
+
+ for (var i = index + 1; i < str.length; i++) {
+ partial += JSON_SYNTAX_CHAR
+ }
+ }
+
+ try {
+ JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation')
+ } catch (e) {
+ return normalizeJsonSyntaxError(e, {
+ message: e.message.replace(JSON_SYNTAX_REGEXP, function (placeholder) {
+ return str.substring(index, index + placeholder.length)
+ }),
+ stack: e.stack
+ })
+ }
+}
+
+/**
+ * Get the first non-whitespace character in a string.
+ *
+ * @param {string} str
+ * @return {function}
+ * @private
+ */
+
+function firstchar (str) {
+ var match = FIRST_CHAR_REGEXP.exec(str)
+
+ return match
+ ? match[1]
+ : undefined
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Normalize a SyntaxError for JSON.parse.
+ *
+ * @param {SyntaxError} error
+ * @param {object} obj
+ * @return {SyntaxError}
+ */
+
+function normalizeJsonSyntaxError (error, obj) {
+ var keys = Object.getOwnPropertyNames(error)
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i]
+ if (key !== 'stack' && key !== 'message') {
+ delete error[key]
+ }
+ }
+
+ // replace stack before message for Node.js 0.10 and below
+ error.stack = obj.stack.replace(error.message, obj.message)
+ error.message = obj.message
+
+ return error
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/lib/types/raw.js b/node_modules/body-parser/lib/types/raw.js
new file mode 100644
index 0000000..f5d1b67
--- /dev/null
+++ b/node_modules/body-parser/lib/types/raw.js
@@ -0,0 +1,101 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var debug = require('debug')('body-parser:raw')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = raw
+
+/**
+ * Create a middleware to parse raw bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function raw (options) {
+ var opts = options || {}
+
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/octet-stream'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function rawParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: null,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/lib/types/text.js b/node_modules/body-parser/lib/types/text.js
new file mode 100644
index 0000000..083a009
--- /dev/null
+++ b/node_modules/body-parser/lib/types/text.js
@@ -0,0 +1,121 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var debug = require('debug')('body-parser:text')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = text
+
+/**
+ * Create a middleware to parse text bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function text (options) {
+ var opts = options || {}
+
+ var defaultCharset = opts.defaultCharset || 'utf-8'
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'text/plain'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function textParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // get charset
+ var charset = getCharset(req) || defaultCharset
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/lib/types/urlencoded.js b/node_modules/body-parser/lib/types/urlencoded.js
new file mode 100644
index 0000000..2bd4485
--- /dev/null
+++ b/node_modules/body-parser/lib/types/urlencoded.js
@@ -0,0 +1,307 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:urlencoded')
+var deprecate = require('depd')('body-parser')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = urlencoded
+
+/**
+ * Cache of parser modules.
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * Create a middleware to parse urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function urlencoded (options) {
+ var opts = options || {}
+
+ // notice because option default will flip in next major
+ if (opts.extended === undefined) {
+ deprecate('undefined extended: provide extended option')
+ }
+
+ var extended = opts.extended !== false
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/x-www-form-urlencoded'
+ var verify = opts.verify || false
+ var depth = typeof opts.depth !== 'number'
+ ? Number(opts.depth || 32)
+ : opts.depth
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate query parser
+ var queryparse = extended
+ ? extendedparser(opts)
+ : simpleparser(opts)
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ return body.length
+ ? queryparse(body)
+ : {}
+ }
+
+ return function urlencodedParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset
+ var charset = getCharset(req) || 'utf-8'
+ if (charset !== 'utf-8') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ debug: debug,
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify,
+ depth: depth
+ })
+ }
+}
+
+/**
+ * Get the extended query parser.
+ *
+ * @param {object} options
+ */
+
+function extendedparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+
+ var depth = typeof options.depth !== 'number'
+ ? Number(options.depth || 32)
+ : options.depth
+ var parse = parser('qs')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isNaN(depth) || depth < 0) {
+ throw new TypeError('option depth must be a zero or a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ var arrayLimit = Math.max(100, paramCount)
+
+ debug('parse extended urlencoding')
+ try {
+ return parse(body, {
+ allowPrototypes: true,
+ arrayLimit: arrayLimit,
+ depth: depth,
+ strictDepth: true,
+ parameterLimit: parameterLimit
+ })
+ } catch (err) {
+ if (err instanceof RangeError) {
+ throw createError(400, 'The input exceeded the depth', {
+ type: 'querystring.parse.rangeError'
+ })
+ } else {
+ throw err
+ }
+ }
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Count the number of parameters, stopping once limit reached
+ *
+ * @param {string} body
+ * @param {number} limit
+ * @api private
+ */
+
+function parameterCount (body, limit) {
+ var count = 0
+ var index = 0
+
+ while ((index = body.indexOf('&', index)) !== -1) {
+ count++
+ index++
+
+ if (count === limit) {
+ return undefined
+ }
+ }
+
+ return count
+}
+
+/**
+ * Get parser for module name dynamically.
+ *
+ * @param {string} name
+ * @return {function}
+ * @api private
+ */
+
+function parser (name) {
+ var mod = parsers[name]
+
+ if (mod !== undefined) {
+ return mod.parse
+ }
+
+ // this uses a switch for static require analysis
+ switch (name) {
+ case 'qs':
+ mod = require('qs')
+ break
+ case 'querystring':
+ mod = require('querystring')
+ break
+ }
+
+ // store to prevent invoking require()
+ parsers[name] = mod
+
+ return mod.parse
+}
+
+/**
+ * Get the simple query parser.
+ *
+ * @param {object} options
+ */
+
+function simpleparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('querystring')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ debug('parse urlencoding')
+ return parse(body, undefined, undefined, { maxKeys: parameterLimit })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/package.json b/node_modules/body-parser/package.json
new file mode 100644
index 0000000..3c9926f
--- /dev/null
+++ b/node_modules/body-parser/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "body-parser",
+ "description": "Node.js body parsing middleware",
+ "version": "1.20.3",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Jonathan Ong (http://jongleberry.com)"
+ ],
+ "license": "MIT",
+ "repository": "expressjs/body-parser",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.5",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "on-finished": "2.4.1",
+ "qs": "6.13.0",
+ "raw-body": "2.5.2",
+ "type-is": "~1.6.18",
+ "unpipe": "1.0.0"
+ },
+ "devDependencies": {
+ "eslint": "8.34.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.27.5",
+ "eslint-plugin-markdown": "3.0.0",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "6.1.1",
+ "eslint-plugin-standard": "4.1.0",
+ "methods": "1.1.2",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "supertest": "6.3.3"
+ },
+ "files": [
+ "lib/",
+ "LICENSE",
+ "HISTORY.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ }
+}
diff --git a/node_modules/brace-expansion/LICENSE b/node_modules/brace-expansion/LICENSE
new file mode 100644
index 0000000..de32266
--- /dev/null
+++ b/node_modules/brace-expansion/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2013 Julian Gruber
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/brace-expansion/README.md b/node_modules/brace-expansion/README.md
new file mode 100644
index 0000000..6b4e0e1
--- /dev/null
+++ b/node_modules/brace-expansion/README.md
@@ -0,0 +1,129 @@
+# brace-expansion
+
+[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html),
+as known from sh/bash, in JavaScript.
+
+[](http://travis-ci.org/juliangruber/brace-expansion)
+[](https://www.npmjs.org/package/brace-expansion)
+[](https://greenkeeper.io/)
+
+[](https://ci.testling.com/juliangruber/brace-expansion)
+
+## Example
+
+```js
+var expand = require('brace-expansion');
+
+expand('file-{a,b,c}.jpg')
+// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg']
+
+expand('-v{,,}')
+// => ['-v', '-v', '-v']
+
+expand('file{0..2}.jpg')
+// => ['file0.jpg', 'file1.jpg', 'file2.jpg']
+
+expand('file-{a..c}.jpg')
+// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg']
+
+expand('file{2..0}.jpg')
+// => ['file2.jpg', 'file1.jpg', 'file0.jpg']
+
+expand('file{0..4..2}.jpg')
+// => ['file0.jpg', 'file2.jpg', 'file4.jpg']
+
+expand('file-{a..e..2}.jpg')
+// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg']
+
+expand('file{00..10..5}.jpg')
+// => ['file00.jpg', 'file05.jpg', 'file10.jpg']
+
+expand('{{A..C},{a..c}}')
+// => ['A', 'B', 'C', 'a', 'b', 'c']
+
+expand('ppp{,config,oe{,conf}}')
+// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf']
+```
+
+## API
+
+```js
+var expand = require('brace-expansion');
+```
+
+### var expanded = expand(str)
+
+Return an array of all possible and valid expansions of `str`. If none are
+found, `[str]` is returned.
+
+Valid expansions are:
+
+```js
+/^(.*,)+(.+)?$/
+// {a,b,...}
+```
+
+A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`.
+
+```js
+/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/
+// {x..y[..incr]}
+```
+
+A numeric sequence from `x` to `y` inclusive, with optional increment.
+If `x` or `y` start with a leading `0`, all the numbers will be padded
+to have equal length. Negative numbers and backwards iteration work too.
+
+```js
+/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/
+// {x..y[..incr]}
+```
+
+An alphabetic sequence from `x` to `y` inclusive, with optional increment.
+`x` and `y` must be exactly one character, and if given, `incr` must be a
+number.
+
+For compatibility reasons, the string `${` is not eligible for brace expansion.
+
+## Installation
+
+With [npm](https://npmjs.org) do:
+
+```bash
+npm install brace-expansion
+```
+
+## Contributors
+
+- [Julian Gruber](https://github.com/juliangruber)
+- [Isaac Z. Schlueter](https://github.com/isaacs)
+
+## Sponsors
+
+This module is proudly supported by my [Sponsors](https://github.com/juliangruber/sponsors)!
+
+Do you want to support modules like this to improve their quality, stability and weigh in on new features? Then please consider donating to my [Patreon](https://www.patreon.com/juliangruber). Not sure how much of my modules you're using? Try [feross/thanks](https://github.com/feross/thanks)!
+
+## License
+
+(MIT)
+
+Copyright (c) 2013 Julian Gruber <julian@juliangruber.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/brace-expansion/index.js b/node_modules/brace-expansion/index.js
new file mode 100644
index 0000000..0478be8
--- /dev/null
+++ b/node_modules/brace-expansion/index.js
@@ -0,0 +1,201 @@
+var concatMap = require('concat-map');
+var balanced = require('balanced-match');
+
+module.exports = expandTop;
+
+var escSlash = '\0SLASH'+Math.random()+'\0';
+var escOpen = '\0OPEN'+Math.random()+'\0';
+var escClose = '\0CLOSE'+Math.random()+'\0';
+var escComma = '\0COMMA'+Math.random()+'\0';
+var escPeriod = '\0PERIOD'+Math.random()+'\0';
+
+function numeric(str) {
+ return parseInt(str, 10) == str
+ ? parseInt(str, 10)
+ : str.charCodeAt(0);
+}
+
+function escapeBraces(str) {
+ return str.split('\\\\').join(escSlash)
+ .split('\\{').join(escOpen)
+ .split('\\}').join(escClose)
+ .split('\\,').join(escComma)
+ .split('\\.').join(escPeriod);
+}
+
+function unescapeBraces(str) {
+ return str.split(escSlash).join('\\')
+ .split(escOpen).join('{')
+ .split(escClose).join('}')
+ .split(escComma).join(',')
+ .split(escPeriod).join('.');
+}
+
+
+// Basically just str.split(","), but handling cases
+// where we have nested braced sections, which should be
+// treated as individual members, like {a,{b,c},d}
+function parseCommaParts(str) {
+ if (!str)
+ return [''];
+
+ var parts = [];
+ var m = balanced('{', '}', str);
+
+ if (!m)
+ return str.split(',');
+
+ var pre = m.pre;
+ var body = m.body;
+ var post = m.post;
+ var p = pre.split(',');
+
+ p[p.length-1] += '{' + body + '}';
+ var postParts = parseCommaParts(post);
+ if (post.length) {
+ p[p.length-1] += postParts.shift();
+ p.push.apply(p, postParts);
+ }
+
+ parts.push.apply(parts, p);
+
+ return parts;
+}
+
+function expandTop(str) {
+ if (!str)
+ return [];
+
+ // I don't know why Bash 4.3 does this, but it does.
+ // Anything starting with {} will have the first two bytes preserved
+ // but *only* at the top level, so {},a}b will not expand to anything,
+ // but a{},b}c will be expanded to [a}c,abc].
+ // One could argue that this is a bug in Bash, but since the goal of
+ // this module is to match Bash's rules, we escape a leading {}
+ if (str.substr(0, 2) === '{}') {
+ str = '\\{\\}' + str.substr(2);
+ }
+
+ return expand(escapeBraces(str), true).map(unescapeBraces);
+}
+
+function identity(e) {
+ return e;
+}
+
+function embrace(str) {
+ return '{' + str + '}';
+}
+function isPadded(el) {
+ return /^-?0\d/.test(el);
+}
+
+function lte(i, y) {
+ return i <= y;
+}
+function gte(i, y) {
+ return i >= y;
+}
+
+function expand(str, isTop) {
+ var expansions = [];
+
+ var m = balanced('{', '}', str);
+ if (!m || /\$$/.test(m.pre)) return [str];
+
+ var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body);
+ var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body);
+ var isSequence = isNumericSequence || isAlphaSequence;
+ var isOptions = m.body.indexOf(',') >= 0;
+ if (!isSequence && !isOptions) {
+ // {a},b}
+ if (m.post.match(/,.*\}/)) {
+ str = m.pre + '{' + m.body + escClose + m.post;
+ return expand(str);
+ }
+ return [str];
+ }
+
+ var n;
+ if (isSequence) {
+ n = m.body.split(/\.\./);
+ } else {
+ n = parseCommaParts(m.body);
+ if (n.length === 1) {
+ // x{{a,b}}y ==> x{a}y x{b}y
+ n = expand(n[0], false).map(embrace);
+ if (n.length === 1) {
+ var post = m.post.length
+ ? expand(m.post, false)
+ : [''];
+ return post.map(function(p) {
+ return m.pre + n[0] + p;
+ });
+ }
+ }
+ }
+
+ // at this point, n is the parts, and we know it's not a comma set
+ // with a single entry.
+
+ // no need to expand pre, since it is guaranteed to be free of brace-sets
+ var pre = m.pre;
+ var post = m.post.length
+ ? expand(m.post, false)
+ : [''];
+
+ var N;
+
+ if (isSequence) {
+ var x = numeric(n[0]);
+ var y = numeric(n[1]);
+ var width = Math.max(n[0].length, n[1].length)
+ var incr = n.length == 3
+ ? Math.abs(numeric(n[2]))
+ : 1;
+ var test = lte;
+ var reverse = y < x;
+ if (reverse) {
+ incr *= -1;
+ test = gte;
+ }
+ var pad = n.some(isPadded);
+
+ N = [];
+
+ for (var i = x; test(i, y); i += incr) {
+ var c;
+ if (isAlphaSequence) {
+ c = String.fromCharCode(i);
+ if (c === '\\')
+ c = '';
+ } else {
+ c = String(i);
+ if (pad) {
+ var need = width - c.length;
+ if (need > 0) {
+ var z = new Array(need + 1).join('0');
+ if (i < 0)
+ c = '-' + z + c.slice(1);
+ else
+ c = z + c;
+ }
+ }
+ }
+ N.push(c);
+ }
+ } else {
+ N = concatMap(n, function(el) { return expand(el, false) });
+ }
+
+ for (var j = 0; j < N.length; j++) {
+ for (var k = 0; k < post.length; k++) {
+ var expansion = pre + N[j] + post[k];
+ if (!isTop || isSequence || expansion)
+ expansions.push(expansion);
+ }
+ }
+
+ return expansions;
+}
+
diff --git a/node_modules/brace-expansion/package.json b/node_modules/brace-expansion/package.json
new file mode 100644
index 0000000..a18faa8
--- /dev/null
+++ b/node_modules/brace-expansion/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "brace-expansion",
+ "description": "Brace expansion as known from sh/bash",
+ "version": "1.1.11",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/juliangruber/brace-expansion.git"
+ },
+ "homepage": "https://github.com/juliangruber/brace-expansion",
+ "main": "index.js",
+ "scripts": {
+ "test": "tape test/*.js",
+ "gentest": "bash test/generate.sh",
+ "bench": "matcha test/perf/bench.js"
+ },
+ "dependencies": {
+ "balanced-match": "^1.0.0",
+ "concat-map": "0.0.1"
+ },
+ "devDependencies": {
+ "matcha": "^0.7.0",
+ "tape": "^4.6.0"
+ },
+ "keywords": [],
+ "author": {
+ "name": "Julian Gruber",
+ "email": "mail@juliangruber.com",
+ "url": "http://juliangruber.com"
+ },
+ "license": "MIT",
+ "testling": {
+ "files": "test/*.js",
+ "browsers": [
+ "ie/8..latest",
+ "firefox/20..latest",
+ "firefox/nightly",
+ "chrome/25..latest",
+ "chrome/canary",
+ "opera/12..latest",
+ "opera/next",
+ "safari/5.1..latest",
+ "ipad/6.0..latest",
+ "iphone/6.0..latest",
+ "android-browser/4.2..latest"
+ ]
+ }
+}
diff --git a/node_modules/braces/LICENSE b/node_modules/braces/LICENSE
new file mode 100644
index 0000000..9af4a67
--- /dev/null
+++ b/node_modules/braces/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-present, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/braces/README.md b/node_modules/braces/README.md
new file mode 100644
index 0000000..f59dd60
--- /dev/null
+++ b/node_modules/braces/README.md
@@ -0,0 +1,586 @@
+# braces [](https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=W8YFZ425KND68) [](https://www.npmjs.com/package/braces) [](https://npmjs.org/package/braces) [](https://npmjs.org/package/braces) [](https://travis-ci.org/micromatch/braces)
+
+> Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed.
+
+Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support.
+
+## Install
+
+Install with [npm](https://www.npmjs.com/):
+
+```sh
+$ npm install --save braces
+```
+
+## v3.0.0 Released!!
+
+See the [changelog](CHANGELOG.md) for details.
+
+## Why use braces?
+
+Brace patterns make globs more powerful by adding the ability to match specific ranges and sequences of characters.
+
+- **Accurate** - complete support for the [Bash 4.3 Brace Expansion](www.gnu.org/software/bash/) specification (passes all of the Bash braces tests)
+- **[fast and performant](#benchmarks)** - Starts fast, runs fast and [scales well](#performance) as patterns increase in complexity.
+- **Organized code base** - The parser and compiler are easy to maintain and update when edge cases crop up.
+- **Well-tested** - Thousands of test assertions, and passes all of the Bash, minimatch, and [brace-expansion](https://github.com/juliangruber/brace-expansion) unit tests (as of the date this was written).
+- **Safer** - You shouldn't have to worry about users defining aggressive or malicious brace patterns that can break your application. Braces takes measures to prevent malicious regex that can be used for DDoS attacks (see [catastrophic backtracking](https://www.regular-expressions.info/catastrophic.html)).
+- [Supports lists](#lists) - (aka "sets") `a/{b,c}/d` => `['a/b/d', 'a/c/d']`
+- [Supports sequences](#sequences) - (aka "ranges") `{01..03}` => `['01', '02', '03']`
+- [Supports steps](#steps) - (aka "increments") `{2..10..2}` => `['2', '4', '6', '8', '10']`
+- [Supports escaping](#escaping) - To prevent evaluation of special characters.
+
+## Usage
+
+The main export is a function that takes one or more brace `patterns` and `options`.
+
+```js
+const braces = require('braces');
+// braces(patterns[, options]);
+
+console.log(braces(['{01..05}', '{a..e}']));
+//=> ['(0[1-5])', '([a-e])']
+
+console.log(braces(['{01..05}', '{a..e}'], { expand: true }));
+//=> ['01', '02', '03', '04', '05', 'a', 'b', 'c', 'd', 'e']
+```
+
+### Brace Expansion vs. Compilation
+
+By default, brace patterns are compiled into strings that are optimized for creating regular expressions and matching.
+
+**Compiled**
+
+```js
+console.log(braces('a/{x,y,z}/b'));
+//=> ['a/(x|y|z)/b']
+console.log(braces(['a/{01..20}/b', 'a/{1..5}/b']));
+//=> [ 'a/(0[1-9]|1[0-9]|20)/b', 'a/([1-5])/b' ]
+```
+
+**Expanded**
+
+Enable brace expansion by setting the `expand` option to true, or by using [braces.expand()](#expand) (returns an array similar to what you'd expect from Bash, or `echo {1..5}`, or [minimatch](https://github.com/isaacs/minimatch)):
+
+```js
+console.log(braces('a/{x,y,z}/b', { expand: true }));
+//=> ['a/x/b', 'a/y/b', 'a/z/b']
+
+console.log(braces.expand('{01..10}'));
+//=> ['01','02','03','04','05','06','07','08','09','10']
+```
+
+### Lists
+
+Expand lists (like Bash "sets"):
+
+```js
+console.log(braces('a/{foo,bar,baz}/*.js'));
+//=> ['a/(foo|bar|baz)/*.js']
+
+console.log(braces.expand('a/{foo,bar,baz}/*.js'));
+//=> ['a/foo/*.js', 'a/bar/*.js', 'a/baz/*.js']
+```
+
+### Sequences
+
+Expand ranges of characters (like Bash "sequences"):
+
+```js
+console.log(braces.expand('{1..3}')); // ['1', '2', '3']
+console.log(braces.expand('a/{1..3}/b')); // ['a/1/b', 'a/2/b', 'a/3/b']
+console.log(braces('{a..c}', { expand: true })); // ['a', 'b', 'c']
+console.log(braces('foo/{a..c}', { expand: true })); // ['foo/a', 'foo/b', 'foo/c']
+
+// supports zero-padded ranges
+console.log(braces('a/{01..03}/b')); //=> ['a/(0[1-3])/b']
+console.log(braces('a/{001..300}/b')); //=> ['a/(0{2}[1-9]|0[1-9][0-9]|[12][0-9]{2}|300)/b']
+```
+
+See [fill-range](https://github.com/jonschlinkert/fill-range) for all available range-expansion options.
+
+### Steppped ranges
+
+Steps, or increments, may be used with ranges:
+
+```js
+console.log(braces.expand('{2..10..2}'));
+//=> ['2', '4', '6', '8', '10']
+
+console.log(braces('{2..10..2}'));
+//=> ['(2|4|6|8|10)']
+```
+
+When the [.optimize](#optimize) method is used, or [options.optimize](#optionsoptimize) is set to true, sequences are passed to [to-regex-range](https://github.com/jonschlinkert/to-regex-range) for expansion.
+
+### Nesting
+
+Brace patterns may be nested. The results of each expanded string are not sorted, and left to right order is preserved.
+
+**"Expanded" braces**
+
+```js
+console.log(braces.expand('a{b,c,/{x,y}}/e'));
+//=> ['ab/e', 'ac/e', 'a/x/e', 'a/y/e']
+
+console.log(braces.expand('a/{x,{1..5},y}/c'));
+//=> ['a/x/c', 'a/1/c', 'a/2/c', 'a/3/c', 'a/4/c', 'a/5/c', 'a/y/c']
+```
+
+**"Optimized" braces**
+
+```js
+console.log(braces('a{b,c,/{x,y}}/e'));
+//=> ['a(b|c|/(x|y))/e']
+
+console.log(braces('a/{x,{1..5},y}/c'));
+//=> ['a/(x|([1-5])|y)/c']
+```
+
+### Escaping
+
+**Escaping braces**
+
+A brace pattern will not be expanded or evaluted if _either the opening or closing brace is escaped_:
+
+```js
+console.log(braces.expand('a\\{d,c,b}e'));
+//=> ['a{d,c,b}e']
+
+console.log(braces.expand('a{d,c,b\\}e'));
+//=> ['a{d,c,b}e']
+```
+
+**Escaping commas**
+
+Commas inside braces may also be escaped:
+
+```js
+console.log(braces.expand('a{b\\,c}d'));
+//=> ['a{b,c}d']
+
+console.log(braces.expand('a{d\\,c,b}e'));
+//=> ['ad,ce', 'abe']
+```
+
+**Single items**
+
+Following bash conventions, a brace pattern is also not expanded when it contains a single character:
+
+```js
+console.log(braces.expand('a{b}c'));
+//=> ['a{b}c']
+```
+
+## Options
+
+### options.maxLength
+
+**Type**: `Number`
+
+**Default**: `10,000`
+
+**Description**: Limit the length of the input string. Useful when the input string is generated or your application allows users to pass a string, et cetera.
+
+```js
+console.log(braces('a/{b,c}/d', { maxLength: 3 })); //=> throws an error
+```
+
+### options.expand
+
+**Type**: `Boolean`
+
+**Default**: `undefined`
+
+**Description**: Generate an "expanded" brace pattern (alternatively you can use the `braces.expand()` method, which does the same thing).
+
+```js
+console.log(braces('a/{b,c}/d', { expand: true }));
+//=> [ 'a/b/d', 'a/c/d' ]
+```
+
+### options.nodupes
+
+**Type**: `Boolean`
+
+**Default**: `undefined`
+
+**Description**: Remove duplicates from the returned array.
+
+### options.rangeLimit
+
+**Type**: `Number`
+
+**Default**: `1000`
+
+**Description**: To prevent malicious patterns from being passed by users, an error is thrown when `braces.expand()` is used or `options.expand` is true and the generated range will exceed the `rangeLimit`.
+
+You can customize `options.rangeLimit` or set it to `Inifinity` to disable this altogether.
+
+**Examples**
+
+```js
+// pattern exceeds the "rangeLimit", so it's optimized automatically
+console.log(braces.expand('{1..1000}'));
+//=> ['([1-9]|[1-9][0-9]{1,2}|1000)']
+
+// pattern does not exceed "rangeLimit", so it's NOT optimized
+console.log(braces.expand('{1..100}'));
+//=> ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12', '13', '14', '15', '16', '17', '18', '19', '20', '21', '22', '23', '24', '25', '26', '27', '28', '29', '30', '31', '32', '33', '34', '35', '36', '37', '38', '39', '40', '41', '42', '43', '44', '45', '46', '47', '48', '49', '50', '51', '52', '53', '54', '55', '56', '57', '58', '59', '60', '61', '62', '63', '64', '65', '66', '67', '68', '69', '70', '71', '72', '73', '74', '75', '76', '77', '78', '79', '80', '81', '82', '83', '84', '85', '86', '87', '88', '89', '90', '91', '92', '93', '94', '95', '96', '97', '98', '99', '100']
+```
+
+### options.transform
+
+**Type**: `Function`
+
+**Default**: `undefined`
+
+**Description**: Customize range expansion.
+
+**Example: Transforming non-numeric values**
+
+```js
+const alpha = braces.expand('x/{a..e}/y', {
+ transform(value, index) {
+ // When non-numeric values are passed, "value" is a character code.
+ return 'foo/' + String.fromCharCode(value) + '-' + index;
+ },
+});
+console.log(alpha);
+//=> [ 'x/foo/a-0/y', 'x/foo/b-1/y', 'x/foo/c-2/y', 'x/foo/d-3/y', 'x/foo/e-4/y' ]
+```
+
+**Example: Transforming numeric values**
+
+```js
+const numeric = braces.expand('{1..5}', {
+ transform(value) {
+ // when numeric values are passed, "value" is a number
+ return 'foo/' + value * 2;
+ },
+});
+console.log(numeric);
+//=> [ 'foo/2', 'foo/4', 'foo/6', 'foo/8', 'foo/10' ]
+```
+
+### options.quantifiers
+
+**Type**: `Boolean`
+
+**Default**: `undefined`
+
+**Description**: In regular expressions, quanitifiers can be used to specify how many times a token can be repeated. For example, `a{1,3}` will match the letter `a` one to three times.
+
+Unfortunately, regex quantifiers happen to share the same syntax as [Bash lists](#lists)
+
+The `quantifiers` option tells braces to detect when [regex quantifiers](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp#quantifiers) are defined in the given pattern, and not to try to expand them as lists.
+
+**Examples**
+
+```js
+const braces = require('braces');
+console.log(braces('a/b{1,3}/{x,y,z}'));
+//=> [ 'a/b(1|3)/(x|y|z)' ]
+console.log(braces('a/b{1,3}/{x,y,z}', { quantifiers: true }));
+//=> [ 'a/b{1,3}/(x|y|z)' ]
+console.log(braces('a/b{1,3}/{x,y,z}', { quantifiers: true, expand: true }));
+//=> [ 'a/b{1,3}/x', 'a/b{1,3}/y', 'a/b{1,3}/z' ]
+```
+
+### options.keepEscaping
+
+**Type**: `Boolean`
+
+**Default**: `undefined`
+
+**Description**: Do not strip backslashes that were used for escaping from the result.
+
+## What is "brace expansion"?
+
+Brace expansion is a type of parameter expansion that was made popular by unix shells for generating lists of strings, as well as regex-like matching when used alongside wildcards (globs).
+
+In addition to "expansion", braces are also used for matching. In other words:
+
+- [brace expansion](#brace-expansion) is for generating new lists
+- [brace matching](#brace-matching) is for filtering existing lists
+
+
+More about brace expansion (click to expand)
+
+There are two main types of brace expansion:
+
+1. **lists**: which are defined using comma-separated values inside curly braces: `{a,b,c}`
+2. **sequences**: which are defined using a starting value and an ending value, separated by two dots: `a{1..3}b`. Optionally, a third argument may be passed to define a "step" or increment to use: `a{1..100..10}b`. These are also sometimes referred to as "ranges".
+
+Here are some example brace patterns to illustrate how they work:
+
+**Sets**
+
+```
+{a,b,c} => a b c
+{a,b,c}{1,2} => a1 a2 b1 b2 c1 c2
+```
+
+**Sequences**
+
+```
+{1..9} => 1 2 3 4 5 6 7 8 9
+{4..-4} => 4 3 2 1 0 -1 -2 -3 -4
+{1..20..3} => 1 4 7 10 13 16 19
+{a..j} => a b c d e f g h i j
+{j..a} => j i h g f e d c b a
+{a..z..3} => a d g j m p s v y
+```
+
+**Combination**
+
+Sets and sequences can be mixed together or used along with any other strings.
+
+```
+{a,b,c}{1..3} => a1 a2 a3 b1 b2 b3 c1 c2 c3
+foo/{a,b,c}/bar => foo/a/bar foo/b/bar foo/c/bar
+```
+
+The fact that braces can be "expanded" from relatively simple patterns makes them ideal for quickly generating test fixtures, file paths, and similar use cases.
+
+## Brace matching
+
+In addition to _expansion_, brace patterns are also useful for performing regular-expression-like matching.
+
+For example, the pattern `foo/{1..3}/bar` would match any of following strings:
+
+```
+foo/1/bar
+foo/2/bar
+foo/3/bar
+```
+
+But not:
+
+```
+baz/1/qux
+baz/2/qux
+baz/3/qux
+```
+
+Braces can also be combined with [glob patterns](https://github.com/jonschlinkert/micromatch) to perform more advanced wildcard matching. For example, the pattern `*/{1..3}/*` would match any of following strings:
+
+```
+foo/1/bar
+foo/2/bar
+foo/3/bar
+baz/1/qux
+baz/2/qux
+baz/3/qux
+```
+
+## Brace matching pitfalls
+
+Although brace patterns offer a user-friendly way of matching ranges or sets of strings, there are also some major disadvantages and potential risks you should be aware of.
+
+### tldr
+
+**"brace bombs"**
+
+- brace expansion can eat up a huge amount of processing resources
+- as brace patterns increase _linearly in size_, the system resources required to expand the pattern increase exponentially
+- users can accidentally (or intentially) exhaust your system's resources resulting in the equivalent of a DoS attack (bonus: no programming knowledge is required!)
+
+For a more detailed explanation with examples, see the [geometric complexity](#geometric-complexity) section.
+
+### The solution
+
+Jump to the [performance section](#performance) to see how Braces solves this problem in comparison to other libraries.
+
+### Geometric complexity
+
+At minimum, brace patterns with sets limited to two elements have quadradic or `O(n^2)` complexity. But the complexity of the algorithm increases exponentially as the number of sets, _and elements per set_, increases, which is `O(n^c)`.
+
+For example, the following sets demonstrate quadratic (`O(n^2)`) complexity:
+
+```
+{1,2}{3,4} => (2X2) => 13 14 23 24
+{1,2}{3,4}{5,6} => (2X2X2) => 135 136 145 146 235 236 245 246
+```
+
+But add an element to a set, and we get a n-fold Cartesian product with `O(n^c)` complexity:
+
+```
+{1,2,3}{4,5,6}{7,8,9} => (3X3X3) => 147 148 149 157 158 159 167 168 169 247 248
+ 249 257 258 259 267 268 269 347 348 349 357
+ 358 359 367 368 369
+```
+
+Now, imagine how this complexity grows given that each element is a n-tuple:
+
+```
+{1..100}{1..100} => (100X100) => 10,000 elements (38.4 kB)
+{1..100}{1..100}{1..100} => (100X100X100) => 1,000,000 elements (5.76 MB)
+```
+
+Although these examples are clearly contrived, they demonstrate how brace patterns can quickly grow out of control.
+
+**More information**
+
+Interested in learning more about brace expansion?
+
+- [linuxjournal/bash-brace-expansion](http://www.linuxjournal.com/content/bash-brace-expansion)
+- [rosettacode/Brace_expansion](https://rosettacode.org/wiki/Brace_expansion)
+- [cartesian product](https://en.wikipedia.org/wiki/Cartesian_product)
+
+
+
+## Performance
+
+Braces is not only screaming fast, it's also more accurate the other brace expansion libraries.
+
+### Better algorithms
+
+Fortunately there is a solution to the ["brace bomb" problem](#brace-matching-pitfalls): _don't expand brace patterns into an array when they're used for matching_.
+
+Instead, convert the pattern into an optimized regular expression. This is easier said than done, and braces is the only library that does this currently.
+
+**The proof is in the numbers**
+
+Minimatch gets exponentially slower as patterns increase in complexity, braces does not. The following results were generated using `braces()` and `minimatch.braceExpand()`, respectively.
+
+| **Pattern** | **braces** | **[minimatch][]** |
+| --------------------------- | ------------------- | ---------------------------- |
+| `{1..9007199254740991}`[^1] | `298 B` (5ms 459μs) | N/A (freezes) |
+| `{1..1000000000000000}` | `41 B` (1ms 15μs) | N/A (freezes) |
+| `{1..100000000000000}` | `40 B` (890μs) | N/A (freezes) |
+| `{1..10000000000000}` | `39 B` (2ms 49μs) | N/A (freezes) |
+| `{1..1000000000000}` | `38 B` (608μs) | N/A (freezes) |
+| `{1..100000000000}` | `37 B` (397μs) | N/A (freezes) |
+| `{1..10000000000}` | `35 B` (983μs) | N/A (freezes) |
+| `{1..1000000000}` | `34 B` (798μs) | N/A (freezes) |
+| `{1..100000000}` | `33 B` (733μs) | N/A (freezes) |
+| `{1..10000000}` | `32 B` (5ms 632μs) | `78.89 MB` (16s 388ms 569μs) |
+| `{1..1000000}` | `31 B` (1ms 381μs) | `6.89 MB` (1s 496ms 887μs) |
+| `{1..100000}` | `30 B` (950μs) | `588.89 kB` (146ms 921μs) |
+| `{1..10000}` | `29 B` (1ms 114μs) | `48.89 kB` (14ms 187μs) |
+| `{1..1000}` | `28 B` (760μs) | `3.89 kB` (1ms 453μs) |
+| `{1..100}` | `22 B` (345μs) | `291 B` (196μs) |
+| `{1..10}` | `10 B` (533μs) | `20 B` (37μs) |
+| `{1..3}` | `7 B` (190μs) | `5 B` (27μs) |
+
+### Faster algorithms
+
+When you need expansion, braces is still much faster.
+
+_(the following results were generated using `braces.expand()` and `minimatch.braceExpand()`, respectively)_
+
+| **Pattern** | **braces** | **[minimatch][]** |
+| --------------- | --------------------------- | ---------------------------- |
+| `{1..10000000}` | `78.89 MB` (2s 698ms 642μs) | `78.89 MB` (18s 601ms 974μs) |
+| `{1..1000000}` | `6.89 MB` (458ms 576μs) | `6.89 MB` (1s 491ms 621μs) |
+| `{1..100000}` | `588.89 kB` (20ms 728μs) | `588.89 kB` (156ms 919μs) |
+| `{1..10000}` | `48.89 kB` (2ms 202μs) | `48.89 kB` (13ms 641μs) |
+| `{1..1000}` | `3.89 kB` (1ms 796μs) | `3.89 kB` (1ms 958μs) |
+| `{1..100}` | `291 B` (424μs) | `291 B` (211μs) |
+| `{1..10}` | `20 B` (487μs) | `20 B` (72μs) |
+| `{1..3}` | `5 B` (166μs) | `5 B` (27μs) |
+
+If you'd like to run these comparisons yourself, see [test/support/generate.js](test/support/generate.js).
+
+## Benchmarks
+
+### Running benchmarks
+
+Install dev dependencies:
+
+```bash
+npm i -d && npm benchmark
+```
+
+### Latest results
+
+Braces is more accurate, without sacrificing performance.
+
+```bash
+● expand - range (expanded)
+ braces x 53,167 ops/sec ±0.12% (102 runs sampled)
+ minimatch x 11,378 ops/sec ±0.10% (102 runs sampled)
+● expand - range (optimized for regex)
+ braces x 373,442 ops/sec ±0.04% (100 runs sampled)
+ minimatch x 3,262 ops/sec ±0.18% (100 runs sampled)
+● expand - nested ranges (expanded)
+ braces x 33,921 ops/sec ±0.09% (99 runs sampled)
+ minimatch x 10,855 ops/sec ±0.28% (100 runs sampled)
+● expand - nested ranges (optimized for regex)
+ braces x 287,479 ops/sec ±0.52% (98 runs sampled)
+ minimatch x 3,219 ops/sec ±0.28% (101 runs sampled)
+● expand - set (expanded)
+ braces x 238,243 ops/sec ±0.19% (97 runs sampled)
+ minimatch x 538,268 ops/sec ±0.31% (96 runs sampled)
+● expand - set (optimized for regex)
+ braces x 321,844 ops/sec ±0.10% (97 runs sampled)
+ minimatch x 140,600 ops/sec ±0.15% (100 runs sampled)
+● expand - nested sets (expanded)
+ braces x 165,371 ops/sec ±0.42% (96 runs sampled)
+ minimatch x 337,720 ops/sec ±0.28% (100 runs sampled)
+● expand - nested sets (optimized for regex)
+ braces x 242,948 ops/sec ±0.12% (99 runs sampled)
+ minimatch x 87,403 ops/sec ±0.79% (96 runs sampled)
+```
+
+## About
+
+
+Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
+
+
+
+
+Running Tests
+
+Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
+
+```sh
+$ npm install && npm test
+```
+
+
+
+
+Building docs
+
+_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_
+
+To generate the readme, run the following command:
+
+```sh
+$ npm install -g verbose/verb#dev verb-generate-readme && verb
+```
+
+
+
+### Contributors
+
+| **Commits** | **Contributor** |
+| ----------- | ------------------------------------------------------------- |
+| 197 | [jonschlinkert](https://github.com/jonschlinkert) |
+| 4 | [doowb](https://github.com/doowb) |
+| 1 | [es128](https://github.com/es128) |
+| 1 | [eush77](https://github.com/eush77) |
+| 1 | [hemanth](https://github.com/hemanth) |
+| 1 | [wtgtybhertgeghgtwtg](https://github.com/wtgtybhertgeghgtwtg) |
+
+### Author
+
+**Jon Schlinkert**
+
+- [GitHub Profile](https://github.com/jonschlinkert)
+- [Twitter Profile](https://twitter.com/jonschlinkert)
+- [LinkedIn Profile](https://linkedin.com/in/jonschlinkert)
+
+### License
+
+Copyright © 2019, [Jon Schlinkert](https://github.com/jonschlinkert).
+Released under the [MIT License](LICENSE).
+
+---
+
+_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.8.0, on April 08, 2019._
diff --git a/node_modules/braces/index.js b/node_modules/braces/index.js
new file mode 100644
index 0000000..d222c13
--- /dev/null
+++ b/node_modules/braces/index.js
@@ -0,0 +1,170 @@
+'use strict';
+
+const stringify = require('./lib/stringify');
+const compile = require('./lib/compile');
+const expand = require('./lib/expand');
+const parse = require('./lib/parse');
+
+/**
+ * Expand the given pattern or create a regex-compatible string.
+ *
+ * ```js
+ * const braces = require('braces');
+ * console.log(braces('{a,b,c}', { compile: true })); //=> ['(a|b|c)']
+ * console.log(braces('{a,b,c}')); //=> ['a', 'b', 'c']
+ * ```
+ * @param {String} `str`
+ * @param {Object} `options`
+ * @return {String}
+ * @api public
+ */
+
+const braces = (input, options = {}) => {
+ let output = [];
+
+ if (Array.isArray(input)) {
+ for (const pattern of input) {
+ const result = braces.create(pattern, options);
+ if (Array.isArray(result)) {
+ output.push(...result);
+ } else {
+ output.push(result);
+ }
+ }
+ } else {
+ output = [].concat(braces.create(input, options));
+ }
+
+ if (options && options.expand === true && options.nodupes === true) {
+ output = [...new Set(output)];
+ }
+ return output;
+};
+
+/**
+ * Parse the given `str` with the given `options`.
+ *
+ * ```js
+ * // braces.parse(pattern, [, options]);
+ * const ast = braces.parse('a/{b,c}/d');
+ * console.log(ast);
+ * ```
+ * @param {String} pattern Brace pattern to parse
+ * @param {Object} options
+ * @return {Object} Returns an AST
+ * @api public
+ */
+
+braces.parse = (input, options = {}) => parse(input, options);
+
+/**
+ * Creates a braces string from an AST, or an AST node.
+ *
+ * ```js
+ * const braces = require('braces');
+ * let ast = braces.parse('foo/{a,b}/bar');
+ * console.log(stringify(ast.nodes[2])); //=> '{a,b}'
+ * ```
+ * @param {String} `input` Brace pattern or AST.
+ * @param {Object} `options`
+ * @return {Array} Returns an array of expanded values.
+ * @api public
+ */
+
+braces.stringify = (input, options = {}) => {
+ if (typeof input === 'string') {
+ return stringify(braces.parse(input, options), options);
+ }
+ return stringify(input, options);
+};
+
+/**
+ * Compiles a brace pattern into a regex-compatible, optimized string.
+ * This method is called by the main [braces](#braces) function by default.
+ *
+ * ```js
+ * const braces = require('braces');
+ * console.log(braces.compile('a/{b,c}/d'));
+ * //=> ['a/(b|c)/d']
+ * ```
+ * @param {String} `input` Brace pattern or AST.
+ * @param {Object} `options`
+ * @return {Array} Returns an array of expanded values.
+ * @api public
+ */
+
+braces.compile = (input, options = {}) => {
+ if (typeof input === 'string') {
+ input = braces.parse(input, options);
+ }
+ return compile(input, options);
+};
+
+/**
+ * Expands a brace pattern into an array. This method is called by the
+ * main [braces](#braces) function when `options.expand` is true. Before
+ * using this method it's recommended that you read the [performance notes](#performance))
+ * and advantages of using [.compile](#compile) instead.
+ *
+ * ```js
+ * const braces = require('braces');
+ * console.log(braces.expand('a/{b,c}/d'));
+ * //=> ['a/b/d', 'a/c/d'];
+ * ```
+ * @param {String} `pattern` Brace pattern
+ * @param {Object} `options`
+ * @return {Array} Returns an array of expanded values.
+ * @api public
+ */
+
+braces.expand = (input, options = {}) => {
+ if (typeof input === 'string') {
+ input = braces.parse(input, options);
+ }
+
+ let result = expand(input, options);
+
+ // filter out empty strings if specified
+ if (options.noempty === true) {
+ result = result.filter(Boolean);
+ }
+
+ // filter out duplicates if specified
+ if (options.nodupes === true) {
+ result = [...new Set(result)];
+ }
+
+ return result;
+};
+
+/**
+ * Processes a brace pattern and returns either an expanded array
+ * (if `options.expand` is true), a highly optimized regex-compatible string.
+ * This method is called by the main [braces](#braces) function.
+ *
+ * ```js
+ * const braces = require('braces');
+ * console.log(braces.create('user-{200..300}/project-{a,b,c}-{1..10}'))
+ * //=> 'user-(20[0-9]|2[1-9][0-9]|300)/project-(a|b|c)-([1-9]|10)'
+ * ```
+ * @param {String} `pattern` Brace pattern
+ * @param {Object} `options`
+ * @return {Array} Returns an array of expanded values.
+ * @api public
+ */
+
+braces.create = (input, options = {}) => {
+ if (input === '' || input.length < 3) {
+ return [input];
+ }
+
+ return options.expand !== true
+ ? braces.compile(input, options)
+ : braces.expand(input, options);
+};
+
+/**
+ * Expose "braces"
+ */
+
+module.exports = braces;
diff --git a/node_modules/braces/lib/compile.js b/node_modules/braces/lib/compile.js
new file mode 100644
index 0000000..dce69be
--- /dev/null
+++ b/node_modules/braces/lib/compile.js
@@ -0,0 +1,60 @@
+'use strict';
+
+const fill = require('fill-range');
+const utils = require('./utils');
+
+const compile = (ast, options = {}) => {
+ const walk = (node, parent = {}) => {
+ const invalidBlock = utils.isInvalidBrace(parent);
+ const invalidNode = node.invalid === true && options.escapeInvalid === true;
+ const invalid = invalidBlock === true || invalidNode === true;
+ const prefix = options.escapeInvalid === true ? '\\' : '';
+ let output = '';
+
+ if (node.isOpen === true) {
+ return prefix + node.value;
+ }
+
+ if (node.isClose === true) {
+ console.log('node.isClose', prefix, node.value);
+ return prefix + node.value;
+ }
+
+ if (node.type === 'open') {
+ return invalid ? prefix + node.value : '(';
+ }
+
+ if (node.type === 'close') {
+ return invalid ? prefix + node.value : ')';
+ }
+
+ if (node.type === 'comma') {
+ return node.prev.type === 'comma' ? '' : invalid ? node.value : '|';
+ }
+
+ if (node.value) {
+ return node.value;
+ }
+
+ if (node.nodes && node.ranges > 0) {
+ const args = utils.reduce(node.nodes);
+ const range = fill(...args, { ...options, wrap: false, toRegex: true, strictZeros: true });
+
+ if (range.length !== 0) {
+ return args.length > 1 && range.length > 1 ? `(${range})` : range;
+ }
+ }
+
+ if (node.nodes) {
+ for (const child of node.nodes) {
+ output += walk(child, node);
+ }
+ }
+
+ return output;
+ };
+
+ return walk(ast);
+};
+
+module.exports = compile;
diff --git a/node_modules/braces/lib/constants.js b/node_modules/braces/lib/constants.js
new file mode 100644
index 0000000..2bb3b88
--- /dev/null
+++ b/node_modules/braces/lib/constants.js
@@ -0,0 +1,57 @@
+'use strict';
+
+module.exports = {
+ MAX_LENGTH: 10000,
+
+ // Digits
+ CHAR_0: '0', /* 0 */
+ CHAR_9: '9', /* 9 */
+
+ // Alphabet chars.
+ CHAR_UPPERCASE_A: 'A', /* A */
+ CHAR_LOWERCASE_A: 'a', /* a */
+ CHAR_UPPERCASE_Z: 'Z', /* Z */
+ CHAR_LOWERCASE_Z: 'z', /* z */
+
+ CHAR_LEFT_PARENTHESES: '(', /* ( */
+ CHAR_RIGHT_PARENTHESES: ')', /* ) */
+
+ CHAR_ASTERISK: '*', /* * */
+
+ // Non-alphabetic chars.
+ CHAR_AMPERSAND: '&', /* & */
+ CHAR_AT: '@', /* @ */
+ CHAR_BACKSLASH: '\\', /* \ */
+ CHAR_BACKTICK: '`', /* ` */
+ CHAR_CARRIAGE_RETURN: '\r', /* \r */
+ CHAR_CIRCUMFLEX_ACCENT: '^', /* ^ */
+ CHAR_COLON: ':', /* : */
+ CHAR_COMMA: ',', /* , */
+ CHAR_DOLLAR: '$', /* . */
+ CHAR_DOT: '.', /* . */
+ CHAR_DOUBLE_QUOTE: '"', /* " */
+ CHAR_EQUAL: '=', /* = */
+ CHAR_EXCLAMATION_MARK: '!', /* ! */
+ CHAR_FORM_FEED: '\f', /* \f */
+ CHAR_FORWARD_SLASH: '/', /* / */
+ CHAR_HASH: '#', /* # */
+ CHAR_HYPHEN_MINUS: '-', /* - */
+ CHAR_LEFT_ANGLE_BRACKET: '<', /* < */
+ CHAR_LEFT_CURLY_BRACE: '{', /* { */
+ CHAR_LEFT_SQUARE_BRACKET: '[', /* [ */
+ CHAR_LINE_FEED: '\n', /* \n */
+ CHAR_NO_BREAK_SPACE: '\u00A0', /* \u00A0 */
+ CHAR_PERCENT: '%', /* % */
+ CHAR_PLUS: '+', /* + */
+ CHAR_QUESTION_MARK: '?', /* ? */
+ CHAR_RIGHT_ANGLE_BRACKET: '>', /* > */
+ CHAR_RIGHT_CURLY_BRACE: '}', /* } */
+ CHAR_RIGHT_SQUARE_BRACKET: ']', /* ] */
+ CHAR_SEMICOLON: ';', /* ; */
+ CHAR_SINGLE_QUOTE: '\'', /* ' */
+ CHAR_SPACE: ' ', /* */
+ CHAR_TAB: '\t', /* \t */
+ CHAR_UNDERSCORE: '_', /* _ */
+ CHAR_VERTICAL_LINE: '|', /* | */
+ CHAR_ZERO_WIDTH_NOBREAK_SPACE: '\uFEFF' /* \uFEFF */
+};
diff --git a/node_modules/braces/lib/expand.js b/node_modules/braces/lib/expand.js
new file mode 100644
index 0000000..35b2c41
--- /dev/null
+++ b/node_modules/braces/lib/expand.js
@@ -0,0 +1,113 @@
+'use strict';
+
+const fill = require('fill-range');
+const stringify = require('./stringify');
+const utils = require('./utils');
+
+const append = (queue = '', stash = '', enclose = false) => {
+ const result = [];
+
+ queue = [].concat(queue);
+ stash = [].concat(stash);
+
+ if (!stash.length) return queue;
+ if (!queue.length) {
+ return enclose ? utils.flatten(stash).map(ele => `{${ele}}`) : stash;
+ }
+
+ for (const item of queue) {
+ if (Array.isArray(item)) {
+ for (const value of item) {
+ result.push(append(value, stash, enclose));
+ }
+ } else {
+ for (let ele of stash) {
+ if (enclose === true && typeof ele === 'string') ele = `{${ele}}`;
+ result.push(Array.isArray(ele) ? append(item, ele, enclose) : item + ele);
+ }
+ }
+ }
+ return utils.flatten(result);
+};
+
+const expand = (ast, options = {}) => {
+ const rangeLimit = options.rangeLimit === undefined ? 1000 : options.rangeLimit;
+
+ const walk = (node, parent = {}) => {
+ node.queue = [];
+
+ let p = parent;
+ let q = parent.queue;
+
+ while (p.type !== 'brace' && p.type !== 'root' && p.parent) {
+ p = p.parent;
+ q = p.queue;
+ }
+
+ if (node.invalid || node.dollar) {
+ q.push(append(q.pop(), stringify(node, options)));
+ return;
+ }
+
+ if (node.type === 'brace' && node.invalid !== true && node.nodes.length === 2) {
+ q.push(append(q.pop(), ['{}']));
+ return;
+ }
+
+ if (node.nodes && node.ranges > 0) {
+ const args = utils.reduce(node.nodes);
+
+ if (utils.exceedsLimit(...args, options.step, rangeLimit)) {
+ throw new RangeError('expanded array length exceeds range limit. Use options.rangeLimit to increase or disable the limit.');
+ }
+
+ let range = fill(...args, options);
+ if (range.length === 0) {
+ range = stringify(node, options);
+ }
+
+ q.push(append(q.pop(), range));
+ node.nodes = [];
+ return;
+ }
+
+ const enclose = utils.encloseBrace(node);
+ let queue = node.queue;
+ let block = node;
+
+ while (block.type !== 'brace' && block.type !== 'root' && block.parent) {
+ block = block.parent;
+ queue = block.queue;
+ }
+
+ for (let i = 0; i < node.nodes.length; i++) {
+ const child = node.nodes[i];
+
+ if (child.type === 'comma' && node.type === 'brace') {
+ if (i === 1) queue.push('');
+ queue.push('');
+ continue;
+ }
+
+ if (child.type === 'close') {
+ q.push(append(q.pop(), queue, enclose));
+ continue;
+ }
+
+ if (child.value && child.type !== 'open') {
+ queue.push(append(queue.pop(), child.value));
+ continue;
+ }
+
+ if (child.nodes) {
+ walk(child, node);
+ }
+ }
+
+ return queue;
+ };
+
+ return utils.flatten(walk(ast));
+};
+
+module.exports = expand;
diff --git a/node_modules/braces/lib/parse.js b/node_modules/braces/lib/parse.js
new file mode 100644
index 0000000..3a6988e
--- /dev/null
+++ b/node_modules/braces/lib/parse.js
@@ -0,0 +1,331 @@
+'use strict';
+
+const stringify = require('./stringify');
+
+/**
+ * Constants
+ */
+
+const {
+ MAX_LENGTH,
+ CHAR_BACKSLASH, /* \ */
+ CHAR_BACKTICK, /* ` */
+ CHAR_COMMA, /* , */
+ CHAR_DOT, /* . */
+ CHAR_LEFT_PARENTHESES, /* ( */
+ CHAR_RIGHT_PARENTHESES, /* ) */
+ CHAR_LEFT_CURLY_BRACE, /* { */
+ CHAR_RIGHT_CURLY_BRACE, /* } */
+ CHAR_LEFT_SQUARE_BRACKET, /* [ */
+ CHAR_RIGHT_SQUARE_BRACKET, /* ] */
+ CHAR_DOUBLE_QUOTE, /* " */
+ CHAR_SINGLE_QUOTE, /* ' */
+ CHAR_NO_BREAK_SPACE,
+ CHAR_ZERO_WIDTH_NOBREAK_SPACE
+} = require('./constants');
+
+/**
+ * parse
+ */
+
+const parse = (input, options = {}) => {
+ if (typeof input !== 'string') {
+ throw new TypeError('Expected a string');
+ }
+
+ const opts = options || {};
+ const max = typeof opts.maxLength === 'number' ? Math.min(MAX_LENGTH, opts.maxLength) : MAX_LENGTH;
+ if (input.length > max) {
+ throw new SyntaxError(`Input length (${input.length}), exceeds max characters (${max})`);
+ }
+
+ const ast = { type: 'root', input, nodes: [] };
+ const stack = [ast];
+ let block = ast;
+ let prev = ast;
+ let brackets = 0;
+ const length = input.length;
+ let index = 0;
+ let depth = 0;
+ let value;
+
+ /**
+ * Helpers
+ */
+
+ const advance = () => input[index++];
+ const push = node => {
+ if (node.type === 'text' && prev.type === 'dot') {
+ prev.type = 'text';
+ }
+
+ if (prev && prev.type === 'text' && node.type === 'text') {
+ prev.value += node.value;
+ return;
+ }
+
+ block.nodes.push(node);
+ node.parent = block;
+ node.prev = prev;
+ prev = node;
+ return node;
+ };
+
+ push({ type: 'bos' });
+
+ while (index < length) {
+ block = stack[stack.length - 1];
+ value = advance();
+
+ /**
+ * Invalid chars
+ */
+
+ if (value === CHAR_ZERO_WIDTH_NOBREAK_SPACE || value === CHAR_NO_BREAK_SPACE) {
+ continue;
+ }
+
+ /**
+ * Escaped chars
+ */
+
+ if (value === CHAR_BACKSLASH) {
+ push({ type: 'text', value: (options.keepEscaping ? value : '') + advance() });
+ continue;
+ }
+
+ /**
+ * Right square bracket (literal): ']'
+ */
+
+ if (value === CHAR_RIGHT_SQUARE_BRACKET) {
+ push({ type: 'text', value: '\\' + value });
+ continue;
+ }
+
+ /**
+ * Left square bracket: '['
+ */
+
+ if (value === CHAR_LEFT_SQUARE_BRACKET) {
+ brackets++;
+
+ let next;
+
+ while (index < length && (next = advance())) {
+ value += next;
+
+ if (next === CHAR_LEFT_SQUARE_BRACKET) {
+ brackets++;
+ continue;
+ }
+
+ if (next === CHAR_BACKSLASH) {
+ value += advance();
+ continue;
+ }
+
+ if (next === CHAR_RIGHT_SQUARE_BRACKET) {
+ brackets--;
+
+ if (brackets === 0) {
+ break;
+ }
+ }
+ }
+
+ push({ type: 'text', value });
+ continue;
+ }
+
+ /**
+ * Parentheses
+ */
+
+ if (value === CHAR_LEFT_PARENTHESES) {
+ block = push({ type: 'paren', nodes: [] });
+ stack.push(block);
+ push({ type: 'text', value });
+ continue;
+ }
+
+ if (value === CHAR_RIGHT_PARENTHESES) {
+ if (block.type !== 'paren') {
+ push({ type: 'text', value });
+ continue;
+ }
+ block = stack.pop();
+ push({ type: 'text', value });
+ block = stack[stack.length - 1];
+ continue;
+ }
+
+ /**
+ * Quotes: '|"|`
+ */
+
+ if (value === CHAR_DOUBLE_QUOTE || value === CHAR_SINGLE_QUOTE || value === CHAR_BACKTICK) {
+ const open = value;
+ let next;
+
+ if (options.keepQuotes !== true) {
+ value = '';
+ }
+
+ while (index < length && (next = advance())) {
+ if (next === CHAR_BACKSLASH) {
+ value += next + advance();
+ continue;
+ }
+
+ if (next === open) {
+ if (options.keepQuotes === true) value += next;
+ break;
+ }
+
+ value += next;
+ }
+
+ push({ type: 'text', value });
+ continue;
+ }
+
+ /**
+ * Left curly brace: '{'
+ */
+
+ if (value === CHAR_LEFT_CURLY_BRACE) {
+ depth++;
+
+ const dollar = prev.value && prev.value.slice(-1) === '$' || block.dollar === true;
+ const brace = {
+ type: 'brace',
+ open: true,
+ close: false,
+ dollar,
+ depth,
+ commas: 0,
+ ranges: 0,
+ nodes: []
+ };
+
+ block = push(brace);
+ stack.push(block);
+ push({ type: 'open', value });
+ continue;
+ }
+
+ /**
+ * Right curly brace: '}'
+ */
+
+ if (value === CHAR_RIGHT_CURLY_BRACE) {
+ if (block.type !== 'brace') {
+ push({ type: 'text', value });
+ continue;
+ }
+
+ const type = 'close';
+ block = stack.pop();
+ block.close = true;
+
+ push({ type, value });
+ depth--;
+
+ block = stack[stack.length - 1];
+ continue;
+ }
+
+ /**
+ * Comma: ','
+ */
+
+ if (value === CHAR_COMMA && depth > 0) {
+ if (block.ranges > 0) {
+ block.ranges = 0;
+ const open = block.nodes.shift();
+ block.nodes = [open, { type: 'text', value: stringify(block) }];
+ }
+
+ push({ type: 'comma', value });
+ block.commas++;
+ continue;
+ }
+
+ /**
+ * Dot: '.'
+ */
+
+ if (value === CHAR_DOT && depth > 0 && block.commas === 0) {
+ const siblings = block.nodes;
+
+ if (depth === 0 || siblings.length === 0) {
+ push({ type: 'text', value });
+ continue;
+ }
+
+ if (prev.type === 'dot') {
+ block.range = [];
+ prev.value += value;
+ prev.type = 'range';
+
+ if (block.nodes.length !== 3 && block.nodes.length !== 5) {
+ block.invalid = true;
+ block.ranges = 0;
+ prev.type = 'text';
+ continue;
+ }
+
+ block.ranges++;
+ block.args = [];
+ continue;
+ }
+
+ if (prev.type === 'range') {
+ siblings.pop();
+
+ const before = siblings[siblings.length - 1];
+ before.value += prev.value + value;
+ prev = before;
+ block.ranges--;
+ continue;
+ }
+
+ push({ type: 'dot', value });
+ continue;
+ }
+
+ /**
+ * Text
+ */
+
+ push({ type: 'text', value });
+ }
+
+ // Mark imbalanced braces and brackets as invalid
+ do {
+ block = stack.pop();
+
+ if (block.type !== 'root') {
+ block.nodes.forEach(node => {
+ if (!node.nodes) {
+ if (node.type === 'open') node.isOpen = true;
+ if (node.type === 'close') node.isClose = true;
+ if (!node.nodes) node.type = 'text';
+ node.invalid = true;
+ }
+ });
+
+ // get the location of the block on parent.nodes (block's siblings)
+ const parent = stack[stack.length - 1];
+ const index = parent.nodes.indexOf(block);
+ // replace the (invalid) block with it's nodes
+ parent.nodes.splice(index, 1, ...block.nodes);
+ }
+ } while (stack.length > 0);
+
+ push({ type: 'eos' });
+ return ast;
+};
+
+module.exports = parse;
diff --git a/node_modules/braces/lib/stringify.js b/node_modules/braces/lib/stringify.js
new file mode 100644
index 0000000..8bcf872
--- /dev/null
+++ b/node_modules/braces/lib/stringify.js
@@ -0,0 +1,32 @@
+'use strict';
+
+const utils = require('./utils');
+
+module.exports = (ast, options = {}) => {
+ const stringify = (node, parent = {}) => {
+ const invalidBlock = options.escapeInvalid && utils.isInvalidBrace(parent);
+ const invalidNode = node.invalid === true && options.escapeInvalid === true;
+ let output = '';
+
+ if (node.value) {
+ if ((invalidBlock || invalidNode) && utils.isOpenOrClose(node)) {
+ return '\\' + node.value;
+ }
+ return node.value;
+ }
+
+ if (node.value) {
+ return node.value;
+ }
+
+ if (node.nodes) {
+ for (const child of node.nodes) {
+ output += stringify(child);
+ }
+ }
+ return output;
+ };
+
+ return stringify(ast);
+};
+
diff --git a/node_modules/braces/lib/utils.js b/node_modules/braces/lib/utils.js
new file mode 100644
index 0000000..d19311f
--- /dev/null
+++ b/node_modules/braces/lib/utils.js
@@ -0,0 +1,122 @@
+'use strict';
+
+exports.isInteger = num => {
+ if (typeof num === 'number') {
+ return Number.isInteger(num);
+ }
+ if (typeof num === 'string' && num.trim() !== '') {
+ return Number.isInteger(Number(num));
+ }
+ return false;
+};
+
+/**
+ * Find a node of the given type
+ */
+
+exports.find = (node, type) => node.nodes.find(node => node.type === type);
+
+/**
+ * Find a node of the given type
+ */
+
+exports.exceedsLimit = (min, max, step = 1, limit) => {
+ if (limit === false) return false;
+ if (!exports.isInteger(min) || !exports.isInteger(max)) return false;
+ return ((Number(max) - Number(min)) / Number(step)) >= limit;
+};
+
+/**
+ * Escape the given node with '\\' before node.value
+ */
+
+exports.escapeNode = (block, n = 0, type) => {
+ const node = block.nodes[n];
+ if (!node) return;
+
+ if ((type && node.type === type) || node.type === 'open' || node.type === 'close') {
+ if (node.escaped !== true) {
+ node.value = '\\' + node.value;
+ node.escaped = true;
+ }
+ }
+};
+
+/**
+ * Returns true if the given brace node should be enclosed in literal braces
+ */
+
+exports.encloseBrace = node => {
+ if (node.type !== 'brace') return false;
+ if ((node.commas >> 0 + node.ranges >> 0) === 0) {
+ node.invalid = true;
+ return true;
+ }
+ return false;
+};
+
+/**
+ * Returns true if a brace node is invalid.
+ */
+
+exports.isInvalidBrace = block => {
+ if (block.type !== 'brace') return false;
+ if (block.invalid === true || block.dollar) return true;
+ if ((block.commas >> 0 + block.ranges >> 0) === 0) {
+ block.invalid = true;
+ return true;
+ }
+ if (block.open !== true || block.close !== true) {
+ block.invalid = true;
+ return true;
+ }
+ return false;
+};
+
+/**
+ * Returns true if a node is an open or close node
+ */
+
+exports.isOpenOrClose = node => {
+ if (node.type === 'open' || node.type === 'close') {
+ return true;
+ }
+ return node.open === true || node.close === true;
+};
+
+/**
+ * Reduce an array of text nodes.
+ */
+
+exports.reduce = nodes => nodes.reduce((acc, node) => {
+ if (node.type === 'text') acc.push(node.value);
+ if (node.type === 'range') node.type = 'text';
+ return acc;
+}, []);
+
+/**
+ * Flatten an array
+ */
+
+exports.flatten = (...args) => {
+ const result = [];
+
+ const flat = arr => {
+ for (let i = 0; i < arr.length; i++) {
+ const ele = arr[i];
+
+ if (Array.isArray(ele)) {
+ flat(ele);
+ continue;
+ }
+
+ if (ele !== undefined) {
+ result.push(ele);
+ }
+ }
+ return result;
+ };
+
+ flat(args);
+ return result;
+};
diff --git a/node_modules/braces/package.json b/node_modules/braces/package.json
new file mode 100644
index 0000000..c3c056e
--- /dev/null
+++ b/node_modules/braces/package.json
@@ -0,0 +1,77 @@
+{
+ "name": "braces",
+ "description": "Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed.",
+ "version": "3.0.3",
+ "homepage": "https://github.com/micromatch/braces",
+ "author": "Jon Schlinkert (https://github.com/jonschlinkert)",
+ "contributors": [
+ "Brian Woodward (https://twitter.com/doowb)",
+ "Elan Shanker (https://github.com/es128)",
+ "Eugene Sharygin (https://github.com/eush77)",
+ "hemanth.hm (http://h3manth.com)",
+ "Jon Schlinkert (http://twitter.com/jonschlinkert)"
+ ],
+ "repository": "micromatch/braces",
+ "bugs": {
+ "url": "https://github.com/micromatch/braces/issues"
+ },
+ "license": "MIT",
+ "files": [
+ "index.js",
+ "lib"
+ ],
+ "main": "index.js",
+ "engines": {
+ "node": ">=8"
+ },
+ "scripts": {
+ "test": "mocha",
+ "benchmark": "node benchmark"
+ },
+ "dependencies": {
+ "fill-range": "^7.1.1"
+ },
+ "devDependencies": {
+ "ansi-colors": "^3.2.4",
+ "bash-path": "^2.0.1",
+ "gulp-format-md": "^2.0.0",
+ "mocha": "^6.1.1"
+ },
+ "keywords": [
+ "alpha",
+ "alphabetical",
+ "bash",
+ "brace",
+ "braces",
+ "expand",
+ "expansion",
+ "filepath",
+ "fill",
+ "fs",
+ "glob",
+ "globbing",
+ "letter",
+ "match",
+ "matches",
+ "matching",
+ "number",
+ "numerical",
+ "path",
+ "range",
+ "ranges",
+ "sh"
+ ],
+ "verb": {
+ "toc": false,
+ "layout": "default",
+ "tasks": [
+ "readme"
+ ],
+ "lint": {
+ "reflinks": true
+ },
+ "plugins": [
+ "gulp-format-md"
+ ]
+ }
+}
diff --git a/node_modules/buffer-equal-constant-time/.npmignore b/node_modules/buffer-equal-constant-time/.npmignore
new file mode 100644
index 0000000..34e4f5c
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/.npmignore
@@ -0,0 +1,2 @@
+.*.sw[mnop]
+node_modules/
diff --git a/node_modules/buffer-equal-constant-time/.travis.yml b/node_modules/buffer-equal-constant-time/.travis.yml
new file mode 100644
index 0000000..78e1c01
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+- "0.11"
+- "0.10"
diff --git a/node_modules/buffer-equal-constant-time/LICENSE.txt b/node_modules/buffer-equal-constant-time/LICENSE.txt
new file mode 100644
index 0000000..9a064f3
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/LICENSE.txt
@@ -0,0 +1,12 @@
+Copyright (c) 2013, GoInstant Inc., a salesforce.com company
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
+
+* Neither the name of salesforce.com, nor GoInstant, nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/node_modules/buffer-equal-constant-time/README.md b/node_modules/buffer-equal-constant-time/README.md
new file mode 100644
index 0000000..4f227f5
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/README.md
@@ -0,0 +1,50 @@
+# buffer-equal-constant-time
+
+Constant-time `Buffer` comparison for node.js. Should work with browserify too.
+
+[](https://travis-ci.org/goinstant/buffer-equal-constant-time)
+
+```sh
+ npm install buffer-equal-constant-time
+```
+
+# Usage
+
+```js
+ var bufferEq = require('buffer-equal-constant-time');
+
+ var a = new Buffer('asdf');
+ var b = new Buffer('asdf');
+ if (bufferEq(a,b)) {
+ // the same!
+ } else {
+ // different in at least one byte!
+ }
+```
+
+If you'd like to install an `.equal()` method onto the node.js `Buffer` and
+`SlowBuffer` prototypes:
+
+```js
+ require('buffer-equal-constant-time').install();
+
+ var a = new Buffer('asdf');
+ var b = new Buffer('asdf');
+ if (a.equal(b)) {
+ // the same!
+ } else {
+ // different in at least one byte!
+ }
+```
+
+To get rid of the installed `.equal()` method, call `.restore()`:
+
+```js
+ require('buffer-equal-constant-time').restore();
+```
+
+# Legal
+
+© 2013 GoInstant Inc., a salesforce.com company
+
+Licensed under the BSD 3-clause license.
diff --git a/node_modules/buffer-equal-constant-time/index.js b/node_modules/buffer-equal-constant-time/index.js
new file mode 100644
index 0000000..5462c1f
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/index.js
@@ -0,0 +1,41 @@
+/*jshint node:true */
+'use strict';
+var Buffer = require('buffer').Buffer; // browserify
+var SlowBuffer = require('buffer').SlowBuffer;
+
+module.exports = bufferEq;
+
+function bufferEq(a, b) {
+
+ // shortcutting on type is necessary for correctness
+ if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
+ return false;
+ }
+
+ // buffer sizes should be well-known information, so despite this
+ // shortcutting, it doesn't leak any information about the *contents* of the
+ // buffers.
+ if (a.length !== b.length) {
+ return false;
+ }
+
+ var c = 0;
+ for (var i = 0; i < a.length; i++) {
+ /*jshint bitwise:false */
+ c |= a[i] ^ b[i]; // XOR
+ }
+ return c === 0;
+}
+
+bufferEq.install = function() {
+ Buffer.prototype.equal = SlowBuffer.prototype.equal = function equal(that) {
+ return bufferEq(this, that);
+ };
+};
+
+var origBufEqual = Buffer.prototype.equal;
+var origSlowBufEqual = SlowBuffer.prototype.equal;
+bufferEq.restore = function() {
+ Buffer.prototype.equal = origBufEqual;
+ SlowBuffer.prototype.equal = origSlowBufEqual;
+};
diff --git a/node_modules/buffer-equal-constant-time/package.json b/node_modules/buffer-equal-constant-time/package.json
new file mode 100644
index 0000000..17c7de2
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/package.json
@@ -0,0 +1,21 @@
+{
+ "name": "buffer-equal-constant-time",
+ "version": "1.0.1",
+ "description": "Constant-time comparison of Buffers",
+ "main": "index.js",
+ "scripts": {
+ "test": "mocha test.js"
+ },
+ "repository": "git@github.com:goinstant/buffer-equal-constant-time.git",
+ "keywords": [
+ "buffer",
+ "equal",
+ "constant-time",
+ "crypto"
+ ],
+ "author": "GoInstant Inc., a salesforce.com company",
+ "license": "BSD-3-Clause",
+ "devDependencies": {
+ "mocha": "~1.15.1"
+ }
+}
diff --git a/node_modules/buffer-equal-constant-time/test.js b/node_modules/buffer-equal-constant-time/test.js
new file mode 100644
index 0000000..0bc972d
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/test.js
@@ -0,0 +1,42 @@
+/*jshint node:true */
+'use strict';
+
+var bufferEq = require('./index');
+var assert = require('assert');
+
+describe('buffer-equal-constant-time', function() {
+ var a = new Buffer('asdfasdf123456');
+ var b = new Buffer('asdfasdf123456');
+ var c = new Buffer('asdfasdf');
+
+ describe('bufferEq', function() {
+ it('says a == b', function() {
+ assert.strictEqual(bufferEq(a, b), true);
+ });
+
+ it('says a != c', function() {
+ assert.strictEqual(bufferEq(a, c), false);
+ });
+ });
+
+ describe('install/restore', function() {
+ before(function() {
+ bufferEq.install();
+ });
+ after(function() {
+ bufferEq.restore();
+ });
+
+ it('installed an .equal method', function() {
+ var SlowBuffer = require('buffer').SlowBuffer;
+ assert.ok(Buffer.prototype.equal);
+ assert.ok(SlowBuffer.prototype.equal);
+ });
+
+ it('infected existing Buffers', function() {
+ assert.strictEqual(a.equal(b), true);
+ assert.strictEqual(a.equal(c), false);
+ });
+ });
+
+});
diff --git a/node_modules/bytes/History.md b/node_modules/bytes/History.md
new file mode 100644
index 0000000..d60ce0e
--- /dev/null
+++ b/node_modules/bytes/History.md
@@ -0,0 +1,97 @@
+3.1.2 / 2022-01-27
+==================
+
+ * Fix return value for un-parsable strings
+
+3.1.1 / 2021-11-15
+==================
+
+ * Fix "thousandsSeparator" incorrecting formatting fractional part
+
+3.1.0 / 2019-01-22
+==================
+
+ * Add petabyte (`pb`) support
+
+3.0.0 / 2017-08-31
+==================
+
+ * Change "kB" to "KB" in format output
+ * Remove support for Node.js 0.6
+ * Remove support for ComponentJS
+
+2.5.0 / 2017-03-24
+==================
+
+ * Add option "unit"
+
+2.4.0 / 2016-06-01
+==================
+
+ * Add option "unitSeparator"
+
+2.3.0 / 2016-02-15
+==================
+
+ * Drop partial bytes on all parsed units
+ * Fix non-finite numbers to `.format` to return `null`
+ * Fix parsing byte string that looks like hex
+ * perf: hoist regular expressions
+
+2.2.0 / 2015-11-13
+==================
+
+ * add option "decimalPlaces"
+ * add option "fixedDecimals"
+
+2.1.0 / 2015-05-21
+==================
+
+ * add `.format` export
+ * add `.parse` export
+
+2.0.2 / 2015-05-20
+==================
+
+ * remove map recreation
+ * remove unnecessary object construction
+
+2.0.1 / 2015-05-07
+==================
+
+ * fix browserify require
+ * remove node.extend dependency
+
+2.0.0 / 2015-04-12
+==================
+
+ * add option "case"
+ * add option "thousandsSeparator"
+ * return "null" on invalid parse input
+ * support proper round-trip: bytes(bytes(num)) === num
+ * units no longer case sensitive when parsing
+
+1.0.0 / 2014-05-05
+==================
+
+ * add negative support. fixes #6
+
+0.3.0 / 2014-03-19
+==================
+
+ * added terabyte support
+
+0.2.1 / 2013-04-01
+==================
+
+ * add .component
+
+0.2.0 / 2012-10-28
+==================
+
+ * bytes(200).should.eql('200b')
+
+0.1.0 / 2012-07-04
+==================
+
+ * add bytes to string conversion [yields]
diff --git a/node_modules/bytes/LICENSE b/node_modules/bytes/LICENSE
new file mode 100644
index 0000000..63e95a9
--- /dev/null
+++ b/node_modules/bytes/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 TJ Holowaychuk
+Copyright (c) 2015 Jed Watson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/bytes/Readme.md b/node_modules/bytes/Readme.md
new file mode 100644
index 0000000..5790e23
--- /dev/null
+++ b/node_modules/bytes/Readme.md
@@ -0,0 +1,152 @@
+# Bytes utility
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```bash
+$ npm install bytes
+```
+
+## Usage
+
+```js
+var bytes = require('bytes');
+```
+
+#### bytes(number|string value, [options]): number|string|null
+
+Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number`|`string` | Number value to format or string value to parse |
+| options | `Object` | Conversion options for `format` |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`|`number`|`null` | Return null upon error. Numeric value in bytes, or string value otherwise. |
+
+**Example**
+
+```js
+bytes(1024);
+// output: '1KB'
+
+bytes('1KB');
+// output: 1024
+```
+
+#### bytes.format(number value, [options]): string|null
+
+Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is
+ rounded.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number` | Value in bytes |
+| options | `Object` | Conversion options |
+
+**Options**
+
+| Property | Type | Description |
+|-------------------|--------|-----------------------------------------------------------------------------------------|
+| decimalPlaces | `number`|`null` | Maximum number of decimal places to include in output. Default value to `2`. |
+| fixedDecimals | `boolean`|`null` | Whether to always display the maximum number of decimal places. Default value to `false` |
+| thousandsSeparator | `string`|`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. |
+| unit | `string`|`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). |
+| unitSeparator | `string`|`null` | Separator to use between number and unit. Default value to `''`. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`|`null` | Return null upon error. String value otherwise. |
+
+**Example**
+
+```js
+bytes.format(1024);
+// output: '1KB'
+
+bytes.format(1000);
+// output: '1000B'
+
+bytes.format(1000, {thousandsSeparator: ' '});
+// output: '1 000B'
+
+bytes.format(1024 * 1.7, {decimalPlaces: 0});
+// output: '2KB'
+
+bytes.format(1024, {unitSeparator: ' '});
+// output: '1 KB'
+```
+
+#### bytes.parse(string|number value): number|null
+
+Parse the string value into an integer in bytes. If no unit is given, or `value`
+is a number, it is assumed the value is in bytes.
+
+Supported units and abbreviations are as follows and are case-insensitive:
+
+ * `b` for bytes
+ * `kb` for kilobytes
+ * `mb` for megabytes
+ * `gb` for gigabytes
+ * `tb` for terabytes
+ * `pb` for petabytes
+
+The units are in powers of two, not ten. This means 1kb = 1024b according to this parser.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------------|--------|--------------------|
+| value | `string`|`number` | String to parse, or number in bytes. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|-------------|-------------------------|
+| results | `number`|`null` | Return null upon error. Value in bytes otherwise. |
+
+**Example**
+
+```js
+bytes.parse('1KB');
+// output: 1024
+
+bytes.parse('1024');
+// output: 1024
+
+bytes.parse(1024);
+// output: 1024
+```
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci
+[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci
+[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master
+[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master
+[downloads-image]: https://badgen.net/npm/dm/bytes
+[downloads-url]: https://npmjs.org/package/bytes
+[npm-image]: https://badgen.net/npm/v/bytes
+[npm-url]: https://npmjs.org/package/bytes
diff --git a/node_modules/bytes/index.js b/node_modules/bytes/index.js
new file mode 100644
index 0000000..6f2d0f8
--- /dev/null
+++ b/node_modules/bytes/index.js
@@ -0,0 +1,170 @@
+/*!
+ * bytes
+ * Copyright(c) 2012-2014 TJ Holowaychuk
+ * Copyright(c) 2015 Jed Watson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = bytes;
+module.exports.format = format;
+module.exports.parse = parse;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g;
+
+var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/;
+
+var map = {
+ b: 1,
+ kb: 1 << 10,
+ mb: 1 << 20,
+ gb: 1 << 30,
+ tb: Math.pow(1024, 4),
+ pb: Math.pow(1024, 5),
+};
+
+var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i;
+
+/**
+ * Convert the given value in bytes into a string or parse to string to an integer in bytes.
+ *
+ * @param {string|number} value
+ * @param {{
+ * case: [string],
+ * decimalPlaces: [number]
+ * fixedDecimals: [boolean]
+ * thousandsSeparator: [string]
+ * unitSeparator: [string]
+ * }} [options] bytes options.
+ *
+ * @returns {string|number|null}
+ */
+
+function bytes(value, options) {
+ if (typeof value === 'string') {
+ return parse(value);
+ }
+
+ if (typeof value === 'number') {
+ return format(value, options);
+ }
+
+ return null;
+}
+
+/**
+ * Format the given value in bytes into a string.
+ *
+ * If the value is negative, it is kept as such. If it is a float,
+ * it is rounded.
+ *
+ * @param {number} value
+ * @param {object} [options]
+ * @param {number} [options.decimalPlaces=2]
+ * @param {number} [options.fixedDecimals=false]
+ * @param {string} [options.thousandsSeparator=]
+ * @param {string} [options.unit=]
+ * @param {string} [options.unitSeparator=]
+ *
+ * @returns {string|null}
+ * @public
+ */
+
+function format(value, options) {
+ if (!Number.isFinite(value)) {
+ return null;
+ }
+
+ var mag = Math.abs(value);
+ var thousandsSeparator = (options && options.thousandsSeparator) || '';
+ var unitSeparator = (options && options.unitSeparator) || '';
+ var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2;
+ var fixedDecimals = Boolean(options && options.fixedDecimals);
+ var unit = (options && options.unit) || '';
+
+ if (!unit || !map[unit.toLowerCase()]) {
+ if (mag >= map.pb) {
+ unit = 'PB';
+ } else if (mag >= map.tb) {
+ unit = 'TB';
+ } else if (mag >= map.gb) {
+ unit = 'GB';
+ } else if (mag >= map.mb) {
+ unit = 'MB';
+ } else if (mag >= map.kb) {
+ unit = 'KB';
+ } else {
+ unit = 'B';
+ }
+ }
+
+ var val = value / map[unit.toLowerCase()];
+ var str = val.toFixed(decimalPlaces);
+
+ if (!fixedDecimals) {
+ str = str.replace(formatDecimalsRegExp, '$1');
+ }
+
+ if (thousandsSeparator) {
+ str = str.split('.').map(function (s, i) {
+ return i === 0
+ ? s.replace(formatThousandsRegExp, thousandsSeparator)
+ : s
+ }).join('.');
+ }
+
+ return str + unitSeparator + unit;
+}
+
+/**
+ * Parse the string value into an integer in bytes.
+ *
+ * If no unit is given, it is assumed the value is in bytes.
+ *
+ * @param {number|string} val
+ *
+ * @returns {number|null}
+ * @public
+ */
+
+function parse(val) {
+ if (typeof val === 'number' && !isNaN(val)) {
+ return val;
+ }
+
+ if (typeof val !== 'string') {
+ return null;
+ }
+
+ // Test if the string passed is valid
+ var results = parseRegExp.exec(val);
+ var floatValue;
+ var unit = 'b';
+
+ if (!results) {
+ // Nothing could be extracted from the given string
+ floatValue = parseInt(val, 10);
+ unit = 'b'
+ } else {
+ // Retrieve the value and the unit
+ floatValue = parseFloat(results[1]);
+ unit = results[4].toLowerCase();
+ }
+
+ if (isNaN(floatValue)) {
+ return null;
+ }
+
+ return Math.floor(map[unit] * floatValue);
+}
diff --git a/node_modules/bytes/package.json b/node_modules/bytes/package.json
new file mode 100644
index 0000000..f2b6a8b
--- /dev/null
+++ b/node_modules/bytes/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "bytes",
+ "description": "Utility to parse a string bytes to bytes and vice-versa",
+ "version": "3.1.2",
+ "author": "TJ Holowaychuk (http://tjholowaychuk.com)",
+ "contributors": [
+ "Jed Watson ",
+ "Théo FIDRY "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "byte",
+ "bytes",
+ "utility",
+ "parse",
+ "parser",
+ "convert",
+ "converter"
+ ],
+ "repository": "visionmedia/bytes.js",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-plugin-markdown": "2.2.1",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "History.md",
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --check-leaks --reporter spec",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ }
+}
diff --git a/node_modules/call-bind-apply-helpers/.eslintrc b/node_modules/call-bind-apply-helpers/.eslintrc
new file mode 100644
index 0000000..dfa9a6c
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/.eslintrc
@@ -0,0 +1,16 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "func-name-matching": 0,
+ "id-length": 0,
+ "new-cap": [2, {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ "no-magic-numbers": 0,
+ },
+}
diff --git a/node_modules/call-bind-apply-helpers/.github/FUNDING.yml b/node_modules/call-bind-apply-helpers/.github/FUNDING.yml
new file mode 100644
index 0000000..0011e9d
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/call-bind-apply-helpers
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/node_modules/call-bind-apply-helpers/.nycrc b/node_modules/call-bind-apply-helpers/.nycrc
new file mode 100644
index 0000000..bdd626c
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/.nycrc
@@ -0,0 +1,9 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/call-bind-apply-helpers/CHANGELOG.md b/node_modules/call-bind-apply-helpers/CHANGELOG.md
new file mode 100644
index 0000000..cf630e8
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/CHANGELOG.md
@@ -0,0 +1,23 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.0.1](https://github.com/ljharb/call-bind-apply-helpers/compare/v1.0.0...v1.0.1) - 2024-12-08
+
+### Commits
+
+- [types] `reflectApply`: fix types [`4efc396`](https://github.com/ljharb/call-bind-apply-helpers/commit/4efc3965351a4f02cc55e836fa391d3d11ef2ef8)
+- [Fix] `reflectApply`: oops, Reflect is not a function [`83cc739`](https://github.com/ljharb/call-bind-apply-helpers/commit/83cc7395de6b79b7730bdf092f1436f0b1263c75)
+- [Dev Deps] update `@arethetypeswrong/cli` [`80bd5d3`](https://github.com/ljharb/call-bind-apply-helpers/commit/80bd5d3ae58b4f6b6995ce439dd5a1bcb178a940)
+
+## v1.0.0 - 2024-12-05
+
+### Commits
+
+- Initial implementation, tests, readme [`7879629`](https://github.com/ljharb/call-bind-apply-helpers/commit/78796290f9b7430c9934d6f33d94ae9bc89fce04)
+- Initial commit [`3f1dc16`](https://github.com/ljharb/call-bind-apply-helpers/commit/3f1dc164afc43285631b114a5f9dd9137b2b952f)
+- npm init [`081df04`](https://github.com/ljharb/call-bind-apply-helpers/commit/081df048c312fcee400922026f6e97281200a603)
+- Only apps should have lockfiles [`5b9ca0f`](https://github.com/ljharb/call-bind-apply-helpers/commit/5b9ca0fe8101ebfaf309c549caac4e0a017ed930)
diff --git a/node_modules/call-bind-apply-helpers/LICENSE b/node_modules/call-bind-apply-helpers/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/call-bind-apply-helpers/README.md b/node_modules/call-bind-apply-helpers/README.md
new file mode 100644
index 0000000..8fc0dae
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/README.md
@@ -0,0 +1,62 @@
+# call-bind-apply-helpers [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![dependency status][deps-svg]][deps-url]
+[![dev dependency status][dev-deps-svg]][dev-deps-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+Helper functions around Function call/apply/bind, for use in `call-bind`.
+
+The only packages that should likely ever use this package directly are `call-bind` and `get-intrinsic`.
+Please use `call-bind` unless you have a very good reason not to.
+
+## Getting started
+
+```sh
+npm install --save call-bind-apply-helpers
+```
+
+## Usage/Examples
+
+```js
+const assert = require('assert');
+const callBindBasic = require('call-bind-apply-helpers');
+
+function f(a, b) {
+ assert.equal(this, 1);
+ assert.equal(a, 2);
+ assert.equal(b, 3);
+ assert.equal(arguments.length, 2);
+}
+
+const fBound = callBindBasic([f, 1]);
+
+delete Function.prototype.call;
+delete Function.prototype.bind;
+
+fBound(2, 3);
+```
+
+## Tests
+
+Clone the repo, `npm install`, and run `npm test`
+
+[package-url]: https://npmjs.org/package/call-bind-apply-helpers
+[npm-version-svg]: https://versionbadg.es/ljharb/call-bind-apply-helpers.svg
+[deps-svg]: https://david-dm.org/ljharb/call-bind-apply-helpers.svg
+[deps-url]: https://david-dm.org/ljharb/call-bind-apply-helpers
+[dev-deps-svg]: https://david-dm.org/ljharb/call-bind-apply-helpers/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/call-bind-apply-helpers#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/call-bind-apply-helpers.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/call-bind-apply-helpers.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/call-bind-apply-helpers.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=call-bind-apply-helpers
+[codecov-image]: https://codecov.io/gh/ljharb/call-bind-apply-helpers/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind-apply-helpers/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind-apply-helpers
+[actions-url]: https://github.com/ljharb/call-bind-apply-helpers/actions
diff --git a/node_modules/call-bind-apply-helpers/actualApply.d.ts b/node_modules/call-bind-apply-helpers/actualApply.d.ts
new file mode 100644
index 0000000..b87286a
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/actualApply.d.ts
@@ -0,0 +1 @@
+export = Reflect.apply;
\ No newline at end of file
diff --git a/node_modules/call-bind-apply-helpers/actualApply.js b/node_modules/call-bind-apply-helpers/actualApply.js
new file mode 100644
index 0000000..ffa5135
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/actualApply.js
@@ -0,0 +1,10 @@
+'use strict';
+
+var bind = require('function-bind');
+
+var $apply = require('./functionApply');
+var $call = require('./functionCall');
+var $reflectApply = require('./reflectApply');
+
+/** @type {import('./actualApply')} */
+module.exports = $reflectApply || bind.call($call, $apply);
diff --git a/node_modules/call-bind-apply-helpers/applyBind.d.ts b/node_modules/call-bind-apply-helpers/applyBind.d.ts
new file mode 100644
index 0000000..d176c1a
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/applyBind.d.ts
@@ -0,0 +1,19 @@
+import actualApply from './actualApply';
+
+type TupleSplitHead = T['length'] extends N
+ ? T
+ : T extends [...infer R, any]
+ ? TupleSplitHead
+ : never
+
+type TupleSplitTail = O['length'] extends N
+ ? T
+ : T extends [infer F, ...infer R]
+ ? TupleSplitTail<[...R], N, [...O, F]>
+ : never
+
+type TupleSplit = [TupleSplitHead, TupleSplitTail]
+
+declare function applyBind(...args: TupleSplit, 2>[1]): ReturnType;
+
+export = applyBind;
\ No newline at end of file
diff --git a/node_modules/call-bind-apply-helpers/applyBind.js b/node_modules/call-bind-apply-helpers/applyBind.js
new file mode 100644
index 0000000..d2b7723
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/applyBind.js
@@ -0,0 +1,10 @@
+'use strict';
+
+var bind = require('function-bind');
+var $apply = require('./functionApply');
+var actualApply = require('./actualApply');
+
+/** @type {import('./applyBind')} */
+module.exports = function applyBind() {
+ return actualApply(bind, $apply, arguments);
+};
diff --git a/node_modules/call-bind-apply-helpers/functionApply.d.ts b/node_modules/call-bind-apply-helpers/functionApply.d.ts
new file mode 100644
index 0000000..1f6e11b
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/functionApply.d.ts
@@ -0,0 +1 @@
+export = Function.prototype.apply;
\ No newline at end of file
diff --git a/node_modules/call-bind-apply-helpers/functionApply.js b/node_modules/call-bind-apply-helpers/functionApply.js
new file mode 100644
index 0000000..c71df9c
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/functionApply.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./functionApply')} */
+module.exports = Function.prototype.apply;
diff --git a/node_modules/call-bind-apply-helpers/functionCall.d.ts b/node_modules/call-bind-apply-helpers/functionCall.d.ts
new file mode 100644
index 0000000..15e93df
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/functionCall.d.ts
@@ -0,0 +1 @@
+export = Function.prototype.call;
\ No newline at end of file
diff --git a/node_modules/call-bind-apply-helpers/functionCall.js b/node_modules/call-bind-apply-helpers/functionCall.js
new file mode 100644
index 0000000..7a8d873
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/functionCall.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./functionCall')} */
+module.exports = Function.prototype.call;
diff --git a/node_modules/call-bind-apply-helpers/index.d.ts b/node_modules/call-bind-apply-helpers/index.d.ts
new file mode 100644
index 0000000..a7ae2c5
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/index.d.ts
@@ -0,0 +1,46 @@
+type RemoveFromTuple<
+ Tuple extends unknown[],
+ RemoveCount extends number,
+ Index extends 1[] = []
+> = Index["length"] extends RemoveCount
+ ? Tuple
+ : Tuple extends [first: unknown, ...infer Rest]
+ ? RemoveFromTuple
+ : Tuple;
+
+type ConcatTuples<
+ Prefix extends unknown[],
+ Suffix extends unknown[]
+> = [...Prefix, ...Suffix];
+
+type ReplaceThis = T extends (this: infer OldThis, ...args: infer A) => infer R
+ ? (this: NewThis, ...args: A) => R
+ : never;
+
+type BindFunction<
+ TThis,
+ T extends (this: TThis, ...args: any[]) => any, // Allow specific types to propagate
+ TBoundArgs extends unknown[],
+ ReceiverBound extends boolean
+> = ReceiverBound extends true
+ ? (...args: RemoveFromTuple, TBoundArgs["length"] & number>) => ReturnType>
+ : (...args: ConcatTuples<[TThis], RemoveFromTuple, TBoundArgs["length"] & number>>) => ReturnType;
+
+declare function callBind<
+ TThis,
+ T extends (this: TThis, ...args: any[]) => any,
+ TBoundArgs extends Partial>
+>(
+ args: [fn: T, thisArg: TThis, ...boundArgs: TBoundArgs]
+): BindFunction;
+
+declare function callBind<
+ TThis,
+ T extends (this: TThis, ...args: any[]) => any,
+ TBoundArgs extends Partial>
+>(
+ args: [fn: T, ...boundArgs: TBoundArgs]
+): BindFunction;
+
+export as namespace callBind;
+export = callBind;
diff --git a/node_modules/call-bind-apply-helpers/index.js b/node_modules/call-bind-apply-helpers/index.js
new file mode 100644
index 0000000..8b6b994
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/index.js
@@ -0,0 +1,15 @@
+'use strict';
+
+var bind = require('function-bind');
+var $TypeError = require('es-errors/type');
+
+var $call = require('./functionCall');
+var $actualApply = require('./actualApply');
+
+/** @type {import('.')} */
+module.exports = function callBindBasic(args) {
+ if (args.length < 1 || typeof args[0] !== 'function') {
+ throw new $TypeError('a function is required');
+ }
+ return $actualApply(bind, $call, args);
+};
diff --git a/node_modules/call-bind-apply-helpers/package.json b/node_modules/call-bind-apply-helpers/package.json
new file mode 100644
index 0000000..7398be7
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/package.json
@@ -0,0 +1,85 @@
+{
+ "name": "call-bind-apply-helpers",
+ "version": "1.0.1",
+ "description": "Helper functions around Function call/apply/bind, for use in `call-bind`",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./actualApply": "./actualApply.js",
+ "./applyBind": "./applyBind.js",
+ "./functionApply": "./functionApply.js",
+ "./functionCall": "./functionCall.js",
+ "./reflectApply": "./reflectApply.js",
+ "./package.json": "./package.json"
+ },
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=auto",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=.js,.mjs .",
+ "postlint": "tsc -p . && attw -P",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "npx npm@'>=10.2' audit --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/call-bind-apply-helpers.git"
+ },
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/call-bind-apply-helpers/issues"
+ },
+ "homepage": "https://github.com/ljharb/call-bind-apply-helpers#readme",
+ "dependencies": {
+ "es-errors": "^1.3.0",
+ "function-bind": "^1.1.2"
+ },
+ "devDependencies": {
+ "@arethetypeswrong/cli": "^0.17.1",
+ "@ljharb/eslint-config": "^21.1.1",
+ "@ljharb/tsconfig": "^0.2.2",
+ "@types/for-each": "^0.3.3",
+ "@types/function-bind": "^1.1.10",
+ "@types/object-inspect": "^1.13.0",
+ "@types/tape": "^5.6.5",
+ "auto-changelog": "^2.5.0",
+ "encoding": "^0.1.13",
+ "es-value-fixtures": "^1.5.0",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "for-each": "^0.3.3",
+ "has-strict-mode": "^1.0.1",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "object-inspect": "^1.13.3",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.9.0",
+ "typescript": "next"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/call-bind-apply-helpers/reflectApply.d.ts b/node_modules/call-bind-apply-helpers/reflectApply.d.ts
new file mode 100644
index 0000000..6b2ae76
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/reflectApply.d.ts
@@ -0,0 +1,3 @@
+declare const reflectApply: false | typeof Reflect.apply;
+
+export = reflectApply;
diff --git a/node_modules/call-bind-apply-helpers/reflectApply.js b/node_modules/call-bind-apply-helpers/reflectApply.js
new file mode 100644
index 0000000..3d03caa
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/reflectApply.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./reflectApply')} */
+module.exports = typeof Reflect !== 'undefined' && Reflect && Reflect.apply;
diff --git a/node_modules/call-bind-apply-helpers/test/index.js b/node_modules/call-bind-apply-helpers/test/index.js
new file mode 100644
index 0000000..8acc08a
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/test/index.js
@@ -0,0 +1,63 @@
+'use strict';
+
+var callBind = require('../');
+var hasStrictMode = require('has-strict-mode')();
+var forEach = require('for-each');
+var inspect = require('object-inspect');
+var v = require('es-value-fixtures');
+
+var test = require('tape');
+
+test('callBindBasic', function (t) {
+ forEach(v.nonFunctions, function (nonFunction) {
+ t['throws'](
+ // @ts-expect-error
+ function () { callBind([nonFunction]); },
+ TypeError,
+ inspect(nonFunction) + ' is not a function'
+ );
+ });
+
+ var sentinel = { sentinel: true };
+ /** @type {(this: T, a: number, b: number) => [T | undefined, number, number]} */
+ var func = function (a, b) {
+ // eslint-disable-next-line no-invalid-this
+ return [!hasStrictMode && this === global ? undefined : this, a, b];
+ };
+ t.equal(func.length, 2, 'original function length is 2');
+
+ /** type {(thisArg: unknown, a: number, b: number) => [unknown, number, number]} */
+ var bound = callBind([func]);
+ /** type {((a: number, b: number) => [sentinel, typeof a, typeof b])} */
+ var boundR = callBind([func, sentinel]);
+ /** type {((b: number) => [sentinel, number, typeof b])} */
+ var boundArg = callBind([func, sentinel, 1]);
+
+ // @ts-expect-error
+ t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with no args');
+
+ // @ts-expect-error
+ t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args');
+ // @ts-expect-error
+ t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func too few args');
+ // @ts-expect-error
+ t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args');
+ // @ts-expect-error
+ t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args');
+
+ t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args');
+ t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with right args');
+ t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args');
+ t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg');
+
+ // @ts-expect-error
+ t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args');
+ // @ts-expect-error
+ t.deepEqual(bound(1, 2, 3, 4), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args');
+ // @ts-expect-error
+ t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args');
+ // @ts-expect-error
+ t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args');
+
+ t.end();
+});
diff --git a/node_modules/call-bind-apply-helpers/tsconfig.json b/node_modules/call-bind-apply-helpers/tsconfig.json
new file mode 100644
index 0000000..aef9993
--- /dev/null
+++ b/node_modules/call-bind-apply-helpers/tsconfig.json
@@ -0,0 +1,9 @@
+{
+ "extends": "@ljharb/tsconfig",
+ "compilerOptions": {
+ "target": "es2021",
+ },
+ "exclude": [
+ "coverage",
+ ],
+}
\ No newline at end of file
diff --git a/node_modules/call-bound/.eslintrc b/node_modules/call-bound/.eslintrc
new file mode 100644
index 0000000..2612ed8
--- /dev/null
+++ b/node_modules/call-bound/.eslintrc
@@ -0,0 +1,13 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "new-cap": [2, {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ },
+}
diff --git a/node_modules/call-bound/.github/FUNDING.yml b/node_modules/call-bound/.github/FUNDING.yml
new file mode 100644
index 0000000..2a2a135
--- /dev/null
+++ b/node_modules/call-bound/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/call-bound
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/node_modules/call-bound/.nycrc b/node_modules/call-bound/.nycrc
new file mode 100644
index 0000000..bdd626c
--- /dev/null
+++ b/node_modules/call-bound/.nycrc
@@ -0,0 +1,9 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/call-bound/CHANGELOG.md b/node_modules/call-bound/CHANGELOG.md
new file mode 100644
index 0000000..25fa7a5
--- /dev/null
+++ b/node_modules/call-bound/CHANGELOG.md
@@ -0,0 +1,34 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.0.3](https://github.com/ljharb/call-bound/compare/v1.0.2...v1.0.3) - 2024-12-15
+
+### Commits
+
+- [Refactor] use `call-bind-apply-helpers` instead of `call-bind` [`5e0b134`](https://github.com/ljharb/call-bound/commit/5e0b13496df14fb7d05dae9412f088da8d3f75be)
+- [Deps] update `get-intrinsic` [`41fc967`](https://github.com/ljharb/call-bound/commit/41fc96732a22c7b7e8f381f93ccc54bb6293be2e)
+- [readme] fix example [`79a0137`](https://github.com/ljharb/call-bound/commit/79a0137723f7c6d09c9c05452bbf8d5efb5d6e49)
+- [meta] add `sideEffects` flag [`08b07be`](https://github.com/ljharb/call-bound/commit/08b07be7f1c03f67dc6f3cdaf0906259771859f7)
+
+## [v1.0.2](https://github.com/ljharb/call-bound/compare/v1.0.1...v1.0.2) - 2024-12-10
+
+### Commits
+
+- [Dev Deps] update `@arethetypeswrong/cli`, `@ljharb/tsconfig`, `gopd` [`e6a5ffe`](https://github.com/ljharb/call-bound/commit/e6a5ffe849368fe4f74dfd6cdeca1b9baa39e8d5)
+- [Deps] update `call-bind`, `get-intrinsic` [`2aeb5b5`](https://github.com/ljharb/call-bound/commit/2aeb5b521dc2b2683d1345c753ea1161de2d1c14)
+- [types] improve return type [`1a0c9fe`](https://github.com/ljharb/call-bound/commit/1a0c9fe3114471e7ca1f57d104e2efe713bb4871)
+
+## v1.0.1 - 2024-12-05
+
+### Commits
+
+- Initial implementation, tests, readme, types [`6d94121`](https://github.com/ljharb/call-bound/commit/6d94121a9243602e506334069f7a03189fe3363d)
+- Initial commit [`0eae867`](https://github.com/ljharb/call-bound/commit/0eae867334ea025c33e6e91cdecfc9df96680cf9)
+- npm init [`71b2479`](https://github.com/ljharb/call-bound/commit/71b2479c6723e0b7d91a6b663613067e98b7b275)
+- Only apps should have lockfiles [`c3754a9`](https://github.com/ljharb/call-bound/commit/c3754a949b7f9132b47e2d18c1729889736741eb)
+- [actions] skip `npm ls` in node < 10 [`74275a5`](https://github.com/ljharb/call-bound/commit/74275a5186b8caf6309b6b97472bdcb0df4683a8)
+- [Dev Deps] add missing peer dep [`1354de8`](https://github.com/ljharb/call-bound/commit/1354de8679413e4ae9c523d85f76fa7a5e032d97)
diff --git a/node_modules/call-bound/LICENSE b/node_modules/call-bound/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/call-bound/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/call-bound/README.md b/node_modules/call-bound/README.md
new file mode 100644
index 0000000..a44e43e
--- /dev/null
+++ b/node_modules/call-bound/README.md
@@ -0,0 +1,53 @@
+# call-bound [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![dependency status][deps-svg]][deps-url]
+[![dev dependency status][dev-deps-svg]][dev-deps-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+Robust call-bound JavaScript intrinsics, using `call-bind` and `get-intrinsic`.
+
+## Getting started
+
+```sh
+npm install --save call-bound
+```
+
+## Usage/Examples
+
+```js
+const assert = require('assert');
+const callBound = require('call-bound');
+
+const slice = callBound('Array.prototype.slice');
+
+delete Function.prototype.call;
+delete Function.prototype.bind;
+delete Array.prototype.slice;
+
+assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]);
+```
+
+## Tests
+
+Clone the repo, `npm install`, and run `npm test`
+
+[package-url]: https://npmjs.org/package/call-bound
+[npm-version-svg]: https://versionbadg.es/ljharb/call-bound.svg
+[deps-svg]: https://david-dm.org/ljharb/call-bound.svg
+[deps-url]: https://david-dm.org/ljharb/call-bound
+[dev-deps-svg]: https://david-dm.org/ljharb/call-bound/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/call-bound#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/call-bound.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/call-bound.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/call-bound.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=call-bound
+[codecov-image]: https://codecov.io/gh/ljharb/call-bound/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/call-bound/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bound
+[actions-url]: https://github.com/ljharb/call-bound/actions
diff --git a/node_modules/call-bound/index.d.ts b/node_modules/call-bound/index.d.ts
new file mode 100644
index 0000000..e3d772c
--- /dev/null
+++ b/node_modules/call-bound/index.d.ts
@@ -0,0 +1,13 @@
+import callBind from 'call-bind-apply-helpers';
+
+declare function callBoundIntrinsic(
+ name: string,
+ allowMissing?: false
+): ReturnType;
+
+declare function callBoundIntrinsic(
+ name: string,
+ allowMissing: true
+): undefined | ReturnType;
+
+export = callBoundIntrinsic;
\ No newline at end of file
diff --git a/node_modules/call-bound/index.js b/node_modules/call-bound/index.js
new file mode 100644
index 0000000..3bb4012
--- /dev/null
+++ b/node_modules/call-bound/index.js
@@ -0,0 +1,18 @@
+'use strict';
+
+var GetIntrinsic = require('get-intrinsic');
+
+var callBindBasic = require('call-bind-apply-helpers');
+
+/** @type {(thisArg: string, searchString: string, position?: number) => number} */
+var $indexOf = callBindBasic([GetIntrinsic('%String.prototype.indexOf%')]);
+
+/** @type {import('.')} */
+module.exports = function callBoundIntrinsic(name, allowMissing) {
+ // eslint-disable-next-line no-extra-parens
+ var intrinsic = /** @type {Parameters[0][0]} */ (GetIntrinsic(name, !!allowMissing));
+ if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) {
+ return callBindBasic([intrinsic]);
+ }
+ return intrinsic;
+};
diff --git a/node_modules/call-bound/package.json b/node_modules/call-bound/package.json
new file mode 100644
index 0000000..2893ed1
--- /dev/null
+++ b/node_modules/call-bound/package.json
@@ -0,0 +1,99 @@
+{
+ "name": "call-bound",
+ "version": "1.0.3",
+ "description": "Robust call-bound JavaScript intrinsics, using `call-bind` and `get-intrinsic`.",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=auto",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=.js,.mjs .",
+ "postlint": "tsc -p . && attw -P",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "npx npm@'>=10.2' audit --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/call-bound.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "es",
+ "js",
+ "callbind",
+ "callbound",
+ "call",
+ "bind",
+ "bound",
+ "call-bind",
+ "call-bound",
+ "function",
+ "es-abstract"
+ ],
+ "author": "Jordan Harband ",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/call-bound/issues"
+ },
+ "homepage": "https://github.com/ljharb/call-bound#readme",
+ "dependencies": {
+ "call-bind-apply-helpers": "^1.0.1",
+ "get-intrinsic": "^1.2.6"
+ },
+ "devDependencies": {
+ "@arethetypeswrong/cli": "^0.17.1",
+ "@ljharb/eslint-config": "^21.1.1",
+ "@ljharb/tsconfig": "^0.2.2",
+ "@types/call-bind": "^1.0.5",
+ "@types/get-intrinsic": "^1.2.3",
+ "@types/tape": "^5.6.5",
+ "auto-changelog": "^2.5.0",
+ "encoding": "^0.1.13",
+ "es-value-fixtures": "^1.5.0",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "for-each": "^0.3.3",
+ "gopd": "^1.2.0",
+ "has-strict-mode": "^1.0.1",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "object-inspect": "^1.13.3",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.9.0",
+ "typescript": "next"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/call-bound/test/index.js b/node_modules/call-bound/test/index.js
new file mode 100644
index 0000000..36f5f0b
--- /dev/null
+++ b/node_modules/call-bound/test/index.js
@@ -0,0 +1,54 @@
+'use strict';
+
+var test = require('tape');
+
+var callBound = require('../');
+
+test('callBound', function (t) {
+ // static primitive
+ t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself');
+ t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself');
+
+ // static non-function object
+ t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself');
+ t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself');
+ t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself');
+ t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself');
+
+ // static function
+ t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself');
+ t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself');
+
+ // prototype primitive
+ t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself');
+ t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself');
+
+ // prototype function
+ t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself');
+ t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself');
+ t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original');
+ t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original');
+
+ t['throws'](
+ function () { callBound('does not exist'); },
+ SyntaxError,
+ 'nonexistent intrinsic throws'
+ );
+ t['throws'](
+ function () { callBound('does not exist', true); },
+ SyntaxError,
+ 'allowMissing arg still throws for unknown intrinsic'
+ );
+
+ t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) {
+ st['throws'](
+ function () { callBound('WeakRef'); },
+ TypeError,
+ 'real but absent intrinsic throws'
+ );
+ st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception');
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/node_modules/call-bound/tsconfig.json b/node_modules/call-bound/tsconfig.json
new file mode 100644
index 0000000..d9a6668
--- /dev/null
+++ b/node_modules/call-bound/tsconfig.json
@@ -0,0 +1,9 @@
+{
+ "extends": "@ljharb/tsconfig",
+ "compilerOptions": {
+ "target": "es2021",
+ },
+ "exclude": [
+ "coverage",
+ ],
+}
diff --git a/node_modules/chokidar/LICENSE b/node_modules/chokidar/LICENSE
new file mode 100644
index 0000000..fa9162b
--- /dev/null
+++ b/node_modules/chokidar/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2012-2019 Paul Miller (https://paulmillr.com), Elan Shanker
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the “Software”), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/chokidar/README.md b/node_modules/chokidar/README.md
new file mode 100644
index 0000000..8e25dec
--- /dev/null
+++ b/node_modules/chokidar/README.md
@@ -0,0 +1,308 @@
+# Chokidar [](https://github.com/paulmillr/chokidar) [](https://github.com/paulmillr/chokidar)
+
+> Minimal and efficient cross-platform file watching library
+
+[](https://www.npmjs.com/package/chokidar)
+
+## Why?
+
+Node.js `fs.watch`:
+
+* Doesn't report filenames on MacOS.
+* Doesn't report events at all when using editors like Sublime on MacOS.
+* Often reports events twice.
+* Emits most changes as `rename`.
+* Does not provide an easy way to recursively watch file trees.
+* Does not support recursive watching on Linux.
+
+Node.js `fs.watchFile`:
+
+* Almost as bad at event handling.
+* Also does not provide any recursive watching.
+* Results in high CPU utilization.
+
+Chokidar resolves these problems.
+
+Initially made for **[Brunch](https://brunch.io/)** (an ultra-swift web app build tool), it is now used in
+[Microsoft's Visual Studio Code](https://github.com/microsoft/vscode),
+[gulp](https://github.com/gulpjs/gulp/),
+[karma](https://karma-runner.github.io/),
+[PM2](https://github.com/Unitech/PM2),
+[browserify](http://browserify.org/),
+[webpack](https://webpack.github.io/),
+[BrowserSync](https://www.browsersync.io/),
+and [many others](https://www.npmjs.com/browse/depended/chokidar).
+It has proven itself in production environments.
+
+Version 3 is out! Check out our blog post about it: [Chokidar 3: How to save 32TB of traffic every week](https://paulmillr.com/posts/chokidar-3-save-32tb-of-traffic/)
+
+## How?
+
+Chokidar does still rely on the Node.js core `fs` module, but when using
+`fs.watch` and `fs.watchFile` for watching, it normalizes the events it
+receives, often checking for truth by getting file stats and/or dir contents.
+
+On MacOS, chokidar by default uses a native extension exposing the Darwin
+`FSEvents` API. This provides very efficient recursive watching compared with
+implementations like `kqueue` available on most \*nix platforms. Chokidar still
+does have to do some work to normalize the events received that way as well.
+
+On most other platforms, the `fs.watch`-based implementation is the default, which
+avoids polling and keeps CPU usage down. Be advised that chokidar will initiate
+watchers recursively for everything within scope of the paths that have been
+specified, so be judicious about not wasting system resources by watching much
+more than needed.
+
+## Getting started
+
+Install with npm:
+
+```sh
+npm install chokidar
+```
+
+Then `require` and use it in your code:
+
+```javascript
+const chokidar = require('chokidar');
+
+// One-liner for current directory
+chokidar.watch('.').on('all', (event, path) => {
+ console.log(event, path);
+});
+```
+
+## API
+
+```javascript
+// Example of a more typical implementation structure
+
+// Initialize watcher.
+const watcher = chokidar.watch('file, dir, glob, or array', {
+ ignored: /(^|[\/\\])\../, // ignore dotfiles
+ persistent: true
+});
+
+// Something to use when events are received.
+const log = console.log.bind(console);
+// Add event listeners.
+watcher
+ .on('add', path => log(`File ${path} has been added`))
+ .on('change', path => log(`File ${path} has been changed`))
+ .on('unlink', path => log(`File ${path} has been removed`));
+
+// More possible events.
+watcher
+ .on('addDir', path => log(`Directory ${path} has been added`))
+ .on('unlinkDir', path => log(`Directory ${path} has been removed`))
+ .on('error', error => log(`Watcher error: ${error}`))
+ .on('ready', () => log('Initial scan complete. Ready for changes'))
+ .on('raw', (event, path, details) => { // internal
+ log('Raw event info:', event, path, details);
+ });
+
+// 'add', 'addDir' and 'change' events also receive stat() results as second
+// argument when available: https://nodejs.org/api/fs.html#fs_class_fs_stats
+watcher.on('change', (path, stats) => {
+ if (stats) console.log(`File ${path} changed size to ${stats.size}`);
+});
+
+// Watch new files.
+watcher.add('new-file');
+watcher.add(['new-file-2', 'new-file-3', '**/other-file*']);
+
+// Get list of actual paths being watched on the filesystem
+var watchedPaths = watcher.getWatched();
+
+// Un-watch some files.
+await watcher.unwatch('new-file*');
+
+// Stop watching.
+// The method is async!
+watcher.close().then(() => console.log('closed'));
+
+// Full list of options. See below for descriptions.
+// Do not use this example!
+chokidar.watch('file', {
+ persistent: true,
+
+ ignored: '*.txt',
+ ignoreInitial: false,
+ followSymlinks: true,
+ cwd: '.',
+ disableGlobbing: false,
+
+ usePolling: false,
+ interval: 100,
+ binaryInterval: 300,
+ alwaysStat: false,
+ depth: 99,
+ awaitWriteFinish: {
+ stabilityThreshold: 2000,
+ pollInterval: 100
+ },
+
+ ignorePermissionErrors: false,
+ atomic: true // or a custom 'atomicity delay', in milliseconds (default 100)
+});
+
+```
+
+`chokidar.watch(paths, [options])`
+
+* `paths` (string or array of strings). Paths to files, dirs to be watched
+recursively, or glob patterns.
+ - Note: globs must not contain windows separators (`\`),
+ because that's how they work by the standard —
+ you'll need to replace them with forward slashes (`/`).
+ - Note 2: for additional glob documentation, check out low-level
+ library: [picomatch](https://github.com/micromatch/picomatch).
+* `options` (object) Options object as defined below:
+
+#### Persistence
+
+* `persistent` (default: `true`). Indicates whether the process
+should continue to run as long as files are being watched. If set to
+`false` when using `fsevents` to watch, no more events will be emitted
+after `ready`, even if the process continues to run.
+
+#### Path filtering
+
+* `ignored` ([anymatch](https://github.com/es128/anymatch)-compatible definition)
+Defines files/paths to be ignored. The whole relative or absolute path is
+tested, not just filename. If a function with two arguments is provided, it
+gets called twice per path - once with a single argument (the path), second
+time with two arguments (the path and the
+[`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats)
+object of that path).
+* `ignoreInitial` (default: `false`). If set to `false` then `add`/`addDir` events are also emitted for matching paths while
+instantiating the watching as chokidar discovers these file paths (before the `ready` event).
+* `followSymlinks` (default: `true`). When `false`, only the
+symlinks themselves will be watched for changes instead of following
+the link references and bubbling events through the link's path.
+* `cwd` (no default). The base directory from which watch `paths` are to be
+derived. Paths emitted with events will be relative to this.
+* `disableGlobbing` (default: `false`). If set to `true` then the strings passed to `.watch()` and `.add()` are treated as
+literal path names, even if they look like globs.
+
+#### Performance
+
+* `usePolling` (default: `false`).
+Whether to use fs.watchFile (backed by polling), or fs.watch. If polling
+leads to high CPU utilization, consider setting this to `false`. It is
+typically necessary to **set this to `true` to successfully watch files over
+a network**, and it may be necessary to successfully watch files in other
+non-standard situations. Setting to `true` explicitly on MacOS overrides the
+`useFsEvents` default. You may also set the CHOKIDAR_USEPOLLING env variable
+to true (1) or false (0) in order to override this option.
+* _Polling-specific settings_ (effective when `usePolling: true`)
+ * `interval` (default: `100`). Interval of file system polling, in milliseconds. You may also
+ set the CHOKIDAR_INTERVAL env variable to override this option.
+ * `binaryInterval` (default: `300`). Interval of file system
+ polling for binary files.
+ ([see list of binary extensions](https://github.com/sindresorhus/binary-extensions/blob/master/binary-extensions.json))
+* `useFsEvents` (default: `true` on MacOS). Whether to use the
+`fsevents` watching interface if available. When set to `true` explicitly
+and `fsevents` is available this supercedes the `usePolling` setting. When
+set to `false` on MacOS, `usePolling: true` becomes the default.
+* `alwaysStat` (default: `false`). If relying upon the
+[`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats)
+object that may get passed with `add`, `addDir`, and `change` events, set
+this to `true` to ensure it is provided even in cases where it wasn't
+already available from the underlying watch events.
+* `depth` (default: `undefined`). If set, limits how many levels of
+subdirectories will be traversed.
+* `awaitWriteFinish` (default: `false`).
+By default, the `add` event will fire when a file first appears on disk, before
+the entire file has been written. Furthermore, in some cases some `change`
+events will be emitted while the file is being written. In some cases,
+especially when watching for large files there will be a need to wait for the
+write operation to finish before responding to a file creation or modification.
+Setting `awaitWriteFinish` to `true` (or a truthy value) will poll file size,
+holding its `add` and `change` events until the size does not change for a
+configurable amount of time. The appropriate duration setting is heavily
+dependent on the OS and hardware. For accurate detection this parameter should
+be relatively high, making file watching much less responsive.
+Use with caution.
+ * *`options.awaitWriteFinish` can be set to an object in order to adjust
+ timing params:*
+ * `awaitWriteFinish.stabilityThreshold` (default: 2000). Amount of time in
+ milliseconds for a file size to remain constant before emitting its event.
+ * `awaitWriteFinish.pollInterval` (default: 100). File size polling interval, in milliseconds.
+
+#### Errors
+
+* `ignorePermissionErrors` (default: `false`). Indicates whether to watch files
+that don't have read permissions if possible. If watching fails due to `EPERM`
+or `EACCES` with this set to `true`, the errors will be suppressed silently.
+* `atomic` (default: `true` if `useFsEvents` and `usePolling` are `false`).
+Automatically filters out artifacts that occur when using editors that use
+"atomic writes" instead of writing directly to the source file. If a file is
+re-added within 100 ms of being deleted, Chokidar emits a `change` event
+rather than `unlink` then `add`. If the default of 100 ms does not work well
+for you, you can override it by setting `atomic` to a custom value, in
+milliseconds.
+
+### Methods & Events
+
+`chokidar.watch()` produces an instance of `FSWatcher`. Methods of `FSWatcher`:
+
+* `.add(path / paths)`: Add files, directories, or glob patterns for tracking.
+Takes an array of strings or just one string.
+* `.on(event, callback)`: Listen for an FS event.
+Available events: `add`, `addDir`, `change`, `unlink`, `unlinkDir`, `ready`,
+`raw`, `error`.
+Additionally `all` is available which gets emitted with the underlying event
+name and path for every event other than `ready`, `raw`, and `error`. `raw` is internal, use it carefully.
+* `.unwatch(path / paths)`: Stop watching files, directories, or glob patterns.
+Takes an array of strings or just one string.
+* `.close()`: **async** Removes all listeners from watched files. Asynchronous, returns Promise. Use with `await` to ensure bugs don't happen.
+* `.getWatched()`: Returns an object representing all the paths on the file
+system being watched by this `FSWatcher` instance. The object's keys are all the
+directories (using absolute paths unless the `cwd` option was used), and the
+values are arrays of the names of the items contained in each directory.
+
+## CLI
+
+If you need a CLI interface for your file watching, check out
+[chokidar-cli](https://github.com/open-cli-tools/chokidar-cli), allowing you to
+execute a command on each change, or get a stdio stream of change events.
+
+## Install Troubleshooting
+
+* `npm WARN optional dep failed, continuing fsevents@n.n.n`
+ * This message is normal part of how `npm` handles optional dependencies and is
+ not indicative of a problem. Even if accompanied by other related error messages,
+ Chokidar should function properly.
+
+* `TypeError: fsevents is not a constructor`
+ * Update chokidar by doing `rm -rf node_modules package-lock.json yarn.lock && npm install`, or update your dependency that uses chokidar.
+
+* Chokidar is producing `ENOSP` error on Linux, like this:
+ * `bash: cannot set terminal process group (-1): Inappropriate ioctl for device bash: no job control in this shell`
+ `Error: watch /home/ ENOSPC`
+ * This means Chokidar ran out of file handles and you'll need to increase their count by executing the following command in Terminal:
+ `echo fs.inotify.max_user_watches=524288 | sudo tee -a /etc/sysctl.conf && sudo sysctl -p`
+
+## Changelog
+
+For more detailed changelog, see [`full_changelog.md`](.github/full_changelog.md).
+- **v3.5 (Jan 6, 2021):** Support for ARM Macs with Apple Silicon. Fixes for deleted symlinks.
+- **v3.4 (Apr 26, 2020):** Support for directory-based symlinks. Fixes for macos file replacement.
+- **v3.3 (Nov 2, 2019):** `FSWatcher#close()` method became async. That fixes IO race conditions related to close method.
+- **v3.2 (Oct 1, 2019):** Improve Linux RAM usage by 50%. Race condition fixes. Windows glob fixes. Improve stability by using tight range of dependency versions.
+- **v3.1 (Sep 16, 2019):** dotfiles are no longer filtered out by default. Use `ignored` option if needed. Improve initial Linux scan time by 50%.
+- **v3 (Apr 30, 2019):** massive CPU & RAM consumption improvements; reduces deps / package size by a factor of 17x and bumps Node.js requirement to v8.16 and higher.
+- **v2 (Dec 29, 2017):** Globs are now posix-style-only; without windows support. Tons of bugfixes.
+- **v1 (Apr 7, 2015):** Glob support, symlink support, tons of bugfixes. Node 0.8+ is supported
+- **v0.1 (Apr 20, 2012):** Initial release, extracted from [Brunch](https://github.com/brunch/brunch/blob/9847a065aea300da99bd0753f90354cde9de1261/src/helpers.coffee#L66)
+
+## Also
+
+Why was chokidar named this way? What's the meaning behind it?
+
+>Chowkidar is a transliteration of a Hindi word meaning 'watchman, gatekeeper', चौकीदार. This ultimately comes from Sanskrit _ चतुष्क_ (crossway, quadrangle, consisting-of-four). This word is also used in other languages like Urdu as (چوکیدار) which is widely used in Pakistan and India.
+
+## License
+
+MIT (c) Paul Miller (), see [LICENSE](LICENSE) file.
diff --git a/node_modules/chokidar/index.js b/node_modules/chokidar/index.js
new file mode 100644
index 0000000..8752893
--- /dev/null
+++ b/node_modules/chokidar/index.js
@@ -0,0 +1,973 @@
+'use strict';
+
+const { EventEmitter } = require('events');
+const fs = require('fs');
+const sysPath = require('path');
+const { promisify } = require('util');
+const readdirp = require('readdirp');
+const anymatch = require('anymatch').default;
+const globParent = require('glob-parent');
+const isGlob = require('is-glob');
+const braces = require('braces');
+const normalizePath = require('normalize-path');
+
+const NodeFsHandler = require('./lib/nodefs-handler');
+const FsEventsHandler = require('./lib/fsevents-handler');
+const {
+ EV_ALL,
+ EV_READY,
+ EV_ADD,
+ EV_CHANGE,
+ EV_UNLINK,
+ EV_ADD_DIR,
+ EV_UNLINK_DIR,
+ EV_RAW,
+ EV_ERROR,
+
+ STR_CLOSE,
+ STR_END,
+
+ BACK_SLASH_RE,
+ DOUBLE_SLASH_RE,
+ SLASH_OR_BACK_SLASH_RE,
+ DOT_RE,
+ REPLACER_RE,
+
+ SLASH,
+ SLASH_SLASH,
+ BRACE_START,
+ BANG,
+ ONE_DOT,
+ TWO_DOTS,
+ GLOBSTAR,
+ SLASH_GLOBSTAR,
+ ANYMATCH_OPTS,
+ STRING_TYPE,
+ FUNCTION_TYPE,
+ EMPTY_STR,
+ EMPTY_FN,
+
+ isWindows,
+ isMacos,
+ isIBMi
+} = require('./lib/constants');
+
+const stat = promisify(fs.stat);
+const readdir = promisify(fs.readdir);
+
+/**
+ * @typedef {String} Path
+ * @typedef {'all'|'add'|'addDir'|'change'|'unlink'|'unlinkDir'|'raw'|'error'|'ready'} EventName
+ * @typedef {'readdir'|'watch'|'add'|'remove'|'change'} ThrottleType
+ */
+
+/**
+ *
+ * @typedef {Object} WatchHelpers
+ * @property {Boolean} followSymlinks
+ * @property {'stat'|'lstat'} statMethod
+ * @property {Path} path
+ * @property {Path} watchPath
+ * @property {Function} entryPath
+ * @property {Boolean} hasGlob
+ * @property {Object} globFilter
+ * @property {Function} filterPath
+ * @property {Function} filterDir
+ */
+
+const arrify = (value = []) => Array.isArray(value) ? value : [value];
+const flatten = (list, result = []) => {
+ list.forEach(item => {
+ if (Array.isArray(item)) {
+ flatten(item, result);
+ } else {
+ result.push(item);
+ }
+ });
+ return result;
+};
+
+const unifyPaths = (paths_) => {
+ /**
+ * @type {Array}
+ */
+ const paths = flatten(arrify(paths_));
+ if (!paths.every(p => typeof p === STRING_TYPE)) {
+ throw new TypeError(`Non-string provided as watch path: ${paths}`);
+ }
+ return paths.map(normalizePathToUnix);
+};
+
+// If SLASH_SLASH occurs at the beginning of path, it is not replaced
+// because "//StoragePC/DrivePool/Movies" is a valid network path
+const toUnix = (string) => {
+ let str = string.replace(BACK_SLASH_RE, SLASH);
+ let prepend = false;
+ if (str.startsWith(SLASH_SLASH)) {
+ prepend = true;
+ }
+ while (str.match(DOUBLE_SLASH_RE)) {
+ str = str.replace(DOUBLE_SLASH_RE, SLASH);
+ }
+ if (prepend) {
+ str = SLASH + str;
+ }
+ return str;
+};
+
+// Our version of upath.normalize
+// TODO: this is not equal to path-normalize module - investigate why
+const normalizePathToUnix = (path) => toUnix(sysPath.normalize(toUnix(path)));
+
+const normalizeIgnored = (cwd = EMPTY_STR) => (path) => {
+ if (typeof path !== STRING_TYPE) return path;
+ return normalizePathToUnix(sysPath.isAbsolute(path) ? path : sysPath.join(cwd, path));
+};
+
+const getAbsolutePath = (path, cwd) => {
+ if (sysPath.isAbsolute(path)) {
+ return path;
+ }
+ if (path.startsWith(BANG)) {
+ return BANG + sysPath.join(cwd, path.slice(1));
+ }
+ return sysPath.join(cwd, path);
+};
+
+const undef = (opts, key) => opts[key] === undefined;
+
+/**
+ * Directory entry.
+ * @property {Path} path
+ * @property {Set} items
+ */
+class DirEntry {
+ /**
+ * @param {Path} dir
+ * @param {Function} removeWatcher
+ */
+ constructor(dir, removeWatcher) {
+ this.path = dir;
+ this._removeWatcher = removeWatcher;
+ /** @type {Set} */
+ this.items = new Set();
+ }
+
+ add(item) {
+ const {items} = this;
+ if (!items) return;
+ if (item !== ONE_DOT && item !== TWO_DOTS) items.add(item);
+ }
+
+ async remove(item) {
+ const {items} = this;
+ if (!items) return;
+ items.delete(item);
+ if (items.size > 0) return;
+
+ const dir = this.path;
+ try {
+ await readdir(dir);
+ } catch (err) {
+ if (this._removeWatcher) {
+ this._removeWatcher(sysPath.dirname(dir), sysPath.basename(dir));
+ }
+ }
+ }
+
+ has(item) {
+ const {items} = this;
+ if (!items) return;
+ return items.has(item);
+ }
+
+ /**
+ * @returns {Array}
+ */
+ getChildren() {
+ const {items} = this;
+ if (!items) return;
+ return [...items.values()];
+ }
+
+ dispose() {
+ this.items.clear();
+ delete this.path;
+ delete this._removeWatcher;
+ delete this.items;
+ Object.freeze(this);
+ }
+}
+
+const STAT_METHOD_F = 'stat';
+const STAT_METHOD_L = 'lstat';
+class WatchHelper {
+ constructor(path, watchPath, follow, fsw) {
+ this.fsw = fsw;
+ this.path = path = path.replace(REPLACER_RE, EMPTY_STR);
+ this.watchPath = watchPath;
+ this.fullWatchPath = sysPath.resolve(watchPath);
+ this.hasGlob = watchPath !== path;
+ /** @type {object|boolean} */
+ if (path === EMPTY_STR) this.hasGlob = false;
+ this.globSymlink = this.hasGlob && follow ? undefined : false;
+ this.globFilter = this.hasGlob ? anymatch(path, undefined, ANYMATCH_OPTS) : false;
+ this.dirParts = this.getDirParts(path);
+ this.dirParts.forEach((parts) => {
+ if (parts.length > 1) parts.pop();
+ });
+ this.followSymlinks = follow;
+ this.statMethod = follow ? STAT_METHOD_F : STAT_METHOD_L;
+ }
+
+ checkGlobSymlink(entry) {
+ // only need to resolve once
+ // first entry should always have entry.parentDir === EMPTY_STR
+ if (this.globSymlink === undefined) {
+ this.globSymlink = entry.fullParentDir === this.fullWatchPath ?
+ false : {realPath: entry.fullParentDir, linkPath: this.fullWatchPath};
+ }
+
+ if (this.globSymlink) {
+ return entry.fullPath.replace(this.globSymlink.realPath, this.globSymlink.linkPath);
+ }
+
+ return entry.fullPath;
+ }
+
+ entryPath(entry) {
+ return sysPath.join(this.watchPath,
+ sysPath.relative(this.watchPath, this.checkGlobSymlink(entry))
+ );
+ }
+
+ filterPath(entry) {
+ const {stats} = entry;
+ if (stats && stats.isSymbolicLink()) return this.filterDir(entry);
+ const resolvedPath = this.entryPath(entry);
+ const matchesGlob = this.hasGlob && typeof this.globFilter === FUNCTION_TYPE ?
+ this.globFilter(resolvedPath) : true;
+ return matchesGlob &&
+ this.fsw._isntIgnored(resolvedPath, stats) &&
+ this.fsw._hasReadPermissions(stats);
+ }
+
+ getDirParts(path) {
+ if (!this.hasGlob) return [];
+ const parts = [];
+ const expandedPath = path.includes(BRACE_START) ? braces.expand(path) : [path];
+ expandedPath.forEach((path) => {
+ parts.push(sysPath.relative(this.watchPath, path).split(SLASH_OR_BACK_SLASH_RE));
+ });
+ return parts;
+ }
+
+ filterDir(entry) {
+ if (this.hasGlob) {
+ const entryParts = this.getDirParts(this.checkGlobSymlink(entry));
+ let globstar = false;
+ this.unmatchedGlob = !this.dirParts.some((parts) => {
+ return parts.every((part, i) => {
+ if (part === GLOBSTAR) globstar = true;
+ return globstar || !entryParts[0][i] || anymatch(part, entryParts[0][i], ANYMATCH_OPTS);
+ });
+ });
+ }
+ return !this.unmatchedGlob && this.fsw._isntIgnored(this.entryPath(entry), entry.stats);
+ }
+}
+
+/**
+ * Watches files & directories for changes. Emitted events:
+ * `add`, `addDir`, `change`, `unlink`, `unlinkDir`, `all`, `error`
+ *
+ * new FSWatcher()
+ * .add(directories)
+ * .on('add', path => log('File', path, 'was added'))
+ */
+class FSWatcher extends EventEmitter {
+// Not indenting methods for history sake; for now.
+constructor(_opts) {
+ super();
+
+ const opts = {};
+ if (_opts) Object.assign(opts, _opts); // for frozen objects
+
+ /** @type {Map} */
+ this._watched = new Map();
+ /** @type {Map} */
+ this._closers = new Map();
+ /** @type {Set} */
+ this._ignoredPaths = new Set();
+
+ /** @type {Map} */
+ this._throttled = new Map();
+
+ /** @type {Map} */
+ this._symlinkPaths = new Map();
+
+ this._streams = new Set();
+ this.closed = false;
+
+ // Set up default options.
+ if (undef(opts, 'persistent')) opts.persistent = true;
+ if (undef(opts, 'ignoreInitial')) opts.ignoreInitial = false;
+ if (undef(opts, 'ignorePermissionErrors')) opts.ignorePermissionErrors = false;
+ if (undef(opts, 'interval')) opts.interval = 100;
+ if (undef(opts, 'binaryInterval')) opts.binaryInterval = 300;
+ if (undef(opts, 'disableGlobbing')) opts.disableGlobbing = false;
+ opts.enableBinaryInterval = opts.binaryInterval !== opts.interval;
+
+ // Enable fsevents on OS X when polling isn't explicitly enabled.
+ if (undef(opts, 'useFsEvents')) opts.useFsEvents = !opts.usePolling;
+
+ // If we can't use fsevents, ensure the options reflect it's disabled.
+ const canUseFsEvents = FsEventsHandler.canUse();
+ if (!canUseFsEvents) opts.useFsEvents = false;
+
+ // Use polling on Mac if not using fsevents.
+ // Other platforms use non-polling fs_watch.
+ if (undef(opts, 'usePolling') && !opts.useFsEvents) {
+ opts.usePolling = isMacos;
+ }
+
+ // Always default to polling on IBM i because fs.watch() is not available on IBM i.
+ if(isIBMi) {
+ opts.usePolling = true;
+ }
+
+ // Global override (useful for end-developers that need to force polling for all
+ // instances of chokidar, regardless of usage/dependency depth)
+ const envPoll = process.env.CHOKIDAR_USEPOLLING;
+ if (envPoll !== undefined) {
+ const envLower = envPoll.toLowerCase();
+
+ if (envLower === 'false' || envLower === '0') {
+ opts.usePolling = false;
+ } else if (envLower === 'true' || envLower === '1') {
+ opts.usePolling = true;
+ } else {
+ opts.usePolling = !!envLower;
+ }
+ }
+ const envInterval = process.env.CHOKIDAR_INTERVAL;
+ if (envInterval) {
+ opts.interval = Number.parseInt(envInterval, 10);
+ }
+
+ // Editor atomic write normalization enabled by default with fs.watch
+ if (undef(opts, 'atomic')) opts.atomic = !opts.usePolling && !opts.useFsEvents;
+ if (opts.atomic) this._pendingUnlinks = new Map();
+
+ if (undef(opts, 'followSymlinks')) opts.followSymlinks = true;
+
+ if (undef(opts, 'awaitWriteFinish')) opts.awaitWriteFinish = false;
+ if (opts.awaitWriteFinish === true) opts.awaitWriteFinish = {};
+ const awf = opts.awaitWriteFinish;
+ if (awf) {
+ if (!awf.stabilityThreshold) awf.stabilityThreshold = 2000;
+ if (!awf.pollInterval) awf.pollInterval = 100;
+ this._pendingWrites = new Map();
+ }
+ if (opts.ignored) opts.ignored = arrify(opts.ignored);
+
+ let readyCalls = 0;
+ this._emitReady = () => {
+ readyCalls++;
+ if (readyCalls >= this._readyCount) {
+ this._emitReady = EMPTY_FN;
+ this._readyEmitted = true;
+ // use process.nextTick to allow time for listener to be bound
+ process.nextTick(() => this.emit(EV_READY));
+ }
+ };
+ this._emitRaw = (...args) => this.emit(EV_RAW, ...args);
+ this._readyEmitted = false;
+ this.options = opts;
+
+ // Initialize with proper watcher.
+ if (opts.useFsEvents) {
+ this._fsEventsHandler = new FsEventsHandler(this);
+ } else {
+ this._nodeFsHandler = new NodeFsHandler(this);
+ }
+
+ // You’re frozen when your heart’s not open.
+ Object.freeze(opts);
+}
+
+// Public methods
+
+/**
+ * Adds paths to be watched on an existing FSWatcher instance
+ * @param {Path|Array} paths_
+ * @param {String=} _origAdd private; for handling non-existent paths to be watched
+ * @param {Boolean=} _internal private; indicates a non-user add
+ * @returns {FSWatcher} for chaining
+ */
+add(paths_, _origAdd, _internal) {
+ const {cwd, disableGlobbing} = this.options;
+ this.closed = false;
+ let paths = unifyPaths(paths_);
+ if (cwd) {
+ paths = paths.map((path) => {
+ const absPath = getAbsolutePath(path, cwd);
+
+ // Check `path` instead of `absPath` because the cwd portion can't be a glob
+ if (disableGlobbing || !isGlob(path)) {
+ return absPath;
+ }
+ return normalizePath(absPath);
+ });
+ }
+
+ // set aside negated glob strings
+ paths = paths.filter((path) => {
+ if (path.startsWith(BANG)) {
+ this._ignoredPaths.add(path.slice(1));
+ return false;
+ }
+
+ // if a path is being added that was previously ignored, stop ignoring it
+ this._ignoredPaths.delete(path);
+ this._ignoredPaths.delete(path + SLASH_GLOBSTAR);
+
+ // reset the cached userIgnored anymatch fn
+ // to make ignoredPaths changes effective
+ this._userIgnored = undefined;
+
+ return true;
+ });
+
+ if (this.options.useFsEvents && this._fsEventsHandler) {
+ if (!this._readyCount) this._readyCount = paths.length;
+ if (this.options.persistent) this._readyCount += paths.length;
+ paths.forEach((path) => this._fsEventsHandler._addToFsEvents(path));
+ } else {
+ if (!this._readyCount) this._readyCount = 0;
+ this._readyCount += paths.length;
+ Promise.all(
+ paths.map(async path => {
+ const res = await this._nodeFsHandler._addToNodeFs(path, !_internal, 0, 0, _origAdd);
+ if (res) this._emitReady();
+ return res;
+ })
+ ).then(results => {
+ if (this.closed) return;
+ results.filter(item => item).forEach(item => {
+ this.add(sysPath.dirname(item), sysPath.basename(_origAdd || item));
+ });
+ });
+ }
+
+ return this;
+}
+
+/**
+ * Close watchers or start ignoring events from specified paths.
+ * @param {Path|Array} paths_ - string or array of strings, file/directory paths and/or globs
+ * @returns {FSWatcher} for chaining
+*/
+unwatch(paths_) {
+ if (this.closed) return this;
+ const paths = unifyPaths(paths_);
+ const {cwd} = this.options;
+
+ paths.forEach((path) => {
+ // convert to absolute path unless relative path already matches
+ if (!sysPath.isAbsolute(path) && !this._closers.has(path)) {
+ if (cwd) path = sysPath.join(cwd, path);
+ path = sysPath.resolve(path);
+ }
+
+ this._closePath(path);
+
+ this._ignoredPaths.add(path);
+ if (this._watched.has(path)) {
+ this._ignoredPaths.add(path + SLASH_GLOBSTAR);
+ }
+
+ // reset the cached userIgnored anymatch fn
+ // to make ignoredPaths changes effective
+ this._userIgnored = undefined;
+ });
+
+ return this;
+}
+
+/**
+ * Close watchers and remove all listeners from watched paths.
+ * @returns {Promise}.
+*/
+close() {
+ if (this.closed) return this._closePromise;
+ this.closed = true;
+
+ // Memory management.
+ this.removeAllListeners();
+ const closers = [];
+ this._closers.forEach(closerList => closerList.forEach(closer => {
+ const promise = closer();
+ if (promise instanceof Promise) closers.push(promise);
+ }));
+ this._streams.forEach(stream => stream.destroy());
+ this._userIgnored = undefined;
+ this._readyCount = 0;
+ this._readyEmitted = false;
+ this._watched.forEach(dirent => dirent.dispose());
+ ['closers', 'watched', 'streams', 'symlinkPaths', 'throttled'].forEach(key => {
+ this[`_${key}`].clear();
+ });
+
+ this._closePromise = closers.length ? Promise.all(closers).then(() => undefined) : Promise.resolve();
+ return this._closePromise;
+}
+
+/**
+ * Expose list of watched paths
+ * @returns {Object} for chaining
+*/
+getWatched() {
+ const watchList = {};
+ this._watched.forEach((entry, dir) => {
+ const key = this.options.cwd ? sysPath.relative(this.options.cwd, dir) : dir;
+ watchList[key || ONE_DOT] = entry.getChildren().sort();
+ });
+ return watchList;
+}
+
+emitWithAll(event, args) {
+ this.emit(...args);
+ if (event !== EV_ERROR) this.emit(EV_ALL, ...args);
+}
+
+// Common helpers
+// --------------
+
+/**
+ * Normalize and emit events.
+ * Calling _emit DOES NOT MEAN emit() would be called!
+ * @param {EventName} event Type of event
+ * @param {Path} path File or directory path
+ * @param {*=} val1 arguments to be passed with event
+ * @param {*=} val2
+ * @param {*=} val3
+ * @returns the error if defined, otherwise the value of the FSWatcher instance's `closed` flag
+ */
+async _emit(event, path, val1, val2, val3) {
+ if (this.closed) return;
+
+ const opts = this.options;
+ if (isWindows) path = sysPath.normalize(path);
+ if (opts.cwd) path = sysPath.relative(opts.cwd, path);
+ /** @type Array */
+ const args = [event, path];
+ if (val3 !== undefined) args.push(val1, val2, val3);
+ else if (val2 !== undefined) args.push(val1, val2);
+ else if (val1 !== undefined) args.push(val1);
+
+ const awf = opts.awaitWriteFinish;
+ let pw;
+ if (awf && (pw = this._pendingWrites.get(path))) {
+ pw.lastChange = new Date();
+ return this;
+ }
+
+ if (opts.atomic) {
+ if (event === EV_UNLINK) {
+ this._pendingUnlinks.set(path, args);
+ setTimeout(() => {
+ this._pendingUnlinks.forEach((entry, path) => {
+ this.emit(...entry);
+ this.emit(EV_ALL, ...entry);
+ this._pendingUnlinks.delete(path);
+ });
+ }, typeof opts.atomic === 'number' ? opts.atomic : 100);
+ return this;
+ }
+ if (event === EV_ADD && this._pendingUnlinks.has(path)) {
+ event = args[0] = EV_CHANGE;
+ this._pendingUnlinks.delete(path);
+ }
+ }
+
+ if (awf && (event === EV_ADD || event === EV_CHANGE) && this._readyEmitted) {
+ const awfEmit = (err, stats) => {
+ if (err) {
+ event = args[0] = EV_ERROR;
+ args[1] = err;
+ this.emitWithAll(event, args);
+ } else if (stats) {
+ // if stats doesn't exist the file must have been deleted
+ if (args.length > 2) {
+ args[2] = stats;
+ } else {
+ args.push(stats);
+ }
+ this.emitWithAll(event, args);
+ }
+ };
+
+ this._awaitWriteFinish(path, awf.stabilityThreshold, event, awfEmit);
+ return this;
+ }
+
+ if (event === EV_CHANGE) {
+ const isThrottled = !this._throttle(EV_CHANGE, path, 50);
+ if (isThrottled) return this;
+ }
+
+ if (opts.alwaysStat && val1 === undefined &&
+ (event === EV_ADD || event === EV_ADD_DIR || event === EV_CHANGE)
+ ) {
+ const fullPath = opts.cwd ? sysPath.join(opts.cwd, path) : path;
+ let stats;
+ try {
+ stats = await stat(fullPath);
+ } catch (err) {}
+ // Suppress event when fs_stat fails, to avoid sending undefined 'stat'
+ if (!stats || this.closed) return;
+ args.push(stats);
+ }
+ this.emitWithAll(event, args);
+
+ return this;
+}
+
+/**
+ * Common handler for errors
+ * @param {Error} error
+ * @returns {Error|Boolean} The error if defined, otherwise the value of the FSWatcher instance's `closed` flag
+ */
+_handleError(error) {
+ const code = error && error.code;
+ if (error && code !== 'ENOENT' && code !== 'ENOTDIR' &&
+ (!this.options.ignorePermissionErrors || (code !== 'EPERM' && code !== 'EACCES'))
+ ) {
+ this.emit(EV_ERROR, error);
+ }
+ return error || this.closed;
+}
+
+/**
+ * Helper utility for throttling
+ * @param {ThrottleType} actionType type being throttled
+ * @param {Path} path being acted upon
+ * @param {Number} timeout duration of time to suppress duplicate actions
+ * @returns {Object|false} tracking object or false if action should be suppressed
+ */
+_throttle(actionType, path, timeout) {
+ if (!this._throttled.has(actionType)) {
+ this._throttled.set(actionType, new Map());
+ }
+
+ /** @type {Map} */
+ const action = this._throttled.get(actionType);
+ /** @type {Object} */
+ const actionPath = action.get(path);
+
+ if (actionPath) {
+ actionPath.count++;
+ return false;
+ }
+
+ let timeoutObject;
+ const clear = () => {
+ const item = action.get(path);
+ const count = item ? item.count : 0;
+ action.delete(path);
+ clearTimeout(timeoutObject);
+ if (item) clearTimeout(item.timeoutObject);
+ return count;
+ };
+ timeoutObject = setTimeout(clear, timeout);
+ const thr = {timeoutObject, clear, count: 0};
+ action.set(path, thr);
+ return thr;
+}
+
+_incrReadyCount() {
+ return this._readyCount++;
+}
+
+/**
+ * Awaits write operation to finish.
+ * Polls a newly created file for size variations. When files size does not change for 'threshold' milliseconds calls callback.
+ * @param {Path} path being acted upon
+ * @param {Number} threshold Time in milliseconds a file size must be fixed before acknowledging write OP is finished
+ * @param {EventName} event
+ * @param {Function} awfEmit Callback to be called when ready for event to be emitted.
+ */
+_awaitWriteFinish(path, threshold, event, awfEmit) {
+ let timeoutHandler;
+
+ let fullPath = path;
+ if (this.options.cwd && !sysPath.isAbsolute(path)) {
+ fullPath = sysPath.join(this.options.cwd, path);
+ }
+
+ const now = new Date();
+
+ const awaitWriteFinish = (prevStat) => {
+ fs.stat(fullPath, (err, curStat) => {
+ if (err || !this._pendingWrites.has(path)) {
+ if (err && err.code !== 'ENOENT') awfEmit(err);
+ return;
+ }
+
+ const now = Number(new Date());
+
+ if (prevStat && curStat.size !== prevStat.size) {
+ this._pendingWrites.get(path).lastChange = now;
+ }
+ const pw = this._pendingWrites.get(path);
+ const df = now - pw.lastChange;
+
+ if (df >= threshold) {
+ this._pendingWrites.delete(path);
+ awfEmit(undefined, curStat);
+ } else {
+ timeoutHandler = setTimeout(
+ awaitWriteFinish,
+ this.options.awaitWriteFinish.pollInterval,
+ curStat
+ );
+ }
+ });
+ };
+
+ if (!this._pendingWrites.has(path)) {
+ this._pendingWrites.set(path, {
+ lastChange: now,
+ cancelWait: () => {
+ this._pendingWrites.delete(path);
+ clearTimeout(timeoutHandler);
+ return event;
+ }
+ });
+ timeoutHandler = setTimeout(
+ awaitWriteFinish,
+ this.options.awaitWriteFinish.pollInterval
+ );
+ }
+}
+
+_getGlobIgnored() {
+ return [...this._ignoredPaths.values()];
+}
+
+/**
+ * Determines whether user has asked to ignore this path.
+ * @param {Path} path filepath or dir
+ * @param {fs.Stats=} stats result of fs.stat
+ * @returns {Boolean}
+ */
+_isIgnored(path, stats) {
+ if (this.options.atomic && DOT_RE.test(path)) return true;
+ if (!this._userIgnored) {
+ const {cwd} = this.options;
+ const ign = this.options.ignored;
+
+ const ignored = ign && ign.map(normalizeIgnored(cwd));
+ const paths = arrify(ignored)
+ .filter((path) => typeof path === STRING_TYPE && !isGlob(path))
+ .map((path) => path + SLASH_GLOBSTAR);
+ const list = this._getGlobIgnored().map(normalizeIgnored(cwd)).concat(ignored, paths);
+ this._userIgnored = anymatch(list, undefined, ANYMATCH_OPTS);
+ }
+
+ return this._userIgnored([path, stats]);
+}
+
+_isntIgnored(path, stat) {
+ return !this._isIgnored(path, stat);
+}
+
+/**
+ * Provides a set of common helpers and properties relating to symlink and glob handling.
+ * @param {Path} path file, directory, or glob pattern being watched
+ * @param {Number=} depth at any depth > 0, this isn't a glob
+ * @returns {WatchHelper} object containing helpers for this path
+ */
+_getWatchHelpers(path, depth) {
+ const watchPath = depth || this.options.disableGlobbing || !isGlob(path) ? path : globParent(path);
+ const follow = this.options.followSymlinks;
+
+ return new WatchHelper(path, watchPath, follow, this);
+}
+
+// Directory helpers
+// -----------------
+
+/**
+ * Provides directory tracking objects
+ * @param {String} directory path of the directory
+ * @returns {DirEntry} the directory's tracking object
+ */
+_getWatchedDir(directory) {
+ if (!this._boundRemove) this._boundRemove = this._remove.bind(this);
+ const dir = sysPath.resolve(directory);
+ if (!this._watched.has(dir)) this._watched.set(dir, new DirEntry(dir, this._boundRemove));
+ return this._watched.get(dir);
+}
+
+// File helpers
+// ------------
+
+/**
+ * Check for read permissions.
+ * Based on this answer on SO: https://stackoverflow.com/a/11781404/1358405
+ * @param {fs.Stats} stats - object, result of fs_stat
+ * @returns {Boolean} indicates whether the file can be read
+*/
+_hasReadPermissions(stats) {
+ if (this.options.ignorePermissionErrors) return true;
+
+ // stats.mode may be bigint
+ const md = stats && Number.parseInt(stats.mode, 10);
+ const st = md & 0o777;
+ const it = Number.parseInt(st.toString(8)[0], 10);
+ return Boolean(4 & it);
+}
+
+/**
+ * Handles emitting unlink events for
+ * files and directories, and via recursion, for
+ * files and directories within directories that are unlinked
+ * @param {String} directory within which the following item is located
+ * @param {String} item base path of item/directory
+ * @returns {void}
+*/
+_remove(directory, item, isDirectory) {
+ // if what is being deleted is a directory, get that directory's paths
+ // for recursive deleting and cleaning of watched object
+ // if it is not a directory, nestedDirectoryChildren will be empty array
+ const path = sysPath.join(directory, item);
+ const fullPath = sysPath.resolve(path);
+ isDirectory = isDirectory != null
+ ? isDirectory
+ : this._watched.has(path) || this._watched.has(fullPath);
+
+ // prevent duplicate handling in case of arriving here nearly simultaneously
+ // via multiple paths (such as _handleFile and _handleDir)
+ if (!this._throttle('remove', path, 100)) return;
+
+ // if the only watched file is removed, watch for its return
+ if (!isDirectory && !this.options.useFsEvents && this._watched.size === 1) {
+ this.add(directory, item, true);
+ }
+
+ // This will create a new entry in the watched object in either case
+ // so we got to do the directory check beforehand
+ const wp = this._getWatchedDir(path);
+ const nestedDirectoryChildren = wp.getChildren();
+
+ // Recursively remove children directories / files.
+ nestedDirectoryChildren.forEach(nested => this._remove(path, nested));
+
+ // Check if item was on the watched list and remove it
+ const parent = this._getWatchedDir(directory);
+ const wasTracked = parent.has(item);
+ parent.remove(item);
+
+ // Fixes issue #1042 -> Relative paths were detected and added as symlinks
+ // (https://github.com/paulmillr/chokidar/blob/e1753ddbc9571bdc33b4a4af172d52cb6e611c10/lib/nodefs-handler.js#L612),
+ // but never removed from the map in case the path was deleted.
+ // This leads to an incorrect state if the path was recreated:
+ // https://github.com/paulmillr/chokidar/blob/e1753ddbc9571bdc33b4a4af172d52cb6e611c10/lib/nodefs-handler.js#L553
+ if (this._symlinkPaths.has(fullPath)) {
+ this._symlinkPaths.delete(fullPath);
+ }
+
+ // If we wait for this file to be fully written, cancel the wait.
+ let relPath = path;
+ if (this.options.cwd) relPath = sysPath.relative(this.options.cwd, path);
+ if (this.options.awaitWriteFinish && this._pendingWrites.has(relPath)) {
+ const event = this._pendingWrites.get(relPath).cancelWait();
+ if (event === EV_ADD) return;
+ }
+
+ // The Entry will either be a directory that just got removed
+ // or a bogus entry to a file, in either case we have to remove it
+ this._watched.delete(path);
+ this._watched.delete(fullPath);
+ const eventName = isDirectory ? EV_UNLINK_DIR : EV_UNLINK;
+ if (wasTracked && !this._isIgnored(path)) this._emit(eventName, path);
+
+ // Avoid conflicts if we later create another file with the same name
+ if (!this.options.useFsEvents) {
+ this._closePath(path);
+ }
+}
+
+/**
+ * Closes all watchers for a path
+ * @param {Path} path
+ */
+_closePath(path) {
+ this._closeFile(path)
+ const dir = sysPath.dirname(path);
+ this._getWatchedDir(dir).remove(sysPath.basename(path));
+}
+
+/**
+ * Closes only file-specific watchers
+ * @param {Path} path
+ */
+_closeFile(path) {
+ const closers = this._closers.get(path);
+ if (!closers) return;
+ closers.forEach(closer => closer());
+ this._closers.delete(path);
+}
+
+/**
+ *
+ * @param {Path} path
+ * @param {Function} closer
+ */
+_addPathCloser(path, closer) {
+ if (!closer) return;
+ let list = this._closers.get(path);
+ if (!list) {
+ list = [];
+ this._closers.set(path, list);
+ }
+ list.push(closer);
+}
+
+_readdirp(root, opts) {
+ if (this.closed) return;
+ const options = {type: EV_ALL, alwaysStat: true, lstat: true, ...opts};
+ let stream = readdirp(root, options);
+ this._streams.add(stream);
+ stream.once(STR_CLOSE, () => {
+ stream = undefined;
+ });
+ stream.once(STR_END, () => {
+ if (stream) {
+ this._streams.delete(stream);
+ stream = undefined;
+ }
+ });
+ return stream;
+}
+
+}
+
+// Export FSWatcher class
+exports.FSWatcher = FSWatcher;
+
+/**
+ * Instantiates watcher with paths to be tracked.
+ * @param {String|Array} paths file/directory paths and/or globs
+ * @param {Object=} options chokidar opts
+ * @returns an instance of FSWatcher for chaining.
+ */
+const watch = (paths, options) => {
+ const watcher = new FSWatcher(options);
+ watcher.add(paths);
+ return watcher;
+};
+
+exports.watch = watch;
diff --git a/node_modules/chokidar/lib/constants.js b/node_modules/chokidar/lib/constants.js
new file mode 100644
index 0000000..4743865
--- /dev/null
+++ b/node_modules/chokidar/lib/constants.js
@@ -0,0 +1,66 @@
+'use strict';
+
+const {sep} = require('path');
+const {platform} = process;
+const os = require('os');
+
+exports.EV_ALL = 'all';
+exports.EV_READY = 'ready';
+exports.EV_ADD = 'add';
+exports.EV_CHANGE = 'change';
+exports.EV_ADD_DIR = 'addDir';
+exports.EV_UNLINK = 'unlink';
+exports.EV_UNLINK_DIR = 'unlinkDir';
+exports.EV_RAW = 'raw';
+exports.EV_ERROR = 'error';
+
+exports.STR_DATA = 'data';
+exports.STR_END = 'end';
+exports.STR_CLOSE = 'close';
+
+exports.FSEVENT_CREATED = 'created';
+exports.FSEVENT_MODIFIED = 'modified';
+exports.FSEVENT_DELETED = 'deleted';
+exports.FSEVENT_MOVED = 'moved';
+exports.FSEVENT_CLONED = 'cloned';
+exports.FSEVENT_UNKNOWN = 'unknown';
+exports.FSEVENT_FLAG_MUST_SCAN_SUBDIRS = 1;
+exports.FSEVENT_TYPE_FILE = 'file';
+exports.FSEVENT_TYPE_DIRECTORY = 'directory';
+exports.FSEVENT_TYPE_SYMLINK = 'symlink';
+
+exports.KEY_LISTENERS = 'listeners';
+exports.KEY_ERR = 'errHandlers';
+exports.KEY_RAW = 'rawEmitters';
+exports.HANDLER_KEYS = [exports.KEY_LISTENERS, exports.KEY_ERR, exports.KEY_RAW];
+
+exports.DOT_SLASH = `.${sep}`;
+
+exports.BACK_SLASH_RE = /\\/g;
+exports.DOUBLE_SLASH_RE = /\/\//;
+exports.SLASH_OR_BACK_SLASH_RE = /[/\\]/;
+exports.DOT_RE = /\..*\.(sw[px])$|~$|\.subl.*\.tmp/;
+exports.REPLACER_RE = /^\.[/\\]/;
+
+exports.SLASH = '/';
+exports.SLASH_SLASH = '//';
+exports.BRACE_START = '{';
+exports.BANG = '!';
+exports.ONE_DOT = '.';
+exports.TWO_DOTS = '..';
+exports.STAR = '*';
+exports.GLOBSTAR = '**';
+exports.ROOT_GLOBSTAR = '/**/*';
+exports.SLASH_GLOBSTAR = '/**';
+exports.DIR_SUFFIX = 'Dir';
+exports.ANYMATCH_OPTS = {dot: true};
+exports.STRING_TYPE = 'string';
+exports.FUNCTION_TYPE = 'function';
+exports.EMPTY_STR = '';
+exports.EMPTY_FN = () => {};
+exports.IDENTITY_FN = val => val;
+
+exports.isWindows = platform === 'win32';
+exports.isMacos = platform === 'darwin';
+exports.isLinux = platform === 'linux';
+exports.isIBMi = os.type() === 'OS400';
diff --git a/node_modules/chokidar/lib/fsevents-handler.js b/node_modules/chokidar/lib/fsevents-handler.js
new file mode 100644
index 0000000..fe29393
--- /dev/null
+++ b/node_modules/chokidar/lib/fsevents-handler.js
@@ -0,0 +1,526 @@
+'use strict';
+
+const fs = require('fs');
+const sysPath = require('path');
+const { promisify } = require('util');
+
+let fsevents;
+try {
+ fsevents = require('fsevents');
+} catch (error) {
+ if (process.env.CHOKIDAR_PRINT_FSEVENTS_REQUIRE_ERROR) console.error(error);
+}
+
+if (fsevents) {
+ // TODO: real check
+ const mtch = process.version.match(/v(\d+)\.(\d+)/);
+ if (mtch && mtch[1] && mtch[2]) {
+ const maj = Number.parseInt(mtch[1], 10);
+ const min = Number.parseInt(mtch[2], 10);
+ if (maj === 8 && min < 16) {
+ fsevents = undefined;
+ }
+ }
+}
+
+const {
+ EV_ADD,
+ EV_CHANGE,
+ EV_ADD_DIR,
+ EV_UNLINK,
+ EV_ERROR,
+ STR_DATA,
+ STR_END,
+ FSEVENT_CREATED,
+ FSEVENT_MODIFIED,
+ FSEVENT_DELETED,
+ FSEVENT_MOVED,
+ // FSEVENT_CLONED,
+ FSEVENT_UNKNOWN,
+ FSEVENT_FLAG_MUST_SCAN_SUBDIRS,
+ FSEVENT_TYPE_FILE,
+ FSEVENT_TYPE_DIRECTORY,
+ FSEVENT_TYPE_SYMLINK,
+
+ ROOT_GLOBSTAR,
+ DIR_SUFFIX,
+ DOT_SLASH,
+ FUNCTION_TYPE,
+ EMPTY_FN,
+ IDENTITY_FN
+} = require('./constants');
+
+const Depth = (value) => isNaN(value) ? {} : {depth: value};
+
+const stat = promisify(fs.stat);
+const lstat = promisify(fs.lstat);
+const realpath = promisify(fs.realpath);
+
+const statMethods = { stat, lstat };
+
+/**
+ * @typedef {String} Path
+ */
+
+/**
+ * @typedef {Object} FsEventsWatchContainer
+ * @property {Set} listeners
+ * @property {Function} rawEmitter
+ * @property {{stop: Function}} watcher
+ */
+
+// fsevents instance helper functions
+/**
+ * Object to hold per-process fsevents instances (may be shared across chokidar FSWatcher instances)
+ * @type {Map}
+ */
+const FSEventsWatchers = new Map();
+
+// Threshold of duplicate path prefixes at which to start
+// consolidating going forward
+const consolidateThreshhold = 10;
+
+const wrongEventFlags = new Set([
+ 69888, 70400, 71424, 72704, 73472, 131328, 131840, 262912
+]);
+
+/**
+ * Instantiates the fsevents interface
+ * @param {Path} path path to be watched
+ * @param {Function} callback called when fsevents is bound and ready
+ * @returns {{stop: Function}} new fsevents instance
+ */
+const createFSEventsInstance = (path, callback) => {
+ const stop = fsevents.watch(path, callback);
+ return {stop};
+};
+
+/**
+ * Instantiates the fsevents interface or binds listeners to an existing one covering
+ * the same file tree.
+ * @param {Path} path - to be watched
+ * @param {Path} realPath - real path for symlinks
+ * @param {Function} listener - called when fsevents emits events
+ * @param {Function} rawEmitter - passes data to listeners of the 'raw' event
+ * @returns {Function} closer
+ */
+function setFSEventsListener(path, realPath, listener, rawEmitter) {
+ let watchPath = sysPath.extname(realPath) ? sysPath.dirname(realPath) : realPath;
+
+ const parentPath = sysPath.dirname(watchPath);
+ let cont = FSEventsWatchers.get(watchPath);
+
+ // If we've accumulated a substantial number of paths that
+ // could have been consolidated by watching one directory
+ // above the current one, create a watcher on the parent
+ // path instead, so that we do consolidate going forward.
+ if (couldConsolidate(parentPath)) {
+ watchPath = parentPath;
+ }
+
+ const resolvedPath = sysPath.resolve(path);
+ const hasSymlink = resolvedPath !== realPath;
+
+ const filteredListener = (fullPath, flags, info) => {
+ if (hasSymlink) fullPath = fullPath.replace(realPath, resolvedPath);
+ if (
+ fullPath === resolvedPath ||
+ !fullPath.indexOf(resolvedPath + sysPath.sep)
+ ) listener(fullPath, flags, info);
+ };
+
+ // check if there is already a watcher on a parent path
+ // modifies `watchPath` to the parent path when it finds a match
+ let watchedParent = false;
+ for (const watchedPath of FSEventsWatchers.keys()) {
+ if (realPath.indexOf(sysPath.resolve(watchedPath) + sysPath.sep) === 0) {
+ watchPath = watchedPath;
+ cont = FSEventsWatchers.get(watchPath);
+ watchedParent = true;
+ break;
+ }
+ }
+
+ if (cont || watchedParent) {
+ cont.listeners.add(filteredListener);
+ } else {
+ cont = {
+ listeners: new Set([filteredListener]),
+ rawEmitter,
+ watcher: createFSEventsInstance(watchPath, (fullPath, flags) => {
+ if (!cont.listeners.size) return;
+ if (flags & FSEVENT_FLAG_MUST_SCAN_SUBDIRS) return;
+ const info = fsevents.getInfo(fullPath, flags);
+ cont.listeners.forEach(list => {
+ list(fullPath, flags, info);
+ });
+
+ cont.rawEmitter(info.event, fullPath, info);
+ })
+ };
+ FSEventsWatchers.set(watchPath, cont);
+ }
+
+ // removes this instance's listeners and closes the underlying fsevents
+ // instance if there are no more listeners left
+ return () => {
+ const lst = cont.listeners;
+
+ lst.delete(filteredListener);
+ if (!lst.size) {
+ FSEventsWatchers.delete(watchPath);
+ if (cont.watcher) return cont.watcher.stop().then(() => {
+ cont.rawEmitter = cont.watcher = undefined;
+ Object.freeze(cont);
+ });
+ }
+ };
+}
+
+// Decide whether or not we should start a new higher-level
+// parent watcher
+const couldConsolidate = (path) => {
+ let count = 0;
+ for (const watchPath of FSEventsWatchers.keys()) {
+ if (watchPath.indexOf(path) === 0) {
+ count++;
+ if (count >= consolidateThreshhold) {
+ return true;
+ }
+ }
+ }
+
+ return false;
+};
+
+// returns boolean indicating whether fsevents can be used
+const canUse = () => fsevents && FSEventsWatchers.size < 128;
+
+// determines subdirectory traversal levels from root to path
+const calcDepth = (path, root) => {
+ let i = 0;
+ while (!path.indexOf(root) && (path = sysPath.dirname(path)) !== root) i++;
+ return i;
+};
+
+// returns boolean indicating whether the fsevents' event info has the same type
+// as the one returned by fs.stat
+const sameTypes = (info, stats) => (
+ info.type === FSEVENT_TYPE_DIRECTORY && stats.isDirectory() ||
+ info.type === FSEVENT_TYPE_SYMLINK && stats.isSymbolicLink() ||
+ info.type === FSEVENT_TYPE_FILE && stats.isFile()
+)
+
+/**
+ * @mixin
+ */
+class FsEventsHandler {
+
+/**
+ * @param {import('../index').FSWatcher} fsw
+ */
+constructor(fsw) {
+ this.fsw = fsw;
+}
+checkIgnored(path, stats) {
+ const ipaths = this.fsw._ignoredPaths;
+ if (this.fsw._isIgnored(path, stats)) {
+ ipaths.add(path);
+ if (stats && stats.isDirectory()) {
+ ipaths.add(path + ROOT_GLOBSTAR);
+ }
+ return true;
+ }
+
+ ipaths.delete(path);
+ ipaths.delete(path + ROOT_GLOBSTAR);
+}
+
+addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts) {
+ const event = watchedDir.has(item) ? EV_CHANGE : EV_ADD;
+ this.handleEvent(event, path, fullPath, realPath, parent, watchedDir, item, info, opts);
+}
+
+async checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts) {
+ try {
+ const stats = await stat(path)
+ if (this.fsw.closed) return;
+ if (sameTypes(info, stats)) {
+ this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ } else {
+ this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ }
+ } catch (error) {
+ if (error.code === 'EACCES') {
+ this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ } else {
+ this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ }
+ }
+}
+
+handleEvent(event, path, fullPath, realPath, parent, watchedDir, item, info, opts) {
+ if (this.fsw.closed || this.checkIgnored(path)) return;
+
+ if (event === EV_UNLINK) {
+ const isDirectory = info.type === FSEVENT_TYPE_DIRECTORY
+ // suppress unlink events on never before seen files
+ if (isDirectory || watchedDir.has(item)) {
+ this.fsw._remove(parent, item, isDirectory);
+ }
+ } else {
+ if (event === EV_ADD) {
+ // track new directories
+ if (info.type === FSEVENT_TYPE_DIRECTORY) this.fsw._getWatchedDir(path);
+
+ if (info.type === FSEVENT_TYPE_SYMLINK && opts.followSymlinks) {
+ // push symlinks back to the top of the stack to get handled
+ const curDepth = opts.depth === undefined ?
+ undefined : calcDepth(fullPath, realPath) + 1;
+ return this._addToFsEvents(path, false, true, curDepth);
+ }
+
+ // track new paths
+ // (other than symlinks being followed, which will be tracked soon)
+ this.fsw._getWatchedDir(parent).add(item);
+ }
+ /**
+ * @type {'add'|'addDir'|'unlink'|'unlinkDir'}
+ */
+ const eventName = info.type === FSEVENT_TYPE_DIRECTORY ? event + DIR_SUFFIX : event;
+ this.fsw._emit(eventName, path);
+ if (eventName === EV_ADD_DIR) this._addToFsEvents(path, false, true);
+ }
+}
+
+/**
+ * Handle symlinks encountered during directory scan
+ * @param {String} watchPath - file/dir path to be watched with fsevents
+ * @param {String} realPath - real path (in case of symlinks)
+ * @param {Function} transform - path transformer
+ * @param {Function} globFilter - path filter in case a glob pattern was provided
+ * @returns {Function} closer for the watcher instance
+*/
+_watchWithFsEvents(watchPath, realPath, transform, globFilter) {
+ if (this.fsw.closed || this.fsw._isIgnored(watchPath)) return;
+ const opts = this.fsw.options;
+ const watchCallback = async (fullPath, flags, info) => {
+ if (this.fsw.closed) return;
+ if (
+ opts.depth !== undefined &&
+ calcDepth(fullPath, realPath) > opts.depth
+ ) return;
+ const path = transform(sysPath.join(
+ watchPath, sysPath.relative(watchPath, fullPath)
+ ));
+ if (globFilter && !globFilter(path)) return;
+ // ensure directories are tracked
+ const parent = sysPath.dirname(path);
+ const item = sysPath.basename(path);
+ const watchedDir = this.fsw._getWatchedDir(
+ info.type === FSEVENT_TYPE_DIRECTORY ? path : parent
+ );
+
+ // correct for wrong events emitted
+ if (wrongEventFlags.has(flags) || info.event === FSEVENT_UNKNOWN) {
+ if (typeof opts.ignored === FUNCTION_TYPE) {
+ let stats;
+ try {
+ stats = await stat(path);
+ } catch (error) {}
+ if (this.fsw.closed) return;
+ if (this.checkIgnored(path, stats)) return;
+ if (sameTypes(info, stats)) {
+ this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ } else {
+ this.handleEvent(EV_UNLINK, path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ }
+ } else {
+ this.checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ }
+ } else {
+ switch (info.event) {
+ case FSEVENT_CREATED:
+ case FSEVENT_MODIFIED:
+ return this.addOrChange(path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ case FSEVENT_DELETED:
+ case FSEVENT_MOVED:
+ return this.checkExists(path, fullPath, realPath, parent, watchedDir, item, info, opts);
+ }
+ }
+ };
+
+ const closer = setFSEventsListener(
+ watchPath,
+ realPath,
+ watchCallback,
+ this.fsw._emitRaw
+ );
+
+ this.fsw._emitReady();
+ return closer;
+}
+
+/**
+ * Handle symlinks encountered during directory scan
+ * @param {String} linkPath path to symlink
+ * @param {String} fullPath absolute path to the symlink
+ * @param {Function} transform pre-existing path transformer
+ * @param {Number} curDepth level of subdirectories traversed to where symlink is
+ * @returns {Promise}
+ */
+async _handleFsEventsSymlink(linkPath, fullPath, transform, curDepth) {
+ // don't follow the same symlink more than once
+ if (this.fsw.closed || this.fsw._symlinkPaths.has(fullPath)) return;
+
+ this.fsw._symlinkPaths.set(fullPath, true);
+ this.fsw._incrReadyCount();
+
+ try {
+ const linkTarget = await realpath(linkPath);
+ if (this.fsw.closed) return;
+ if (this.fsw._isIgnored(linkTarget)) {
+ return this.fsw._emitReady();
+ }
+
+ this.fsw._incrReadyCount();
+
+ // add the linkTarget for watching with a wrapper for transform
+ // that causes emitted paths to incorporate the link's path
+ this._addToFsEvents(linkTarget || linkPath, (path) => {
+ let aliasedPath = linkPath;
+ if (linkTarget && linkTarget !== DOT_SLASH) {
+ aliasedPath = path.replace(linkTarget, linkPath);
+ } else if (path !== DOT_SLASH) {
+ aliasedPath = sysPath.join(linkPath, path);
+ }
+ return transform(aliasedPath);
+ }, false, curDepth);
+ } catch(error) {
+ if (this.fsw._handleError(error)) {
+ return this.fsw._emitReady();
+ }
+ }
+}
+
+/**
+ *
+ * @param {Path} newPath
+ * @param {fs.Stats} stats
+ */
+emitAdd(newPath, stats, processPath, opts, forceAdd) {
+ const pp = processPath(newPath);
+ const isDir = stats.isDirectory();
+ const dirObj = this.fsw._getWatchedDir(sysPath.dirname(pp));
+ const base = sysPath.basename(pp);
+
+ // ensure empty dirs get tracked
+ if (isDir) this.fsw._getWatchedDir(pp);
+ if (dirObj.has(base)) return;
+ dirObj.add(base);
+
+ if (!opts.ignoreInitial || forceAdd === true) {
+ this.fsw._emit(isDir ? EV_ADD_DIR : EV_ADD, pp, stats);
+ }
+}
+
+initWatch(realPath, path, wh, processPath) {
+ if (this.fsw.closed) return;
+ const closer = this._watchWithFsEvents(
+ wh.watchPath,
+ sysPath.resolve(realPath || wh.watchPath),
+ processPath,
+ wh.globFilter
+ );
+ this.fsw._addPathCloser(path, closer);
+}
+
+/**
+ * Handle added path with fsevents
+ * @param {String} path file/dir path or glob pattern
+ * @param {Function|Boolean=} transform converts working path to what the user expects
+ * @param {Boolean=} forceAdd ensure add is emitted
+ * @param {Number=} priorDepth Level of subdirectories already traversed.
+ * @returns {Promise}
+ */
+async _addToFsEvents(path, transform, forceAdd, priorDepth) {
+ if (this.fsw.closed) {
+ return;
+ }
+ const opts = this.fsw.options;
+ const processPath = typeof transform === FUNCTION_TYPE ? transform : IDENTITY_FN;
+
+ const wh = this.fsw._getWatchHelpers(path);
+
+ // evaluate what is at the path we're being asked to watch
+ try {
+ const stats = await statMethods[wh.statMethod](wh.watchPath);
+ if (this.fsw.closed) return;
+ if (this.fsw._isIgnored(wh.watchPath, stats)) {
+ throw null;
+ }
+ if (stats.isDirectory()) {
+ // emit addDir unless this is a glob parent
+ if (!wh.globFilter) this.emitAdd(processPath(path), stats, processPath, opts, forceAdd);
+
+ // don't recurse further if it would exceed depth setting
+ if (priorDepth && priorDepth > opts.depth) return;
+
+ // scan the contents of the dir
+ this.fsw._readdirp(wh.watchPath, {
+ fileFilter: entry => wh.filterPath(entry),
+ directoryFilter: entry => wh.filterDir(entry),
+ ...Depth(opts.depth - (priorDepth || 0))
+ }).on(STR_DATA, (entry) => {
+ // need to check filterPath on dirs b/c filterDir is less restrictive
+ if (this.fsw.closed) {
+ return;
+ }
+ if (entry.stats.isDirectory() && !wh.filterPath(entry)) return;
+
+ const joinedPath = sysPath.join(wh.watchPath, entry.path);
+ const {fullPath} = entry;
+
+ if (wh.followSymlinks && entry.stats.isSymbolicLink()) {
+ // preserve the current depth here since it can't be derived from
+ // real paths past the symlink
+ const curDepth = opts.depth === undefined ?
+ undefined : calcDepth(joinedPath, sysPath.resolve(wh.watchPath)) + 1;
+
+ this._handleFsEventsSymlink(joinedPath, fullPath, processPath, curDepth);
+ } else {
+ this.emitAdd(joinedPath, entry.stats, processPath, opts, forceAdd);
+ }
+ }).on(EV_ERROR, EMPTY_FN).on(STR_END, () => {
+ this.fsw._emitReady();
+ });
+ } else {
+ this.emitAdd(wh.watchPath, stats, processPath, opts, forceAdd);
+ this.fsw._emitReady();
+ }
+ } catch (error) {
+ if (!error || this.fsw._handleError(error)) {
+ // TODO: Strange thing: "should not choke on an ignored watch path" will be failed without 2 ready calls -__-
+ this.fsw._emitReady();
+ this.fsw._emitReady();
+ }
+ }
+
+ if (opts.persistent && forceAdd !== true) {
+ if (typeof transform === FUNCTION_TYPE) {
+ // realpath has already been resolved
+ this.initWatch(undefined, path, wh, processPath);
+ } else {
+ let realPath;
+ try {
+ realPath = await realpath(wh.watchPath);
+ } catch (e) {}
+ this.initWatch(realPath, path, wh, processPath);
+ }
+ }
+}
+
+}
+
+module.exports = FsEventsHandler;
+module.exports.canUse = canUse;
diff --git a/node_modules/chokidar/lib/nodefs-handler.js b/node_modules/chokidar/lib/nodefs-handler.js
new file mode 100644
index 0000000..199cfe9
--- /dev/null
+++ b/node_modules/chokidar/lib/nodefs-handler.js
@@ -0,0 +1,654 @@
+'use strict';
+
+const fs = require('fs');
+const sysPath = require('path');
+const { promisify } = require('util');
+const isBinaryPath = require('is-binary-path');
+const {
+ isWindows,
+ isLinux,
+ EMPTY_FN,
+ EMPTY_STR,
+ KEY_LISTENERS,
+ KEY_ERR,
+ KEY_RAW,
+ HANDLER_KEYS,
+ EV_CHANGE,
+ EV_ADD,
+ EV_ADD_DIR,
+ EV_ERROR,
+ STR_DATA,
+ STR_END,
+ BRACE_START,
+ STAR
+} = require('./constants');
+
+const THROTTLE_MODE_WATCH = 'watch';
+
+const open = promisify(fs.open);
+const stat = promisify(fs.stat);
+const lstat = promisify(fs.lstat);
+const close = promisify(fs.close);
+const fsrealpath = promisify(fs.realpath);
+
+const statMethods = { lstat, stat };
+
+// TODO: emit errors properly. Example: EMFILE on Macos.
+const foreach = (val, fn) => {
+ if (val instanceof Set) {
+ val.forEach(fn);
+ } else {
+ fn(val);
+ }
+};
+
+const addAndConvert = (main, prop, item) => {
+ let container = main[prop];
+ if (!(container instanceof Set)) {
+ main[prop] = container = new Set([container]);
+ }
+ container.add(item);
+};
+
+const clearItem = cont => key => {
+ const set = cont[key];
+ if (set instanceof Set) {
+ set.clear();
+ } else {
+ delete cont[key];
+ }
+};
+
+const delFromSet = (main, prop, item) => {
+ const container = main[prop];
+ if (container instanceof Set) {
+ container.delete(item);
+ } else if (container === item) {
+ delete main[prop];
+ }
+};
+
+const isEmptySet = (val) => val instanceof Set ? val.size === 0 : !val;
+
+/**
+ * @typedef {String} Path
+ */
+
+// fs_watch helpers
+
+// object to hold per-process fs_watch instances
+// (may be shared across chokidar FSWatcher instances)
+
+/**
+ * @typedef {Object} FsWatchContainer
+ * @property {Set} listeners
+ * @property {Set} errHandlers
+ * @property {Set} rawEmitters
+ * @property {fs.FSWatcher=} watcher
+ * @property {Boolean=} watcherUnusable
+ */
+
+/**
+ * @type {Map}
+ */
+const FsWatchInstances = new Map();
+
+/**
+ * Instantiates the fs_watch interface
+ * @param {String} path to be watched
+ * @param {Object} options to be passed to fs_watch
+ * @param {Function} listener main event handler
+ * @param {Function} errHandler emits info about errors
+ * @param {Function} emitRaw emits raw event data
+ * @returns {fs.FSWatcher} new fsevents instance
+ */
+function createFsWatchInstance(path, options, listener, errHandler, emitRaw) {
+ const handleEvent = (rawEvent, evPath) => {
+ listener(path);
+ emitRaw(rawEvent, evPath, {watchedPath: path});
+
+ // emit based on events occurring for files from a directory's watcher in
+ // case the file's watcher misses it (and rely on throttling to de-dupe)
+ if (evPath && path !== evPath) {
+ fsWatchBroadcast(
+ sysPath.resolve(path, evPath), KEY_LISTENERS, sysPath.join(path, evPath)
+ );
+ }
+ };
+ try {
+ return fs.watch(path, options, handleEvent);
+ } catch (error) {
+ errHandler(error);
+ }
+}
+
+/**
+ * Helper for passing fs_watch event data to a collection of listeners
+ * @param {Path} fullPath absolute path bound to fs_watch instance
+ * @param {String} type listener type
+ * @param {*=} val1 arguments to be passed to listeners
+ * @param {*=} val2
+ * @param {*=} val3
+ */
+const fsWatchBroadcast = (fullPath, type, val1, val2, val3) => {
+ const cont = FsWatchInstances.get(fullPath);
+ if (!cont) return;
+ foreach(cont[type], (listener) => {
+ listener(val1, val2, val3);
+ });
+};
+
+/**
+ * Instantiates the fs_watch interface or binds listeners
+ * to an existing one covering the same file system entry
+ * @param {String} path
+ * @param {String} fullPath absolute path
+ * @param {Object} options to be passed to fs_watch
+ * @param {Object} handlers container for event listener functions
+ */
+const setFsWatchListener = (path, fullPath, options, handlers) => {
+ const {listener, errHandler, rawEmitter} = handlers;
+ let cont = FsWatchInstances.get(fullPath);
+
+ /** @type {fs.FSWatcher=} */
+ let watcher;
+ if (!options.persistent) {
+ watcher = createFsWatchInstance(
+ path, options, listener, errHandler, rawEmitter
+ );
+ return watcher.close.bind(watcher);
+ }
+ if (cont) {
+ addAndConvert(cont, KEY_LISTENERS, listener);
+ addAndConvert(cont, KEY_ERR, errHandler);
+ addAndConvert(cont, KEY_RAW, rawEmitter);
+ } else {
+ watcher = createFsWatchInstance(
+ path,
+ options,
+ fsWatchBroadcast.bind(null, fullPath, KEY_LISTENERS),
+ errHandler, // no need to use broadcast here
+ fsWatchBroadcast.bind(null, fullPath, KEY_RAW)
+ );
+ if (!watcher) return;
+ watcher.on(EV_ERROR, async (error) => {
+ const broadcastErr = fsWatchBroadcast.bind(null, fullPath, KEY_ERR);
+ cont.watcherUnusable = true; // documented since Node 10.4.1
+ // Workaround for https://github.com/joyent/node/issues/4337
+ if (isWindows && error.code === 'EPERM') {
+ try {
+ const fd = await open(path, 'r');
+ await close(fd);
+ broadcastErr(error);
+ } catch (err) {}
+ } else {
+ broadcastErr(error);
+ }
+ });
+ cont = {
+ listeners: listener,
+ errHandlers: errHandler,
+ rawEmitters: rawEmitter,
+ watcher
+ };
+ FsWatchInstances.set(fullPath, cont);
+ }
+ // const index = cont.listeners.indexOf(listener);
+
+ // removes this instance's listeners and closes the underlying fs_watch
+ // instance if there are no more listeners left
+ return () => {
+ delFromSet(cont, KEY_LISTENERS, listener);
+ delFromSet(cont, KEY_ERR, errHandler);
+ delFromSet(cont, KEY_RAW, rawEmitter);
+ if (isEmptySet(cont.listeners)) {
+ // Check to protect against issue gh-730.
+ // if (cont.watcherUnusable) {
+ cont.watcher.close();
+ // }
+ FsWatchInstances.delete(fullPath);
+ HANDLER_KEYS.forEach(clearItem(cont));
+ cont.watcher = undefined;
+ Object.freeze(cont);
+ }
+ };
+};
+
+// fs_watchFile helpers
+
+// object to hold per-process fs_watchFile instances
+// (may be shared across chokidar FSWatcher instances)
+const FsWatchFileInstances = new Map();
+
+/**
+ * Instantiates the fs_watchFile interface or binds listeners
+ * to an existing one covering the same file system entry
+ * @param {String} path to be watched
+ * @param {String} fullPath absolute path
+ * @param {Object} options options to be passed to fs_watchFile
+ * @param {Object} handlers container for event listener functions
+ * @returns {Function} closer
+ */
+const setFsWatchFileListener = (path, fullPath, options, handlers) => {
+ const {listener, rawEmitter} = handlers;
+ let cont = FsWatchFileInstances.get(fullPath);
+
+ /* eslint-disable no-unused-vars, prefer-destructuring */
+ let listeners = new Set();
+ let rawEmitters = new Set();
+
+ const copts = cont && cont.options;
+ if (copts && (copts.persistent < options.persistent || copts.interval > options.interval)) {
+ // "Upgrade" the watcher to persistence or a quicker interval.
+ // This creates some unlikely edge case issues if the user mixes
+ // settings in a very weird way, but solving for those cases
+ // doesn't seem worthwhile for the added complexity.
+ listeners = cont.listeners;
+ rawEmitters = cont.rawEmitters;
+ fs.unwatchFile(fullPath);
+ cont = undefined;
+ }
+
+ /* eslint-enable no-unused-vars, prefer-destructuring */
+
+ if (cont) {
+ addAndConvert(cont, KEY_LISTENERS, listener);
+ addAndConvert(cont, KEY_RAW, rawEmitter);
+ } else {
+ // TODO
+ // listeners.add(listener);
+ // rawEmitters.add(rawEmitter);
+ cont = {
+ listeners: listener,
+ rawEmitters: rawEmitter,
+ options,
+ watcher: fs.watchFile(fullPath, options, (curr, prev) => {
+ foreach(cont.rawEmitters, (rawEmitter) => {
+ rawEmitter(EV_CHANGE, fullPath, {curr, prev});
+ });
+ const currmtime = curr.mtimeMs;
+ if (curr.size !== prev.size || currmtime > prev.mtimeMs || currmtime === 0) {
+ foreach(cont.listeners, (listener) => listener(path, curr));
+ }
+ })
+ };
+ FsWatchFileInstances.set(fullPath, cont);
+ }
+ // const index = cont.listeners.indexOf(listener);
+
+ // Removes this instance's listeners and closes the underlying fs_watchFile
+ // instance if there are no more listeners left.
+ return () => {
+ delFromSet(cont, KEY_LISTENERS, listener);
+ delFromSet(cont, KEY_RAW, rawEmitter);
+ if (isEmptySet(cont.listeners)) {
+ FsWatchFileInstances.delete(fullPath);
+ fs.unwatchFile(fullPath);
+ cont.options = cont.watcher = undefined;
+ Object.freeze(cont);
+ }
+ };
+};
+
+/**
+ * @mixin
+ */
+class NodeFsHandler {
+
+/**
+ * @param {import("../index").FSWatcher} fsW
+ */
+constructor(fsW) {
+ this.fsw = fsW;
+ this._boundHandleError = (error) => fsW._handleError(error);
+}
+
+/**
+ * Watch file for changes with fs_watchFile or fs_watch.
+ * @param {String} path to file or dir
+ * @param {Function} listener on fs change
+ * @returns {Function} closer for the watcher instance
+ */
+_watchWithNodeFs(path, listener) {
+ const opts = this.fsw.options;
+ const directory = sysPath.dirname(path);
+ const basename = sysPath.basename(path);
+ const parent = this.fsw._getWatchedDir(directory);
+ parent.add(basename);
+ const absolutePath = sysPath.resolve(path);
+ const options = {persistent: opts.persistent};
+ if (!listener) listener = EMPTY_FN;
+
+ let closer;
+ if (opts.usePolling) {
+ options.interval = opts.enableBinaryInterval && isBinaryPath(basename) ?
+ opts.binaryInterval : opts.interval;
+ closer = setFsWatchFileListener(path, absolutePath, options, {
+ listener,
+ rawEmitter: this.fsw._emitRaw
+ });
+ } else {
+ closer = setFsWatchListener(path, absolutePath, options, {
+ listener,
+ errHandler: this._boundHandleError,
+ rawEmitter: this.fsw._emitRaw
+ });
+ }
+ return closer;
+}
+
+/**
+ * Watch a file and emit add event if warranted.
+ * @param {Path} file Path
+ * @param {fs.Stats} stats result of fs_stat
+ * @param {Boolean} initialAdd was the file added at watch instantiation?
+ * @returns {Function} closer for the watcher instance
+ */
+_handleFile(file, stats, initialAdd) {
+ if (this.fsw.closed) {
+ return;
+ }
+ const dirname = sysPath.dirname(file);
+ const basename = sysPath.basename(file);
+ const parent = this.fsw._getWatchedDir(dirname);
+ // stats is always present
+ let prevStats = stats;
+
+ // if the file is already being watched, do nothing
+ if (parent.has(basename)) return;
+
+ const listener = async (path, newStats) => {
+ if (!this.fsw._throttle(THROTTLE_MODE_WATCH, file, 5)) return;
+ if (!newStats || newStats.mtimeMs === 0) {
+ try {
+ const newStats = await stat(file);
+ if (this.fsw.closed) return;
+ // Check that change event was not fired because of changed only accessTime.
+ const at = newStats.atimeMs;
+ const mt = newStats.mtimeMs;
+ if (!at || at <= mt || mt !== prevStats.mtimeMs) {
+ this.fsw._emit(EV_CHANGE, file, newStats);
+ }
+ if (isLinux && prevStats.ino !== newStats.ino) {
+ this.fsw._closeFile(path)
+ prevStats = newStats;
+ this.fsw._addPathCloser(path, this._watchWithNodeFs(file, listener));
+ } else {
+ prevStats = newStats;
+ }
+ } catch (error) {
+ // Fix issues where mtime is null but file is still present
+ this.fsw._remove(dirname, basename);
+ }
+ // add is about to be emitted if file not already tracked in parent
+ } else if (parent.has(basename)) {
+ // Check that change event was not fired because of changed only accessTime.
+ const at = newStats.atimeMs;
+ const mt = newStats.mtimeMs;
+ if (!at || at <= mt || mt !== prevStats.mtimeMs) {
+ this.fsw._emit(EV_CHANGE, file, newStats);
+ }
+ prevStats = newStats;
+ }
+ }
+ // kick off the watcher
+ const closer = this._watchWithNodeFs(file, listener);
+
+ // emit an add event if we're supposed to
+ if (!(initialAdd && this.fsw.options.ignoreInitial) && this.fsw._isntIgnored(file)) {
+ if (!this.fsw._throttle(EV_ADD, file, 0)) return;
+ this.fsw._emit(EV_ADD, file, stats);
+ }
+
+ return closer;
+}
+
+/**
+ * Handle symlinks encountered while reading a dir.
+ * @param {Object} entry returned by readdirp
+ * @param {String} directory path of dir being read
+ * @param {String} path of this item
+ * @param {String} item basename of this item
+ * @returns {Promise} true if no more processing is needed for this entry.
+ */
+async _handleSymlink(entry, directory, path, item) {
+ if (this.fsw.closed) {
+ return;
+ }
+ const full = entry.fullPath;
+ const dir = this.fsw._getWatchedDir(directory);
+
+ if (!this.fsw.options.followSymlinks) {
+ // watch symlink directly (don't follow) and detect changes
+ this.fsw._incrReadyCount();
+
+ let linkPath;
+ try {
+ linkPath = await fsrealpath(path);
+ } catch (e) {
+ this.fsw._emitReady();
+ return true;
+ }
+
+ if (this.fsw.closed) return;
+ if (dir.has(item)) {
+ if (this.fsw._symlinkPaths.get(full) !== linkPath) {
+ this.fsw._symlinkPaths.set(full, linkPath);
+ this.fsw._emit(EV_CHANGE, path, entry.stats);
+ }
+ } else {
+ dir.add(item);
+ this.fsw._symlinkPaths.set(full, linkPath);
+ this.fsw._emit(EV_ADD, path, entry.stats);
+ }
+ this.fsw._emitReady();
+ return true;
+ }
+
+ // don't follow the same symlink more than once
+ if (this.fsw._symlinkPaths.has(full)) {
+ return true;
+ }
+
+ this.fsw._symlinkPaths.set(full, true);
+}
+
+_handleRead(directory, initialAdd, wh, target, dir, depth, throttler) {
+ // Normalize the directory name on Windows
+ directory = sysPath.join(directory, EMPTY_STR);
+
+ if (!wh.hasGlob) {
+ throttler = this.fsw._throttle('readdir', directory, 1000);
+ if (!throttler) return;
+ }
+
+ const previous = this.fsw._getWatchedDir(wh.path);
+ const current = new Set();
+
+ let stream = this.fsw._readdirp(directory, {
+ fileFilter: entry => wh.filterPath(entry),
+ directoryFilter: entry => wh.filterDir(entry),
+ depth: 0
+ }).on(STR_DATA, async (entry) => {
+ if (this.fsw.closed) {
+ stream = undefined;
+ return;
+ }
+ const item = entry.path;
+ let path = sysPath.join(directory, item);
+ current.add(item);
+
+ if (entry.stats.isSymbolicLink() && await this._handleSymlink(entry, directory, path, item)) {
+ return;
+ }
+
+ if (this.fsw.closed) {
+ stream = undefined;
+ return;
+ }
+ // Files that present in current directory snapshot
+ // but absent in previous are added to watch list and
+ // emit `add` event.
+ if (item === target || !target && !previous.has(item)) {
+ this.fsw._incrReadyCount();
+
+ // ensure relativeness of path is preserved in case of watcher reuse
+ path = sysPath.join(dir, sysPath.relative(dir, path));
+
+ this._addToNodeFs(path, initialAdd, wh, depth + 1);
+ }
+ }).on(EV_ERROR, this._boundHandleError);
+
+ return new Promise(resolve =>
+ stream.once(STR_END, () => {
+ if (this.fsw.closed) {
+ stream = undefined;
+ return;
+ }
+ const wasThrottled = throttler ? throttler.clear() : false;
+
+ resolve();
+
+ // Files that absent in current directory snapshot
+ // but present in previous emit `remove` event
+ // and are removed from @watched[directory].
+ previous.getChildren().filter((item) => {
+ return item !== directory &&
+ !current.has(item) &&
+ // in case of intersecting globs;
+ // a path may have been filtered out of this readdir, but
+ // shouldn't be removed because it matches a different glob
+ (!wh.hasGlob || wh.filterPath({
+ fullPath: sysPath.resolve(directory, item)
+ }));
+ }).forEach((item) => {
+ this.fsw._remove(directory, item);
+ });
+
+ stream = undefined;
+
+ // one more time for any missed in case changes came in extremely quickly
+ if (wasThrottled) this._handleRead(directory, false, wh, target, dir, depth, throttler);
+ })
+ );
+}
+
+/**
+ * Read directory to add / remove files from `@watched` list and re-read it on change.
+ * @param {String} dir fs path
+ * @param {fs.Stats} stats
+ * @param {Boolean} initialAdd
+ * @param {Number} depth relative to user-supplied path
+ * @param {String} target child path targeted for watch
+ * @param {Object} wh Common watch helpers for this path
+ * @param {String} realpath
+ * @returns {Promise} closer for the watcher instance.
+ */
+async _handleDir(dir, stats, initialAdd, depth, target, wh, realpath) {
+ const parentDir = this.fsw._getWatchedDir(sysPath.dirname(dir));
+ const tracked = parentDir.has(sysPath.basename(dir));
+ if (!(initialAdd && this.fsw.options.ignoreInitial) && !target && !tracked) {
+ if (!wh.hasGlob || wh.globFilter(dir)) this.fsw._emit(EV_ADD_DIR, dir, stats);
+ }
+
+ // ensure dir is tracked (harmless if redundant)
+ parentDir.add(sysPath.basename(dir));
+ this.fsw._getWatchedDir(dir);
+ let throttler;
+ let closer;
+
+ const oDepth = this.fsw.options.depth;
+ if ((oDepth == null || depth <= oDepth) && !this.fsw._symlinkPaths.has(realpath)) {
+ if (!target) {
+ await this._handleRead(dir, initialAdd, wh, target, dir, depth, throttler);
+ if (this.fsw.closed) return;
+ }
+
+ closer = this._watchWithNodeFs(dir, (dirPath, stats) => {
+ // if current directory is removed, do nothing
+ if (stats && stats.mtimeMs === 0) return;
+
+ this._handleRead(dirPath, false, wh, target, dir, depth, throttler);
+ });
+ }
+ return closer;
+}
+
+/**
+ * Handle added file, directory, or glob pattern.
+ * Delegates call to _handleFile / _handleDir after checks.
+ * @param {String} path to file or ir
+ * @param {Boolean} initialAdd was the file added at watch instantiation?
+ * @param {Object} priorWh depth relative to user-supplied path
+ * @param {Number} depth Child path actually targeted for watch
+ * @param {String=} target Child path actually targeted for watch
+ * @returns {Promise}
+ */
+async _addToNodeFs(path, initialAdd, priorWh, depth, target) {
+ const ready = this.fsw._emitReady;
+ if (this.fsw._isIgnored(path) || this.fsw.closed) {
+ ready();
+ return false;
+ }
+
+ const wh = this.fsw._getWatchHelpers(path, depth);
+ if (!wh.hasGlob && priorWh) {
+ wh.hasGlob = priorWh.hasGlob;
+ wh.globFilter = priorWh.globFilter;
+ wh.filterPath = entry => priorWh.filterPath(entry);
+ wh.filterDir = entry => priorWh.filterDir(entry);
+ }
+
+ // evaluate what is at the path we're being asked to watch
+ try {
+ const stats = await statMethods[wh.statMethod](wh.watchPath);
+ if (this.fsw.closed) return;
+ if (this.fsw._isIgnored(wh.watchPath, stats)) {
+ ready();
+ return false;
+ }
+
+ const follow = this.fsw.options.followSymlinks && !path.includes(STAR) && !path.includes(BRACE_START);
+ let closer;
+ if (stats.isDirectory()) {
+ const absPath = sysPath.resolve(path);
+ const targetPath = follow ? await fsrealpath(path) : path;
+ if (this.fsw.closed) return;
+ closer = await this._handleDir(wh.watchPath, stats, initialAdd, depth, target, wh, targetPath);
+ if (this.fsw.closed) return;
+ // preserve this symlink's target path
+ if (absPath !== targetPath && targetPath !== undefined) {
+ this.fsw._symlinkPaths.set(absPath, targetPath);
+ }
+ } else if (stats.isSymbolicLink()) {
+ const targetPath = follow ? await fsrealpath(path) : path;
+ if (this.fsw.closed) return;
+ const parent = sysPath.dirname(wh.watchPath);
+ this.fsw._getWatchedDir(parent).add(wh.watchPath);
+ this.fsw._emit(EV_ADD, wh.watchPath, stats);
+ closer = await this._handleDir(parent, stats, initialAdd, depth, path, wh, targetPath);
+ if (this.fsw.closed) return;
+
+ // preserve this symlink's target path
+ if (targetPath !== undefined) {
+ this.fsw._symlinkPaths.set(sysPath.resolve(path), targetPath);
+ }
+ } else {
+ closer = this._handleFile(wh.watchPath, stats, initialAdd);
+ }
+ ready();
+
+ this.fsw._addPathCloser(path, closer);
+ return false;
+
+ } catch (error) {
+ if (this.fsw._handleError(error)) {
+ ready();
+ return path;
+ }
+ }
+}
+
+}
+
+module.exports = NodeFsHandler;
diff --git a/node_modules/chokidar/package.json b/node_modules/chokidar/package.json
new file mode 100644
index 0000000..e8f8b3d
--- /dev/null
+++ b/node_modules/chokidar/package.json
@@ -0,0 +1,70 @@
+{
+ "name": "chokidar",
+ "description": "Minimal and efficient cross-platform file watching library",
+ "version": "3.6.0",
+ "homepage": "https://github.com/paulmillr/chokidar",
+ "author": "Paul Miller (https://paulmillr.com)",
+ "contributors": [
+ "Paul Miller (https://paulmillr.com)",
+ "Elan Shanker"
+ ],
+ "engines": {
+ "node": ">= 8.10.0"
+ },
+ "main": "index.js",
+ "types": "./types/index.d.ts",
+ "dependencies": {
+ "anymatch": "~3.1.2",
+ "braces": "~3.0.2",
+ "glob-parent": "~5.1.2",
+ "is-binary-path": "~2.1.0",
+ "is-glob": "~4.0.1",
+ "normalize-path": "~3.0.0",
+ "readdirp": "~3.6.0"
+ },
+ "optionalDependencies": {
+ "fsevents": "~2.3.2"
+ },
+ "devDependencies": {
+ "@types/node": "^14",
+ "chai": "^4.3",
+ "dtslint": "^3.3.0",
+ "eslint": "^7.0.0",
+ "mocha": "^7.0.0",
+ "rimraf": "^3.0.0",
+ "sinon": "^9.0.1",
+ "sinon-chai": "^3.3.0",
+ "typescript": "^4.4.3",
+ "upath": "^1.2.0"
+ },
+ "files": [
+ "index.js",
+ "lib/*.js",
+ "types/index.d.ts"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/paulmillr/chokidar.git"
+ },
+ "bugs": {
+ "url": "https://github.com/paulmillr/chokidar/issues"
+ },
+ "license": "MIT",
+ "scripts": {
+ "dtslint": "dtslint types",
+ "lint": "eslint --report-unused-disable-directives --ignore-path .gitignore .",
+ "build": "npm ls",
+ "mocha": "mocha --exit --timeout 90000",
+ "test": "npm run lint && npm run mocha"
+ },
+ "keywords": [
+ "fs",
+ "watch",
+ "watchFile",
+ "watcher",
+ "watching",
+ "file",
+ "fsevents"
+ ],
+ "funding": "https://paulmillr.com/funding/"
+}
diff --git a/node_modules/chokidar/types/index.d.ts b/node_modules/chokidar/types/index.d.ts
new file mode 100644
index 0000000..4558066
--- /dev/null
+++ b/node_modules/chokidar/types/index.d.ts
@@ -0,0 +1,192 @@
+// TypeScript Version: 3.0
+
+///
+
+import * as fs from "fs";
+import { EventEmitter } from "events";
+import { Matcher } from 'anymatch';
+
+export class FSWatcher extends EventEmitter implements fs.FSWatcher {
+ options: WatchOptions;
+
+ /**
+ * Constructs a new FSWatcher instance with optional WatchOptions parameter.
+ */
+ constructor(options?: WatchOptions);
+
+ /**
+ * Add files, directories, or glob patterns for tracking. Takes an array of strings or just one
+ * string.
+ */
+ add(paths: string | ReadonlyArray): this;
+
+ /**
+ * Stop watching files, directories, or glob patterns. Takes an array of strings or just one
+ * string.
+ */
+ unwatch(paths: string | ReadonlyArray): this;
+
+ /**
+ * Returns an object representing all the paths on the file system being watched by this
+ * `FSWatcher` instance. The object's keys are all the directories (using absolute paths unless
+ * the `cwd` option was used), and the values are arrays of the names of the items contained in
+ * each directory.
+ */
+ getWatched(): {
+ [directory: string]: string[];
+ };
+
+ /**
+ * Removes all listeners from watched files.
+ */
+ close(): Promise;
+
+ on(event: 'add'|'addDir'|'change', listener: (path: string, stats?: fs.Stats) => void): this;
+
+ on(event: 'all', listener: (eventName: 'add'|'addDir'|'change'|'unlink'|'unlinkDir', path: string, stats?: fs.Stats) => void): this;
+
+ /**
+ * Error occurred
+ */
+ on(event: 'error', listener: (error: Error) => void): this;
+
+ /**
+ * Exposes the native Node `fs.FSWatcher events`
+ */
+ on(event: 'raw', listener: (eventName: string, path: string, details: any) => void): this;
+
+ /**
+ * Fires when the initial scan is complete
+ */
+ on(event: 'ready', listener: () => void): this;
+
+ on(event: 'unlink'|'unlinkDir', listener: (path: string) => void): this;
+
+ on(event: string, listener: (...args: any[]) => void): this;
+
+ ref(): this;
+
+ unref(): this;
+}
+
+export interface WatchOptions {
+ /**
+ * Indicates whether the process should continue to run as long as files are being watched. If
+ * set to `false` when using `fsevents` to watch, no more events will be emitted after `ready`,
+ * even if the process continues to run.
+ */
+ persistent?: boolean;
+
+ /**
+ * ([anymatch](https://github.com/micromatch/anymatch)-compatible definition) Defines files/paths to
+ * be ignored. The whole relative or absolute path is tested, not just filename. If a function
+ * with two arguments is provided, it gets called twice per path - once with a single argument
+ * (the path), second time with two arguments (the path and the
+ * [`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) object of that path).
+ */
+ ignored?: Matcher;
+
+ /**
+ * If set to `false` then `add`/`addDir` events are also emitted for matching paths while
+ * instantiating the watching as chokidar discovers these file paths (before the `ready` event).
+ */
+ ignoreInitial?: boolean;
+
+ /**
+ * When `false`, only the symlinks themselves will be watched for changes instead of following
+ * the link references and bubbling events through the link's path.
+ */
+ followSymlinks?: boolean;
+
+ /**
+ * The base directory from which watch `paths` are to be derived. Paths emitted with events will
+ * be relative to this.
+ */
+ cwd?: string;
+
+ /**
+ * If set to true then the strings passed to .watch() and .add() are treated as literal path
+ * names, even if they look like globs. Default: false.
+ */
+ disableGlobbing?: boolean;
+
+ /**
+ * Whether to use fs.watchFile (backed by polling), or fs.watch. If polling leads to high CPU
+ * utilization, consider setting this to `false`. It is typically necessary to **set this to
+ * `true` to successfully watch files over a network**, and it may be necessary to successfully
+ * watch files in other non-standard situations. Setting to `true` explicitly on OS X overrides
+ * the `useFsEvents` default.
+ */
+ usePolling?: boolean;
+
+ /**
+ * Whether to use the `fsevents` watching interface if available. When set to `true` explicitly
+ * and `fsevents` is available this supercedes the `usePolling` setting. When set to `false` on
+ * OS X, `usePolling: true` becomes the default.
+ */
+ useFsEvents?: boolean;
+
+ /**
+ * If relying upon the [`fs.Stats`](https://nodejs.org/api/fs.html#fs_class_fs_stats) object that
+ * may get passed with `add`, `addDir`, and `change` events, set this to `true` to ensure it is
+ * provided even in cases where it wasn't already available from the underlying watch events.
+ */
+ alwaysStat?: boolean;
+
+ /**
+ * If set, limits how many levels of subdirectories will be traversed.
+ */
+ depth?: number;
+
+ /**
+ * Interval of file system polling.
+ */
+ interval?: number;
+
+ /**
+ * Interval of file system polling for binary files. ([see list of binary extensions](https://gi
+ * thub.com/sindresorhus/binary-extensions/blob/master/binary-extensions.json))
+ */
+ binaryInterval?: number;
+
+ /**
+ * Indicates whether to watch files that don't have read permissions if possible. If watching
+ * fails due to `EPERM` or `EACCES` with this set to `true`, the errors will be suppressed
+ * silently.
+ */
+ ignorePermissionErrors?: boolean;
+
+ /**
+ * `true` if `useFsEvents` and `usePolling` are `false`). Automatically filters out artifacts
+ * that occur when using editors that use "atomic writes" instead of writing directly to the
+ * source file. If a file is re-added within 100 ms of being deleted, Chokidar emits a `change`
+ * event rather than `unlink` then `add`. If the default of 100 ms does not work well for you,
+ * you can override it by setting `atomic` to a custom value, in milliseconds.
+ */
+ atomic?: boolean | number;
+
+ /**
+ * can be set to an object in order to adjust timing params:
+ */
+ awaitWriteFinish?: AwaitWriteFinishOptions | boolean;
+}
+
+export interface AwaitWriteFinishOptions {
+ /**
+ * Amount of time in milliseconds for a file size to remain constant before emitting its event.
+ */
+ stabilityThreshold?: number;
+
+ /**
+ * File size polling interval.
+ */
+ pollInterval?: number;
+}
+
+/**
+ * produces an instance of `FSWatcher`.
+ */
+export function watch(
+ paths: string | ReadonlyArray,
+ options?: WatchOptions
+): FSWatcher;
diff --git a/node_modules/concat-map/.travis.yml b/node_modules/concat-map/.travis.yml
new file mode 100644
index 0000000..f1d0f13
--- /dev/null
+++ b/node_modules/concat-map/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+ - 0.4
+ - 0.6
diff --git a/node_modules/concat-map/LICENSE b/node_modules/concat-map/LICENSE
new file mode 100644
index 0000000..ee27ba4
--- /dev/null
+++ b/node_modules/concat-map/LICENSE
@@ -0,0 +1,18 @@
+This software is released under the MIT license:
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/concat-map/README.markdown b/node_modules/concat-map/README.markdown
new file mode 100644
index 0000000..408f70a
--- /dev/null
+++ b/node_modules/concat-map/README.markdown
@@ -0,0 +1,62 @@
+concat-map
+==========
+
+Concatenative mapdashery.
+
+[](http://ci.testling.com/substack/node-concat-map)
+
+[](http://travis-ci.org/substack/node-concat-map)
+
+example
+=======
+
+``` js
+var concatMap = require('concat-map');
+var xs = [ 1, 2, 3, 4, 5, 6 ];
+var ys = concatMap(xs, function (x) {
+ return x % 2 ? [ x - 0.1, x, x + 0.1 ] : [];
+});
+console.dir(ys);
+```
+
+***
+
+```
+[ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ]
+```
+
+methods
+=======
+
+``` js
+var concatMap = require('concat-map')
+```
+
+concatMap(xs, fn)
+-----------------
+
+Return an array of concatenated elements by calling `fn(x, i)` for each element
+`x` and each index `i` in the array `xs`.
+
+When `fn(x, i)` returns an array, its result will be concatenated with the
+result array. If `fn(x, i)` returns anything else, that value will be pushed
+onto the end of the result array.
+
+install
+=======
+
+With [npm](http://npmjs.org) do:
+
+```
+npm install concat-map
+```
+
+license
+=======
+
+MIT
+
+notes
+=====
+
+This module was written while sitting high above the ground in a tree.
diff --git a/node_modules/concat-map/example/map.js b/node_modules/concat-map/example/map.js
new file mode 100644
index 0000000..3365621
--- /dev/null
+++ b/node_modules/concat-map/example/map.js
@@ -0,0 +1,6 @@
+var concatMap = require('../');
+var xs = [ 1, 2, 3, 4, 5, 6 ];
+var ys = concatMap(xs, function (x) {
+ return x % 2 ? [ x - 0.1, x, x + 0.1 ] : [];
+});
+console.dir(ys);
diff --git a/node_modules/concat-map/index.js b/node_modules/concat-map/index.js
new file mode 100644
index 0000000..b29a781
--- /dev/null
+++ b/node_modules/concat-map/index.js
@@ -0,0 +1,13 @@
+module.exports = function (xs, fn) {
+ var res = [];
+ for (var i = 0; i < xs.length; i++) {
+ var x = fn(xs[i], i);
+ if (isArray(x)) res.push.apply(res, x);
+ else res.push(x);
+ }
+ return res;
+};
+
+var isArray = Array.isArray || function (xs) {
+ return Object.prototype.toString.call(xs) === '[object Array]';
+};
diff --git a/node_modules/concat-map/package.json b/node_modules/concat-map/package.json
new file mode 100644
index 0000000..d3640e6
--- /dev/null
+++ b/node_modules/concat-map/package.json
@@ -0,0 +1,43 @@
+{
+ "name" : "concat-map",
+ "description" : "concatenative mapdashery",
+ "version" : "0.0.1",
+ "repository" : {
+ "type" : "git",
+ "url" : "git://github.com/substack/node-concat-map.git"
+ },
+ "main" : "index.js",
+ "keywords" : [
+ "concat",
+ "concatMap",
+ "map",
+ "functional",
+ "higher-order"
+ ],
+ "directories" : {
+ "example" : "example",
+ "test" : "test"
+ },
+ "scripts" : {
+ "test" : "tape test/*.js"
+ },
+ "devDependencies" : {
+ "tape" : "~2.4.0"
+ },
+ "license" : "MIT",
+ "author" : {
+ "name" : "James Halliday",
+ "email" : "mail@substack.net",
+ "url" : "http://substack.net"
+ },
+ "testling" : {
+ "files" : "test/*.js",
+ "browsers" : {
+ "ie" : [ 6, 7, 8, 9 ],
+ "ff" : [ 3.5, 10, 15.0 ],
+ "chrome" : [ 10, 22 ],
+ "safari" : [ 5.1 ],
+ "opera" : [ 12 ]
+ }
+ }
+}
diff --git a/node_modules/concat-map/test/map.js b/node_modules/concat-map/test/map.js
new file mode 100644
index 0000000..fdbd702
--- /dev/null
+++ b/node_modules/concat-map/test/map.js
@@ -0,0 +1,39 @@
+var concatMap = require('../');
+var test = require('tape');
+
+test('empty or not', function (t) {
+ var xs = [ 1, 2, 3, 4, 5, 6 ];
+ var ixes = [];
+ var ys = concatMap(xs, function (x, ix) {
+ ixes.push(ix);
+ return x % 2 ? [ x - 0.1, x, x + 0.1 ] : [];
+ });
+ t.same(ys, [ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ]);
+ t.same(ixes, [ 0, 1, 2, 3, 4, 5 ]);
+ t.end();
+});
+
+test('always something', function (t) {
+ var xs = [ 'a', 'b', 'c', 'd' ];
+ var ys = concatMap(xs, function (x) {
+ return x === 'b' ? [ 'B', 'B', 'B' ] : [ x ];
+ });
+ t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]);
+ t.end();
+});
+
+test('scalars', function (t) {
+ var xs = [ 'a', 'b', 'c', 'd' ];
+ var ys = concatMap(xs, function (x) {
+ return x === 'b' ? [ 'B', 'B', 'B' ] : x;
+ });
+ t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]);
+ t.end();
+});
+
+test('undefs', function (t) {
+ var xs = [ 'a', 'b', 'c', 'd' ];
+ var ys = concatMap(xs, function () {});
+ t.same(ys, [ undefined, undefined, undefined, undefined ]);
+ t.end();
+});
diff --git a/node_modules/content-disposition/HISTORY.md b/node_modules/content-disposition/HISTORY.md
new file mode 100644
index 0000000..488effa
--- /dev/null
+++ b/node_modules/content-disposition/HISTORY.md
@@ -0,0 +1,60 @@
+0.5.4 / 2021-12-10
+==================
+
+ * deps: safe-buffer@5.2.1
+
+0.5.3 / 2018-12-17
+==================
+
+ * Use `safe-buffer` for improved Buffer API
+
+0.5.2 / 2016-12-08
+==================
+
+ * Fix `parse` to accept any linear whitespace character
+
+0.5.1 / 2016-01-17
+==================
+
+ * perf: enable strict mode
+
+0.5.0 / 2014-10-11
+==================
+
+ * Add `parse` function
+
+0.4.0 / 2014-09-21
+==================
+
+ * Expand non-Unicode `filename` to the full ISO-8859-1 charset
+
+0.3.0 / 2014-09-20
+==================
+
+ * Add `fallback` option
+ * Add `type` option
+
+0.2.0 / 2014-09-19
+==================
+
+ * Reduce ambiguity of file names with hex escape in buggy browsers
+
+0.1.2 / 2014-09-19
+==================
+
+ * Fix periodic invalid Unicode filename header
+
+0.1.1 / 2014-09-19
+==================
+
+ * Fix invalid characters appearing in `filename*` parameter
+
+0.1.0 / 2014-09-18
+==================
+
+ * Make the `filename` argument optional
+
+0.0.0 / 2014-09-18
+==================
+
+ * Initial release
diff --git a/node_modules/content-disposition/LICENSE b/node_modules/content-disposition/LICENSE
new file mode 100644
index 0000000..84441fb
--- /dev/null
+++ b/node_modules/content-disposition/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/content-disposition/README.md b/node_modules/content-disposition/README.md
new file mode 100644
index 0000000..3a0bb05
--- /dev/null
+++ b/node_modules/content-disposition/README.md
@@ -0,0 +1,142 @@
+# content-disposition
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP `Content-Disposition` header
+
+## Installation
+
+```sh
+$ npm install content-disposition
+```
+
+## API
+
+```js
+var contentDisposition = require('content-disposition')
+```
+
+### contentDisposition(filename, options)
+
+Create an attachment `Content-Disposition` header value using the given file name,
+if supplied. The `filename` is optional and if no file name is desired, but you
+want to specify `options`, set `filename` to `undefined`.
+
+```js
+res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf'))
+```
+
+**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this
+header through a means different from `setHeader` in Node.js, you'll want to specify
+the `'binary'` encoding in Node.js.
+
+#### Options
+
+`contentDisposition` accepts these properties in the options object.
+
+##### fallback
+
+If the `filename` option is outside ISO-8859-1, then the file name is actually
+stored in a supplemental field for clients that support Unicode file names and
+a ISO-8859-1 version of the file name is automatically generated.
+
+This specifies the ISO-8859-1 file name to override the automatic generation or
+disables the generation all together, defaults to `true`.
+
+ - A string will specify the ISO-8859-1 file name to use in place of automatic
+ generation.
+ - `false` will disable including a ISO-8859-1 file name and only include the
+ Unicode version (unless the file name is already ISO-8859-1).
+ - `true` will enable automatic generation if the file name is outside ISO-8859-1.
+
+If the `filename` option is ISO-8859-1 and this option is specified and has a
+different value, then the `filename` option is encoded in the extended field
+and this set as the fallback field, even though they are both ISO-8859-1.
+
+##### type
+
+Specifies the disposition type, defaults to `"attachment"`. This can also be
+`"inline"`, or any other value (all values except inline are treated like
+`attachment`, but can convey additional information if both parties agree to
+it). The type is normalized to lower-case.
+
+### contentDisposition.parse(string)
+
+```js
+var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt')
+```
+
+Parse a `Content-Disposition` header string. This automatically handles extended
+("Unicode") parameters by decoding them and providing them under the standard
+parameter name. This will return an object with the following properties (examples
+are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`):
+
+ - `type`: The disposition type (always lower case). Example: `'attachment'`
+
+ - `parameters`: An object of the parameters in the disposition (name of parameter
+ always lower case and extended versions replace non-extended versions). Example:
+ `{filename: "€ rates.txt"}`
+
+## Examples
+
+### Send a file for download
+
+```js
+var contentDisposition = require('content-disposition')
+var destroy = require('destroy')
+var fs = require('fs')
+var http = require('http')
+var onFinished = require('on-finished')
+
+var filePath = '/path/to/public/plans.pdf'
+
+http.createServer(function onRequest (req, res) {
+ // set headers
+ res.setHeader('Content-Type', 'application/pdf')
+ res.setHeader('Content-Disposition', contentDisposition(filePath))
+
+ // send file
+ var stream = fs.createReadStream(filePath)
+ stream.pipe(res)
+ onFinished(res, function () {
+ destroy(stream)
+ })
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## References
+
+- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616]
+- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987]
+- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266]
+- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231]
+
+[rfc-2616]: https://tools.ietf.org/html/rfc2616
+[rfc-5987]: https://tools.ietf.org/html/rfc5987
+[rfc-6266]: https://tools.ietf.org/html/rfc6266
+[tc-2231]: http://greenbytes.de/tech/tc2231/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-disposition.svg
+[npm-url]: https://npmjs.org/package/content-disposition
+[node-version-image]: https://img.shields.io/node/v/content-disposition.svg
+[node-version-url]: https://nodejs.org/en/download
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg
+[downloads-url]: https://npmjs.org/package/content-disposition
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci
diff --git a/node_modules/content-disposition/index.js b/node_modules/content-disposition/index.js
new file mode 100644
index 0000000..ecec899
--- /dev/null
+++ b/node_modules/content-disposition/index.js
@@ -0,0 +1,458 @@
+/*!
+ * content-disposition
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = contentDisposition
+module.exports.parse = parse
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var basename = require('path').basename
+var Buffer = require('safe-buffer').Buffer
+
+/**
+ * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%")
+ * @private
+ */
+
+var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match percent encoding escape.
+ * @private
+ */
+
+var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/
+var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g
+
+/**
+ * RegExp to match non-latin1 characters.
+ * @private
+ */
+
+var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * @private
+ */
+
+var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ * @private
+ */
+
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp for various RFC 2616 grammar
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * HT =
+ * CTL =
+ * OCTET =
+ * @private
+ */
+
+var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/
+
+/**
+ * RegExp for various RFC 5987 grammar
+ *
+ * ext-value = charset "'" [ language ] "'" value-chars
+ * charset = "UTF-8" / "ISO-8859-1" / mime-charset
+ * mime-charset = 1*mime-charsetc
+ * mime-charsetc = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "%" / "&"
+ * / "+" / "-" / "^" / "_" / "`"
+ * / "{" / "}" / "~"
+ * language = ( 2*3ALPHA [ extlang ] )
+ * / 4ALPHA
+ * / 5*8ALPHA
+ * extlang = *3( "-" 3ALPHA )
+ * value-chars = *( pct-encoded / attr-char )
+ * pct-encoded = "%" HEXDIG HEXDIG
+ * attr-char = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "&" / "+" / "-" / "."
+ * / "^" / "_" / "`" / "|" / "~"
+ * @private
+ */
+
+var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/
+
+/**
+ * RegExp for various RFC 6266 grammar
+ *
+ * disposition-type = "inline" | "attachment" | disp-ext-type
+ * disp-ext-type = token
+ * disposition-parm = filename-parm | disp-ext-parm
+ * filename-parm = "filename" "=" value
+ * | "filename*" "=" ext-value
+ * disp-ext-parm = token "=" value
+ * | ext-token "=" ext-value
+ * ext-token =
+ * @private
+ */
+
+var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create an attachment Content-Disposition header.
+ *
+ * @param {string} [filename]
+ * @param {object} [options]
+ * @param {string} [options.type=attachment]
+ * @param {string|boolean} [options.fallback=true]
+ * @return {string}
+ * @public
+ */
+
+function contentDisposition (filename, options) {
+ var opts = options || {}
+
+ // get type
+ var type = opts.type || 'attachment'
+
+ // get parameters
+ var params = createparams(filename, opts.fallback)
+
+ // format into string
+ return format(new ContentDisposition(type, params))
+}
+
+/**
+ * Create parameters object from filename and fallback.
+ *
+ * @param {string} [filename]
+ * @param {string|boolean} [fallback=true]
+ * @return {object}
+ * @private
+ */
+
+function createparams (filename, fallback) {
+ if (filename === undefined) {
+ return
+ }
+
+ var params = {}
+
+ if (typeof filename !== 'string') {
+ throw new TypeError('filename must be a string')
+ }
+
+ // fallback defaults to true
+ if (fallback === undefined) {
+ fallback = true
+ }
+
+ if (typeof fallback !== 'string' && typeof fallback !== 'boolean') {
+ throw new TypeError('fallback must be a string or boolean')
+ }
+
+ if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) {
+ throw new TypeError('fallback must be ISO-8859-1 string')
+ }
+
+ // restrict to file base name
+ var name = basename(filename)
+
+ // determine if name is suitable for quoted string
+ var isQuotedString = TEXT_REGEXP.test(name)
+
+ // generate fallback name
+ var fallbackName = typeof fallback !== 'string'
+ ? fallback && getlatin1(name)
+ : basename(fallback)
+ var hasFallback = typeof fallbackName === 'string' && fallbackName !== name
+
+ // set extended filename parameter
+ if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) {
+ params['filename*'] = name
+ }
+
+ // set filename parameter
+ if (isQuotedString || hasFallback) {
+ params.filename = hasFallback
+ ? fallbackName
+ : name
+ }
+
+ return params
+}
+
+/**
+ * Format object to Content-Disposition header.
+ *
+ * @param {object} obj
+ * @param {string} obj.type
+ * @param {object} [obj.parameters]
+ * @return {string}
+ * @private
+ */
+
+function format (obj) {
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ // start with normalized type
+ var string = String(type).toLowerCase()
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ var val = param.substr(-1) === '*'
+ ? ustring(parameters[param])
+ : qstring(parameters[param])
+
+ string += '; ' + param + '=' + val
+ }
+ }
+
+ return string
+}
+
+/**
+ * Decode a RFC 5987 field value (gracefully).
+ *
+ * @param {string} str
+ * @return {string}
+ * @private
+ */
+
+function decodefield (str) {
+ var match = EXT_VALUE_REGEXP.exec(str)
+
+ if (!match) {
+ throw new TypeError('invalid extended field value')
+ }
+
+ var charset = match[1].toLowerCase()
+ var encoded = match[2]
+ var value
+
+ // to binary string
+ var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode)
+
+ switch (charset) {
+ case 'iso-8859-1':
+ value = getlatin1(binary)
+ break
+ case 'utf-8':
+ value = Buffer.from(binary, 'binary').toString('utf8')
+ break
+ default:
+ throw new TypeError('unsupported charset in extended field')
+ }
+
+ return value
+}
+
+/**
+ * Get ISO-8859-1 version of string.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function getlatin1 (val) {
+ // simple Unicode -> ISO-8859-1 transformation
+ return String(val).replace(NON_LATIN1_REGEXP, '?')
+}
+
+/**
+ * Parse Content-Disposition header string.
+ *
+ * @param {string} string
+ * @return {object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string || typeof string !== 'string') {
+ throw new TypeError('argument string is required')
+ }
+
+ var match = DISPOSITION_TYPE_REGEXP.exec(string)
+
+ if (!match) {
+ throw new TypeError('invalid type format')
+ }
+
+ // normalize type
+ var index = match[0].length
+ var type = match[1].toLowerCase()
+
+ var key
+ var names = []
+ var params = {}
+ var value
+
+ // calculate index to start at
+ index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';'
+ ? index - 1
+ : index
+
+ // match parameters
+ while ((match = PARAM_REGEXP.exec(string))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (names.indexOf(key) !== -1) {
+ throw new TypeError('invalid duplicate parameter')
+ }
+
+ names.push(key)
+
+ if (key.indexOf('*') + 1 === key.length) {
+ // decode extended value
+ key = key.slice(0, -1)
+ value = decodefield(value)
+
+ // overwrite existing value
+ params[key] = value
+ continue
+ }
+
+ if (typeof params[key] === 'string') {
+ continue
+ }
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ return new ContentDisposition(type, params)
+}
+
+/**
+ * Percent decode a single character.
+ *
+ * @param {string} str
+ * @param {string} hex
+ * @return {string}
+ * @private
+ */
+
+function pdecode (str, hex) {
+ return String.fromCharCode(parseInt(hex, 16))
+}
+
+/**
+ * Percent encode a single character.
+ *
+ * @param {string} char
+ * @return {string}
+ * @private
+ */
+
+function pencode (char) {
+ return '%' + String(char)
+ .charCodeAt(0)
+ .toString(16)
+ .toUpperCase()
+}
+
+/**
+ * Quote a string for HTTP.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Encode a Unicode string for HTTP (RFC 5987).
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function ustring (val) {
+ var str = String(val)
+
+ // percent encode as UTF-8
+ var encoded = encodeURIComponent(str)
+ .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode)
+
+ return 'UTF-8\'\'' + encoded
+}
+
+/**
+ * Class for parsed Content-Disposition header for v8 optimization
+ *
+ * @public
+ * @param {string} type
+ * @param {object} parameters
+ * @constructor
+ */
+
+function ContentDisposition (type, parameters) {
+ this.type = type
+ this.parameters = parameters
+}
diff --git a/node_modules/content-disposition/package.json b/node_modules/content-disposition/package.json
new file mode 100644
index 0000000..43c70ce
--- /dev/null
+++ b/node_modules/content-disposition/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "content-disposition",
+ "description": "Create and parse Content-Disposition header",
+ "version": "0.5.4",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "content-disposition",
+ "http",
+ "rfc6266",
+ "res"
+ ],
+ "repository": "jshttp/content-disposition",
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "13.0.1",
+ "eslint-plugin-import": "2.25.3",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "istanbul": "0.4.5",
+ "mocha": "9.1.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+ }
+}
diff --git a/node_modules/content-type/HISTORY.md b/node_modules/content-type/HISTORY.md
new file mode 100644
index 0000000..4583671
--- /dev/null
+++ b/node_modules/content-type/HISTORY.md
@@ -0,0 +1,29 @@
+1.0.5 / 2023-01-29
+==================
+
+ * perf: skip value escaping when unnecessary
+
+1.0.4 / 2017-09-11
+==================
+
+ * perf: skip parameter parsing when no parameters
+
+1.0.3 / 2017-09-10
+==================
+
+ * perf: remove argument reassignment
+
+1.0.2 / 2016-05-09
+==================
+
+ * perf: enable strict mode
+
+1.0.1 / 2015-02-13
+==================
+
+ * Improve missing `Content-Type` header error message
+
+1.0.0 / 2015-02-01
+==================
+
+ * Initial implementation, derived from `media-typer@0.3.0`
diff --git a/node_modules/content-type/LICENSE b/node_modules/content-type/LICENSE
new file mode 100644
index 0000000..34b1a2d
--- /dev/null
+++ b/node_modules/content-type/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/content-type/README.md b/node_modules/content-type/README.md
new file mode 100644
index 0000000..c1a922a
--- /dev/null
+++ b/node_modules/content-type/README.md
@@ -0,0 +1,94 @@
+# content-type
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Create and parse HTTP Content-Type header according to RFC 7231
+
+## Installation
+
+```sh
+$ npm install content-type
+```
+
+## API
+
+```js
+var contentType = require('content-type')
+```
+
+### contentType.parse(string)
+
+```js
+var obj = contentType.parse('image/svg+xml; charset=utf-8')
+```
+
+Parse a `Content-Type` header. This will return an object with the following
+properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (the type and subtype, always lower case).
+ Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of parameter
+ always lower case). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the string is missing or invalid.
+
+### contentType.parse(req)
+
+```js
+var obj = contentType.parse(req)
+```
+
+Parse the `Content-Type` header from the given `req`. Short-cut for
+`contentType.parse(req.headers['content-type'])`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.parse(res)
+
+```js
+var obj = contentType.parse(res)
+```
+
+Parse the `Content-Type` header set on the given `res`. Short-cut for
+`contentType.parse(res.getHeader('content-type'))`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.format(obj)
+
+```js
+var str = contentType.format({
+ type: 'image/svg+xml',
+ parameters: { charset: 'utf-8' }
+})
+```
+
+Format an object into a `Content-Type` header. This will return a string of the
+content type for the given object with the following properties (examples are
+shown that produce the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of the
+ parameter will be lower-cased). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the object contains an invalid type or parameter names.
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci
+[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master
+[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master
+[node-image]: https://badgen.net/npm/node/content-type
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/content-type
+[npm-url]: https://npmjs.org/package/content-type
+[npm-version-image]: https://badgen.net/npm/v/content-type
diff --git a/node_modules/content-type/index.js b/node_modules/content-type/index.js
new file mode 100644
index 0000000..41840e7
--- /dev/null
+++ b/node_modules/content-type/index.js
@@ -0,0 +1,225 @@
+/*!
+ * content-type
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1
+ *
+ * parameter = token "=" ( token / quoted-string )
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*"
+ * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~"
+ * / DIGIT / ALPHA
+ * ; any VCHAR, except delimiters
+ * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE
+ * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text
+ * obs-text = %x80-FF
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ */
+var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex
+var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * RegExp to match quoted-pair in RFC 7230 sec 3.2.6
+ *
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ * obs-text = %x80-FF
+ */
+var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6
+ */
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp to match type in RFC 7231 sec 3.1.1.1
+ *
+ * media-type = type "/" subtype
+ * type = token
+ * subtype = token
+ */
+var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.format = format
+exports.parse = parse
+
+/**
+ * Format object to media type.
+ *
+ * @param {object} obj
+ * @return {string}
+ * @public
+ */
+
+function format (obj) {
+ if (!obj || typeof obj !== 'object') {
+ throw new TypeError('argument obj is required')
+ }
+
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || !TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ var string = type
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ if (!TOKEN_REGEXP.test(param)) {
+ throw new TypeError('invalid parameter name')
+ }
+
+ string += '; ' + param + '=' + qstring(parameters[param])
+ }
+ }
+
+ return string
+}
+
+/**
+ * Parse media type to object.
+ *
+ * @param {string|object} string
+ * @return {Object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string) {
+ throw new TypeError('argument string is required')
+ }
+
+ // support req/res-like objects as argument
+ var header = typeof string === 'object'
+ ? getcontenttype(string)
+ : string
+
+ if (typeof header !== 'string') {
+ throw new TypeError('argument string is required to be a string')
+ }
+
+ var index = header.indexOf(';')
+ var type = index !== -1
+ ? header.slice(0, index).trim()
+ : header.trim()
+
+ if (!TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid media type')
+ }
+
+ var obj = new ContentType(type.toLowerCase())
+
+ // parse parameters
+ if (index !== -1) {
+ var key
+ var match
+ var value
+
+ PARAM_REGEXP.lastIndex = index
+
+ while ((match = PARAM_REGEXP.exec(header))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (value.charCodeAt(0) === 0x22 /* " */) {
+ // remove quotes
+ value = value.slice(1, -1)
+
+ // remove escapes
+ if (value.indexOf('\\') !== -1) {
+ value = value.replace(QESC_REGEXP, '$1')
+ }
+ }
+
+ obj.parameters[key] = value
+ }
+
+ if (index !== header.length) {
+ throw new TypeError('invalid parameter format')
+ }
+ }
+
+ return obj
+}
+
+/**
+ * Get content-type from req/res objects.
+ *
+ * @param {object}
+ * @return {Object}
+ * @private
+ */
+
+function getcontenttype (obj) {
+ var header
+
+ if (typeof obj.getHeader === 'function') {
+ // res-like
+ header = obj.getHeader('content-type')
+ } else if (typeof obj.headers === 'object') {
+ // req-like
+ header = obj.headers && obj.headers['content-type']
+ }
+
+ if (typeof header !== 'string') {
+ throw new TypeError('content-type header is missing from object')
+ }
+
+ return header
+}
+
+/**
+ * Quote a string if necessary.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ // no need to quote tokens
+ if (TOKEN_REGEXP.test(str)) {
+ return str
+ }
+
+ if (str.length > 0 && !TEXT_REGEXP.test(str)) {
+ throw new TypeError('invalid parameter value')
+ }
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Class to represent a content type.
+ * @private
+ */
+function ContentType (type) {
+ this.parameters = Object.create(null)
+ this.type = type
+}
diff --git a/node_modules/content-type/package.json b/node_modules/content-type/package.json
new file mode 100644
index 0000000..9db19f6
--- /dev/null
+++ b/node_modules/content-type/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "content-type",
+ "description": "Create and parse HTTP Content-Type header",
+ "version": "1.0.5",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "content-type",
+ "http",
+ "req",
+ "res",
+ "rfc7231"
+ ],
+ "repository": "jshttp/content-type",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "8.32.0",
+ "eslint-config-standard": "15.0.1",
+ "eslint-plugin-import": "2.27.5",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "6.1.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcovonly --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ }
+}
diff --git a/node_modules/cookie-signature/.npmignore b/node_modules/cookie-signature/.npmignore
new file mode 100644
index 0000000..f1250e5
--- /dev/null
+++ b/node_modules/cookie-signature/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/node_modules/cookie-signature/History.md b/node_modules/cookie-signature/History.md
new file mode 100644
index 0000000..78513cc
--- /dev/null
+++ b/node_modules/cookie-signature/History.md
@@ -0,0 +1,38 @@
+1.0.6 / 2015-02-03
+==================
+
+* use `npm test` instead of `make test` to run tests
+* clearer assertion messages when checking input
+
+
+1.0.5 / 2014-09-05
+==================
+
+* add license to package.json
+
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/node_modules/cookie-signature/Readme.md b/node_modules/cookie-signature/Readme.md
new file mode 100644
index 0000000..2559e84
--- /dev/null
+++ b/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/node_modules/cookie-signature/index.js b/node_modules/cookie-signature/index.js
new file mode 100644
index 0000000..b8c9463
--- /dev/null
+++ b/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/node_modules/cookie-signature/package.json b/node_modules/cookie-signature/package.json
new file mode 100644
index 0000000..29c4498
--- /dev/null
+++ b/node_modules/cookie-signature/package.json
@@ -0,0 +1,18 @@
+{
+ "name": "cookie-signature",
+ "version": "1.0.6",
+ "description": "Sign and unsign cookies",
+ "keywords": ["cookie", "sign", "unsign"],
+ "author": "TJ Holowaychuk ",
+ "license": "MIT",
+ "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"},
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "scripts": {
+ "test": "mocha --require should --reporter spec"
+ },
+ "main": "index"
+}
diff --git a/node_modules/cookie/LICENSE b/node_modules/cookie/LICENSE
new file mode 100644
index 0000000..058b6b4
--- /dev/null
+++ b/node_modules/cookie/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 Roman Shtylman
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/cookie/README.md b/node_modules/cookie/README.md
new file mode 100644
index 0000000..71fdac1
--- /dev/null
+++ b/node_modules/cookie/README.md
@@ -0,0 +1,317 @@
+# cookie
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Basic HTTP cookie parser and serializer for HTTP servers.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cookie
+```
+
+## API
+
+```js
+var cookie = require('cookie');
+```
+
+### cookie.parse(str, options)
+
+Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs.
+The `str` argument is the string representing a `Cookie` header value and `options` is an
+optional object containing additional parsing options.
+
+```js
+var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2');
+// { foo: 'bar', equation: 'E=mc^2' }
+```
+
+#### Options
+
+`cookie.parse` accepts these properties in the options object.
+
+##### decode
+
+Specifies a function that will be used to decode a cookie's value. Since the value of a cookie
+has a limited character set (and must be a simple string), this function can be used to decode
+a previously-encoded cookie value into a JavaScript string or other object.
+
+The default function is the global `decodeURIComponent`, which will decode any URL-encoded
+sequences into their byte representations.
+
+**note** if an error is thrown from this function, the original, non-decoded cookie value will
+be returned as the cookie's value.
+
+### cookie.serialize(name, value, options)
+
+Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the
+name for the cookie, the `value` argument is the value to set the cookie to, and the `options`
+argument is an optional object containing additional serialization options.
+
+```js
+var setCookie = cookie.serialize('foo', 'bar');
+// foo=bar
+```
+
+#### Options
+
+`cookie.serialize` accepts these properties in the options object.
+
+##### domain
+
+Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no
+domain is set, and most clients will consider the cookie to apply to only the current domain.
+
+##### encode
+
+Specifies a function that will be used to encode a cookie's value. Since value of a cookie
+has a limited character set (and must be a simple string), this function can be used to encode
+a value into a string suited for a cookie's value.
+
+The default function is the global `encodeURIComponent`, which will encode a JavaScript string
+into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range.
+
+##### expires
+
+Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1].
+By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and
+will delete it on a condition like exiting a web browser application.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### httpOnly
+
+Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not allow client-side
+JavaScript to see the cookie in `document.cookie`.
+
+##### maxAge
+
+Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2].
+The given number will be converted to an integer by rounding down. By default, no maximum age is set.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### partitioned
+
+Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies)
+attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. By default, the
+`Partitioned` attribute is not set.
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+More information about can be found in [the proposal](https://github.com/privacycg/CHIPS).
+
+##### path
+
+Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path
+is considered the ["default path"][rfc-6265-5.1.4].
+
+##### priority
+
+Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1].
+
+ - `'low'` will set the `Priority` attribute to `Low`.
+ - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set.
+ - `'high'` will set the `Priority` attribute to `High`.
+
+More information about the different priority levels can be found in
+[the specification][rfc-west-cookie-priority-00-4.1].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### sameSite
+
+Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7].
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-09-5.4.7].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### secure
+
+Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to
+the server in the future if the browser does not have an HTTPS connection.
+
+## Example
+
+The following example uses this module in conjunction with the Node.js core HTTP server
+to prompt a user for their name and display it back on future visits.
+
+```js
+var cookie = require('cookie');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var url = require('url');
+
+function onRequest(req, res) {
+ // Parse the query string
+ var query = url.parse(req.url, true, true).query;
+
+ if (query && query.name) {
+ // Set a new cookie with the name
+ res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), {
+ httpOnly: true,
+ maxAge: 60 * 60 * 24 * 7 // 1 week
+ }));
+
+ // Redirect back after setting cookie
+ res.statusCode = 302;
+ res.setHeader('Location', req.headers.referer || '/');
+ res.end();
+ return;
+ }
+
+ // Parse the cookies on the request
+ var cookies = cookie.parse(req.headers.cookie || '');
+
+ // Get the visitor name set in the cookie
+ var name = cookies.name;
+
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8');
+
+ if (name) {
+ res.write('Welcome back, ' + escapeHtml(name) + ' !
');
+ } else {
+ res.write('Hello, new visitor!
');
+ }
+
+ res.write('');
+}
+
+http.createServer(onRequest).listen(3000);
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```
+$ npm run bench
+
+> cookie@0.5.0 bench
+> node benchmark/index.js
+
+ node@18.18.2
+ acorn@8.10.0
+ ada@2.6.0
+ ares@1.19.1
+ brotli@1.0.9
+ cldr@43.1
+ icu@73.2
+ llhttp@6.0.11
+ modules@108
+ napi@9
+ nghttp2@1.57.0
+ nghttp3@0.7.0
+ ngtcp2@0.8.1
+ openssl@3.0.10+quic
+ simdutf@3.2.14
+ tz@2023c
+ undici@5.26.3
+ unicode@15.0
+ uv@1.44.2
+ uvwasi@0.0.18
+ v8@10.2.154.26-node.26
+ zlib@1.2.13.1-motley
+
+> node benchmark/parse-top.js
+
+ cookie.parse - top sites
+
+ 14 tests completed.
+
+ parse accounts.google.com x 2,588,913 ops/sec ±0.74% (186 runs sampled)
+ parse apple.com x 2,370,002 ops/sec ±0.69% (186 runs sampled)
+ parse cloudflare.com x 2,213,102 ops/sec ±0.88% (188 runs sampled)
+ parse docs.google.com x 2,194,157 ops/sec ±1.03% (184 runs sampled)
+ parse drive.google.com x 2,265,084 ops/sec ±0.79% (187 runs sampled)
+ parse en.wikipedia.org x 457,099 ops/sec ±0.81% (186 runs sampled)
+ parse linkedin.com x 504,407 ops/sec ±0.89% (186 runs sampled)
+ parse maps.google.com x 1,230,959 ops/sec ±0.98% (186 runs sampled)
+ parse microsoft.com x 926,294 ops/sec ±0.88% (184 runs sampled)
+ parse play.google.com x 2,311,338 ops/sec ±0.83% (185 runs sampled)
+ parse support.google.com x 1,508,850 ops/sec ±0.86% (186 runs sampled)
+ parse www.google.com x 1,022,582 ops/sec ±1.32% (182 runs sampled)
+ parse youtu.be x 332,136 ops/sec ±1.02% (185 runs sampled)
+ parse youtube.com x 323,833 ops/sec ±0.77% (183 runs sampled)
+
+> node benchmark/parse.js
+
+ cookie.parse - generic
+
+ 6 tests completed.
+
+ simple x 3,214,032 ops/sec ±1.61% (183 runs sampled)
+ decode x 587,237 ops/sec ±1.16% (187 runs sampled)
+ unquote x 2,954,618 ops/sec ±1.35% (183 runs sampled)
+ duplicates x 857,008 ops/sec ±0.89% (187 runs sampled)
+ 10 cookies x 292,133 ops/sec ±0.89% (187 runs sampled)
+ 100 cookies x 22,610 ops/sec ±0.68% (187 runs sampled)
+```
+
+## References
+
+- [RFC 6265: HTTP State Management Mechanism][rfc-6265]
+- [Same-site Cookies][rfc-6265bis-09-5.4.7]
+
+[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/
+[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1
+[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7
+[rfc-6265]: https://tools.ietf.org/html/rfc6265
+[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4
+[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1
+[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2
+[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3
+[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4
+[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5
+[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6
+[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/jshttp/cookie/master?label=ci
+[ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master
+[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master
+[node-image]: https://badgen.net/npm/node/cookie
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/cookie
+[npm-url]: https://npmjs.org/package/cookie
+[npm-version-image]: https://badgen.net/npm/v/cookie
diff --git a/node_modules/cookie/SECURITY.md b/node_modules/cookie/SECURITY.md
new file mode 100644
index 0000000..fd4a6c5
--- /dev/null
+++ b/node_modules/cookie/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The `cookie` team and community take all security bugs seriously. Thank
+you for improving the security of the project. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `cookie`. This
+information can be found in the npm registry using the command
+`npm owner ls cookie`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/jshttp/cookie/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/node_modules/cookie/index.js b/node_modules/cookie/index.js
new file mode 100644
index 0000000..51a58cb
--- /dev/null
+++ b/node_modules/cookie/index.js
@@ -0,0 +1,334 @@
+/*!
+ * cookie
+ * Copyright(c) 2012-2014 Roman Shtylman
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.parse = parse;
+exports.serialize = serialize;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var __toString = Object.prototype.toString
+
+/**
+ * RegExp to match cookie-name in RFC 6265 sec 4.1.1
+ * This refers out to the obsoleted definition of token in RFC 2616 sec 2.2
+ * which has been replaced by the token definition in RFC 7230 appendix B.
+ *
+ * cookie-name = token
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" /
+ * "*" / "+" / "-" / "." / "^" / "_" /
+ * "`" / "|" / "~" / DIGIT / ALPHA
+ */
+
+var cookieNameRegExp = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/;
+
+/**
+ * RegExp to match cookie-value in RFC 6265 sec 4.1.1
+ *
+ * cookie-value = *cookie-octet / ( DQUOTE *cookie-octet DQUOTE )
+ * cookie-octet = %x21 / %x23-2B / %x2D-3A / %x3C-5B / %x5D-7E
+ * ; US-ASCII characters excluding CTLs,
+ * ; whitespace DQUOTE, comma, semicolon,
+ * ; and backslash
+ */
+
+var cookieValueRegExp = /^("?)[\u0021\u0023-\u002B\u002D-\u003A\u003C-\u005B\u005D-\u007E]*\1$/;
+
+/**
+ * RegExp to match domain-value in RFC 6265 sec 4.1.1
+ *
+ * domain-value =
+ * ; defined in [RFC1034], Section 3.5, as
+ * ; enhanced by [RFC1123], Section 2.1
+ * = | "."
+ * = [ [ ] ]
+ * Labels must be 63 characters or less.
+ * 'let-dig' not 'letter' in the first char, per RFC1123
+ * = |
+ * = | "-"
+ * = |
+ * = any one of the 52 alphabetic characters A through Z in
+ * upper case and a through z in lower case
+ * = any one of the ten digits 0 through 9
+ *
+ * Keep support for leading dot: https://github.com/jshttp/cookie/issues/173
+ *
+ * > (Note that a leading %x2E ("."), if present, is ignored even though that
+ * character is not permitted, but a trailing %x2E ("."), if present, will
+ * cause the user agent to ignore the attribute.)
+ */
+
+var domainValueRegExp = /^([.]?[a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)([.][a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)*$/i;
+
+/**
+ * RegExp to match path-value in RFC 6265 sec 4.1.1
+ *
+ * path-value =
+ * CHAR = %x01-7F
+ * ; defined in RFC 5234 appendix B.1
+ */
+
+var pathValueRegExp = /^[\u0020-\u003A\u003D-\u007E]*$/;
+
+/**
+ * Parse a cookie header.
+ *
+ * Parse the given cookie header string into an object
+ * The object has the various cookies as keys(names) => values
+ *
+ * @param {string} str
+ * @param {object} [opt]
+ * @return {object}
+ * @public
+ */
+
+function parse(str, opt) {
+ if (typeof str !== 'string') {
+ throw new TypeError('argument str must be a string');
+ }
+
+ var obj = {};
+ var len = str.length;
+ // RFC 6265 sec 4.1.1, RFC 2616 2.2 defines a cookie name consists of one char minimum, plus '='.
+ if (len < 2) return obj;
+
+ var dec = (opt && opt.decode) || decode;
+ var index = 0;
+ var eqIdx = 0;
+ var endIdx = 0;
+
+ do {
+ eqIdx = str.indexOf('=', index);
+ if (eqIdx === -1) break; // No more cookie pairs.
+
+ endIdx = str.indexOf(';', index);
+
+ if (endIdx === -1) {
+ endIdx = len;
+ } else if (eqIdx > endIdx) {
+ // backtrack on prior semicolon
+ index = str.lastIndexOf(';', eqIdx - 1) + 1;
+ continue;
+ }
+
+ var keyStartIdx = startIndex(str, index, eqIdx);
+ var keyEndIdx = endIndex(str, eqIdx, keyStartIdx);
+ var key = str.slice(keyStartIdx, keyEndIdx);
+
+ // only assign once
+ if (!obj.hasOwnProperty(key)) {
+ var valStartIdx = startIndex(str, eqIdx + 1, endIdx);
+ var valEndIdx = endIndex(str, endIdx, valStartIdx);
+
+ if (str.charCodeAt(valStartIdx) === 0x22 /* " */ && str.charCodeAt(valEndIdx - 1) === 0x22 /* " */) {
+ valStartIdx++;
+ valEndIdx--;
+ }
+
+ var val = str.slice(valStartIdx, valEndIdx);
+ obj[key] = tryDecode(val, dec);
+ }
+
+ index = endIdx + 1
+ } while (index < len);
+
+ return obj;
+}
+
+function startIndex(str, index, max) {
+ do {
+ var code = str.charCodeAt(index);
+ if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index;
+ } while (++index < max);
+ return max;
+}
+
+function endIndex(str, index, min) {
+ while (index > min) {
+ var code = str.charCodeAt(--index);
+ if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index + 1;
+ }
+ return min;
+}
+
+/**
+ * Serialize data into a cookie header.
+ *
+ * Serialize a name value pair into a cookie string suitable for
+ * http headers. An optional options object specifies cookie parameters.
+ *
+ * serialize('foo', 'bar', { httpOnly: true })
+ * => "foo=bar; httpOnly"
+ *
+ * @param {string} name
+ * @param {string} val
+ * @param {object} [opt]
+ * @return {string}
+ * @public
+ */
+
+function serialize(name, val, opt) {
+ var enc = (opt && opt.encode) || encodeURIComponent;
+
+ if (typeof enc !== 'function') {
+ throw new TypeError('option encode is invalid');
+ }
+
+ if (!cookieNameRegExp.test(name)) {
+ throw new TypeError('argument name is invalid');
+ }
+
+ var value = enc(val);
+
+ if (!cookieValueRegExp.test(value)) {
+ throw new TypeError('argument val is invalid');
+ }
+
+ var str = name + '=' + value;
+ if (!opt) return str;
+
+ if (null != opt.maxAge) {
+ var maxAge = Math.floor(opt.maxAge);
+
+ if (!isFinite(maxAge)) {
+ throw new TypeError('option maxAge is invalid')
+ }
+
+ str += '; Max-Age=' + maxAge;
+ }
+
+ if (opt.domain) {
+ if (!domainValueRegExp.test(opt.domain)) {
+ throw new TypeError('option domain is invalid');
+ }
+
+ str += '; Domain=' + opt.domain;
+ }
+
+ if (opt.path) {
+ if (!pathValueRegExp.test(opt.path)) {
+ throw new TypeError('option path is invalid');
+ }
+
+ str += '; Path=' + opt.path;
+ }
+
+ if (opt.expires) {
+ var expires = opt.expires
+
+ if (!isDate(expires) || isNaN(expires.valueOf())) {
+ throw new TypeError('option expires is invalid');
+ }
+
+ str += '; Expires=' + expires.toUTCString()
+ }
+
+ if (opt.httpOnly) {
+ str += '; HttpOnly';
+ }
+
+ if (opt.secure) {
+ str += '; Secure';
+ }
+
+ if (opt.partitioned) {
+ str += '; Partitioned'
+ }
+
+ if (opt.priority) {
+ var priority = typeof opt.priority === 'string'
+ ? opt.priority.toLowerCase() : opt.priority;
+
+ switch (priority) {
+ case 'low':
+ str += '; Priority=Low'
+ break
+ case 'medium':
+ str += '; Priority=Medium'
+ break
+ case 'high':
+ str += '; Priority=High'
+ break
+ default:
+ throw new TypeError('option priority is invalid')
+ }
+ }
+
+ if (opt.sameSite) {
+ var sameSite = typeof opt.sameSite === 'string'
+ ? opt.sameSite.toLowerCase() : opt.sameSite;
+
+ switch (sameSite) {
+ case true:
+ str += '; SameSite=Strict';
+ break;
+ case 'lax':
+ str += '; SameSite=Lax';
+ break;
+ case 'strict':
+ str += '; SameSite=Strict';
+ break;
+ case 'none':
+ str += '; SameSite=None';
+ break;
+ default:
+ throw new TypeError('option sameSite is invalid');
+ }
+ }
+
+ return str;
+}
+
+/**
+ * URL-decode string value. Optimized to skip native call when no %.
+ *
+ * @param {string} str
+ * @returns {string}
+ */
+
+function decode (str) {
+ return str.indexOf('%') !== -1
+ ? decodeURIComponent(str)
+ : str
+}
+
+/**
+ * Determine if value is a Date.
+ *
+ * @param {*} val
+ * @private
+ */
+
+function isDate (val) {
+ return __toString.call(val) === '[object Date]';
+}
+
+/**
+ * Try decoding a string using a decoding function.
+ *
+ * @param {string} str
+ * @param {function} decode
+ * @private
+ */
+
+function tryDecode(str, decode) {
+ try {
+ return decode(str);
+ } catch (e) {
+ return str;
+ }
+}
diff --git a/node_modules/cookie/package.json b/node_modules/cookie/package.json
new file mode 100644
index 0000000..f498ea7
--- /dev/null
+++ b/node_modules/cookie/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "cookie",
+ "description": "HTTP server cookie parsing and serialization",
+ "version": "0.7.1",
+ "author": "Roman Shtylman ",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "repository": "jshttp/cookie",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "8.53.0",
+ "eslint-plugin-markdown": "3.0.1",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "top-sites": "1.1.194"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "main": "index.js",
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "update-bench": "node scripts/update-benchmark.js"
+ }
+}
diff --git a/node_modules/core-util-is/LICENSE b/node_modules/core-util-is/LICENSE
new file mode 100644
index 0000000..d8d7f94
--- /dev/null
+++ b/node_modules/core-util-is/LICENSE
@@ -0,0 +1,19 @@
+Copyright Node.js contributors. All rights reserved.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to
+deal in the Software without restriction, including without limitation the
+rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+sell copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS
+IN THE SOFTWARE.
diff --git a/node_modules/core-util-is/README.md b/node_modules/core-util-is/README.md
new file mode 100644
index 0000000..5a76b41
--- /dev/null
+++ b/node_modules/core-util-is/README.md
@@ -0,0 +1,3 @@
+# core-util-is
+
+The `util.is*` functions introduced in Node v0.12.
diff --git a/node_modules/core-util-is/lib/util.js b/node_modules/core-util-is/lib/util.js
new file mode 100644
index 0000000..6e5a20d
--- /dev/null
+++ b/node_modules/core-util-is/lib/util.js
@@ -0,0 +1,107 @@
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+
+function isArray(arg) {
+ if (Array.isArray) {
+ return Array.isArray(arg);
+ }
+ return objectToString(arg) === '[object Array]';
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+ return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+ return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+ return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+ return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+ return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+ return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+ return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+ return objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+ return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+ return objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+ return (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+ return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+ return arg === null ||
+ typeof arg === 'boolean' ||
+ typeof arg === 'number' ||
+ typeof arg === 'string' ||
+ typeof arg === 'symbol' || // ES6 symbol
+ typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = require('buffer').Buffer.isBuffer;
+
+function objectToString(o) {
+ return Object.prototype.toString.call(o);
+}
diff --git a/node_modules/core-util-is/package.json b/node_modules/core-util-is/package.json
new file mode 100644
index 0000000..b0c51f5
--- /dev/null
+++ b/node_modules/core-util-is/package.json
@@ -0,0 +1,38 @@
+{
+ "name": "core-util-is",
+ "version": "1.0.3",
+ "description": "The `util.is*` functions introduced in Node v0.12.",
+ "main": "lib/util.js",
+ "files": [
+ "lib"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/isaacs/core-util-is"
+ },
+ "keywords": [
+ "util",
+ "isBuffer",
+ "isArray",
+ "isNumber",
+ "isString",
+ "isRegExp",
+ "isThis",
+ "isThat",
+ "polyfill"
+ ],
+ "author": "Isaac Z. Schlueter (http://blog.izs.me/)",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/isaacs/core-util-is/issues"
+ },
+ "scripts": {
+ "test": "tap test.js",
+ "preversion": "npm test",
+ "postversion": "npm publish",
+ "prepublishOnly": "git push origin --follow-tags"
+ },
+ "devDependencies": {
+ "tap": "^15.0.9"
+ }
+}
diff --git a/node_modules/cors/CONTRIBUTING.md b/node_modules/cors/CONTRIBUTING.md
new file mode 100644
index 0000000..591b09a
--- /dev/null
+++ b/node_modules/cors/CONTRIBUTING.md
@@ -0,0 +1,33 @@
+# contributing to `cors`
+
+CORS is a node.js package for providing a [connect](http://www.senchalabs.org/connect/)/[express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options. Learn more about the project in [the README](README.md).
+
+## The CORS Spec
+
+[http://www.w3.org/TR/cors/](http://www.w3.org/TR/cors/)
+
+## Pull Requests Welcome
+
+* Include `'use strict';` in every javascript file.
+* 2 space indentation.
+* Please run the testing steps below before submitting.
+
+## Testing
+
+```bash
+$ npm install
+$ npm test
+```
+
+## Interactive Testing Harness
+
+[http://node-cors-client.herokuapp.com](http://node-cors-client.herokuapp.com)
+
+Related git repositories:
+
+* [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server)
+* [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client)
+
+## License
+
+[MIT License](http://www.opensource.org/licenses/mit-license.php)
diff --git a/node_modules/cors/HISTORY.md b/node_modules/cors/HISTORY.md
new file mode 100644
index 0000000..5762bce
--- /dev/null
+++ b/node_modules/cors/HISTORY.md
@@ -0,0 +1,58 @@
+2.8.5 / 2018-11-04
+==================
+
+ * Fix setting `maxAge` option to `0`
+
+2.8.4 / 2017-07-12
+==================
+
+ * Work-around Safari bug in default pre-flight response
+
+2.8.3 / 2017-03-29
+==================
+
+ * Fix error when options delegate missing `methods` option
+
+2.8.2 / 2017-03-28
+==================
+
+ * Fix error when frozen options are passed
+ * Send "Vary: Origin" when using regular expressions
+ * Send "Vary: Access-Control-Request-Headers" when dynamic `allowedHeaders`
+
+2.8.1 / 2016-09-08
+==================
+
+This release only changed documentation.
+
+2.8.0 / 2016-08-23
+==================
+
+ * Add `optionsSuccessStatus` option
+
+2.7.2 / 2016-08-23
+==================
+
+ * Fix error when Node.js running in strict mode
+
+2.7.1 / 2015-05-28
+==================
+
+ * Move module into expressjs organization
+
+2.7.0 / 2015-05-28
+==================
+
+ * Allow array of matching condition as `origin` option
+ * Allow regular expression as `origin` option
+
+2.6.1 / 2015-05-28
+==================
+
+ * Update `license` in package.json
+
+2.6.0 / 2015-04-27
+==================
+
+ * Add `preflightContinue` option
+ * Fix "Vary: Origin" header added for "*"
diff --git a/node_modules/cors/LICENSE b/node_modules/cors/LICENSE
new file mode 100644
index 0000000..fd10c84
--- /dev/null
+++ b/node_modules/cors/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2013 Troy Goode
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/cors/README.md b/node_modules/cors/README.md
new file mode 100644
index 0000000..732b847
--- /dev/null
+++ b/node_modules/cors/README.md
@@ -0,0 +1,243 @@
+# cors
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+CORS is a node.js package for providing a [Connect](http://www.senchalabs.org/connect/)/[Express](http://expressjs.com/) middleware that can be used to enable [CORS](http://en.wikipedia.org/wiki/Cross-origin_resource_sharing) with various options.
+
+**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)**
+
+* [Installation](#installation)
+* [Usage](#usage)
+ * [Simple Usage](#simple-usage-enable-all-cors-requests)
+ * [Enable CORS for a Single Route](#enable-cors-for-a-single-route)
+ * [Configuring CORS](#configuring-cors)
+ * [Configuring CORS Asynchronously](#configuring-cors-asynchronously)
+ * [Enabling CORS Pre-Flight](#enabling-cors-pre-flight)
+* [Configuration Options](#configuration-options)
+* [Demo](#demo)
+* [License](#license)
+* [Author](#author)
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cors
+```
+
+## Usage
+
+### Simple Usage (Enable *All* CORS Requests)
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+app.use(cors())
+
+app.get('/products/:id', function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for all origins!'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+### Enable CORS for a Single Route
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+app.get('/products/:id', cors(), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for a Single Route'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+### Configuring CORS
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+var corsOptions = {
+ origin: 'http://example.com',
+ optionsSuccessStatus: 200 // some legacy browsers (IE11, various SmartTVs) choke on 204
+}
+
+app.get('/products/:id', cors(corsOptions), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for only example.com.'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+### Configuring CORS w/ Dynamic Origin
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+var whitelist = ['http://example1.com', 'http://example2.com']
+var corsOptions = {
+ origin: function (origin, callback) {
+ if (whitelist.indexOf(origin) !== -1) {
+ callback(null, true)
+ } else {
+ callback(new Error('Not allowed by CORS'))
+ }
+ }
+}
+
+app.get('/products/:id', cors(corsOptions), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for a whitelisted domain.'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+If you do not want to block REST tools or server-to-server requests,
+add a `!origin` check in the origin function like so:
+
+```javascript
+var corsOptions = {
+ origin: function (origin, callback) {
+ if (whitelist.indexOf(origin) !== -1 || !origin) {
+ callback(null, true)
+ } else {
+ callback(new Error('Not allowed by CORS'))
+ }
+ }
+}
+```
+
+### Enabling CORS Pre-Flight
+
+Certain CORS requests are considered 'complex' and require an initial
+`OPTIONS` request (called the "pre-flight request"). An example of a
+'complex' CORS request is one that uses an HTTP verb other than
+GET/HEAD/POST (such as DELETE) or that uses custom headers. To enable
+pre-flighting, you must add a new OPTIONS handler for the route you want
+to support:
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+app.options('/products/:id', cors()) // enable pre-flight request for DELETE request
+app.del('/products/:id', cors(), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for all origins!'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+You can also enable pre-flight across-the-board like so:
+
+```javascript
+app.options('*', cors()) // include before other routes
+```
+
+### Configuring CORS Asynchronously
+
+```javascript
+var express = require('express')
+var cors = require('cors')
+var app = express()
+
+var whitelist = ['http://example1.com', 'http://example2.com']
+var corsOptionsDelegate = function (req, callback) {
+ var corsOptions;
+ if (whitelist.indexOf(req.header('Origin')) !== -1) {
+ corsOptions = { origin: true } // reflect (enable) the requested origin in the CORS response
+ } else {
+ corsOptions = { origin: false } // disable CORS for this request
+ }
+ callback(null, corsOptions) // callback expects two parameters: error and options
+}
+
+app.get('/products/:id', cors(corsOptionsDelegate), function (req, res, next) {
+ res.json({msg: 'This is CORS-enabled for a whitelisted domain.'})
+})
+
+app.listen(80, function () {
+ console.log('CORS-enabled web server listening on port 80')
+})
+```
+
+## Configuration Options
+
+* `origin`: Configures the **Access-Control-Allow-Origin** CORS header. Possible values:
+ - `Boolean` - set `origin` to `true` to reflect the [request origin](http://tools.ietf.org/html/draft-abarth-origin-09), as defined by `req.header('Origin')`, or set it to `false` to disable CORS.
+ - `String` - set `origin` to a specific origin. For example if you set it to `"http://example.com"` only requests from "http://example.com" will be allowed.
+ - `RegExp` - set `origin` to a regular expression pattern which will be used to test the request origin. If it's a match, the request origin will be reflected. For example the pattern `/example\.com$/` will reflect any request that is coming from an origin ending with "example.com".
+ - `Array` - set `origin` to an array of valid origins. Each origin can be a `String` or a `RegExp`. For example `["http://example1.com", /\.example2\.com$/]` will accept any request from "http://example1.com" or from a subdomain of "example2.com".
+ - `Function` - set `origin` to a function implementing some custom logic. The function takes the request origin as the first parameter and a callback (which expects the signature `err [object], allow [bool]`) as the second.
+* `methods`: Configures the **Access-Control-Allow-Methods** CORS header. Expects a comma-delimited string (ex: 'GET,PUT,POST') or an array (ex: `['GET', 'PUT', 'POST']`).
+* `allowedHeaders`: Configures the **Access-Control-Allow-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Type,Authorization') or an array (ex: `['Content-Type', 'Authorization']`). If not specified, defaults to reflecting the headers specified in the request's **Access-Control-Request-Headers** header.
+* `exposedHeaders`: Configures the **Access-Control-Expose-Headers** CORS header. Expects a comma-delimited string (ex: 'Content-Range,X-Content-Range') or an array (ex: `['Content-Range', 'X-Content-Range']`). If not specified, no custom headers are exposed.
+* `credentials`: Configures the **Access-Control-Allow-Credentials** CORS header. Set to `true` to pass the header, otherwise it is omitted.
+* `maxAge`: Configures the **Access-Control-Max-Age** CORS header. Set to an integer to pass the header, otherwise it is omitted.
+* `preflightContinue`: Pass the CORS preflight response to the next handler.
+* `optionsSuccessStatus`: Provides a status code to use for successful `OPTIONS` requests, since some legacy browsers (IE11, various SmartTVs) choke on `204`.
+
+The default configuration is the equivalent of:
+
+```json
+{
+ "origin": "*",
+ "methods": "GET,HEAD,PUT,PATCH,POST,DELETE",
+ "preflightContinue": false,
+ "optionsSuccessStatus": 204
+}
+```
+
+For details on the effect of each CORS header, read [this](http://www.html5rocks.com/en/tutorials/cors/) article on HTML5 Rocks.
+
+## Demo
+
+A demo that illustrates CORS working (and not working) using jQuery is available here: [http://node-cors-client.herokuapp.com/](http://node-cors-client.herokuapp.com/)
+
+Code for that demo can be found here:
+
+* Client: [https://github.com/TroyGoode/node-cors-client](https://github.com/TroyGoode/node-cors-client)
+* Server: [https://github.com/TroyGoode/node-cors-server](https://github.com/TroyGoode/node-cors-server)
+
+## License
+
+[MIT License](http://www.opensource.org/licenses/mit-license.php)
+
+## Author
+
+[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com))
+
+[coveralls-image]: https://img.shields.io/coveralls/expressjs/cors/master.svg
+[coveralls-url]: https://coveralls.io/r/expressjs/cors?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/cors.svg
+[downloads-url]: https://npmjs.org/package/cors
+[npm-image]: https://img.shields.io/npm/v/cors.svg
+[npm-url]: https://npmjs.org/package/cors
+[travis-image]: https://img.shields.io/travis/expressjs/cors/master.svg
+[travis-url]: https://travis-ci.org/expressjs/cors
diff --git a/node_modules/cors/lib/index.js b/node_modules/cors/lib/index.js
new file mode 100644
index 0000000..5475aec
--- /dev/null
+++ b/node_modules/cors/lib/index.js
@@ -0,0 +1,238 @@
+(function () {
+
+ 'use strict';
+
+ var assign = require('object-assign');
+ var vary = require('vary');
+
+ var defaults = {
+ origin: '*',
+ methods: 'GET,HEAD,PUT,PATCH,POST,DELETE',
+ preflightContinue: false,
+ optionsSuccessStatus: 204
+ };
+
+ function isString(s) {
+ return typeof s === 'string' || s instanceof String;
+ }
+
+ function isOriginAllowed(origin, allowedOrigin) {
+ if (Array.isArray(allowedOrigin)) {
+ for (var i = 0; i < allowedOrigin.length; ++i) {
+ if (isOriginAllowed(origin, allowedOrigin[i])) {
+ return true;
+ }
+ }
+ return false;
+ } else if (isString(allowedOrigin)) {
+ return origin === allowedOrigin;
+ } else if (allowedOrigin instanceof RegExp) {
+ return allowedOrigin.test(origin);
+ } else {
+ return !!allowedOrigin;
+ }
+ }
+
+ function configureOrigin(options, req) {
+ var requestOrigin = req.headers.origin,
+ headers = [],
+ isAllowed;
+
+ if (!options.origin || options.origin === '*') {
+ // allow any origin
+ headers.push([{
+ key: 'Access-Control-Allow-Origin',
+ value: '*'
+ }]);
+ } else if (isString(options.origin)) {
+ // fixed origin
+ headers.push([{
+ key: 'Access-Control-Allow-Origin',
+ value: options.origin
+ }]);
+ headers.push([{
+ key: 'Vary',
+ value: 'Origin'
+ }]);
+ } else {
+ isAllowed = isOriginAllowed(requestOrigin, options.origin);
+ // reflect origin
+ headers.push([{
+ key: 'Access-Control-Allow-Origin',
+ value: isAllowed ? requestOrigin : false
+ }]);
+ headers.push([{
+ key: 'Vary',
+ value: 'Origin'
+ }]);
+ }
+
+ return headers;
+ }
+
+ function configureMethods(options) {
+ var methods = options.methods;
+ if (methods.join) {
+ methods = options.methods.join(','); // .methods is an array, so turn it into a string
+ }
+ return {
+ key: 'Access-Control-Allow-Methods',
+ value: methods
+ };
+ }
+
+ function configureCredentials(options) {
+ if (options.credentials === true) {
+ return {
+ key: 'Access-Control-Allow-Credentials',
+ value: 'true'
+ };
+ }
+ return null;
+ }
+
+ function configureAllowedHeaders(options, req) {
+ var allowedHeaders = options.allowedHeaders || options.headers;
+ var headers = [];
+
+ if (!allowedHeaders) {
+ allowedHeaders = req.headers['access-control-request-headers']; // .headers wasn't specified, so reflect the request headers
+ headers.push([{
+ key: 'Vary',
+ value: 'Access-Control-Request-Headers'
+ }]);
+ } else if (allowedHeaders.join) {
+ allowedHeaders = allowedHeaders.join(','); // .headers is an array, so turn it into a string
+ }
+ if (allowedHeaders && allowedHeaders.length) {
+ headers.push([{
+ key: 'Access-Control-Allow-Headers',
+ value: allowedHeaders
+ }]);
+ }
+
+ return headers;
+ }
+
+ function configureExposedHeaders(options) {
+ var headers = options.exposedHeaders;
+ if (!headers) {
+ return null;
+ } else if (headers.join) {
+ headers = headers.join(','); // .headers is an array, so turn it into a string
+ }
+ if (headers && headers.length) {
+ return {
+ key: 'Access-Control-Expose-Headers',
+ value: headers
+ };
+ }
+ return null;
+ }
+
+ function configureMaxAge(options) {
+ var maxAge = (typeof options.maxAge === 'number' || options.maxAge) && options.maxAge.toString()
+ if (maxAge && maxAge.length) {
+ return {
+ key: 'Access-Control-Max-Age',
+ value: maxAge
+ };
+ }
+ return null;
+ }
+
+ function applyHeaders(headers, res) {
+ for (var i = 0, n = headers.length; i < n; i++) {
+ var header = headers[i];
+ if (header) {
+ if (Array.isArray(header)) {
+ applyHeaders(header, res);
+ } else if (header.key === 'Vary' && header.value) {
+ vary(res, header.value);
+ } else if (header.value) {
+ res.setHeader(header.key, header.value);
+ }
+ }
+ }
+ }
+
+ function cors(options, req, res, next) {
+ var headers = [],
+ method = req.method && req.method.toUpperCase && req.method.toUpperCase();
+
+ if (method === 'OPTIONS') {
+ // preflight
+ headers.push(configureOrigin(options, req));
+ headers.push(configureCredentials(options, req));
+ headers.push(configureMethods(options, req));
+ headers.push(configureAllowedHeaders(options, req));
+ headers.push(configureMaxAge(options, req));
+ headers.push(configureExposedHeaders(options, req));
+ applyHeaders(headers, res);
+
+ if (options.preflightContinue) {
+ next();
+ } else {
+ // Safari (and potentially other browsers) need content-length 0,
+ // for 204 or they just hang waiting for a body
+ res.statusCode = options.optionsSuccessStatus;
+ res.setHeader('Content-Length', '0');
+ res.end();
+ }
+ } else {
+ // actual response
+ headers.push(configureOrigin(options, req));
+ headers.push(configureCredentials(options, req));
+ headers.push(configureExposedHeaders(options, req));
+ applyHeaders(headers, res);
+ next();
+ }
+ }
+
+ function middlewareWrapper(o) {
+ // if options are static (either via defaults or custom options passed in), wrap in a function
+ var optionsCallback = null;
+ if (typeof o === 'function') {
+ optionsCallback = o;
+ } else {
+ optionsCallback = function (req, cb) {
+ cb(null, o);
+ };
+ }
+
+ return function corsMiddleware(req, res, next) {
+ optionsCallback(req, function (err, options) {
+ if (err) {
+ next(err);
+ } else {
+ var corsOptions = assign({}, defaults, options);
+ var originCallback = null;
+ if (corsOptions.origin && typeof corsOptions.origin === 'function') {
+ originCallback = corsOptions.origin;
+ } else if (corsOptions.origin) {
+ originCallback = function (origin, cb) {
+ cb(null, corsOptions.origin);
+ };
+ }
+
+ if (originCallback) {
+ originCallback(req.headers.origin, function (err2, origin) {
+ if (err2 || !origin) {
+ next(err2);
+ } else {
+ corsOptions.origin = origin;
+ cors(corsOptions, req, res, next);
+ }
+ });
+ } else {
+ next();
+ }
+ }
+ });
+ };
+ }
+
+ // can pass either an options hash, an options delegate, or nothing
+ module.exports = middlewareWrapper;
+
+}());
diff --git a/node_modules/cors/package.json b/node_modules/cors/package.json
new file mode 100644
index 0000000..ff37d98
--- /dev/null
+++ b/node_modules/cors/package.json
@@ -0,0 +1,41 @@
+{
+ "name": "cors",
+ "description": "Node.js CORS middleware",
+ "version": "2.8.5",
+ "author": "Troy Goode (https://github.com/troygoode/)",
+ "license": "MIT",
+ "keywords": [
+ "cors",
+ "express",
+ "connect",
+ "middleware"
+ ],
+ "repository": "expressjs/cors",
+ "main": "./lib/index.js",
+ "dependencies": {
+ "object-assign": "^4",
+ "vary": "^1"
+ },
+ "devDependencies": {
+ "after": "0.8.2",
+ "eslint": "2.13.1",
+ "express": "4.16.3",
+ "mocha": "5.2.0",
+ "nyc": "13.1.0",
+ "supertest": "3.3.0"
+ },
+ "files": [
+ "lib/index.js",
+ "CONTRIBUTING.md",
+ "HISTORY.md",
+ "LICENSE",
+ "README.md"
+ ],
+ "engines": {
+ "node": ">= 0.10"
+ },
+ "scripts": {
+ "test": "npm run lint && nyc --reporter=html --reporter=text mocha --require test/support/env",
+ "lint": "eslint lib test"
+ }
+}
diff --git a/node_modules/crypto/README.md b/node_modules/crypto/README.md
new file mode 100644
index 0000000..5437f14
--- /dev/null
+++ b/node_modules/crypto/README.md
@@ -0,0 +1,7 @@
+# Deprecated Package
+
+This package is no longer supported and has been deprecated. To avoid malicious use, npm is hanging on to the package name.
+
+It's now a built-in Node module. If you've depended on crypto, you should switch to the one that's built-in.
+
+Please contact support@npmjs.com if you have questions about this package.
diff --git a/node_modules/crypto/package.json b/node_modules/crypto/package.json
new file mode 100644
index 0000000..01aa4d3
--- /dev/null
+++ b/node_modules/crypto/package.json
@@ -0,0 +1,19 @@
+{
+ "name": "crypto",
+ "version": "1.0.1",
+ "description": "",
+ "main": "index.js",
+ "scripts": {
+ "test": "echo \"Error: no test specified\" && exit 1"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/npm/deprecate-holder.git"
+ },
+ "author": "",
+ "license": "ISC",
+ "bugs": {
+ "url": "https://github.com/npm/deprecate-holder/issues"
+ },
+ "homepage": "https://github.com/npm/deprecate-holder#readme"
+}
diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml
new file mode 100644
index 0000000..20a7068
--- /dev/null
+++ b/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc
new file mode 100644
index 0000000..8a37ae2
--- /dev/null
+++ b/node_modules/debug/.eslintrc
@@ -0,0 +1,11 @@
+{
+ "env": {
+ "browser": true,
+ "node": true
+ },
+ "rules": {
+ "no-console": 0,
+ "no-empty": [1, { "allowEmptyCatch": true }]
+ },
+ "extends": "eslint:recommended"
+}
diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore
new file mode 100644
index 0000000..5f60eec
--- /dev/null
+++ b/node_modules/debug/.npmignore
@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml
new file mode 100644
index 0000000..6c6090c
--- /dev/null
+++ b/node_modules/debug/.travis.yml
@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+ - "6"
+ - "5"
+ - "4"
+
+install:
+ - make node_modules
+
+script:
+ - make lint
+ - make test
+ - make coveralls
diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md
new file mode 100644
index 0000000..eadaa18
--- /dev/null
+++ b/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+ * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+ * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+ * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+ * Fix: Inline extend function in node implementation (#452, @dougwilson)
+ * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+
+ * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+ * Misc: clean up browser reference checks (#447, @thebigredgeek)
+ * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+ * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+ * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+ * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+ * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+ * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+ * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+ * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+ * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+ * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+ * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+ * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+ * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+ * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+ * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+ * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+ * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+ * Docs: fixed README typo (#391, @lurch)
+ * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+ * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+ * Fix: wrong reference in bower file (@thebigredgeek)
+ * Fix: webworker compatibility (@thebigredgeek)
+ * Fix: output formatting issue (#388, @kribblo)
+ * Fix: babel-loader compatibility (#383, @escwald)
+ * Misc: removed built asset from repo and publications (@thebigredgeek)
+ * Misc: moved source files to /src (#378, @yamikuronue)
+ * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+ * Test: coveralls integration (#378, @yamikuronue)
+ * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+ * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+ * Fix: custom log function (#379, @hsiliev)
+ * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+ * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+ * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+ * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+ * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+ * Fix: browser colors (#367, @tootallnate)
+ * Misc: travis ci integration (@thebigredgeek)
+ * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+ * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+ * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+ * Fix: revert "handle regex special characters" (@tootallnate)
+ * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+ * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+ * Improvement: allow colors in workers (#335, @botverse)
+ * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+ * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+ * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+ * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+ * Fix: be super-safe in index.js as well (@TooTallNate)
+ * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+ * Fix: Added electron compatibility (#324, @paulcbetts)
+ * Improvement: Added performance optimizations (@tootallnate)
+ * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+ * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+ * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+ * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+ * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+ * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+ * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+ * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+ * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+ * Readme: fix USE_COLORS to DEBUG_COLORS
+ * Readme: Doc fixes for format string sugar (#269, @mlucool)
+ * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+ * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+ * Readme: better docs for browser support (#224, @matthewmueller)
+ * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+ * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+ * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+ * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+ * package: update "ms" to v0.7.1 (#202, @dougwilson)
+ * README: add logging to file example (#193, @DanielOchoa)
+ * README: fixed a typo (#191, @amir-s)
+ * browser: expose `storage` (#190, @stephenmathieson)
+ * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE
new file mode 100644
index 0000000..658c933
--- /dev/null
+++ b/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile
new file mode 100644
index 0000000..584da8b
--- /dev/null
+++ b/node_modules/debug/Makefile
@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+ @NODE_ENV= $(PKG) install
+ @touch node_modules
+
+lint: .FORCE
+ eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+ istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+ mkdir -p dist
+
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > dist/debug.js
+
+ karma start --single-run
+ rimraf dist
+
+test: .FORCE
+ concurrently \
+ "make test-node" \
+ "make test-browser"
+
+coveralls:
+ cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md
new file mode 100644
index 0000000..f67be6b
--- /dev/null
+++ b/node_modules/debug/README.md
@@ -0,0 +1,312 @@
+# debug
+[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+ When running through Node.js, you can set a few environment variables that will
+ change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+ __Note:__ The environment variables beginning with `DEBUG_` end up being
+ converted into an Options object that gets used with `%o`/`%O` formatters.
+ See the Node.js documentation for
+ [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+ for the complete list.
+
+## Formatters
+
+
+ Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+ You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+ You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+ or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+ if you don't want to build it yourself.
+
+ Debug's enable state is currently persisted by `localStorage`.
+ Consider the situation shown below where you have `worker:a` and `worker:b`,
+ and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json
new file mode 100644
index 0000000..9de2641
--- /dev/null
+++ b/node_modules/debug/component.json
@@ -0,0 +1,19 @@
+{
+ "name": "debug",
+ "repo": "visionmedia/debug",
+ "description": "small debugging utility",
+ "version": "2.6.9",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "main": "src/browser.js",
+ "scripts": [
+ "src/browser.js",
+ "src/debug.js"
+ ],
+ "dependencies": {
+ "rauchg/ms.js": "0.7.1"
+ }
+}
diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js
new file mode 100644
index 0000000..103a82d
--- /dev/null
+++ b/node_modules/debug/karma.conf.js
@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+ config.set({
+
+ // base path that will be used to resolve all patterns (eg. files, exclude)
+ basePath: '',
+
+
+ // frameworks to use
+ // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+ frameworks: ['mocha', 'chai', 'sinon'],
+
+
+ // list of files / patterns to load in the browser
+ files: [
+ 'dist/debug.js',
+ 'test/*spec.js'
+ ],
+
+
+ // list of files to exclude
+ exclude: [
+ 'src/node.js'
+ ],
+
+
+ // preprocess matching files before serving them to the browser
+ // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+ preprocessors: {
+ },
+
+ // test results reporter to use
+ // possible values: 'dots', 'progress'
+ // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+ reporters: ['progress'],
+
+
+ // web server port
+ port: 9876,
+
+
+ // enable / disable colors in the output (reporters and logs)
+ colors: true,
+
+
+ // level of logging
+ // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+ logLevel: config.LOG_INFO,
+
+
+ // enable / disable watching file and executing tests whenever any file changes
+ autoWatch: true,
+
+
+ // start these browsers
+ // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+ browsers: ['PhantomJS'],
+
+
+ // Continuous Integration mode
+ // if true, Karma captures browsers, runs the tests and exits
+ singleRun: false,
+
+ // Concurrency level
+ // how many browser should be started simultaneous
+ concurrency: Infinity
+ })
+}
diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js
new file mode 100644
index 0000000..7fc36fe
--- /dev/null
+++ b/node_modules/debug/node.js
@@ -0,0 +1 @@
+module.exports = require('./src/node');
diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json
new file mode 100644
index 0000000..dc787ba
--- /dev/null
+++ b/node_modules/debug/package.json
@@ -0,0 +1,49 @@
+{
+ "name": "debug",
+ "version": "2.6.9",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/visionmedia/debug.git"
+ },
+ "description": "small debugging utility",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "author": "TJ Holowaychuk ",
+ "contributors": [
+ "Nathan Rajlich (http://n8.io)",
+ "Andrew Rhyne "
+ ],
+ "license": "MIT",
+ "dependencies": {
+ "ms": "2.0.0"
+ },
+ "devDependencies": {
+ "browserify": "9.0.3",
+ "chai": "^3.5.0",
+ "concurrently": "^3.1.0",
+ "coveralls": "^2.11.15",
+ "eslint": "^3.12.1",
+ "istanbul": "^0.4.5",
+ "karma": "^1.3.0",
+ "karma-chai": "^0.1.0",
+ "karma-mocha": "^1.3.0",
+ "karma-phantomjs-launcher": "^1.0.2",
+ "karma-sinon": "^1.0.5",
+ "mocha": "^3.2.0",
+ "mocha-lcov-reporter": "^1.2.0",
+ "rimraf": "^2.5.4",
+ "sinon": "^1.17.6",
+ "sinon-chai": "^2.8.0"
+ },
+ "main": "./src/index.js",
+ "browser": "./src/browser.js",
+ "component": {
+ "scripts": {
+ "debug/index.js": "browser.js",
+ "debug/debug.js": "debug.js"
+ }
+ }
+}
diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js
new file mode 100644
index 0000000..7106924
--- /dev/null
+++ b/node_modules/debug/src/browser.js
@@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+ && 'undefined' != typeof chrome.storage
+ ? chrome.storage.local
+ : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+ 'lightseagreen',
+ 'forestgreen',
+ 'goldenrod',
+ 'dodgerblue',
+ 'darkorchid',
+ 'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+ // NB: In an Electron preload script, document will be defined but not fully
+ // initialized. Since we know we're in Chrome, we'll just detect this case
+ // explicitly
+ if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+ return true;
+ }
+
+ // is webkit? http://stackoverflow.com/a/16459606/376773
+ // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+ return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+ // is firebug? http://stackoverflow.com/a/398120/376773
+ (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+ // is firefox >= v31?
+ // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+ // double check webkit in userAgent just in case we are in a worker
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+ try {
+ return JSON.stringify(v);
+ } catch (err) {
+ return '[UnexpectedJSONParseError]: ' + err.message;
+ }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var useColors = this.useColors;
+
+ args[0] = (useColors ? '%c' : '')
+ + this.namespace
+ + (useColors ? ' %c' : ' ')
+ + args[0]
+ + (useColors ? '%c ' : ' ')
+ + '+' + exports.humanize(this.diff);
+
+ if (!useColors) return;
+
+ var c = 'color: ' + this.color;
+ args.splice(1, 0, c, 'color: inherit')
+
+ // the final "%c" is somewhat tricky, because there could be other
+ // arguments passed either before or after the %c, so we need to
+ // figure out the correct index to insert the CSS into
+ var index = 0;
+ var lastC = 0;
+ args[0].replace(/%[a-zA-Z%]/g, function(match) {
+ if ('%%' === match) return;
+ index++;
+ if ('%c' === match) {
+ // we only are interested in the *last* %c
+ // (the user may have provided their own)
+ lastC = index;
+ }
+ });
+
+ args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+ // this hackery is required for IE8/9, where
+ // the `console.log` function doesn't have 'apply'
+ return 'object' === typeof console
+ && console.log
+ && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ try {
+ if (null == namespaces) {
+ exports.storage.removeItem('debug');
+ } else {
+ exports.storage.debug = namespaces;
+ }
+ } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ var r;
+ try {
+ r = exports.storage.debug;
+ } catch(e) {}
+
+ // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+ if (!r && typeof process !== 'undefined' && 'env' in process) {
+ r = process.env.DEBUG;
+ }
+
+ return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+ try {
+ return window.localStorage;
+ } catch (e) {}
+}
diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js
new file mode 100644
index 0000000..6a5e3fc
--- /dev/null
+++ b/node_modules/debug/src/debug.js
@@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+ var hash = 0, i;
+
+ for (i in namespace) {
+ hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
+ hash |= 0; // Convert to 32bit integer
+ }
+
+ return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+ function debug() {
+ // disabled?
+ if (!debug.enabled) return;
+
+ var self = debug;
+
+ // set `diff` timestamp
+ var curr = +new Date();
+ var ms = curr - (prevTime || curr);
+ self.diff = ms;
+ self.prev = prevTime;
+ self.curr = curr;
+ prevTime = curr;
+
+ // turn the `arguments` into a proper Array
+ var args = new Array(arguments.length);
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i];
+ }
+
+ args[0] = exports.coerce(args[0]);
+
+ if ('string' !== typeof args[0]) {
+ // anything else let's inspect with %O
+ args.unshift('%O');
+ }
+
+ // apply any `formatters` transformations
+ var index = 0;
+ args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+ // if we encounter an escaped % then don't increase the array index
+ if (match === '%%') return match;
+ index++;
+ var formatter = exports.formatters[format];
+ if ('function' === typeof formatter) {
+ var val = args[index];
+ match = formatter.call(self, val);
+
+ // now we need to remove `args[index]` since it's inlined in the `format`
+ args.splice(index, 1);
+ index--;
+ }
+ return match;
+ });
+
+ // apply env-specific formatting (colors, etc.)
+ exports.formatArgs.call(self, args);
+
+ var logFn = debug.log || exports.log || console.log.bind(console);
+ logFn.apply(self, args);
+ }
+
+ debug.namespace = namespace;
+ debug.enabled = exports.enabled(namespace);
+ debug.useColors = exports.useColors();
+ debug.color = selectColor(namespace);
+
+ // env-specific initialization logic for debug instances
+ if ('function' === typeof exports.init) {
+ exports.init(debug);
+ }
+
+ return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+ exports.save(namespaces);
+
+ exports.names = [];
+ exports.skips = [];
+
+ var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+ var len = split.length;
+
+ for (var i = 0; i < len; i++) {
+ if (!split[i]) continue; // ignore empty strings
+ namespaces = split[i].replace(/\*/g, '.*?');
+ if (namespaces[0] === '-') {
+ exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+ } else {
+ exports.names.push(new RegExp('^' + namespaces + '$'));
+ }
+ }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+ exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+ var i, len;
+ for (i = 0, len = exports.skips.length; i < len; i++) {
+ if (exports.skips[i].test(name)) {
+ return false;
+ }
+ }
+ for (i = 0, len = exports.names.length; i < len; i++) {
+ if (exports.names[i].test(name)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+ if (val instanceof Error) return val.stack || val.message;
+ return val;
+}
diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js
new file mode 100644
index 0000000..e12cf4d
--- /dev/null
+++ b/node_modules/debug/src/index.js
@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+ module.exports = require('./browser.js');
+} else {
+ module.exports = require('./node.js');
+}
diff --git a/node_modules/debug/src/inspector-log.js b/node_modules/debug/src/inspector-log.js
new file mode 100644
index 0000000..60ea6c0
--- /dev/null
+++ b/node_modules/debug/src/inspector-log.js
@@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+ const stdout = console._stdout;
+ console._stdout = nullStream;
+ console.log.apply(console, arguments);
+ console._stdout = stdout;
+}
diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js
new file mode 100644
index 0000000..b15109c
--- /dev/null
+++ b/node_modules/debug/src/node.js
@@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+ return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+ // camel-case
+ var prop = key
+ .substring(6)
+ .toLowerCase()
+ .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+ // coerce string value into JS value
+ var val = process.env[key];
+ if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+ else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+ else if (val === 'null') val = null;
+ else val = Number(val);
+
+ obj[prop] = val;
+ return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ * $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+ util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+ 2 === fd ? process.stderr :
+ createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+ return 'colors' in exports.inspectOpts
+ ? Boolean(exports.inspectOpts.colors)
+ : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts)
+ .split('\n').map(function(str) {
+ return str.trim()
+ }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var name = this.namespace;
+ var useColors = this.useColors;
+
+ if (useColors) {
+ var c = this.color;
+ var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+ args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+ args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+ } else {
+ args[0] = new Date().toUTCString()
+ + ' ' + name + ' ' + args[0];
+ }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+ return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ if (null == namespaces) {
+ // If you set a process.env field to null or undefined, it gets cast to the
+ // string 'null' or 'undefined'. Just delete instead.
+ delete process.env.DEBUG;
+ } else {
+ process.env.DEBUG = namespaces;
+ }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+ var stream;
+ var tty_wrap = process.binding('tty_wrap');
+
+ // Note stream._type is used for test-module-load-list.js
+
+ switch (tty_wrap.guessHandleType(fd)) {
+ case 'TTY':
+ stream = new tty.WriteStream(fd);
+ stream._type = 'tty';
+
+ // Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ case 'FILE':
+ var fs = require('fs');
+ stream = new fs.SyncWriteStream(fd, { autoClose: false });
+ stream._type = 'fs';
+ break;
+
+ case 'PIPE':
+ case 'TCP':
+ var net = require('net');
+ stream = new net.Socket({
+ fd: fd,
+ readable: false,
+ writable: true
+ });
+
+ // FIXME Should probably have an option in net.Socket to create a
+ // stream from an existing fd which is writable only. But for now
+ // we'll just add this hack and set the `readable` member to false.
+ // Test: ./node test/fixtures/echo.js < /etc/passwd
+ stream.readable = false;
+ stream.read = null;
+ stream._type = 'pipe';
+
+ // FIXME Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ default:
+ // Probably an error on in uv_guess_handle()
+ throw new Error('Implement me. Unknown stream file type!');
+ }
+
+ // For supporting legacy API we put the FD here.
+ stream.fd = fd;
+
+ stream._isStdio = true;
+
+ return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+ debug.inspectOpts = {};
+
+ var keys = Object.keys(exports.inspectOpts);
+ for (var i = 0; i < keys.length; i++) {
+ debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+ }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/node_modules/denque/CHANGELOG.md b/node_modules/denque/CHANGELOG.md
new file mode 100644
index 0000000..391a1f5
--- /dev/null
+++ b/node_modules/denque/CHANGELOG.md
@@ -0,0 +1,29 @@
+## 2.1.0
+
+ - fix: issue where `clear()` is still keeping references to the elements (#47)
+ - refactor: performance optimizations for growth and array copy (#43)
+ - refactor: performance optimizations for toArray and fromArray (#46)
+ - test: add additional benchmarks for queue growth and `toArray` (#45)
+
+## 2.0.1
+
+ - fix(types): incorrect return type on `size()`
+
+## 2.0.0
+
+ - fix!: `push` & `unshift` now accept `undefined` values to match behaviour of `Array` (fixes #25) (#35)
+ - This is only a **BREAKING** change if you are currently expecting `push(undefined)` and `unshift(undefined)` to do
+ nothing - the new behaviour now correctly adds undefined values to the queue.
+ - **Note**: behaviour of `push()` & `unshift()` (no arguments) remains unchanged (nothing gets added to the queue).
+ - **Note**: If you need to differentiate between `undefined` values in the queue and the return value of `pop()` then
+ check the queue `.length` before popping.
+ - fix: incorrect methods in types definition file
+
+## 1.5.1
+
+ - perf: minor performance tweak when growing queue size (#29)
+
+## 1.5.0
+
+ - feat: adds capacity option for circular buffers (#27)
+
diff --git a/node_modules/denque/LICENSE b/node_modules/denque/LICENSE
new file mode 100644
index 0000000..c9cde92
--- /dev/null
+++ b/node_modules/denque/LICENSE
@@ -0,0 +1,201 @@
+ Apache License
+ Version 2.0, January 2004
+ http://www.apache.org/licenses/
+
+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+ 1. Definitions.
+
+ "License" shall mean the terms and conditions for use, reproduction,
+ and distribution as defined by Sections 1 through 9 of this document.
+
+ "Licensor" shall mean the copyright owner or entity authorized by
+ the copyright owner that is granting the License.
+
+ "Legal Entity" shall mean the union of the acting entity and all
+ other entities that control, are controlled by, or are under common
+ control with that entity. For the purposes of this definition,
+ "control" means (i) the power, direct or indirect, to cause the
+ direction or management of such entity, whether by contract or
+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
+ outstanding shares, or (iii) beneficial ownership of such entity.
+
+ "You" (or "Your") shall mean an individual or Legal Entity
+ exercising permissions granted by this License.
+
+ "Source" form shall mean the preferred form for making modifications,
+ including but not limited to software source code, documentation
+ source, and configuration files.
+
+ "Object" form shall mean any form resulting from mechanical
+ transformation or translation of a Source form, including but
+ not limited to compiled object code, generated documentation,
+ and conversions to other media types.
+
+ "Work" shall mean the work of authorship, whether in Source or
+ Object form, made available under the License, as indicated by a
+ copyright notice that is included in or attached to the work
+ (an example is provided in the Appendix below).
+
+ "Derivative Works" shall mean any work, whether in Source or Object
+ form, that is based on (or derived from) the Work and for which the
+ editorial revisions, annotations, elaborations, or other modifications
+ represent, as a whole, an original work of authorship. For the purposes
+ of this License, Derivative Works shall not include works that remain
+ separable from, or merely link (or bind by name) to the interfaces of,
+ the Work and Derivative Works thereof.
+
+ "Contribution" shall mean any work of authorship, including
+ the original version of the Work and any modifications or additions
+ to that Work or Derivative Works thereof, that is intentionally
+ submitted to Licensor for inclusion in the Work by the copyright owner
+ or by an individual or Legal Entity authorized to submit on behalf of
+ the copyright owner. For the purposes of this definition, "submitted"
+ means any form of electronic, verbal, or written communication sent
+ to the Licensor or its representatives, including but not limited to
+ communication on electronic mailing lists, source code control systems,
+ and issue tracking systems that are managed by, or on behalf of, the
+ Licensor for the purpose of discussing and improving the Work, but
+ excluding communication that is conspicuously marked or otherwise
+ designated in writing by the copyright owner as "Not a Contribution."
+
+ "Contributor" shall mean Licensor and any individual or Legal Entity
+ on behalf of whom a Contribution has been received by Licensor and
+ subsequently incorporated within the Work.
+
+ 2. Grant of Copyright License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ copyright license to reproduce, prepare Derivative Works of,
+ publicly display, publicly perform, sublicense, and distribute the
+ Work and such Derivative Works in Source or Object form.
+
+ 3. Grant of Patent License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ (except as stated in this section) patent license to make, have made,
+ use, offer to sell, sell, import, and otherwise transfer the Work,
+ where such license applies only to those patent claims licensable
+ by such Contributor that are necessarily infringed by their
+ Contribution(s) alone or by combination of their Contribution(s)
+ with the Work to which such Contribution(s) was submitted. If You
+ institute patent litigation against any entity (including a
+ cross-claim or counterclaim in a lawsuit) alleging that the Work
+ or a Contribution incorporated within the Work constitutes direct
+ or contributory patent infringement, then any patent licenses
+ granted to You under this License for that Work shall terminate
+ as of the date such litigation is filed.
+
+ 4. Redistribution. You may reproduce and distribute copies of the
+ Work or Derivative Works thereof in any medium, with or without
+ modifications, and in Source or Object form, provided that You
+ meet the following conditions:
+
+ (a) You must give any other recipients of the Work or
+ Derivative Works a copy of this License; and
+
+ (b) You must cause any modified files to carry prominent notices
+ stating that You changed the files; and
+
+ (c) You must retain, in the Source form of any Derivative Works
+ that You distribute, all copyright, patent, trademark, and
+ attribution notices from the Source form of the Work,
+ excluding those notices that do not pertain to any part of
+ the Derivative Works; and
+
+ (d) If the Work includes a "NOTICE" text file as part of its
+ distribution, then any Derivative Works that You distribute must
+ include a readable copy of the attribution notices contained
+ within such NOTICE file, excluding those notices that do not
+ pertain to any part of the Derivative Works, in at least one
+ of the following places: within a NOTICE text file distributed
+ as part of the Derivative Works; within the Source form or
+ documentation, if provided along with the Derivative Works; or,
+ within a display generated by the Derivative Works, if and
+ wherever such third-party notices normally appear. The contents
+ of the NOTICE file are for informational purposes only and
+ do not modify the License. You may add Your own attribution
+ notices within Derivative Works that You distribute, alongside
+ or as an addendum to the NOTICE text from the Work, provided
+ that such additional attribution notices cannot be construed
+ as modifying the License.
+
+ You may add Your own copyright statement to Your modifications and
+ may provide additional or different license terms and conditions
+ for use, reproduction, or distribution of Your modifications, or
+ for any such Derivative Works as a whole, provided Your use,
+ reproduction, and distribution of the Work otherwise complies with
+ the conditions stated in this License.
+
+ 5. Submission of Contributions. Unless You explicitly state otherwise,
+ any Contribution intentionally submitted for inclusion in the Work
+ by You to the Licensor shall be under the terms and conditions of
+ this License, without any additional terms or conditions.
+ Notwithstanding the above, nothing herein shall supersede or modify
+ the terms of any separate license agreement you may have executed
+ with Licensor regarding such Contributions.
+
+ 6. Trademarks. This License does not grant permission to use the trade
+ names, trademarks, service marks, or product names of the Licensor,
+ except as required for reasonable and customary use in describing the
+ origin of the Work and reproducing the content of the NOTICE file.
+
+ 7. Disclaimer of Warranty. Unless required by applicable law or
+ agreed to in writing, Licensor provides the Work (and each
+ Contributor provides its Contributions) on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+ implied, including, without limitation, any warranties or conditions
+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+ PARTICULAR PURPOSE. You are solely responsible for determining the
+ appropriateness of using or redistributing the Work and assume any
+ risks associated with Your exercise of permissions under this License.
+
+ 8. Limitation of Liability. In no event and under no legal theory,
+ whether in tort (including negligence), contract, or otherwise,
+ unless required by applicable law (such as deliberate and grossly
+ negligent acts) or agreed to in writing, shall any Contributor be
+ liable to You for damages, including any direct, indirect, special,
+ incidental, or consequential damages of any character arising as a
+ result of this License or out of the use or inability to use the
+ Work (including but not limited to damages for loss of goodwill,
+ work stoppage, computer failure or malfunction, or any and all
+ other commercial damages or losses), even if such Contributor
+ has been advised of the possibility of such damages.
+
+ 9. Accepting Warranty or Additional Liability. While redistributing
+ the Work or Derivative Works thereof, You may choose to offer,
+ and charge a fee for, acceptance of support, warranty, indemnity,
+ or other liability obligations and/or rights consistent with this
+ License. However, in accepting such obligations, You may act only
+ on Your own behalf and on Your sole responsibility, not on behalf
+ of any other Contributor, and only if You agree to indemnify,
+ defend, and hold each Contributor harmless for any liability
+ incurred by, or claims asserted against, such Contributor by reason
+ of your accepting any such warranty or additional liability.
+
+ END OF TERMS AND CONDITIONS
+
+ APPENDIX: How to apply the Apache License to your work.
+
+ To apply the Apache License to your work, attach the following
+ boilerplate notice, with the fields enclosed by brackets "[]"
+ replaced with your own identifying information. (Don't include
+ the brackets!) The text should be enclosed in the appropriate
+ comment syntax for the file format. We also recommend that a
+ file or class name and description of purpose be included on the
+ same "printed page" as the copyright notice for easier
+ identification within third-party archives.
+
+ Copyright 2018-present Invertase Limited
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
diff --git a/node_modules/denque/README.md b/node_modules/denque/README.md
new file mode 100644
index 0000000..3c645d3
--- /dev/null
+++ b/node_modules/denque/README.md
@@ -0,0 +1,77 @@
+
+
Denque
+
+
+
+
+
+
+
+
+
+
+
+Denque is a well tested, extremely fast and lightweight [double-ended queue](http://en.wikipedia.org/wiki/Double-ended_queue)
+implementation with zero dependencies and includes TypeScript types.
+
+Double-ended queues can also be used as a:
+
+- [Stack](http://en.wikipedia.org/wiki/Stack_\(abstract_data_type\))
+- [Queue](http://en.wikipedia.org/wiki/Queue_\(data_structure\))
+
+This implementation is currently the fastest available, even faster than `double-ended-queue`, see the [benchmarks](https://docs.page/invertase/denque/benchmarks).
+
+Every queue operation is done at a constant `O(1)` - including random access from `.peekAt(index)`.
+
+**Works on all node versions >= v0.10**
+
+## Quick Start
+
+Install the package:
+
+```bash
+npm install denque
+```
+
+Create and consume a queue:
+
+```js
+const Denque = require("denque");
+
+const denque = new Denque([1,2,3,4]);
+denque.shift(); // 1
+denque.pop(); // 4
+```
+
+
+See the [API reference documentation](https://docs.page/invertase/denque/api) for more examples.
+
+---
+
+## Who's using it?
+
+- [Kafka Node.js client](https://www.npmjs.com/package/kafka-node)
+- [MariaDB Node.js client](https://www.npmjs.com/package/mariadb)
+- [MongoDB Node.js client](https://www.npmjs.com/package/mongodb)
+- [MySQL Node.js client](https://www.npmjs.com/package/mysql2)
+- [Redis Node.js clients](https://www.npmjs.com/package/redis)
+
+... and [many more](https://www.npmjs.com/browse/depended/denque).
+
+
+---
+
+## License
+
+- See [LICENSE](/LICENSE)
+
+---
+
+
+
+
+
+
+ Built and maintained by Invertase .
+
+
diff --git a/node_modules/denque/index.d.ts b/node_modules/denque/index.d.ts
new file mode 100644
index 0000000..e125dd4
--- /dev/null
+++ b/node_modules/denque/index.d.ts
@@ -0,0 +1,47 @@
+declare class Denque {
+ length: number;
+
+ constructor();
+
+ constructor(array: T[]);
+
+ constructor(array: T[], options: IDenqueOptions);
+
+ push(item: T): number;
+
+ unshift(item: T): number;
+
+ pop(): T | undefined;
+
+ shift(): T | undefined;
+
+ peekBack(): T | undefined;
+
+ peekFront(): T | undefined;
+
+ peekAt(index: number): T | undefined;
+
+ get(index: number): T | undefined;
+
+ remove(index: number, count: number): T[];
+
+ removeOne(index: number): T | undefined;
+
+ splice(index: number, count: number, ...item: T[]): T[] | undefined;
+
+ isEmpty(): boolean;
+
+ clear(): void;
+
+ size(): number;
+
+ toString(): string;
+
+ toArray(): T[];
+}
+
+interface IDenqueOptions {
+ capacity?: number
+}
+
+export = Denque;
diff --git a/node_modules/denque/index.js b/node_modules/denque/index.js
new file mode 100644
index 0000000..6b2e9d8
--- /dev/null
+++ b/node_modules/denque/index.js
@@ -0,0 +1,481 @@
+'use strict';
+
+/**
+ * Custom implementation of a double ended queue.
+ */
+function Denque(array, options) {
+ var options = options || {};
+ this._capacity = options.capacity;
+
+ this._head = 0;
+ this._tail = 0;
+
+ if (Array.isArray(array)) {
+ this._fromArray(array);
+ } else {
+ this._capacityMask = 0x3;
+ this._list = new Array(4);
+ }
+}
+
+/**
+ * --------------
+ * PUBLIC API
+ * -------------
+ */
+
+/**
+ * Returns the item at the specified index from the list.
+ * 0 is the first element, 1 is the second, and so on...
+ * Elements at negative values are that many from the end: -1 is one before the end
+ * (the last element), -2 is two before the end (one before last), etc.
+ * @param index
+ * @returns {*}
+ */
+Denque.prototype.peekAt = function peekAt(index) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ var len = this.size();
+ if (i >= len || i < -len) return undefined;
+ if (i < 0) i += len;
+ i = (this._head + i) & this._capacityMask;
+ return this._list[i];
+};
+
+/**
+ * Alias for peekAt()
+ * @param i
+ * @returns {*}
+ */
+Denque.prototype.get = function get(i) {
+ return this.peekAt(i);
+};
+
+/**
+ * Returns the first item in the list without removing it.
+ * @returns {*}
+ */
+Denque.prototype.peek = function peek() {
+ if (this._head === this._tail) return undefined;
+ return this._list[this._head];
+};
+
+/**
+ * Alias for peek()
+ * @returns {*}
+ */
+Denque.prototype.peekFront = function peekFront() {
+ return this.peek();
+};
+
+/**
+ * Returns the item that is at the back of the queue without removing it.
+ * Uses peekAt(-1)
+ */
+Denque.prototype.peekBack = function peekBack() {
+ return this.peekAt(-1);
+};
+
+/**
+ * Returns the current length of the queue
+ * @return {Number}
+ */
+Object.defineProperty(Denque.prototype, 'length', {
+ get: function length() {
+ return this.size();
+ }
+});
+
+/**
+ * Return the number of items on the list, or 0 if empty.
+ * @returns {number}
+ */
+Denque.prototype.size = function size() {
+ if (this._head === this._tail) return 0;
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Add an item at the beginning of the list.
+ * @param item
+ */
+Denque.prototype.unshift = function unshift(item) {
+ if (arguments.length === 0) return this.size();
+ var len = this._list.length;
+ this._head = (this._head - 1 + len) & this._capacityMask;
+ this._list[this._head] = item;
+ if (this._tail === this._head) this._growArray();
+ if (this._capacity && this.size() > this._capacity) this.pop();
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Remove and return the first item on the list,
+ * Returns undefined if the list is empty.
+ * @returns {*}
+ */
+Denque.prototype.shift = function shift() {
+ var head = this._head;
+ if (head === this._tail) return undefined;
+ var item = this._list[head];
+ this._list[head] = undefined;
+ this._head = (head + 1) & this._capacityMask;
+ if (head < 2 && this._tail > 10000 && this._tail <= this._list.length >>> 2) this._shrinkArray();
+ return item;
+};
+
+/**
+ * Add an item to the bottom of the list.
+ * @param item
+ */
+Denque.prototype.push = function push(item) {
+ if (arguments.length === 0) return this.size();
+ var tail = this._tail;
+ this._list[tail] = item;
+ this._tail = (tail + 1) & this._capacityMask;
+ if (this._tail === this._head) {
+ this._growArray();
+ }
+ if (this._capacity && this.size() > this._capacity) {
+ this.shift();
+ }
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Remove and return the last item on the list.
+ * Returns undefined if the list is empty.
+ * @returns {*}
+ */
+Denque.prototype.pop = function pop() {
+ var tail = this._tail;
+ if (tail === this._head) return undefined;
+ var len = this._list.length;
+ this._tail = (tail - 1 + len) & this._capacityMask;
+ var item = this._list[this._tail];
+ this._list[this._tail] = undefined;
+ if (this._head < 2 && tail > 10000 && tail <= len >>> 2) this._shrinkArray();
+ return item;
+};
+
+/**
+ * Remove and return the item at the specified index from the list.
+ * Returns undefined if the list is empty.
+ * @param index
+ * @returns {*}
+ */
+Denque.prototype.removeOne = function removeOne(index) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ if (this._head === this._tail) return void 0;
+ var size = this.size();
+ var len = this._list.length;
+ if (i >= size || i < -size) return void 0;
+ if (i < 0) i += size;
+ i = (this._head + i) & this._capacityMask;
+ var item = this._list[i];
+ var k;
+ if (index < size / 2) {
+ for (k = index; k > 0; k--) {
+ this._list[i] = this._list[i = (i - 1 + len) & this._capacityMask];
+ }
+ this._list[i] = void 0;
+ this._head = (this._head + 1 + len) & this._capacityMask;
+ } else {
+ for (k = size - 1 - index; k > 0; k--) {
+ this._list[i] = this._list[i = (i + 1 + len) & this._capacityMask];
+ }
+ this._list[i] = void 0;
+ this._tail = (this._tail - 1 + len) & this._capacityMask;
+ }
+ return item;
+};
+
+/**
+ * Remove number of items from the specified index from the list.
+ * Returns array of removed items.
+ * Returns undefined if the list is empty.
+ * @param index
+ * @param count
+ * @returns {array}
+ */
+Denque.prototype.remove = function remove(index, count) {
+ var i = index;
+ var removed;
+ var del_count = count;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ if (this._head === this._tail) return void 0;
+ var size = this.size();
+ var len = this._list.length;
+ if (i >= size || i < -size || count < 1) return void 0;
+ if (i < 0) i += size;
+ if (count === 1 || !count) {
+ removed = new Array(1);
+ removed[0] = this.removeOne(i);
+ return removed;
+ }
+ if (i === 0 && i + count >= size) {
+ removed = this.toArray();
+ this.clear();
+ return removed;
+ }
+ if (i + count > size) count = size - i;
+ var k;
+ removed = new Array(count);
+ for (k = 0; k < count; k++) {
+ removed[k] = this._list[(this._head + i + k) & this._capacityMask];
+ }
+ i = (this._head + i) & this._capacityMask;
+ if (index + count === size) {
+ this._tail = (this._tail - count + len) & this._capacityMask;
+ for (k = count; k > 0; k--) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ }
+ return removed;
+ }
+ if (index === 0) {
+ this._head = (this._head + count + len) & this._capacityMask;
+ for (k = count - 1; k > 0; k--) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ }
+ return removed;
+ }
+ if (i < size / 2) {
+ this._head = (this._head + index + count + len) & this._capacityMask;
+ for (k = index; k > 0; k--) {
+ this.unshift(this._list[i = (i - 1 + len) & this._capacityMask]);
+ }
+ i = (this._head - 1 + len) & this._capacityMask;
+ while (del_count > 0) {
+ this._list[i = (i - 1 + len) & this._capacityMask] = void 0;
+ del_count--;
+ }
+ if (index < 0) this._tail = i;
+ } else {
+ this._tail = i;
+ i = (i + count + len) & this._capacityMask;
+ for (k = size - (count + index); k > 0; k--) {
+ this.push(this._list[i++]);
+ }
+ i = this._tail;
+ while (del_count > 0) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ del_count--;
+ }
+ }
+ if (this._head < 2 && this._tail > 10000 && this._tail <= len >>> 2) this._shrinkArray();
+ return removed;
+};
+
+/**
+ * Native splice implementation.
+ * Remove number of items from the specified index from the list and/or add new elements.
+ * Returns array of removed items or empty array if count == 0.
+ * Returns undefined if the list is empty.
+ *
+ * @param index
+ * @param count
+ * @param {...*} [elements]
+ * @returns {array}
+ */
+Denque.prototype.splice = function splice(index, count) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ var size = this.size();
+ if (i < 0) i += size;
+ if (i > size) return void 0;
+ if (arguments.length > 2) {
+ var k;
+ var temp;
+ var removed;
+ var arg_len = arguments.length;
+ var len = this._list.length;
+ var arguments_index = 2;
+ if (!size || i < size / 2) {
+ temp = new Array(i);
+ for (k = 0; k < i; k++) {
+ temp[k] = this._list[(this._head + k) & this._capacityMask];
+ }
+ if (count === 0) {
+ removed = [];
+ if (i > 0) {
+ this._head = (this._head + i + len) & this._capacityMask;
+ }
+ } else {
+ removed = this.remove(i, count);
+ this._head = (this._head + i + len) & this._capacityMask;
+ }
+ while (arg_len > arguments_index) {
+ this.unshift(arguments[--arg_len]);
+ }
+ for (k = i; k > 0; k--) {
+ this.unshift(temp[k - 1]);
+ }
+ } else {
+ temp = new Array(size - (i + count));
+ var leng = temp.length;
+ for (k = 0; k < leng; k++) {
+ temp[k] = this._list[(this._head + i + count + k) & this._capacityMask];
+ }
+ if (count === 0) {
+ removed = [];
+ if (i != size) {
+ this._tail = (this._head + i + len) & this._capacityMask;
+ }
+ } else {
+ removed = this.remove(i, count);
+ this._tail = (this._tail - leng + len) & this._capacityMask;
+ }
+ while (arguments_index < arg_len) {
+ this.push(arguments[arguments_index++]);
+ }
+ for (k = 0; k < leng; k++) {
+ this.push(temp[k]);
+ }
+ }
+ return removed;
+ } else {
+ return this.remove(i, count);
+ }
+};
+
+/**
+ * Soft clear - does not reset capacity.
+ */
+Denque.prototype.clear = function clear() {
+ this._list = new Array(this._list.length);
+ this._head = 0;
+ this._tail = 0;
+};
+
+/**
+ * Returns true or false whether the list is empty.
+ * @returns {boolean}
+ */
+Denque.prototype.isEmpty = function isEmpty() {
+ return this._head === this._tail;
+};
+
+/**
+ * Returns an array of all queue items.
+ * @returns {Array}
+ */
+Denque.prototype.toArray = function toArray() {
+ return this._copyArray(false);
+};
+
+/**
+ * -------------
+ * INTERNALS
+ * -------------
+ */
+
+/**
+ * Fills the queue with items from an array
+ * For use in the constructor
+ * @param array
+ * @private
+ */
+Denque.prototype._fromArray = function _fromArray(array) {
+ var length = array.length;
+ var capacity = this._nextPowerOf2(length);
+
+ this._list = new Array(capacity);
+ this._capacityMask = capacity - 1;
+ this._tail = length;
+
+ for (var i = 0; i < length; i++) this._list[i] = array[i];
+};
+
+/**
+ *
+ * @param fullCopy
+ * @param size Initialize the array with a specific size. Will default to the current list size
+ * @returns {Array}
+ * @private
+ */
+Denque.prototype._copyArray = function _copyArray(fullCopy, size) {
+ var src = this._list;
+ var capacity = src.length;
+ var length = this.length;
+ size = size | length;
+
+ // No prealloc requested and the buffer is contiguous
+ if (size == length && this._head < this._tail) {
+ // Simply do a fast slice copy
+ return this._list.slice(this._head, this._tail);
+ }
+
+ var dest = new Array(size);
+
+ var k = 0;
+ var i;
+ if (fullCopy || this._head > this._tail) {
+ for (i = this._head; i < capacity; i++) dest[k++] = src[i];
+ for (i = 0; i < this._tail; i++) dest[k++] = src[i];
+ } else {
+ for (i = this._head; i < this._tail; i++) dest[k++] = src[i];
+ }
+
+ return dest;
+}
+
+/**
+ * Grows the internal list array.
+ * @private
+ */
+Denque.prototype._growArray = function _growArray() {
+ if (this._head != 0) {
+ // double array size and copy existing data, head to end, then beginning to tail.
+ var newList = this._copyArray(true, this._list.length << 1);
+
+ this._tail = this._list.length;
+ this._head = 0;
+
+ this._list = newList;
+ } else {
+ this._tail = this._list.length;
+ this._list.length <<= 1;
+ }
+
+ this._capacityMask = (this._capacityMask << 1) | 1;
+};
+
+/**
+ * Shrinks the internal list array.
+ * @private
+ */
+Denque.prototype._shrinkArray = function _shrinkArray() {
+ this._list.length >>>= 1;
+ this._capacityMask >>>= 1;
+};
+
+/**
+ * Find the next power of 2, at least 4
+ * @private
+ * @param {number} num
+ * @returns {number}
+ */
+Denque.prototype._nextPowerOf2 = function _nextPowerOf2(num) {
+ var log2 = Math.log(num) / Math.log(2);
+ var nextPow2 = 1 << (log2 + 1);
+
+ return Math.max(nextPow2, 4);
+}
+
+module.exports = Denque;
diff --git a/node_modules/denque/package.json b/node_modules/denque/package.json
new file mode 100644
index 0000000..a635910
--- /dev/null
+++ b/node_modules/denque/package.json
@@ -0,0 +1,58 @@
+{
+ "name": "denque",
+ "version": "2.1.0",
+ "description": "The fastest javascript implementation of a double-ended queue. Used by the official Redis, MongoDB, MariaDB & MySQL libraries for Node.js and many other libraries. Maintains compatability with deque.",
+ "main": "index.js",
+ "engines": {
+ "node": ">=0.10"
+ },
+ "keywords": [
+ "data-structure",
+ "data-structures",
+ "queue",
+ "double",
+ "end",
+ "ended",
+ "deque",
+ "denque",
+ "double-ended-queue"
+ ],
+ "scripts": {
+ "test": "istanbul cover --report lcov _mocha && npm run typescript",
+ "coveralls": "cat ./coverage/lcov.info | coveralls",
+ "typescript": "tsc --project ./test/type/tsconfig.json",
+ "benchmark_thousand": "node benchmark/thousand",
+ "benchmark_2mil": "node benchmark/two_million",
+ "benchmark_splice": "node benchmark/splice",
+ "benchmark_remove": "node benchmark/remove",
+ "benchmark_removeOne": "node benchmark/removeOne",
+ "benchmark_growth": "node benchmark/growth",
+ "benchmark_toArray": "node benchmark/toArray",
+ "benchmark_fromArray": "node benchmark/fromArray"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/invertase/denque.git"
+ },
+ "license": "Apache-2.0",
+ "author": {
+ "name": "Invertase",
+ "email": "oss@invertase.io",
+ "url": "http://github.com/invertase/"
+ },
+ "contributors": [
+ "Mike Diarmid (Salakar) "
+ ],
+ "bugs": {
+ "url": "https://github.com/invertase/denque/issues"
+ },
+ "homepage": "https://docs.page/invertase/denque",
+ "devDependencies": {
+ "benchmark": "^2.1.4",
+ "codecov": "^3.8.3",
+ "double-ended-queue": "^2.1.0-0",
+ "istanbul": "^0.4.5",
+ "mocha": "^3.5.3",
+ "typescript": "^3.4.1"
+ }
+}
diff --git a/node_modules/depd/History.md b/node_modules/depd/History.md
new file mode 100644
index 0000000..cd9ebaa
--- /dev/null
+++ b/node_modules/depd/History.md
@@ -0,0 +1,103 @@
+2.0.0 / 2018-10-26
+==================
+
+ * Drop support for Node.js 0.6
+ * Replace internal `eval` usage with `Function` constructor
+ * Use instance methods on `process` to check for listeners
+
+1.1.2 / 2018-01-11
+==================
+
+ * perf: remove argument reassignment
+ * Support Node.js 0.6 to 9.x
+
+1.1.1 / 2017-07-27
+==================
+
+ * Remove unnecessary `Buffer` loading
+ * Support Node.js 0.6 to 8.x
+
+1.1.0 / 2015-09-14
+==================
+
+ * Enable strict mode in more places
+ * Support io.js 3.x
+ * Support io.js 2.x
+ * Support web browser loading
+ - Requires bundler like Browserify or webpack
+
+1.0.1 / 2015-04-07
+==================
+
+ * Fix `TypeError`s when under `'use strict'` code
+ * Fix useless type name on auto-generated messages
+ * Support io.js 1.x
+ * Support Node.js 0.12
+
+1.0.0 / 2014-09-17
+==================
+
+ * No changes
+
+0.4.5 / 2014-09-09
+==================
+
+ * Improve call speed to functions using the function wrapper
+ * Support Node.js 0.6
+
+0.4.4 / 2014-07-27
+==================
+
+ * Work-around v8 generating empty stack traces
+
+0.4.3 / 2014-07-26
+==================
+
+ * Fix exception when global `Error.stackTraceLimit` is too low
+
+0.4.2 / 2014-07-19
+==================
+
+ * Correct call site for wrapped functions and properties
+
+0.4.1 / 2014-07-19
+==================
+
+ * Improve automatic message generation for function properties
+
+0.4.0 / 2014-07-19
+==================
+
+ * Add `TRACE_DEPRECATION` environment variable
+ * Remove non-standard grey color from color output
+ * Support `--no-deprecation` argument
+ * Support `--trace-deprecation` argument
+ * Support `deprecate.property(fn, prop, message)`
+
+0.3.0 / 2014-06-16
+==================
+
+ * Add `NO_DEPRECATION` environment variable
+
+0.2.0 / 2014-06-15
+==================
+
+ * Add `deprecate.property(obj, prop, message)`
+ * Remove `supports-color` dependency for node.js 0.8
+
+0.1.0 / 2014-06-15
+==================
+
+ * Add `deprecate.function(fn, message)`
+ * Add `process.on('deprecation', fn)` emitter
+ * Automatically generate message when omitted from `deprecate()`
+
+0.0.1 / 2014-06-15
+==================
+
+ * Fix warning for dynamic calls at singe call site
+
+0.0.0 / 2014-06-15
+==================
+
+ * Initial implementation
diff --git a/node_modules/depd/LICENSE b/node_modules/depd/LICENSE
new file mode 100644
index 0000000..248de7a
--- /dev/null
+++ b/node_modules/depd/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2018 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/depd/Readme.md b/node_modules/depd/Readme.md
new file mode 100644
index 0000000..043d1ca
--- /dev/null
+++ b/node_modules/depd/Readme.md
@@ -0,0 +1,280 @@
+# depd
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Linux Build][travis-image]][travis-url]
+[![Windows Build][appveyor-image]][appveyor-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Deprecate all the things
+
+> With great modules comes great responsibility; mark things deprecated!
+
+## Install
+
+This module is installed directly using `npm`:
+
+```sh
+$ npm install depd
+```
+
+This module can also be bundled with systems like
+[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/),
+though by default this module will alter it's API to no longer display or
+track deprecations.
+
+## API
+
+
+
+```js
+var deprecate = require('depd')('my-module')
+```
+
+This library allows you to display deprecation messages to your users.
+This library goes above and beyond with deprecation warnings by
+introspection of the call stack (but only the bits that it is interested
+in).
+
+Instead of just warning on the first invocation of a deprecated
+function and never again, this module will warn on the first invocation
+of a deprecated function per unique call site, making it ideal to alert
+users of all deprecated uses across the code base, rather than just
+whatever happens to execute first.
+
+The deprecation warnings from this module also include the file and line
+information for the call into the module that the deprecated function was
+in.
+
+**NOTE** this library has a similar interface to the `debug` module, and
+this module uses the calling file to get the boundary for the call stacks,
+so you should always create a new `deprecate` object in each file and not
+within some central file.
+
+### depd(namespace)
+
+Create a new deprecate function that uses the given namespace name in the
+messages and will display the call site prior to the stack entering the
+file this function was called from. It is highly suggested you use the
+name of your module as the namespace.
+
+### deprecate(message)
+
+Call this function from deprecated code to display a deprecation message.
+This message will appear once per unique caller site. Caller site is the
+first call site in the stack in a different file from the caller of this
+function.
+
+If the message is omitted, a message is generated for you based on the site
+of the `deprecate()` call and will display the name of the function called,
+similar to the name displayed in a stack trace.
+
+### deprecate.function(fn, message)
+
+Call this function to wrap a given function in a deprecation message on any
+call to the function. An optional message can be supplied to provide a custom
+message.
+
+### deprecate.property(obj, prop, message)
+
+Call this function to wrap a given property on object in a deprecation message
+on any accessing or setting of the property. An optional message can be supplied
+to provide a custom message.
+
+The method must be called on the object where the property belongs (not
+inherited from the prototype).
+
+If the property is a data descriptor, it will be converted to an accessor
+descriptor in order to display the deprecation message.
+
+### process.on('deprecation', fn)
+
+This module will allow easy capturing of deprecation errors by emitting the
+errors as the type "deprecation" on the global `process`. If there are no
+listeners for this type, the errors are written to STDERR as normal, but if
+there are any listeners, nothing will be written to STDERR and instead only
+emitted. From there, you can write the errors in a different format or to a
+logging source.
+
+The error represents the deprecation and is emitted only once with the same
+rules as writing to STDERR. The error has the following properties:
+
+ - `message` - This is the message given by the library
+ - `name` - This is always `'DeprecationError'`
+ - `namespace` - This is the namespace the deprecation came from
+ - `stack` - This is the stack of the call to the deprecated thing
+
+Example `error.stack` output:
+
+```
+DeprecationError: my-cool-module deprecated oldfunction
+ at Object. ([eval]-wrapper:6:22)
+ at Module._compile (module.js:456:26)
+ at evalScript (node.js:532:25)
+ at startup (node.js:80:7)
+ at node.js:902:3
+```
+
+### process.env.NO_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `NO_DEPRECATION`
+is provided as a quick solution to silencing deprecation warnings from being
+output. The format of this is similar to that of `DEBUG`:
+
+```sh
+$ NO_DEPRECATION=my-module,othermod node app.js
+```
+
+This will suppress deprecations from being output for "my-module" and "othermod".
+The value is a list of comma-separated namespaces. To suppress every warning
+across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--no-deprecation` to the `node` executable will suppress
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not suppress the deperecations given to any "deprecation"
+event listeners, just the output to STDERR.
+
+### process.env.TRACE_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION`
+is provided as a solution to getting more detailed location information in deprecation
+warnings by including the entire stack trace. The format of this is the same as
+`NO_DEPRECATION`:
+
+```sh
+$ TRACE_DEPRECATION=my-module,othermod node app.js
+```
+
+This will include stack traces for deprecations being output for "my-module" and
+"othermod". The value is a list of comma-separated namespaces. To trace every
+warning across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--trace-deprecation` to the `node` executable will trace
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`.
+
+## Display
+
+
+
+When a user calls a function in your library that you mark deprecated, they
+will see the following written to STDERR (in the given colors, similar colors
+and layout to the `debug` module):
+
+```
+bright cyan bright yellow
+| | reset cyan
+| | | |
+▼ ▼ ▼ ▼
+my-cool-module deprecated oldfunction [eval]-wrapper:6:22
+▲ ▲ ▲ ▲
+| | | |
+namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+If the user redirects their STDERR to a file or somewhere that does not support
+colors, they see (similar layout to the `debug` module):
+
+```
+Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22
+▲ ▲ ▲ ▲ ▲
+| | | | |
+timestamp of message namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+## Examples
+
+### Deprecating all calls to a function
+
+This will display a deprecated message about "oldfunction" being deprecated
+from "my-module" on STDERR.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+// message automatically derived from function name
+// Object.oldfunction
+exports.oldfunction = deprecate.function(function oldfunction () {
+ // all calls to function are deprecated
+})
+
+// specific message
+exports.oldfunction = deprecate.function(function () {
+ // all calls to function are deprecated
+}, 'oldfunction')
+```
+
+### Conditionally deprecating a function call
+
+This will display a deprecated message about "weirdfunction" being deprecated
+from "my-module" on STDERR when called with less than 2 arguments.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ }
+}
+```
+
+When calling `deprecate` as a function, the warning is counted per call site
+within your own module, so you can display different deprecations depending
+on different situations and the users will still get all the warnings:
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ } else if (typeof arguments[0] !== 'string') {
+ // calls with non-string first argument are deprecated
+ deprecate('weirdfunction non-string first arg')
+ }
+}
+```
+
+### Deprecating property access
+
+This will display a deprecated message about "oldprop" being deprecated
+from "my-module" on STDERR when accessed. A deprecation will be displayed
+when setting the value and when getting the value.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.oldprop = 'something'
+
+// message automatically derives from property name
+deprecate.property(exports, 'oldprop')
+
+// explicit message
+deprecate.property(exports, 'oldprop', 'oldprop >= 0.10')
+```
+
+## License
+
+[MIT](LICENSE)
+
+[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd
+[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master
+[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master
+[node-image]: https://badgen.net/npm/node/depd
+[node-url]: https://nodejs.org/en/download/
+[npm-downloads-image]: https://badgen.net/npm/dm/depd
+[npm-url]: https://npmjs.org/package/depd
+[npm-version-image]: https://badgen.net/npm/v/depd
+[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux
+[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd
diff --git a/node_modules/depd/index.js b/node_modules/depd/index.js
new file mode 100644
index 0000000..1bf2fcf
--- /dev/null
+++ b/node_modules/depd/index.js
@@ -0,0 +1,538 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2018 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var relative = require('path').relative
+
+/**
+ * Module exports.
+ */
+
+module.exports = depd
+
+/**
+ * Get the path to base files on.
+ */
+
+var basePath = process.cwd()
+
+/**
+ * Determine if namespace is contained in the string.
+ */
+
+function containsNamespace (str, namespace) {
+ var vals = str.split(/[ ,]+/)
+ var ns = String(namespace).toLowerCase()
+
+ for (var i = 0; i < vals.length; i++) {
+ var val = vals[i]
+
+ // namespace contained
+ if (val && (val === '*' || val.toLowerCase() === ns)) {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * Convert a data descriptor to accessor descriptor.
+ */
+
+function convertDataDescriptorToAccessor (obj, prop, message) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+ var value = descriptor.value
+
+ descriptor.get = function getter () { return value }
+
+ if (descriptor.writable) {
+ descriptor.set = function setter (val) { return (value = val) }
+ }
+
+ delete descriptor.value
+ delete descriptor.writable
+
+ Object.defineProperty(obj, prop, descriptor)
+
+ return descriptor
+}
+
+/**
+ * Create arguments string to keep arity.
+ */
+
+function createArgumentsString (arity) {
+ var str = ''
+
+ for (var i = 0; i < arity; i++) {
+ str += ', arg' + i
+ }
+
+ return str.substr(2)
+}
+
+/**
+ * Create stack string from stack.
+ */
+
+function createStackString (stack) {
+ var str = this.name + ': ' + this.namespace
+
+ if (this.message) {
+ str += ' deprecated ' + this.message
+ }
+
+ for (var i = 0; i < stack.length; i++) {
+ str += '\n at ' + stack[i].toString()
+ }
+
+ return str
+}
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+ var file = site[0]
+
+ function deprecate (message) {
+ // call to self as log
+ log.call(deprecate, message)
+ }
+
+ deprecate._file = file
+ deprecate._ignored = isignored(namespace)
+ deprecate._namespace = namespace
+ deprecate._traced = istraced(namespace)
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Determine if event emitter has listeners of a given type.
+ *
+ * The way to do this check is done three different ways in Node.js >= 0.8
+ * so this consolidates them into a minimal set using instance methods.
+ *
+ * @param {EventEmitter} emitter
+ * @param {string} type
+ * @returns {boolean}
+ * @private
+ */
+
+function eehaslisteners (emitter, type) {
+ var count = typeof emitter.listenerCount !== 'function'
+ ? emitter.listeners(type).length
+ : emitter.listenerCount(type)
+
+ return count > 0
+}
+
+/**
+ * Determine if namespace is ignored.
+ */
+
+function isignored (namespace) {
+ if (process.noDeprecation) {
+ // --no-deprecation support
+ return true
+ }
+
+ var str = process.env.NO_DEPRECATION || ''
+
+ // namespace ignored
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Determine if namespace is traced.
+ */
+
+function istraced (namespace) {
+ if (process.traceDeprecation) {
+ // --trace-deprecation support
+ return true
+ }
+
+ var str = process.env.TRACE_DEPRECATION || ''
+
+ // namespace traced
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Display deprecation message.
+ */
+
+function log (message, site) {
+ var haslisteners = eehaslisteners(process, 'deprecation')
+
+ // abort early if no destination
+ if (!haslisteners && this._ignored) {
+ return
+ }
+
+ var caller
+ var callFile
+ var callSite
+ var depSite
+ var i = 0
+ var seen = false
+ var stack = getStack()
+ var file = this._file
+
+ if (site) {
+ // provided site
+ depSite = site
+ callSite = callSiteLocation(stack[1])
+ callSite.name = depSite.name
+ file = callSite[0]
+ } else {
+ // get call site
+ i = 2
+ depSite = callSiteLocation(stack[i])
+ callSite = depSite
+ }
+
+ // get caller of deprecated thing in relation to file
+ for (; i < stack.length; i++) {
+ caller = callSiteLocation(stack[i])
+ callFile = caller[0]
+
+ if (callFile === file) {
+ seen = true
+ } else if (callFile === this._file) {
+ file = this._file
+ } else if (seen) {
+ break
+ }
+ }
+
+ var key = caller
+ ? depSite.join(':') + '__' + caller.join(':')
+ : undefined
+
+ if (key !== undefined && key in this._warned) {
+ // already warned
+ return
+ }
+
+ this._warned[key] = true
+
+ // generate automatic message from call site
+ var msg = message
+ if (!msg) {
+ msg = callSite === depSite || !callSite.name
+ ? defaultMessage(depSite)
+ : defaultMessage(callSite)
+ }
+
+ // emit deprecation if listeners exist
+ if (haslisteners) {
+ var err = DeprecationError(this._namespace, msg, stack.slice(i))
+ process.emit('deprecation', err)
+ return
+ }
+
+ // format and write message
+ var format = process.stderr.isTTY
+ ? formatColor
+ : formatPlain
+ var output = format.call(this, msg, caller, stack.slice(i))
+ process.stderr.write(output + '\n', 'utf8')
+}
+
+/**
+ * Get call site location as array.
+ */
+
+function callSiteLocation (callSite) {
+ var file = callSite.getFileName() || ''
+ var line = callSite.getLineNumber()
+ var colm = callSite.getColumnNumber()
+
+ if (callSite.isEval()) {
+ file = callSite.getEvalOrigin() + ', ' + file
+ }
+
+ var site = [file, line, colm]
+
+ site.callSite = callSite
+ site.name = callSite.getFunctionName()
+
+ return site
+}
+
+/**
+ * Generate a default message from the site.
+ */
+
+function defaultMessage (site) {
+ var callSite = site.callSite
+ var funcName = site.name
+
+ // make useful anonymous name
+ if (!funcName) {
+ funcName = ''
+ }
+
+ var context = callSite.getThis()
+ var typeName = context && callSite.getTypeName()
+
+ // ignore useless type name
+ if (typeName === 'Object') {
+ typeName = undefined
+ }
+
+ // make useful type name
+ if (typeName === 'Function') {
+ typeName = context.name || typeName
+ }
+
+ return typeName && callSite.getMethodName()
+ ? typeName + '.' + funcName
+ : funcName
+}
+
+/**
+ * Format deprecation message without color.
+ */
+
+function formatPlain (msg, caller, stack) {
+ var timestamp = new Date().toUTCString()
+
+ var formatted = timestamp +
+ ' ' + this._namespace +
+ ' deprecated ' + msg
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n at ' + stack[i].toString()
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' at ' + formatLocation(caller)
+ }
+
+ return formatted
+}
+
+/**
+ * Format deprecation message with color.
+ */
+
+function formatColor (msg, caller, stack) {
+ var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan
+ ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow
+ ' \x1b[0m' + msg + '\x1b[39m' // reset
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+}
+
+/**
+ * Format call site location.
+ */
+
+function formatLocation (callSite) {
+ return relative(basePath, callSite[0]) +
+ ':' + callSite[1] +
+ ':' + callSite[2]
+}
+
+/**
+ * Get the stack as array of call sites.
+ */
+
+function getStack () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = Math.max(10, limit)
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice this function off the top
+ var stack = obj.stack.slice(1)
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack
+}
+
+/**
+ * Capture call site stack from v8.
+ */
+
+function prepareObjectStackTrace (obj, stack) {
+ return stack
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ var args = createArgumentsString(fn.length)
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ site.name = fn.name
+
+ // eslint-disable-next-line no-new-func
+ var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site',
+ '"use strict"\n' +
+ 'return function (' + args + ') {' +
+ 'log.call(deprecate, message, site)\n' +
+ 'return fn.apply(this, arguments)\n' +
+ '}')(fn, log, this, message, site)
+
+ return deprecatedfn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ // set site name
+ site.name = prop
+
+ // convert data descriptor
+ if ('value' in descriptor) {
+ descriptor = convertDataDescriptorToAccessor(obj, prop, message)
+ }
+
+ var get = descriptor.get
+ var set = descriptor.set
+
+ // wrap getter
+ if (typeof get === 'function') {
+ descriptor.get = function getter () {
+ log.call(deprecate, message, site)
+ return get.apply(this, arguments)
+ }
+ }
+
+ // wrap setter
+ if (typeof set === 'function') {
+ descriptor.set = function setter () {
+ log.call(deprecate, message, site)
+ return set.apply(this, arguments)
+ }
+ }
+
+ Object.defineProperty(obj, prop, descriptor)
+}
+
+/**
+ * Create DeprecationError for deprecation
+ */
+
+function DeprecationError (namespace, message, stack) {
+ var error = new Error()
+ var stackString
+
+ Object.defineProperty(error, 'constructor', {
+ value: DeprecationError
+ })
+
+ Object.defineProperty(error, 'message', {
+ configurable: true,
+ enumerable: false,
+ value: message,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'name', {
+ enumerable: false,
+ configurable: true,
+ value: 'DeprecationError',
+ writable: true
+ })
+
+ Object.defineProperty(error, 'namespace', {
+ configurable: true,
+ enumerable: false,
+ value: namespace,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'stack', {
+ configurable: true,
+ enumerable: false,
+ get: function () {
+ if (stackString !== undefined) {
+ return stackString
+ }
+
+ // prepare stack trace
+ return (stackString = createStackString.call(this, stack))
+ },
+ set: function setter (val) {
+ stackString = val
+ }
+ })
+
+ return error
+}
diff --git a/node_modules/depd/lib/browser/index.js b/node_modules/depd/lib/browser/index.js
new file mode 100644
index 0000000..6be45cc
--- /dev/null
+++ b/node_modules/depd/lib/browser/index.js
@@ -0,0 +1,77 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = depd
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ function deprecate (message) {
+ // no-op in browser
+ }
+
+ deprecate._file = undefined
+ deprecate._ignored = true
+ deprecate._namespace = namespace
+ deprecate._traced = false
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ return fn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+}
diff --git a/node_modules/depd/package.json b/node_modules/depd/package.json
new file mode 100644
index 0000000..3857e19
--- /dev/null
+++ b/node_modules/depd/package.json
@@ -0,0 +1,45 @@
+{
+ "name": "depd",
+ "description": "Deprecate all the things",
+ "version": "2.0.0",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "deprecate",
+ "deprecated"
+ ],
+ "repository": "dougwilson/nodejs-depd",
+ "browser": "lib/browser/index.js",
+ "devDependencies": {
+ "benchmark": "2.1.4",
+ "beautify-benchmark": "0.2.4",
+ "eslint": "5.7.0",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.14.0",
+ "eslint-plugin-markdown": "1.0.0-beta.7",
+ "eslint-plugin-node": "7.0.1",
+ "eslint-plugin-promise": "4.0.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "5.2.0",
+ "safe-buffer": "5.1.2",
+ "uid-safe": "2.1.5"
+ },
+ "files": [
+ "lib/",
+ "History.md",
+ "LICENSE",
+ "index.js",
+ "Readme.md"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail test/",
+ "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary",
+ "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary"
+ }
+}
diff --git a/node_modules/destroy/LICENSE b/node_modules/destroy/LICENSE
new file mode 100644
index 0000000..0e2c35f
--- /dev/null
+++ b/node_modules/destroy/LICENSE
@@ -0,0 +1,23 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/destroy/README.md b/node_modules/destroy/README.md
new file mode 100644
index 0000000..e7701ae
--- /dev/null
+++ b/node_modules/destroy/README.md
@@ -0,0 +1,63 @@
+# destroy
+
+[![NPM version][npm-image]][npm-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+Destroy a stream.
+
+This module is meant to ensure a stream gets destroyed, handling different APIs
+and Node.js bugs.
+
+## API
+
+```js
+var destroy = require('destroy')
+```
+
+### destroy(stream [, suppress])
+
+Destroy the given stream, and optionally suppress any future `error` events.
+
+In most cases, this is identical to a simple `stream.destroy()` call. The rules
+are as follows for a given stream:
+
+ 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()`
+ and add a listener to the `open` event to call `stream.close()` if it is
+ fired. This is for a Node.js bug that will leak a file descriptor if
+ `.destroy()` is called before `open`.
+ 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()`
+ and close the underlying zlib handle if open, otherwise call `stream.close()`.
+ This is for consistency across Node.js versions and a Node.js bug that will
+ leak a native zlib handle.
+ 3. If the `stream` is not an instance of `Stream`, then nothing happens.
+ 4. If the `stream` has a `.destroy()` method, then call it.
+
+The function returns the `stream` passed in as the argument.
+
+## Example
+
+```js
+var destroy = require('destroy')
+
+var fs = require('fs')
+var stream = fs.createReadStream('package.json')
+
+// ... and later
+destroy(stream)
+```
+
+[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/destroy
+[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square
+[github-url]: https://github.com/stream-utils/destroy/tags
+[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master
+[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/destroy
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square
+[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml
diff --git a/node_modules/destroy/index.js b/node_modules/destroy/index.js
new file mode 100644
index 0000000..7fd5c09
--- /dev/null
+++ b/node_modules/destroy/index.js
@@ -0,0 +1,209 @@
+/*!
+ * destroy
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015-2022 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var EventEmitter = require('events').EventEmitter
+var ReadStream = require('fs').ReadStream
+var Stream = require('stream')
+var Zlib = require('zlib')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = destroy
+
+/**
+ * Destroy the given stream, and optionally suppress any future `error` events.
+ *
+ * @param {object} stream
+ * @param {boolean} suppress
+ * @public
+ */
+
+function destroy (stream, suppress) {
+ if (isFsReadStream(stream)) {
+ destroyReadStream(stream)
+ } else if (isZlibStream(stream)) {
+ destroyZlibStream(stream)
+ } else if (hasDestroy(stream)) {
+ stream.destroy()
+ }
+
+ if (isEventEmitter(stream) && suppress) {
+ stream.removeAllListeners('error')
+ stream.addListener('error', noop)
+ }
+
+ return stream
+}
+
+/**
+ * Destroy a ReadStream.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyReadStream (stream) {
+ stream.destroy()
+
+ if (typeof stream.close === 'function') {
+ // node.js core bug work-around
+ stream.on('open', onOpenClose)
+ }
+}
+
+/**
+ * Close a Zlib stream.
+ *
+ * Zlib streams below Node.js 4.5.5 have a buggy implementation
+ * of .close() when zlib encountered an error.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function closeZlibStream (stream) {
+ if (stream._hadError === true) {
+ var prop = stream._binding === null
+ ? '_binding'
+ : '_handle'
+
+ stream[prop] = {
+ close: function () { this[prop] = null }
+ }
+ }
+
+ stream.close()
+}
+
+/**
+ * Destroy a Zlib stream.
+ *
+ * Zlib streams don't have a destroy function in Node.js 6. On top of that
+ * simply calling destroy on a zlib stream in Node.js 8+ will result in a
+ * memory leak. So until that is fixed, we need to call both close AND destroy.
+ *
+ * PR to fix memory leak: https://github.com/nodejs/node/pull/23734
+ *
+ * In Node.js 6+8, it's important that destroy is called before close as the
+ * stream would otherwise emit the error 'zlib binding closed'.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyZlibStream (stream) {
+ if (typeof stream.destroy === 'function') {
+ // node.js core bug work-around
+ // istanbul ignore if: node.js 0.8
+ if (stream._binding) {
+ // node.js < 0.10.0
+ stream.destroy()
+ if (stream._processing) {
+ stream._needDrain = true
+ stream.once('drain', onDrainClearBinding)
+ } else {
+ stream._binding.clear()
+ }
+ } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) {
+ // node.js >= 12, ^11.1.0, ^10.15.1
+ stream.destroy()
+ } else if (stream._destroy && typeof stream.close === 'function') {
+ // node.js 7, 8
+ stream.destroyed = true
+ stream.close()
+ } else {
+ // fallback
+ // istanbul ignore next
+ stream.destroy()
+ }
+ } else if (typeof stream.close === 'function') {
+ // node.js < 8 fallback
+ closeZlibStream(stream)
+ }
+}
+
+/**
+ * Determine if stream has destroy.
+ * @private
+ */
+
+function hasDestroy (stream) {
+ return stream instanceof Stream &&
+ typeof stream.destroy === 'function'
+}
+
+/**
+ * Determine if val is EventEmitter.
+ * @private
+ */
+
+function isEventEmitter (val) {
+ return val instanceof EventEmitter
+}
+
+/**
+ * Determine if stream is fs.ReadStream stream.
+ * @private
+ */
+
+function isFsReadStream (stream) {
+ return stream instanceof ReadStream
+}
+
+/**
+ * Determine if stream is Zlib stream.
+ * @private
+ */
+
+function isZlibStream (stream) {
+ return stream instanceof Zlib.Gzip ||
+ stream instanceof Zlib.Gunzip ||
+ stream instanceof Zlib.Deflate ||
+ stream instanceof Zlib.DeflateRaw ||
+ stream instanceof Zlib.Inflate ||
+ stream instanceof Zlib.InflateRaw ||
+ stream instanceof Zlib.Unzip
+}
+
+/**
+ * No-op function.
+ * @private
+ */
+
+function noop () {}
+
+/**
+ * On drain handler to clear binding.
+ * @private
+ */
+
+// istanbul ignore next: node.js 0.8
+function onDrainClearBinding () {
+ this._binding.clear()
+}
+
+/**
+ * On open handler to close stream.
+ * @private
+ */
+
+function onOpenClose () {
+ if (typeof this.fd === 'number') {
+ // actually close down the fd
+ this.close()
+ }
+}
diff --git a/node_modules/destroy/package.json b/node_modules/destroy/package.json
new file mode 100644
index 0000000..c85e438
--- /dev/null
+++ b/node_modules/destroy/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "destroy",
+ "description": "destroy a stream if possible",
+ "version": "1.2.0",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com",
+ "twitter": "https://twitter.com/jongleberry"
+ },
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "repository": "stream-utils/destroy",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.2",
+ "nyc": "15.1.0"
+ },
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec",
+ "test-ci": "nyc --reporter=lcovonly --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "keywords": [
+ "stream",
+ "streams",
+ "destroy",
+ "cleanup",
+ "leak",
+ "fd"
+ ]
+}
diff --git a/node_modules/dotenv/CHANGELOG.md b/node_modules/dotenv/CHANGELOG.md
new file mode 100644
index 0000000..e3e40d6
--- /dev/null
+++ b/node_modules/dotenv/CHANGELOG.md
@@ -0,0 +1,488 @@
+# Changelog
+
+All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines.
+
+## [Unreleased](https://github.com/motdotla/dotenv/compare/v16.4.7...master)
+
+## [16.4.7](https://github.com/motdotla/dotenv/compare/v16.4.6...v16.4.7 (2024-12-03)
+
+### Changed
+
+- Ignore `.tap` folder when publishing. (oops, sorry about that everyone. - @motdotla) [#848](https://github.com/motdotla/dotenv/pull/848)
+
+## [16.4.6](https://github.com/motdotla/dotenv/compare/v16.4.5...v16.4.6) (2024-12-02)
+
+### Changed
+
+- Clean up stale dev dependencies [#847](https://github.com/motdotla/dotenv/pull/847)
+- Various README updates clarifying usage and alternative solutions using [dotenvx](https://github.com/dotenvx/dotenvx)
+
+## [16.4.5](https://github.com/motdotla/dotenv/compare/v16.4.4...v16.4.5) (2024-02-19)
+
+### Changed
+
+- 🐞 Fix recent regression when using `path` option. return to historical behavior: do not attempt to auto find `.env` if `path` set. (regression was introduced in `16.4.3`) [#814](https://github.com/motdotla/dotenv/pull/814)
+
+## [16.4.4](https://github.com/motdotla/dotenv/compare/v16.4.3...v16.4.4) (2024-02-13)
+
+### Changed
+
+- 🐞 Replaced chaining operator `?.` with old school `&&` (fixing node 12 failures) [#812](https://github.com/motdotla/dotenv/pull/812)
+
+## [16.4.3](https://github.com/motdotla/dotenv/compare/v16.4.2...v16.4.3) (2024-02-12)
+
+### Changed
+
+- Fixed processing of multiple files in `options.path` [#805](https://github.com/motdotla/dotenv/pull/805)
+
+## [16.4.2](https://github.com/motdotla/dotenv/compare/v16.4.1...v16.4.2) (2024-02-10)
+
+### Changed
+
+- Changed funding link in package.json to [`dotenvx.com`](https://dotenvx.com)
+
+## [16.4.1](https://github.com/motdotla/dotenv/compare/v16.4.0...v16.4.1) (2024-01-24)
+
+- Patch support for array as `path` option [#797](https://github.com/motdotla/dotenv/pull/797)
+
+## [16.4.0](https://github.com/motdotla/dotenv/compare/v16.3.2...v16.4.0) (2024-01-23)
+
+- Add `error.code` to error messages around `.env.vault` decryption handling [#795](https://github.com/motdotla/dotenv/pull/795)
+- Add ability to find `.env.vault` file when filename(s) passed as an array [#784](https://github.com/motdotla/dotenv/pull/784)
+
+## [16.3.2](https://github.com/motdotla/dotenv/compare/v16.3.1...v16.3.2) (2024-01-18)
+
+### Added
+
+- Add debug message when no encoding set [#735](https://github.com/motdotla/dotenv/pull/735)
+
+### Changed
+
+- Fix output typing for `populate` [#792](https://github.com/motdotla/dotenv/pull/792)
+- Use subarray instead of slice [#793](https://github.com/motdotla/dotenv/pull/793)
+
+## [16.3.1](https://github.com/motdotla/dotenv/compare/v16.3.0...v16.3.1) (2023-06-17)
+
+### Added
+
+- Add missing type definitions for `processEnv` and `DOTENV_KEY` options. [#756](https://github.com/motdotla/dotenv/pull/756)
+
+## [16.3.0](https://github.com/motdotla/dotenv/compare/v16.2.0...v16.3.0) (2023-06-16)
+
+### Added
+
+- Optionally pass `DOTENV_KEY` to options rather than relying on `process.env.DOTENV_KEY`. Defaults to `process.env.DOTENV_KEY` [#754](https://github.com/motdotla/dotenv/pull/754)
+
+## [16.2.0](https://github.com/motdotla/dotenv/compare/v16.1.4...v16.2.0) (2023-06-15)
+
+### Added
+
+- Optionally write to your own target object rather than `process.env`. Defaults to `process.env`. [#753](https://github.com/motdotla/dotenv/pull/753)
+- Add import type URL to types file [#751](https://github.com/motdotla/dotenv/pull/751)
+
+## [16.1.4](https://github.com/motdotla/dotenv/compare/v16.1.3...v16.1.4) (2023-06-04)
+
+### Added
+
+- Added `.github/` to `.npmignore` [#747](https://github.com/motdotla/dotenv/pull/747)
+
+## [16.1.3](https://github.com/motdotla/dotenv/compare/v16.1.2...v16.1.3) (2023-05-31)
+
+### Removed
+
+- Removed `browser` keys for `path`, `os`, and `crypto` in package.json. These were set to false incorrectly as of 16.1. Instead, if using dotenv on the front-end make sure to include polyfills for `path`, `os`, and `crypto`. [node-polyfill-webpack-plugin](https://github.com/Richienb/node-polyfill-webpack-plugin) provides these.
+
+## [16.1.2](https://github.com/motdotla/dotenv/compare/v16.1.1...v16.1.2) (2023-05-31)
+
+### Changed
+
+- Exposed private function `_configDotenv` as `configDotenv`. [#744](https://github.com/motdotla/dotenv/pull/744)
+
+## [16.1.1](https://github.com/motdotla/dotenv/compare/v16.1.0...v16.1.1) (2023-05-30)
+
+### Added
+
+- Added type definition for `decrypt` function
+
+### Changed
+
+- Fixed `{crypto: false}` in `packageJson.browser`
+
+## [16.1.0](https://github.com/motdotla/dotenv/compare/v16.0.3...v16.1.0) (2023-05-30)
+
+### Added
+
+- Add `populate` convenience method [#733](https://github.com/motdotla/dotenv/pull/733)
+- Accept URL as path option [#720](https://github.com/motdotla/dotenv/pull/720)
+- Add dotenv to `npm fund` command
+- Spanish language README [#698](https://github.com/motdotla/dotenv/pull/698)
+- Add `.env.vault` support. 🎉 ([#730](https://github.com/motdotla/dotenv/pull/730))
+
+ℹ️ `.env.vault` extends the `.env` file format standard with a localized encrypted vault file. Package it securely with your production code deploys. It's cloud agnostic so that you can deploy your secrets anywhere – without [risky third-party integrations](https://techcrunch.com/2023/01/05/circleci-breach/). [read more](https://github.com/motdotla/dotenv#-deploying)
+
+### Changed
+
+- Fixed "cannot resolve 'fs'" error on tools like Replit [#693](https://github.com/motdotla/dotenv/pull/693)
+
+## [16.0.3](https://github.com/motdotla/dotenv/compare/v16.0.2...v16.0.3) (2022-09-29)
+
+### Changed
+
+- Added library version to debug logs ([#682](https://github.com/motdotla/dotenv/pull/682))
+
+## [16.0.2](https://github.com/motdotla/dotenv/compare/v16.0.1...v16.0.2) (2022-08-30)
+
+### Added
+
+- Export `env-options.js` and `cli-options.js` in package.json for use with downstream [dotenv-expand](https://github.com/motdotla/dotenv-expand) module
+
+## [16.0.1](https://github.com/motdotla/dotenv/compare/v16.0.0...v16.0.1) (2022-05-10)
+
+### Changed
+
+- Minor README clarifications
+- Development ONLY: updated devDependencies as recommended for development only security risks ([#658](https://github.com/motdotla/dotenv/pull/658))
+
+## [16.0.0](https://github.com/motdotla/dotenv/compare/v15.0.1...v16.0.0) (2022-02-02)
+
+### Added
+
+- _Breaking:_ Backtick support 🎉 ([#615](https://github.com/motdotla/dotenv/pull/615))
+
+If you had values containing the backtick character, please quote those values with either single or double quotes.
+
+## [15.0.1](https://github.com/motdotla/dotenv/compare/v15.0.0...v15.0.1) (2022-02-02)
+
+### Changed
+
+- Properly parse empty single or double quoted values 🐞 ([#614](https://github.com/motdotla/dotenv/pull/614))
+
+## [15.0.0](https://github.com/motdotla/dotenv/compare/v14.3.2...v15.0.0) (2022-01-31)
+
+`v15.0.0` is a major new release with some important breaking changes.
+
+### Added
+
+- _Breaking:_ Multiline parsing support (just works. no need for the flag.)
+
+### Changed
+
+- _Breaking:_ `#` marks the beginning of a comment (UNLESS the value is wrapped in quotes. Please update your `.env` files to wrap in quotes any values containing `#`. For example: `SECRET_HASH="something-with-a-#-hash"`).
+
+..Understandably, (as some teams have noted) this is tedious to do across the entire team. To make it less tedious, we recommend using [dotenv cli](https://github.com/dotenv-org/cli) going forward. It's an optional plugin that will keep your `.env` files in sync between machines, environments, or team members.
+
+### Removed
+
+- _Breaking:_ Remove multiline option (just works out of the box now. no need for the flag.)
+
+## [14.3.2](https://github.com/motdotla/dotenv/compare/v14.3.1...v14.3.2) (2022-01-25)
+
+### Changed
+
+- Preserve backwards compatibility on values containing `#` 🐞 ([#603](https://github.com/motdotla/dotenv/pull/603))
+
+## [14.3.1](https://github.com/motdotla/dotenv/compare/v14.3.0...v14.3.1) (2022-01-25)
+
+### Changed
+
+- Preserve backwards compatibility on exports by re-introducing the prior in-place exports 🐞 ([#606](https://github.com/motdotla/dotenv/pull/606))
+
+## [14.3.0](https://github.com/motdotla/dotenv/compare/v14.2.0...v14.3.0) (2022-01-24)
+
+### Added
+
+- Add `multiline` option 🎉 ([#486](https://github.com/motdotla/dotenv/pull/486))
+
+## [14.2.0](https://github.com/motdotla/dotenv/compare/v14.1.1...v14.2.0) (2022-01-17)
+
+### Added
+
+- Add `dotenv_config_override` cli option
+- Add `DOTENV_CONFIG_OVERRIDE` command line env option
+
+## [14.1.1](https://github.com/motdotla/dotenv/compare/v14.1.0...v14.1.1) (2022-01-17)
+
+### Added
+
+- Add React gotcha to FAQ on README
+
+## [14.1.0](https://github.com/motdotla/dotenv/compare/v14.0.1...v14.1.0) (2022-01-17)
+
+### Added
+
+- Add `override` option 🎉 ([#595](https://github.com/motdotla/dotenv/pull/595))
+
+## [14.0.1](https://github.com/motdotla/dotenv/compare/v14.0.0...v14.0.1) (2022-01-16)
+
+### Added
+
+- Log error on failure to load `.env` file ([#594](https://github.com/motdotla/dotenv/pull/594))
+
+## [14.0.0](https://github.com/motdotla/dotenv/compare/v13.0.1...v14.0.0) (2022-01-16)
+
+### Added
+
+- _Breaking:_ Support inline comments for the parser 🎉 ([#568](https://github.com/motdotla/dotenv/pull/568))
+
+## [13.0.1](https://github.com/motdotla/dotenv/compare/v13.0.0...v13.0.1) (2022-01-16)
+
+### Changed
+
+* Hide comments and newlines from debug output ([#404](https://github.com/motdotla/dotenv/pull/404))
+
+## [13.0.0](https://github.com/motdotla/dotenv/compare/v12.0.4...v13.0.0) (2022-01-16)
+
+### Added
+
+* _Breaking:_ Add type file for `config.js` ([#539](https://github.com/motdotla/dotenv/pull/539))
+
+## [12.0.4](https://github.com/motdotla/dotenv/compare/v12.0.3...v12.0.4) (2022-01-16)
+
+### Changed
+
+* README updates
+* Minor order adjustment to package json format
+
+## [12.0.3](https://github.com/motdotla/dotenv/compare/v12.0.2...v12.0.3) (2022-01-15)
+
+### Changed
+
+* Simplified jsdoc for consistency across editors
+
+## [12.0.2](https://github.com/motdotla/dotenv/compare/v12.0.1...v12.0.2) (2022-01-15)
+
+### Changed
+
+* Improve embedded jsdoc type documentation
+
+## [12.0.1](https://github.com/motdotla/dotenv/compare/v12.0.0...v12.0.1) (2022-01-15)
+
+### Changed
+
+* README updates and clarifications
+
+## [12.0.0](https://github.com/motdotla/dotenv/compare/v11.0.0...v12.0.0) (2022-01-15)
+
+### Removed
+
+- _Breaking:_ drop support for Flow static type checker ([#584](https://github.com/motdotla/dotenv/pull/584))
+
+### Changed
+
+- Move types/index.d.ts to lib/main.d.ts ([#585](https://github.com/motdotla/dotenv/pull/585))
+- Typescript cleanup ([#587](https://github.com/motdotla/dotenv/pull/587))
+- Explicit typescript inclusion in package.json ([#566](https://github.com/motdotla/dotenv/pull/566))
+
+## [11.0.0](https://github.com/motdotla/dotenv/compare/v10.0.0...v11.0.0) (2022-01-11)
+
+### Changed
+
+- _Breaking:_ drop support for Node v10 ([#558](https://github.com/motdotla/dotenv/pull/558))
+- Patch debug option ([#550](https://github.com/motdotla/dotenv/pull/550))
+
+## [10.0.0](https://github.com/motdotla/dotenv/compare/v9.0.2...v10.0.0) (2021-05-20)
+
+### Added
+
+- Add generic support to parse function
+- Allow for import "dotenv/config.js"
+- Add support to resolve home directory in path via ~
+
+## [9.0.2](https://github.com/motdotla/dotenv/compare/v9.0.1...v9.0.2) (2021-05-10)
+
+### Changed
+
+- Support windows newlines with debug mode
+
+## [9.0.1](https://github.com/motdotla/dotenv/compare/v9.0.0...v9.0.1) (2021-05-08)
+
+### Changed
+
+- Updates to README
+
+## [9.0.0](https://github.com/motdotla/dotenv/compare/v8.6.0...v9.0.0) (2021-05-05)
+
+### Changed
+
+- _Breaking:_ drop support for Node v8
+
+## [8.6.0](https://github.com/motdotla/dotenv/compare/v8.5.1...v8.6.0) (2021-05-05)
+
+### Added
+
+- define package.json in exports
+
+## [8.5.1](https://github.com/motdotla/dotenv/compare/v8.5.0...v8.5.1) (2021-05-05)
+
+### Changed
+
+- updated dev dependencies via npm audit
+
+## [8.5.0](https://github.com/motdotla/dotenv/compare/v8.4.0...v8.5.0) (2021-05-05)
+
+### Added
+
+- allow for `import "dotenv/config"`
+
+## [8.4.0](https://github.com/motdotla/dotenv/compare/v8.3.0...v8.4.0) (2021-05-05)
+
+### Changed
+
+- point to exact types file to work with VS Code
+
+## [8.3.0](https://github.com/motdotla/dotenv/compare/v8.2.0...v8.3.0) (2021-05-05)
+
+### Changed
+
+- _Breaking:_ drop support for Node v8 (mistake to be released as minor bump. later bumped to 9.0.0. see above.)
+
+## [8.2.0](https://github.com/motdotla/dotenv/compare/v8.1.0...v8.2.0) (2019-10-16)
+
+### Added
+
+- TypeScript types
+
+## [8.1.0](https://github.com/motdotla/dotenv/compare/v8.0.0...v8.1.0) (2019-08-18)
+
+### Changed
+
+- _Breaking:_ drop support for Node v6 ([#392](https://github.com/motdotla/dotenv/issues/392))
+
+# [8.0.0](https://github.com/motdotla/dotenv/compare/v7.0.0...v8.0.0) (2019-05-02)
+
+### Changed
+
+- _Breaking:_ drop support for Node v6 ([#302](https://github.com/motdotla/dotenv/issues/392))
+
+## [7.0.0] - 2019-03-12
+
+### Fixed
+
+- Fix removing unbalanced quotes ([#376](https://github.com/motdotla/dotenv/pull/376))
+
+### Removed
+
+- Removed `load` alias for `config` for consistency throughout code and documentation.
+
+## [6.2.0] - 2018-12-03
+
+### Added
+
+- Support preload configuration via environment variables ([#351](https://github.com/motdotla/dotenv/issues/351))
+
+## [6.1.0] - 2018-10-08
+
+### Added
+
+- `debug` option for `config` and `parse` methods will turn on logging
+
+## [6.0.0] - 2018-06-02
+
+### Changed
+
+- _Breaking:_ drop support for Node v4 ([#304](https://github.com/motdotla/dotenv/pull/304))
+
+## [5.0.0] - 2018-01-29
+
+### Added
+
+- Testing against Node v8 and v9
+- Documentation on trim behavior of values
+- Documentation on how to use with `import`
+
+### Changed
+
+- _Breaking_: default `path` is now `path.resolve(process.cwd(), '.env')`
+- _Breaking_: does not write over keys already in `process.env` if the key has a falsy value
+- using `const` and `let` instead of `var`
+
+### Removed
+
+- Testing against Node v7
+
+## [4.0.0] - 2016-12-23
+
+### Changed
+
+- Return Object with parsed content or error instead of false ([#165](https://github.com/motdotla/dotenv/pull/165)).
+
+### Removed
+
+- `verbose` option removed in favor of returning result.
+
+## [3.0.0] - 2016-12-20
+
+### Added
+
+- `verbose` option will log any error messages. Off by default.
+- parses email addresses correctly
+- allow importing config method directly in ES6
+
+### Changed
+
+- Suppress error messages by default ([#154](https://github.com/motdotla/dotenv/pull/154))
+- Ignoring more files for NPM to make package download smaller
+
+### Fixed
+
+- False positive test due to case-sensitive variable ([#124](https://github.com/motdotla/dotenv/pull/124))
+
+### Removed
+
+- `silent` option removed in favor of `verbose`
+
+## [2.0.0] - 2016-01-20
+
+### Added
+
+- CHANGELOG to ["make it easier for users and contributors to see precisely what notable changes have been made between each release"](http://keepachangelog.com/). Linked to from README
+- LICENSE to be more explicit about what was defined in `package.json`. Linked to from README
+- Testing nodejs v4 on travis-ci
+- added examples of how to use dotenv in different ways
+- return parsed object on success rather than boolean true
+
+### Changed
+
+- README has shorter description not referencing ruby gem since we don't have or want feature parity
+
+### Removed
+
+- Variable expansion and escaping so environment variables are encouraged to be fully orthogonal
+
+## [1.2.0] - 2015-06-20
+
+### Added
+
+- Preload hook to require dotenv without including it in your code
+
+### Changed
+
+- clarified license to be "BSD-2-Clause" in `package.json`
+
+### Fixed
+
+- retain spaces in string vars
+
+## [1.1.0] - 2015-03-31
+
+### Added
+
+- Silent option to silence `console.log` when `.env` missing
+
+## [1.0.0] - 2015-03-13
+
+### Removed
+
+- support for multiple `.env` files. should always use one `.env` file for the current environment
+
+[7.0.0]: https://github.com/motdotla/dotenv/compare/v6.2.0...v7.0.0
+[6.2.0]: https://github.com/motdotla/dotenv/compare/v6.1.0...v6.2.0
+[6.1.0]: https://github.com/motdotla/dotenv/compare/v6.0.0...v6.1.0
+[6.0.0]: https://github.com/motdotla/dotenv/compare/v5.0.0...v6.0.0
+[5.0.0]: https://github.com/motdotla/dotenv/compare/v4.0.0...v5.0.0
+[4.0.0]: https://github.com/motdotla/dotenv/compare/v3.0.0...v4.0.0
+[3.0.0]: https://github.com/motdotla/dotenv/compare/v2.0.0...v3.0.0
+[2.0.0]: https://github.com/motdotla/dotenv/compare/v1.2.0...v2.0.0
+[1.2.0]: https://github.com/motdotla/dotenv/compare/v1.1.0...v1.2.0
+[1.1.0]: https://github.com/motdotla/dotenv/compare/v1.0.0...v1.1.0
+[1.0.0]: https://github.com/motdotla/dotenv/compare/v0.4.0...v1.0.0
diff --git a/node_modules/dotenv/LICENSE b/node_modules/dotenv/LICENSE
new file mode 100644
index 0000000..c430ad8
--- /dev/null
+++ b/node_modules/dotenv/LICENSE
@@ -0,0 +1,23 @@
+Copyright (c) 2015, Scott Motte
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+ list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+ this list of conditions and the following disclaimer in the documentation
+ and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/node_modules/dotenv/README-es.md b/node_modules/dotenv/README-es.md
new file mode 100644
index 0000000..154c139
--- /dev/null
+++ b/node_modules/dotenv/README-es.md
@@ -0,0 +1,448 @@
+
+🎉 announcing
dotenvx .
run anywhere, multi-environment, encrypted envs .
+
+
+
+
+
+
+
+
+ Dotenv es apoyado por la comunidad.
+
+
+
Gracias espaciales a:
+
+
+
+
+
+
+ Warp es una rápida e impresionante terminal basada en Rust, reinventado para funcionar como una aplicación moderna.
+
+ Haga más en la CLI con edición de texto real, resultado básado en bloques, y busqueda de comandos de IA.
+
+
+
+
+
+
+
+ Retool ayuda a los desarrolladores a crear software interno personalizado, como aplicaciones CRUD y paneles de administración, realmente rápido.
+
+ Construya Interfaces de Usuario de forma visual con componentes flexibles, conéctese a cualquier fuente de datos, y escriba lógica de negocio en JavaScript.
+
+
+
+
+
+
+
+ Su Apliación, Lista para la Empresa.
+
+ Agrega Inicio de Sesión Único, Autenticación Multi-Factor, y mucho más, en minutos en lugar de meses.
+
+
+
+
+
+
+
+
+
+
+# dotenv [](https://www.npmjs.com/package/dotenv)
+
+
+
+Dotenv es un módulo de dependencia cero que carga las variables de entorno desde un archivo `.env` en [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). El almacenamiento de la configuración del entorno separado del código está basado en la metodología [The Twelve-Factor App](http://12factor.net/config).
+
+[](https://github.com/feross/standard)
+[](LICENSE)
+
+## Instalación
+
+```bash
+# instalación local (recomendado)
+npm install dotenv --save
+```
+
+O installación con yarn? `yarn add dotenv`
+
+## Uso
+
+Cree un archivo `.env` en la raíz de su proyecto:
+
+```dosini
+S3_BUCKET="YOURS3BUCKET"
+SECRET_KEY="YOURSECRETKEYGOESHERE"
+```
+
+Tan prónto como sea posible en su aplicación, importe y configure dotenv:
+
+```javascript
+require('dotenv').config()
+console.log(process.env) // elimine esto después que haya confirmado que esta funcionando
+```
+
+.. o usa ES6?
+
+```javascript
+import * as dotenv from 'dotenv' // vea en https://github.com/motdotla/dotenv#como-uso-dotenv-con-import
+// REVISAR LINK DE REFERENCIA DE IMPORTACIÓN
+dotenv.config()
+import express from 'express'
+```
+
+Eso es todo. `process.env` ahora tiene las claves y los valores que definiste en tu archivo `.env`:
+
+```javascript
+require('dotenv').config()
+
+...
+
+s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {})
+```
+
+### Valores multilínea
+
+Si necesita variables de varias líneas, por ejemplo, claves privadas, ahora se admiten en la versión (`>= v15.0.0`) con saltos de línea:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----
+...
+Kh9NV...
+...
+-----END RSA PRIVATE KEY-----"
+```
+
+Alternativamente, puede usar comillas dobles y usar el carácter `\n`:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n"
+```
+
+### Comentarios
+
+Los comentarios pueden ser agregados en tu archivo o en la misma línea:
+
+```dosini
+# This is a comment
+SECRET_KEY=YOURSECRETKEYGOESHERE # comment
+SECRET_HASH="something-with-a-#-hash"
+```
+
+Los comentarios comienzan donde existe un `#`, entonces, si su valor contiene un `#`, enciérrelo entre comillas. Este es un cambio importante desde la versión `>= v15.0.0` en adelante.
+
+### Análisis
+
+El motor que analiza el contenido de su archivo que contiene variables de entorno está disponible para su uso. Este Acepta una Cadena o un Búfer y devolverá un Objeto con las claves y los valores analizados.
+
+```javascript
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASICO=basico')
+const config = dotenv.parse(buf) // devolverá un objeto
+console.log(typeof config, config) // objeto { BASICO : 'basico' }
+```
+
+### Precarga
+
+Puede usar el `--require` (`-r`) [opción de línea de comando](https://nodejs.org/api/cli.html#-r---require-module) para precargar dotenv. Al hacer esto, no necesita requerir ni cargar dotnev en el código de su aplicación.
+
+```bash
+$ node -r dotenv/config tu_script.js
+```
+
+Las opciones de configuración a continuación se admiten como argumentos de línea de comandos en el formato `dotenv_config_=value`
+
+```bash
+$ node -r dotenv/config tu_script.js dotenv_config_path=/custom/path/to/.env dotenv_config_debug=true
+```
+
+Además, puede usar variables de entorno para establecer opciones de configuración. Los argumentos de línea de comandos precederán a estos.
+
+```bash
+$ DOTENV_CONFIG_ =value node -r dotenv/config tu_script.js
+```
+
+```bash
+$ DOTENV_CONFIG_ENCODING=latin1 DOTENV_CONFIG_DEBUG=true node -r dotenv/config tu_script.js dotenv_config_path=/custom/path/to/.env
+```
+
+### Expansión Variable
+
+Necesitaras agregar el valor de otro variable en una de sus variables? Usa [dotenv-expand](https://github.com/motdotla/dotenv-expand).
+
+### Sincronizando
+
+Necesitas mentener sincronizados los archivos `.env` entre maquinas, entornos, o miembros del equipo? Usa
+[dotenv-vault](https://github.com/dotenv-org/dotenv-vault).
+
+## Ejemplos
+
+Vea [ejemplos](https://github.com/dotenv-org/examples) sobre el uso de dotenv con varios frameworks, lenguajes y configuraciones.
+
+* [nodejs](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs)
+* [nodejs (depurar en)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-debug)
+* [nodejs (anular en)](https://github.com/dotenv-org/examples/tree/master/dotenv-nodejs-override)
+* [esm](https://github.com/dotenv-org/examples/tree/master/dotenv-esm)
+* [esm (precarga)](https://github.com/dotenv-org/examples/tree/master/dotenv-esm-preload)
+* [typescript](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript)
+* [typescript parse](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-parse)
+* [typescript config](https://github.com/dotenv-org/examples/tree/master/dotenv-typescript-config)
+* [webpack](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack)
+* [webpack (plugin)](https://github.com/dotenv-org/examples/tree/master/dotenv-webpack2)
+* [react](https://github.com/dotenv-org/examples/tree/master/dotenv-react)
+* [react (typescript)](https://github.com/dotenv-org/examples/tree/master/dotenv-react-typescript)
+* [express](https://github.com/dotenv-org/examples/tree/master/dotenv-express)
+* [nestjs](https://github.com/dotenv-org/examples/tree/master/dotenv-nestjs)
+
+## Documentación
+
+Dotenv expone dos funciones:
+
+* `configuración`
+* `analizar`
+
+### Configuración
+
+`Configuración` leerá su archivo `.env`, analizará el contenido, lo asignará a [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env),
+y devolverá un Objeto con una clave `parsed` que contiene el contenido cargado o una clave `error` si falla.
+
+```js
+const result = dotenv.config()
+
+if (result.error) {
+ throw result.error
+}
+
+console.log(result.parsed)
+```
+
+Adicionalmente, puede pasar opciones a `configuracion`.
+
+#### Opciones
+
+##### Ruta
+
+Por defecto: `path.resolve(process.cwd(), '.env')`
+
+Especifique una ruta personalizada si el archivo que contiene las variables de entorno se encuentra localizado en otro lugar.
+
+```js
+require('dotenv').config({ path: '/personalizado/ruta/a/.env' })
+```
+
+##### Codificación
+
+Por defecto: `utf8`
+
+Especifique la codificación del archivo que contiene las variables de entorno.
+
+```js
+require('dotenv').config({ encoding: 'latin1' })
+```
+
+##### Depurar
+
+Por defecto: `false`
+
+Active el registro de ayuda para depurar por qué ciertas claves o valores no se inician como lo esperabas.
+
+```js
+require('dotenv').config({ debug: process.env.DEBUG })
+```
+
+##### Anular
+
+Por defecto: `false`
+
+Anule cualquier variable de entorno que ya se haya configurada en su maquina con los valores de su archivo .env.
+
+```js
+require('dotenv').config({ override: true })
+```
+
+### Analizar
+
+El motor que analiza el contenido del archivo que contiene las variables de entorno está disponible para su uso. Acepta una Cadena o un Búfer y retornará un objecto con los valores analizados.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASICO=basico')
+const config = dotenv.parse(buf) // devolverá un objeto
+console.log(typeof config, config) // objeto { BASICO : 'basico' }
+```
+
+#### Opciones
+
+##### Depurar
+
+Por defecto: `false`
+
+Active el registro de ayuda para depurar por qué ciertas claves o valores no se inician como lo esperabas.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('hola mundo')
+const opt = { debug: true }
+const config = dotenv.parse(buf, opt)
+// espere por un mensaje de depuración porque el búfer no esta listo KEY=VAL
+```
+
+## FAQ
+
+### ¿Por qué el archivo `.env` no carga mis variables de entorno correctamente?
+
+Lo más probable es que su archivo `.env` no esté en el lugar correcto. [Vea este stack overflow](https://stackoverflow.com/questions/42335016/dotenv-file-is-not-loading-environment-variables).
+
+Active el modo de depuración y vuelva a intentarlo...
+
+```js
+require('dotenv').config({ debug: true })
+```
+
+Recibirá un error apropiado en su consola.
+
+### ¿Debo confirmar mi archivo `.env`?
+
+No. Recomendamos **enfáticamente** no enviar su archivo `.env` a la versión de control. Solo debe incluir los valores especificos del entorno, como la base de datos, contraseñas o claves API.
+
+### ¿Debería tener multiples archivos `.env`?
+
+No. Recomendamos **enfáticamente** no tener un archivo `.env` "principal" y un archivo `.env` de "entorno" como `.env.test`. Su configuración debe variar entre implementaciones y no debe compartir valores entre entornos.
+
+> En una Aplicación de Doce Factores, las variables de entorno son controles diferenciados, cada uno totalmente independiente a otras variables de entorno. Nunca se agrupan como "entornos", sino que se gestionan de manera independiente para cada despliegue. Este es un modelo que se escala sin problemas a medida que la aplicación se expande de forma natural en más despliegues a lo largo de su vida.
+>
+> – [La Apliación de los Doce Factores](https://12factor.net/es/)
+
+### ¿Qué reglas sigue el motor de análisis?
+
+El motor de análisis actualmente admite las siguientes reglas:
+
+- `BASICO=basico` se convierte en `{BASICO: 'basico'}`
+- las líneas vacías se saltan
+- las líneas que comienzan con `#` se tratan como comentarios
+- `#` marca el comienzo de un comentario (a menos que el valor esté entre comillas)
+- valores vacíos se convierten en cadenas vacías (`VACIO=` se convierte en `{VACIO: ''}`)
+- las comillas internas se mantienen (piensa en JSON) (`JSON={"foo": "bar"}` se convierte en `{JSON:"{\"foo\": \"bar\"}"`)
+- los espacios en blanco se eliminan de ambos extremos de los valores no citanos (aprende más en [`trim`](https://developer.mozilla.org/es/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)) (`FOO= algo ` se convierte en `{FOO: 'algo'}`)
+- los valores entre comillas simples y dobles se escapan (`CITA_SIMPLE='citado'` se convierte en `{CITA_SIMPLE: "citado"}`)
+- los valores entre comillas simples y dobles mantienen los espacios en blanco en ambos extremos (`FOO=" algo "` se convierte en `{FOO: ' algo '}`)
+- los valores entre comillas dobles expanden nuevas líneas (`MULTILINEA="nueva\nlínea"` se convierte en
+
+```
+{MULTILINEA: 'nueva
+línea'}
+```
+
+- se admite la comilla simple invertida (`` SIGNO_ACENTO=`Esto tiene comillas 'simples' y "dobles" en su interior.` ``)
+
+### ¿Qué sucede con las variables de entorno que ya estaban configuradas?
+
+Por defecto, nunca modificaremos ninguna variable de entorno que ya haya sido establecida. En particular, si hay una variable en su archivo `.env` que colisiona con una que ya existe en su entorno, entonces esa variable se omitirá.
+
+Si por el contrario, quieres anular `process.env` utiliza la opción `override`.
+
+```javascript
+require('dotenv').config({ override: true })
+```
+
+### ¿Por qué mis variables de entorno no aparecen para React?
+
+Su código React se ejecuta en Webpack, donde el módulo `fs` o incluso el propio `process` global no son accesibles fuera-de-la-caja. El módulo `process.env` sólo puede ser inyectado a través de la configuración de Webpack.
+
+Si estás usando [`react-scripts`](https://www.npmjs.com/package/react-scripts), el cual se distribuye a través de [`create-react-app`](https://create-react-app.dev/), tiene dotenv incorporado pero con una singularidad. Escriba sus variables de entorno con `REACT_APP_`. Vea [este stack overflow](https://stackoverflow.com/questions/42182577/is-it-possible-to-use-dotenv-in-a-react-project) para más detalles.
+
+Si estás utilizando otros frameworks (por ejemplo, Next.js, Gatsby...), debes consultar su documentación para saber cómo injectar variables de entorno en el cliente.
+
+### ¿Puedo personalizar/escribir plugins para dotenv?
+
+Sí! `dotenv.config()` devuelve un objeto que representa el archivo `.env` analizado. Esto te da todo lo que necesitas para poder establecer valores en `process.env`. Por ejemplo:
+
+```js
+const dotenv = require('dotenv')
+const variableExpansion = require('dotenv-expand')
+const miEnv = dotenv.config()
+variableExpansion(miEnv)
+```
+
+### Cómo uso dotnev con `import`?
+
+Simplemente..
+
+```javascript
+// index.mjs (ESM)
+import * as dotenv from 'dotenv' // vea https://github.com/motdotla/dotenv#como-uso-dotenv-con-import
+dotenv.config()
+import express from 'express'
+```
+
+Un poco de historia...
+
+> Cuando se ejecuta un módulo que contiene una sentencia `import`, los módulos que importa serán cargados primero, y luego se ejecuta cada bloque del módulo en un recorrido en profundidad del gráfico de dependencias, evitando los ciclos al saltarse todo lo que ya se ha ejecutado.
+>
+> – [ES6 en Profundidad: Módulos](https://hacks.mozilla.org/2015/08/es6-in-depth-modules/)
+
+¿Qué significa esto en lenguaje sencillo? Significa que se podrías pensar que lo siguiente funcionaría pero no lo hará.
+
+```js
+// notificarError.mjs
+import { Cliente } from 'mejor-servicio-para-notificar-error'
+
+export default new Client(process.env.CLAVE_API)
+
+// index.mjs
+import dotenv from 'dotenv'
+dotenv.config()
+
+import notificarError from './notificarError.mjs'
+notificarError.report(new Error('ejemplo documentado'))
+```
+
+`process.env.CLAVE_API` será vacio.
+
+En su lugar, el código anterior debe ser escrito como...
+
+```js
+// notificarError.mjs
+import { Cliente } from 'mejor-servicio-para-notificar-errores'
+
+export default new Client(process.env.CLAVE_API)
+
+// index.mjs
+import * as dotenv from 'dotenv'
+dotenv.config()
+
+import notificarError from './notificarError.mjs'
+notificarError.report(new Error('ejemplo documentado'))
+```
+
+¿Esto tiene algo de sentido? Esto es poco poco intuitivo, pero es como funciona la importación de módulos en ES6. Aquí hay un ejemplo [ejemplo práctico de esta trampa](https://github.com/dotenv-org/examples/tree/master/dotenv-es6-import-pitfall).
+
+Existen dos arternativas a este planteamiento:
+
+1. Precarga dotenv: `node --require dotenv/config index.js` (_Nota: no es necesario usar `import` dotenv con este método_)
+2. Cree un archivo separado que ejecutará `config` primero como se describe en [este comentario #133](https://github.com/motdotla/dotenv/issues/133#issuecomment-255298822)
+
+### ¿Qué pasa con la expansión de variable?
+
+Prueba [dotenv-expand](https://github.com/motdotla/dotenv-expand)
+
+### ¿Qué pasa con la sincronización y la seguridad de los archivos .env?
+
+Vea [dotenv-vault](https://github.com/dotenv-org/dotenv-vault)
+
+## Guía de contribución
+
+Vea [CONTRIBUTING.md](CONTRIBUTING.md)
+
+## REGISTRO DE CAMBIOS
+
+Vea [CHANGELOG.md](CHANGELOG.md)
+
+## ¿Quiénes utilizan dotenv?
+
+[Estos módulos npm dependen de él.](https://www.npmjs.com/browse/depended/dotenv)
+
+Los proyectos que lo amplían suelen utilizar la [palabra clave "dotenv" en npm](https://www.npmjs.com/search?q=keywords:dotenv).
diff --git a/node_modules/dotenv/README.md b/node_modules/dotenv/README.md
new file mode 100644
index 0000000..3bd511c
--- /dev/null
+++ b/node_modules/dotenv/README.md
@@ -0,0 +1,651 @@
+
+🎉 announcing
dotenvx .
run anywhere, multi-environment, encrypted envs .
+
+
+
+
+
+
+# dotenv [](https://www.npmjs.com/package/dotenv)
+
+
+
+Dotenv is a zero-dependency module that loads environment variables from a `.env` file into [`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env). Storing configuration in the environment separate from code is based on [The Twelve-Factor App](https://12factor.net/config) methodology.
+
+[](https://github.com/feross/standard)
+[](LICENSE)
+[](https://codecov.io/gh/motdotla/dotenv-expand)
+
+* [🌱 Install](#-install)
+* [🏗️ Usage (.env)](#%EF%B8%8F-usage)
+* [🌴 Multiple Environments 🆕](#-manage-multiple-environments)
+* [🚀 Deploying (encryption) 🆕](#-deploying)
+* [📚 Examples](#-examples)
+* [📖 Docs](#-documentation)
+* [❓ FAQ](#-faq)
+* [⏱️ Changelog](./CHANGELOG.md)
+
+## 🌱 Install
+
+```bash
+# install locally (recommended)
+npm install dotenv --save
+```
+
+Or installing with yarn? `yarn add dotenv`
+
+## 🏗️ Usage
+
+
+
+
+
+
+
+
+Create a `.env` file in the root of your project (if using a monorepo structure like `apps/backend/app.js`, put it in the root of the folder where your `app.js` process runs):
+
+```dosini
+S3_BUCKET="YOURS3BUCKET"
+SECRET_KEY="YOURSECRETKEYGOESHERE"
+```
+
+As early as possible in your application, import and configure dotenv:
+
+```javascript
+require('dotenv').config()
+console.log(process.env) // remove this after you've confirmed it is working
+```
+
+.. [or using ES6?](#how-do-i-use-dotenv-with-import)
+
+```javascript
+import 'dotenv/config'
+```
+
+That's it. `process.env` now has the keys and values you defined in your `.env` file:
+
+```javascript
+require('dotenv').config()
+// or import 'dotenv/config' if you're using ES6
+
+...
+
+s3.getBucketCors({Bucket: process.env.S3_BUCKET}, function(err, data) {})
+```
+
+### Multiline values
+
+If you need multiline variables, for example private keys, those are now supported (`>= v15.0.0`) with line breaks:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----
+...
+Kh9NV...
+...
+-----END RSA PRIVATE KEY-----"
+```
+
+Alternatively, you can double quote strings and use the `\n` character:
+
+```dosini
+PRIVATE_KEY="-----BEGIN RSA PRIVATE KEY-----\nKh9NV...\n-----END RSA PRIVATE KEY-----\n"
+```
+
+### Comments
+
+Comments may be added to your file on their own line or inline:
+
+```dosini
+# This is a comment
+SECRET_KEY=YOURSECRETKEYGOESHERE # comment
+SECRET_HASH="something-with-a-#-hash"
+```
+
+Comments begin where a `#` exists, so if your value contains a `#` please wrap it in quotes. This is a breaking change from `>= v15.0.0` and on.
+
+### Parsing
+
+The engine which parses the contents of your file containing environment variables is available to use. It accepts a String or Buffer and will return an Object with the parsed keys and values.
+
+```javascript
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASIC=basic')
+const config = dotenv.parse(buf) // will return an object
+console.log(typeof config, config) // object { BASIC : 'basic' }
+```
+
+### Preload
+
+> Note: Consider using [`dotenvx`](https://github.com/dotenvx/dotenvx) instead of preloading. I am now doing (and recommending) so.
+>
+> It serves the same purpose (you do not need to require and load dotenv), adds better debugging, and works with ANY language, framework, or platform. – [motdotla](https://github.com/motdotla)
+
+You can use the `--require` (`-r`) [command line option](https://nodejs.org/api/cli.html#-r---require-module) to preload dotenv. By doing this, you do not need to require and load dotenv in your application code.
+
+```bash
+$ node -r dotenv/config your_script.js
+```
+
+The configuration options below are supported as command line arguments in the format `dotenv_config_ =value`
+
+```bash
+$ node -r dotenv/config your_script.js dotenv_config_path=/custom/path/to/.env dotenv_config_debug=true
+```
+
+Additionally, you can use environment variables to set configuration options. Command line arguments will precede these.
+
+```bash
+$ DOTENV_CONFIG_ =value node -r dotenv/config your_script.js
+```
+
+```bash
+$ DOTENV_CONFIG_ENCODING=latin1 DOTENV_CONFIG_DEBUG=true node -r dotenv/config your_script.js dotenv_config_path=/custom/path/to/.env
+```
+
+### Variable Expansion
+
+You need to add the value of another variable in one of your variables? Use [dotenv-expand](https://github.com/motdotla/dotenv-expand).
+
+### Command Substitution
+
+Use [dotenvx](https://github.com/dotenvx/dotenvx) to use command substitution.
+
+Add the output of a command to one of your variables in your .env file.
+
+```ini
+# .env
+DATABASE_URL="postgres://$(whoami)@localhost/my_database"
+```
+```js
+// index.js
+console.log('DATABASE_URL', process.env.DATABASE_URL)
+```
+```sh
+$ dotenvx run --debug -- node index.js
+[dotenvx@0.14.1] injecting env (1) from .env
+DATABASE_URL postgres://yourusername@localhost/my_database
+```
+
+### Syncing
+
+You need to keep `.env` files in sync between machines, environments, or team members? Use [dotenvx](https://github.com/dotenvx/dotenvx) to encrypt your `.env` files and safely include them in source control. This still subscribes to the twelve-factor app rules by generating a decryption key separate from code.
+
+### Multiple Environments
+
+Use [dotenvx](https://github.com/dotenvx/dotenvx) to generate `.env.ci`, `.env.production` files, and more.
+
+### Deploying
+
+You need to deploy your secrets in a cloud-agnostic manner? Use [dotenvx](https://github.com/dotenvx/dotenvx) to generate a private decryption key that is set on your production server.
+
+## 🌴 Manage Multiple Environments
+
+Use [dotenvx](https://github.com/dotenvx/dotenvx)
+
+Run any environment locally. Create a `.env.ENVIRONMENT` file and use `--env-file` to load it. It's straightforward, yet flexible.
+
+```bash
+$ echo "HELLO=production" > .env.production
+$ echo "console.log('Hello ' + process.env.HELLO)" > index.js
+
+$ dotenvx run --env-file=.env.production -- node index.js
+Hello production
+> ^^
+```
+
+or with multiple .env files
+
+```bash
+$ echo "HELLO=local" > .env.local
+$ echo "HELLO=World" > .env
+$ echo "console.log('Hello ' + process.env.HELLO)" > index.js
+
+$ dotenvx run --env-file=.env.local --env-file=.env -- node index.js
+Hello local
+```
+
+[more environment examples](https://dotenvx.com/docs/quickstart/environments)
+
+## 🚀 Deploying
+
+Use [dotenvx](https://github.com/dotenvx/dotenvx).
+
+Add encryption to your `.env` files with a single command. Pass the `--encrypt` flag.
+
+```
+$ dotenvx set HELLO Production --encrypt -f .env.production
+$ echo "console.log('Hello ' + process.env.HELLO)" > index.js
+
+$ DOTENV_PRIVATE_KEY_PRODUCTION="<.env.production private key>" dotenvx run -- node index.js
+[dotenvx] injecting env (2) from .env.production
+Hello Production
+```
+
+[learn more](https://github.com/dotenvx/dotenvx?tab=readme-ov-file#encryption)
+
+## 📚 Examples
+
+See [examples](https://github.com/dotenv-org/examples) of using dotenv with various frameworks, languages, and configurations.
+
+* [nodejs](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-nodejs)
+* [nodejs (debug on)](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-nodejs-debug)
+* [nodejs (override on)](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-nodejs-override)
+* [nodejs (processEnv override)](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-custom-target)
+* [esm](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-esm)
+* [esm (preload)](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-esm-preload)
+* [typescript](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-typescript)
+* [typescript parse](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-typescript-parse)
+* [typescript config](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-typescript-config)
+* [webpack](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-webpack)
+* [webpack (plugin)](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-webpack2)
+* [react](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-react)
+* [react (typescript)](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-react-typescript)
+* [express](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-express)
+* [nestjs](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-nestjs)
+* [fastify](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-fastify)
+
+## 📖 Documentation
+
+Dotenv exposes four functions:
+
+* `config`
+* `parse`
+* `populate`
+* `decrypt`
+
+### Config
+
+`config` will read your `.env` file, parse the contents, assign it to
+[`process.env`](https://nodejs.org/docs/latest/api/process.html#process_process_env),
+and return an Object with a `parsed` key containing the loaded content or an `error` key if it failed.
+
+```js
+const result = dotenv.config()
+
+if (result.error) {
+ throw result.error
+}
+
+console.log(result.parsed)
+```
+
+You can additionally, pass options to `config`.
+
+#### Options
+
+##### path
+
+Default: `path.resolve(process.cwd(), '.env')`
+
+Specify a custom path if your file containing environment variables is located elsewhere.
+
+```js
+require('dotenv').config({ path: '/custom/path/to/.env' })
+```
+
+By default, `config` will look for a file called .env in the current working directory.
+
+Pass in multiple files as an array, and they will be parsed in order and combined with `process.env` (or `option.processEnv`, if set). The first value set for a variable will win, unless the `options.override` flag is set, in which case the last value set will win. If a value already exists in `process.env` and the `options.override` flag is NOT set, no changes will be made to that value.
+
+```js
+require('dotenv').config({ path: ['.env.local', '.env'] })
+```
+
+##### encoding
+
+Default: `utf8`
+
+Specify the encoding of your file containing environment variables.
+
+```js
+require('dotenv').config({ encoding: 'latin1' })
+```
+
+##### debug
+
+Default: `false`
+
+Turn on logging to help debug why certain keys or values are not being set as you expect.
+
+```js
+require('dotenv').config({ debug: process.env.DEBUG })
+```
+
+##### override
+
+Default: `false`
+
+Override any environment variables that have already been set on your machine with values from your .env file(s). If multiple files have been provided in `option.path` the override will also be used as each file is combined with the next. Without `override` being set, the first value wins. With `override` set the last value wins.
+
+```js
+require('dotenv').config({ override: true })
+```
+
+##### processEnv
+
+Default: `process.env`
+
+Specify an object to write your secrets to. Defaults to `process.env` environment variables.
+
+```js
+const myObject = {}
+require('dotenv').config({ processEnv: myObject })
+
+console.log(myObject) // values from .env
+console.log(process.env) // this was not changed or written to
+```
+
+### Parse
+
+The engine which parses the contents of your file containing environment
+variables is available to use. It accepts a String or Buffer and will return
+an Object with the parsed keys and values.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('BASIC=basic')
+const config = dotenv.parse(buf) // will return an object
+console.log(typeof config, config) // object { BASIC : 'basic' }
+```
+
+#### Options
+
+##### debug
+
+Default: `false`
+
+Turn on logging to help debug why certain keys or values are not being set as you expect.
+
+```js
+const dotenv = require('dotenv')
+const buf = Buffer.from('hello world')
+const opt = { debug: true }
+const config = dotenv.parse(buf, opt)
+// expect a debug message because the buffer is not in KEY=VAL form
+```
+
+### Populate
+
+The engine which populates the contents of your .env file to `process.env` is available for use. It accepts a target, a source, and options. This is useful for power users who want to supply their own objects.
+
+For example, customizing the source:
+
+```js
+const dotenv = require('dotenv')
+const parsed = { HELLO: 'world' }
+
+dotenv.populate(process.env, parsed)
+
+console.log(process.env.HELLO) // world
+```
+
+For example, customizing the source AND target:
+
+```js
+const dotenv = require('dotenv')
+const parsed = { HELLO: 'universe' }
+const target = { HELLO: 'world' } // empty object
+
+dotenv.populate(target, parsed, { override: true, debug: true })
+
+console.log(target) // { HELLO: 'universe' }
+```
+
+#### options
+
+##### Debug
+
+Default: `false`
+
+Turn on logging to help debug why certain keys or values are not being populated as you expect.
+
+##### override
+
+Default: `false`
+
+Override any environment variables that have already been set.
+
+## ❓ FAQ
+
+### Why is the `.env` file not loading my environment variables successfully?
+
+Most likely your `.env` file is not in the correct place. [See this stack overflow](https://stackoverflow.com/questions/42335016/dotenv-file-is-not-loading-environment-variables).
+
+Turn on debug mode and try again..
+
+```js
+require('dotenv').config({ debug: true })
+```
+
+You will receive a helpful error outputted to your console.
+
+### Should I commit my `.env` file?
+
+No. We **strongly** recommend against committing your `.env` file to version
+control. It should only include environment-specific values such as database
+passwords or API keys. Your production database should have a different
+password than your development database.
+
+### Should I have multiple `.env` files?
+
+We recommend creating one `.env` file per environment. Use `.env` for local/development, `.env.production` for production and so on. This still follows the twelve factor principles as each is attributed individually to its own environment. Avoid custom set ups that work in inheritance somehow (`.env.production` inherits values form `.env` for example). It is better to duplicate values if necessary across each `.env.environment` file.
+
+> In a twelve-factor app, env vars are granular controls, each fully orthogonal to other env vars. They are never grouped together as “environments”, but instead are independently managed for each deploy. This is a model that scales up smoothly as the app naturally expands into more deploys over its lifetime.
+>
+> – [The Twelve-Factor App](http://12factor.net/config)
+
+### What rules does the parsing engine follow?
+
+The parsing engine currently supports the following rules:
+
+- `BASIC=basic` becomes `{BASIC: 'basic'}`
+- empty lines are skipped
+- lines beginning with `#` are treated as comments
+- `#` marks the beginning of a comment (unless when the value is wrapped in quotes)
+- empty values become empty strings (`EMPTY=` becomes `{EMPTY: ''}`)
+- inner quotes are maintained (think JSON) (`JSON={"foo": "bar"}` becomes `{JSON:"{\"foo\": \"bar\"}"`)
+- whitespace is removed from both ends of unquoted values (see more on [`trim`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)) (`FOO= some value ` becomes `{FOO: 'some value'}`)
+- single and double quoted values are escaped (`SINGLE_QUOTE='quoted'` becomes `{SINGLE_QUOTE: "quoted"}`)
+- single and double quoted values maintain whitespace from both ends (`FOO=" some value "` becomes `{FOO: ' some value '}`)
+- double quoted values expand new lines (`MULTILINE="new\nline"` becomes
+
+```
+{MULTILINE: 'new
+line'}
+```
+
+- backticks are supported (`` BACKTICK_KEY=`This has 'single' and "double" quotes inside of it.` ``)
+
+### What happens to environment variables that were already set?
+
+By default, we will never modify any environment variables that have already been set. In particular, if there is a variable in your `.env` file which collides with one that already exists in your environment, then that variable will be skipped.
+
+If instead, you want to override `process.env` use the `override` option.
+
+```javascript
+require('dotenv').config({ override: true })
+```
+
+### How come my environment variables are not showing up for React?
+
+Your React code is run in Webpack, where the `fs` module or even the `process` global itself are not accessible out-of-the-box. `process.env` can only be injected through Webpack configuration.
+
+If you are using [`react-scripts`](https://www.npmjs.com/package/react-scripts), which is distributed through [`create-react-app`](https://create-react-app.dev/), it has dotenv built in but with a quirk. Preface your environment variables with `REACT_APP_`. See [this stack overflow](https://stackoverflow.com/questions/42182577/is-it-possible-to-use-dotenv-in-a-react-project) for more details.
+
+If you are using other frameworks (e.g. Next.js, Gatsby...), you need to consult their documentation for how to inject environment variables into the client.
+
+### Can I customize/write plugins for dotenv?
+
+Yes! `dotenv.config()` returns an object representing the parsed `.env` file. This gives you everything you need to continue setting values on `process.env`. For example:
+
+```js
+const dotenv = require('dotenv')
+const variableExpansion = require('dotenv-expand')
+const myEnv = dotenv.config()
+variableExpansion(myEnv)
+```
+
+### How do I use dotenv with `import`?
+
+Simply..
+
+```javascript
+// index.mjs (ESM)
+import 'dotenv/config' // see https://github.com/motdotla/dotenv#how-do-i-use-dotenv-with-import
+import express from 'express'
+```
+
+A little background..
+
+> When you run a module containing an `import` declaration, the modules it imports are loaded first, then each module body is executed in a depth-first traversal of the dependency graph, avoiding cycles by skipping anything already executed.
+>
+> – [ES6 In Depth: Modules](https://hacks.mozilla.org/2015/08/es6-in-depth-modules/)
+
+What does this mean in plain language? It means you would think the following would work but it won't.
+
+`errorReporter.mjs`:
+```js
+import { Client } from 'best-error-reporting-service'
+
+export default new Client(process.env.API_KEY)
+```
+`index.mjs`:
+```js
+// Note: this is INCORRECT and will not work
+import * as dotenv from 'dotenv'
+dotenv.config()
+
+import errorReporter from './errorReporter.mjs'
+errorReporter.report(new Error('documented example'))
+```
+
+`process.env.API_KEY` will be blank.
+
+Instead, `index.mjs` should be written as..
+
+```js
+import 'dotenv/config'
+
+import errorReporter from './errorReporter.mjs'
+errorReporter.report(new Error('documented example'))
+```
+
+Does that make sense? It's a bit unintuitive, but it is how importing of ES6 modules work. Here is a [working example of this pitfall](https://github.com/dotenv-org/examples/tree/master/usage/dotenv-es6-import-pitfall).
+
+There are two alternatives to this approach:
+
+1. Preload dotenv: `node --require dotenv/config index.js` (_Note: you do not need to `import` dotenv with this approach_)
+2. Create a separate file that will execute `config` first as outlined in [this comment on #133](https://github.com/motdotla/dotenv/issues/133#issuecomment-255298822)
+
+### Why am I getting the error `Module not found: Error: Can't resolve 'crypto|os|path'`?
+
+You are using dotenv on the front-end and have not included a polyfill. Webpack < 5 used to include these for you. Do the following:
+
+```bash
+npm install node-polyfill-webpack-plugin
+```
+
+Configure your `webpack.config.js` to something like the following.
+
+```js
+require('dotenv').config()
+
+const path = require('path');
+const webpack = require('webpack')
+
+const NodePolyfillPlugin = require('node-polyfill-webpack-plugin')
+
+module.exports = {
+ mode: 'development',
+ entry: './src/index.ts',
+ output: {
+ filename: 'bundle.js',
+ path: path.resolve(__dirname, 'dist'),
+ },
+ plugins: [
+ new NodePolyfillPlugin(),
+ new webpack.DefinePlugin({
+ 'process.env': {
+ HELLO: JSON.stringify(process.env.HELLO)
+ }
+ }),
+ ]
+};
+```
+
+Alternatively, just use [dotenv-webpack](https://github.com/mrsteele/dotenv-webpack) which does this and more behind the scenes for you.
+
+### What about variable expansion?
+
+Try [dotenv-expand](https://github.com/motdotla/dotenv-expand)
+
+### What about syncing and securing .env files?
+
+Use [dotenvx](https://github.com/dotenvx/dotenvx)
+
+### What if I accidentally commit my `.env` file to code?
+
+Remove it, [remove git history](https://docs.github.com/en/authentication/keeping-your-account-and-data-secure/removing-sensitive-data-from-a-repository) and then install the [git pre-commit hook](https://github.com/dotenvx/dotenvx#pre-commit) to prevent this from ever happening again.
+
+```
+brew install dotenvx/brew/dotenvx
+dotenvx precommit --install
+```
+
+### How can I prevent committing my `.env` file to a Docker build?
+
+Use the [docker prebuild hook](https://dotenvx.com/docs/features/prebuild).
+
+```bash
+# Dockerfile
+...
+RUN curl -fsS https://dotenvx.sh/ | sh
+...
+RUN dotenvx prebuild
+CMD ["dotenvx", "run", "--", "node", "index.js"]
+```
+
+## Contributing Guide
+
+See [CONTRIBUTING.md](CONTRIBUTING.md)
+
+## CHANGELOG
+
+See [CHANGELOG.md](CHANGELOG.md)
+
+## Who's using dotenv?
+
+[These npm modules depend on it.](https://www.npmjs.com/browse/depended/dotenv)
+
+Projects that expand it often use the [keyword "dotenv" on npm](https://www.npmjs.com/search?q=keywords:dotenv).
diff --git a/node_modules/dotenv/config.d.ts b/node_modules/dotenv/config.d.ts
new file mode 100644
index 0000000..cb0ff5c
--- /dev/null
+++ b/node_modules/dotenv/config.d.ts
@@ -0,0 +1 @@
+export {};
diff --git a/node_modules/dotenv/config.js b/node_modules/dotenv/config.js
new file mode 100644
index 0000000..b0b5576
--- /dev/null
+++ b/node_modules/dotenv/config.js
@@ -0,0 +1,9 @@
+(function () {
+ require('./lib/main').config(
+ Object.assign(
+ {},
+ require('./lib/env-options'),
+ require('./lib/cli-options')(process.argv)
+ )
+ )
+})()
diff --git a/node_modules/dotenv/lib/cli-options.js b/node_modules/dotenv/lib/cli-options.js
new file mode 100644
index 0000000..09aca5b
--- /dev/null
+++ b/node_modules/dotenv/lib/cli-options.js
@@ -0,0 +1,11 @@
+const re = /^dotenv_config_(encoding|path|debug|override|DOTENV_KEY)=(.+)$/
+
+module.exports = function optionMatcher (args) {
+ return args.reduce(function (acc, cur) {
+ const matches = cur.match(re)
+ if (matches) {
+ acc[matches[1]] = matches[2]
+ }
+ return acc
+ }, {})
+}
diff --git a/node_modules/dotenv/lib/env-options.js b/node_modules/dotenv/lib/env-options.js
new file mode 100644
index 0000000..7ebae3d
--- /dev/null
+++ b/node_modules/dotenv/lib/env-options.js
@@ -0,0 +1,24 @@
+// ../config.js accepts options via environment variables
+const options = {}
+
+if (process.env.DOTENV_CONFIG_ENCODING != null) {
+ options.encoding = process.env.DOTENV_CONFIG_ENCODING
+}
+
+if (process.env.DOTENV_CONFIG_PATH != null) {
+ options.path = process.env.DOTENV_CONFIG_PATH
+}
+
+if (process.env.DOTENV_CONFIG_DEBUG != null) {
+ options.debug = process.env.DOTENV_CONFIG_DEBUG
+}
+
+if (process.env.DOTENV_CONFIG_OVERRIDE != null) {
+ options.override = process.env.DOTENV_CONFIG_OVERRIDE
+}
+
+if (process.env.DOTENV_CONFIG_DOTENV_KEY != null) {
+ options.DOTENV_KEY = process.env.DOTENV_CONFIG_DOTENV_KEY
+}
+
+module.exports = options
diff --git a/node_modules/dotenv/lib/main.d.ts b/node_modules/dotenv/lib/main.d.ts
new file mode 100644
index 0000000..a48c3c1
--- /dev/null
+++ b/node_modules/dotenv/lib/main.d.ts
@@ -0,0 +1,153 @@
+// TypeScript Version: 3.0
+///
+import type { URL } from 'url';
+
+export interface DotenvParseOutput {
+ [name: string]: string;
+}
+
+/**
+ * Parses a string or buffer in the .env file format into an object.
+ *
+ * See https://dotenvx.com/docs
+ *
+ * @param src - contents to be parsed. example: `'DB_HOST=localhost'`
+ * @returns an object with keys and values based on `src`. example: `{ DB_HOST : 'localhost' }`
+ */
+export function parse(
+ src: string | Buffer
+): T;
+
+export interface DotenvConfigOptions {
+ /**
+ * Default: `path.resolve(process.cwd(), '.env')`
+ *
+ * Specify a custom path if your file containing environment variables is located elsewhere.
+ * Can also be an array of strings, specifying multiple paths.
+ *
+ * example: `require('dotenv').config({ path: '/custom/path/to/.env' })`
+ * example: `require('dotenv').config({ path: ['/path/to/first.env', '/path/to/second.env'] })`
+ */
+ path?: string | string[] | URL;
+
+ /**
+ * Default: `utf8`
+ *
+ * Specify the encoding of your file containing environment variables.
+ *
+ * example: `require('dotenv').config({ encoding: 'latin1' })`
+ */
+ encoding?: string;
+
+ /**
+ * Default: `false`
+ *
+ * Turn on logging to help debug why certain keys or values are not being set as you expect.
+ *
+ * example: `require('dotenv').config({ debug: process.env.DEBUG })`
+ */
+ debug?: boolean;
+
+ /**
+ * Default: `false`
+ *
+ * Override any environment variables that have already been set on your machine with values from your .env file.
+ *
+ * example: `require('dotenv').config({ override: true })`
+ */
+ override?: boolean;
+
+ /**
+ * Default: `process.env`
+ *
+ * Specify an object to write your secrets to. Defaults to process.env environment variables.
+ *
+ * example: `const processEnv = {}; require('dotenv').config({ processEnv: processEnv })`
+ */
+ processEnv?: DotenvPopulateInput;
+
+ /**
+ * Default: `undefined`
+ *
+ * Pass the DOTENV_KEY directly to config options. Defaults to looking for process.env.DOTENV_KEY environment variable. Note this only applies to decrypting .env.vault files. If passed as null or undefined, or not passed at all, dotenv falls back to its traditional job of parsing a .env file.
+ *
+ * example: `require('dotenv').config({ DOTENV_KEY: 'dotenv://:key_1234…@dotenvx.com/vault/.env.vault?environment=production' })`
+ */
+ DOTENV_KEY?: string;
+}
+
+export interface DotenvConfigOutput {
+ error?: Error;
+ parsed?: DotenvParseOutput;
+}
+
+export interface DotenvPopulateOptions {
+ /**
+ * Default: `false`
+ *
+ * Turn on logging to help debug why certain keys or values are not being set as you expect.
+ *
+ * example: `require('dotenv').config({ debug: process.env.DEBUG })`
+ */
+ debug?: boolean;
+
+ /**
+ * Default: `false`
+ *
+ * Override any environment variables that have already been set on your machine with values from your .env file.
+ *
+ * example: `require('dotenv').config({ override: true })`
+ */
+ override?: boolean;
+}
+
+export interface DotenvPopulateInput {
+ [name: string]: string;
+}
+
+/**
+ * Loads `.env` file contents into process.env by default. If `DOTENV_KEY` is present, it smartly attempts to load encrypted `.env.vault` file contents into process.env.
+ *
+ * See https://dotenvx.com/docs
+ *
+ * @param options - additional options. example: `{ path: './custom/path', encoding: 'latin1', debug: true, override: false }`
+ * @returns an object with a `parsed` key if successful or `error` key if an error occurred. example: { parsed: { KEY: 'value' } }
+ *
+ */
+export function config(options?: DotenvConfigOptions): DotenvConfigOutput;
+
+/**
+ * Loads `.env` file contents into process.env.
+ *
+ * See https://dotenvx.com/docs
+ *
+ * @param options - additional options. example: `{ path: './custom/path', encoding: 'latin1', debug: true, override: false }`
+ * @returns an object with a `parsed` key if successful or `error` key if an error occurred. example: { parsed: { KEY: 'value' } }
+ *
+ */
+export function configDotenv(options?: DotenvConfigOptions): DotenvConfigOutput;
+
+/**
+ * Loads `source` json contents into `target` like process.env.
+ *
+ * See https://dotenvx.com/docs
+ *
+ * @param processEnv - the target JSON object. in most cases use process.env but you can also pass your own JSON object
+ * @param parsed - the source JSON object
+ * @param options - additional options. example: `{ debug: true, override: false }`
+ * @returns {void}
+ *
+ */
+export function populate(processEnv: DotenvPopulateInput, parsed: DotenvPopulateInput, options?: DotenvConfigOptions): void;
+
+/**
+ * Decrypt ciphertext
+ *
+ * See https://dotenvx.com/docs
+ *
+ * @param encrypted - the encrypted ciphertext string
+ * @param keyStr - the decryption key string
+ * @returns {string}
+ *
+ */
+export function decrypt(encrypted: string, keyStr: string): string;
diff --git a/node_modules/dotenv/lib/main.js b/node_modules/dotenv/lib/main.js
new file mode 100644
index 0000000..314f49a
--- /dev/null
+++ b/node_modules/dotenv/lib/main.js
@@ -0,0 +1,361 @@
+const fs = require('fs')
+const path = require('path')
+const os = require('os')
+const crypto = require('crypto')
+const packageJson = require('../package.json')
+
+const version = packageJson.version
+
+const LINE = /(?:^|^)\s*(?:export\s+)?([\w.-]+)(?:\s*=\s*?|:\s+?)(\s*'(?:\\'|[^'])*'|\s*"(?:\\"|[^"])*"|\s*`(?:\\`|[^`])*`|[^#\r\n]+)?\s*(?:#.*)?(?:$|$)/mg
+
+// Parse src into an Object
+function parse (src) {
+ const obj = {}
+
+ // Convert buffer to string
+ let lines = src.toString()
+
+ // Convert line breaks to same format
+ lines = lines.replace(/\r\n?/mg, '\n')
+
+ let match
+ while ((match = LINE.exec(lines)) != null) {
+ const key = match[1]
+
+ // Default undefined or null to empty string
+ let value = (match[2] || '')
+
+ // Remove whitespace
+ value = value.trim()
+
+ // Check if double quoted
+ const maybeQuote = value[0]
+
+ // Remove surrounding quotes
+ value = value.replace(/^(['"`])([\s\S]*)\1$/mg, '$2')
+
+ // Expand newlines if double quoted
+ if (maybeQuote === '"') {
+ value = value.replace(/\\n/g, '\n')
+ value = value.replace(/\\r/g, '\r')
+ }
+
+ // Add to object
+ obj[key] = value
+ }
+
+ return obj
+}
+
+function _parseVault (options) {
+ const vaultPath = _vaultPath(options)
+
+ // Parse .env.vault
+ const result = DotenvModule.configDotenv({ path: vaultPath })
+ if (!result.parsed) {
+ const err = new Error(`MISSING_DATA: Cannot parse ${vaultPath} for an unknown reason`)
+ err.code = 'MISSING_DATA'
+ throw err
+ }
+
+ // handle scenario for comma separated keys - for use with key rotation
+ // example: DOTENV_KEY="dotenv://:key_1234@dotenvx.com/vault/.env.vault?environment=prod,dotenv://:key_7890@dotenvx.com/vault/.env.vault?environment=prod"
+ const keys = _dotenvKey(options).split(',')
+ const length = keys.length
+
+ let decrypted
+ for (let i = 0; i < length; i++) {
+ try {
+ // Get full key
+ const key = keys[i].trim()
+
+ // Get instructions for decrypt
+ const attrs = _instructions(result, key)
+
+ // Decrypt
+ decrypted = DotenvModule.decrypt(attrs.ciphertext, attrs.key)
+
+ break
+ } catch (error) {
+ // last key
+ if (i + 1 >= length) {
+ throw error
+ }
+ // try next key
+ }
+ }
+
+ // Parse decrypted .env string
+ return DotenvModule.parse(decrypted)
+}
+
+function _log (message) {
+ console.log(`[dotenv@${version}][INFO] ${message}`)
+}
+
+function _warn (message) {
+ console.log(`[dotenv@${version}][WARN] ${message}`)
+}
+
+function _debug (message) {
+ console.log(`[dotenv@${version}][DEBUG] ${message}`)
+}
+
+function _dotenvKey (options) {
+ // prioritize developer directly setting options.DOTENV_KEY
+ if (options && options.DOTENV_KEY && options.DOTENV_KEY.length > 0) {
+ return options.DOTENV_KEY
+ }
+
+ // secondary infra already contains a DOTENV_KEY environment variable
+ if (process.env.DOTENV_KEY && process.env.DOTENV_KEY.length > 0) {
+ return process.env.DOTENV_KEY
+ }
+
+ // fallback to empty string
+ return ''
+}
+
+function _instructions (result, dotenvKey) {
+ // Parse DOTENV_KEY. Format is a URI
+ let uri
+ try {
+ uri = new URL(dotenvKey)
+ } catch (error) {
+ if (error.code === 'ERR_INVALID_URL') {
+ const err = new Error('INVALID_DOTENV_KEY: Wrong format. Must be in valid uri format like dotenv://:key_1234@dotenvx.com/vault/.env.vault?environment=development')
+ err.code = 'INVALID_DOTENV_KEY'
+ throw err
+ }
+
+ throw error
+ }
+
+ // Get decrypt key
+ const key = uri.password
+ if (!key) {
+ const err = new Error('INVALID_DOTENV_KEY: Missing key part')
+ err.code = 'INVALID_DOTENV_KEY'
+ throw err
+ }
+
+ // Get environment
+ const environment = uri.searchParams.get('environment')
+ if (!environment) {
+ const err = new Error('INVALID_DOTENV_KEY: Missing environment part')
+ err.code = 'INVALID_DOTENV_KEY'
+ throw err
+ }
+
+ // Get ciphertext payload
+ const environmentKey = `DOTENV_VAULT_${environment.toUpperCase()}`
+ const ciphertext = result.parsed[environmentKey] // DOTENV_VAULT_PRODUCTION
+ if (!ciphertext) {
+ const err = new Error(`NOT_FOUND_DOTENV_ENVIRONMENT: Cannot locate environment ${environmentKey} in your .env.vault file.`)
+ err.code = 'NOT_FOUND_DOTENV_ENVIRONMENT'
+ throw err
+ }
+
+ return { ciphertext, key }
+}
+
+function _vaultPath (options) {
+ let possibleVaultPath = null
+
+ if (options && options.path && options.path.length > 0) {
+ if (Array.isArray(options.path)) {
+ for (const filepath of options.path) {
+ if (fs.existsSync(filepath)) {
+ possibleVaultPath = filepath.endsWith('.vault') ? filepath : `${filepath}.vault`
+ }
+ }
+ } else {
+ possibleVaultPath = options.path.endsWith('.vault') ? options.path : `${options.path}.vault`
+ }
+ } else {
+ possibleVaultPath = path.resolve(process.cwd(), '.env.vault')
+ }
+
+ if (fs.existsSync(possibleVaultPath)) {
+ return possibleVaultPath
+ }
+
+ return null
+}
+
+function _resolveHome (envPath) {
+ return envPath[0] === '~' ? path.join(os.homedir(), envPath.slice(1)) : envPath
+}
+
+function _configVault (options) {
+ _log('Loading env from encrypted .env.vault')
+
+ const parsed = DotenvModule._parseVault(options)
+
+ let processEnv = process.env
+ if (options && options.processEnv != null) {
+ processEnv = options.processEnv
+ }
+
+ DotenvModule.populate(processEnv, parsed, options)
+
+ return { parsed }
+}
+
+function configDotenv (options) {
+ const dotenvPath = path.resolve(process.cwd(), '.env')
+ let encoding = 'utf8'
+ const debug = Boolean(options && options.debug)
+
+ if (options && options.encoding) {
+ encoding = options.encoding
+ } else {
+ if (debug) {
+ _debug('No encoding is specified. UTF-8 is used by default')
+ }
+ }
+
+ let optionPaths = [dotenvPath] // default, look for .env
+ if (options && options.path) {
+ if (!Array.isArray(options.path)) {
+ optionPaths = [_resolveHome(options.path)]
+ } else {
+ optionPaths = [] // reset default
+ for (const filepath of options.path) {
+ optionPaths.push(_resolveHome(filepath))
+ }
+ }
+ }
+
+ // Build the parsed data in a temporary object (because we need to return it). Once we have the final
+ // parsed data, we will combine it with process.env (or options.processEnv if provided).
+ let lastError
+ const parsedAll = {}
+ for (const path of optionPaths) {
+ try {
+ // Specifying an encoding returns a string instead of a buffer
+ const parsed = DotenvModule.parse(fs.readFileSync(path, { encoding }))
+
+ DotenvModule.populate(parsedAll, parsed, options)
+ } catch (e) {
+ if (debug) {
+ _debug(`Failed to load ${path} ${e.message}`)
+ }
+ lastError = e
+ }
+ }
+
+ let processEnv = process.env
+ if (options && options.processEnv != null) {
+ processEnv = options.processEnv
+ }
+
+ DotenvModule.populate(processEnv, parsedAll, options)
+
+ if (lastError) {
+ return { parsed: parsedAll, error: lastError }
+ } else {
+ return { parsed: parsedAll }
+ }
+}
+
+// Populates process.env from .env file
+function config (options) {
+ // fallback to original dotenv if DOTENV_KEY is not set
+ if (_dotenvKey(options).length === 0) {
+ return DotenvModule.configDotenv(options)
+ }
+
+ const vaultPath = _vaultPath(options)
+
+ // dotenvKey exists but .env.vault file does not exist
+ if (!vaultPath) {
+ _warn(`You set DOTENV_KEY but you are missing a .env.vault file at ${vaultPath}. Did you forget to build it?`)
+
+ return DotenvModule.configDotenv(options)
+ }
+
+ return DotenvModule._configVault(options)
+}
+
+function decrypt (encrypted, keyStr) {
+ const key = Buffer.from(keyStr.slice(-64), 'hex')
+ let ciphertext = Buffer.from(encrypted, 'base64')
+
+ const nonce = ciphertext.subarray(0, 12)
+ const authTag = ciphertext.subarray(-16)
+ ciphertext = ciphertext.subarray(12, -16)
+
+ try {
+ const aesgcm = crypto.createDecipheriv('aes-256-gcm', key, nonce)
+ aesgcm.setAuthTag(authTag)
+ return `${aesgcm.update(ciphertext)}${aesgcm.final()}`
+ } catch (error) {
+ const isRange = error instanceof RangeError
+ const invalidKeyLength = error.message === 'Invalid key length'
+ const decryptionFailed = error.message === 'Unsupported state or unable to authenticate data'
+
+ if (isRange || invalidKeyLength) {
+ const err = new Error('INVALID_DOTENV_KEY: It must be 64 characters long (or more)')
+ err.code = 'INVALID_DOTENV_KEY'
+ throw err
+ } else if (decryptionFailed) {
+ const err = new Error('DECRYPTION_FAILED: Please check your DOTENV_KEY')
+ err.code = 'DECRYPTION_FAILED'
+ throw err
+ } else {
+ throw error
+ }
+ }
+}
+
+// Populate process.env with parsed values
+function populate (processEnv, parsed, options = {}) {
+ const debug = Boolean(options && options.debug)
+ const override = Boolean(options && options.override)
+
+ if (typeof parsed !== 'object') {
+ const err = new Error('OBJECT_REQUIRED: Please check the processEnv argument being passed to populate')
+ err.code = 'OBJECT_REQUIRED'
+ throw err
+ }
+
+ // Set process.env
+ for (const key of Object.keys(parsed)) {
+ if (Object.prototype.hasOwnProperty.call(processEnv, key)) {
+ if (override === true) {
+ processEnv[key] = parsed[key]
+ }
+
+ if (debug) {
+ if (override === true) {
+ _debug(`"${key}" is already defined and WAS overwritten`)
+ } else {
+ _debug(`"${key}" is already defined and was NOT overwritten`)
+ }
+ }
+ } else {
+ processEnv[key] = parsed[key]
+ }
+ }
+}
+
+const DotenvModule = {
+ configDotenv,
+ _configVault,
+ _parseVault,
+ config,
+ decrypt,
+ parse,
+ populate
+}
+
+module.exports.configDotenv = DotenvModule.configDotenv
+module.exports._configVault = DotenvModule._configVault
+module.exports._parseVault = DotenvModule._parseVault
+module.exports.config = DotenvModule.config
+module.exports.decrypt = DotenvModule.decrypt
+module.exports.parse = DotenvModule.parse
+module.exports.populate = DotenvModule.populate
+
+module.exports = DotenvModule
diff --git a/node_modules/dotenv/package.json b/node_modules/dotenv/package.json
new file mode 100644
index 0000000..528426b
--- /dev/null
+++ b/node_modules/dotenv/package.json
@@ -0,0 +1,61 @@
+{
+ "name": "dotenv",
+ "version": "16.4.7",
+ "description": "Loads environment variables from .env file",
+ "main": "lib/main.js",
+ "types": "lib/main.d.ts",
+ "exports": {
+ ".": {
+ "types": "./lib/main.d.ts",
+ "require": "./lib/main.js",
+ "default": "./lib/main.js"
+ },
+ "./config": "./config.js",
+ "./config.js": "./config.js",
+ "./lib/env-options": "./lib/env-options.js",
+ "./lib/env-options.js": "./lib/env-options.js",
+ "./lib/cli-options": "./lib/cli-options.js",
+ "./lib/cli-options.js": "./lib/cli-options.js",
+ "./package.json": "./package.json"
+ },
+ "scripts": {
+ "dts-check": "tsc --project tests/types/tsconfig.json",
+ "lint": "standard",
+ "pretest": "npm run lint && npm run dts-check",
+ "test": "tap run --allow-empty-coverage --disable-coverage --timeout=60000",
+ "test:coverage": "tap run --show-full-coverage --timeout=60000 --coverage-report=lcov",
+ "prerelease": "npm test",
+ "release": "standard-version"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/motdotla/dotenv.git"
+ },
+ "funding": "https://dotenvx.com",
+ "keywords": [
+ "dotenv",
+ "env",
+ ".env",
+ "environment",
+ "variables",
+ "config",
+ "settings"
+ ],
+ "readmeFilename": "README.md",
+ "license": "BSD-2-Clause",
+ "devDependencies": {
+ "@types/node": "^18.11.3",
+ "decache": "^4.6.2",
+ "sinon": "^14.0.1",
+ "standard": "^17.0.0",
+ "standard-version": "^9.5.0",
+ "tap": "^19.2.0",
+ "typescript": "^4.8.4"
+ },
+ "engines": {
+ "node": ">=12"
+ },
+ "browser": {
+ "fs": false
+ }
+}
diff --git a/node_modules/dunder-proto/.eslintrc b/node_modules/dunder-proto/.eslintrc
new file mode 100644
index 0000000..3b5d9e9
--- /dev/null
+++ b/node_modules/dunder-proto/.eslintrc
@@ -0,0 +1,5 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+}
diff --git a/node_modules/dunder-proto/.github/FUNDING.yml b/node_modules/dunder-proto/.github/FUNDING.yml
new file mode 100644
index 0000000..8a1d7b0
--- /dev/null
+++ b/node_modules/dunder-proto/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/dunder-proto
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/node_modules/dunder-proto/.nycrc b/node_modules/dunder-proto/.nycrc
new file mode 100644
index 0000000..1826526
--- /dev/null
+++ b/node_modules/dunder-proto/.nycrc
@@ -0,0 +1,13 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "lines": 86,
+ "statements": 85.93,
+ "functions": 82.43,
+ "branches": 76.06,
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/dunder-proto/CHANGELOG.md b/node_modules/dunder-proto/CHANGELOG.md
new file mode 100644
index 0000000..9b8b2f8
--- /dev/null
+++ b/node_modules/dunder-proto/CHANGELOG.md
@@ -0,0 +1,24 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.0.1](https://github.com/es-shims/dunder-proto/compare/v1.0.0...v1.0.1) - 2024-12-16
+
+### Commits
+
+- [Fix] do not crash when `--disable-proto=throw` [`6c367d9`](https://github.com/es-shims/dunder-proto/commit/6c367d919bc1604778689a297bbdbfea65752847)
+- [Tests] ensure noproto tests only use the current version of dunder-proto [`b02365b`](https://github.com/es-shims/dunder-proto/commit/b02365b9cf889c4a2cac7be0c3cfc90a789af36c)
+- [Dev Deps] update `@arethetypeswrong/cli`, `@types/tape` [`e3c5c3b`](https://github.com/es-shims/dunder-proto/commit/e3c5c3bd81cf8cef7dff2eca19e558f0e307f666)
+- [Deps] update `call-bind-apply-helpers` [`19f1da0`](https://github.com/es-shims/dunder-proto/commit/19f1da028b8dd0d05c85bfd8f7eed2819b686450)
+
+## v1.0.0 - 2024-12-06
+
+### Commits
+
+- Initial implementation, tests, readme, types [`a5b74b0`](https://github.com/es-shims/dunder-proto/commit/a5b74b0082f5270cb0905cd9a2e533cee7498373)
+- Initial commit [`73fb5a3`](https://github.com/es-shims/dunder-proto/commit/73fb5a353b51ac2ab00c9fdeb0114daffd4c07a8)
+- npm init [`80152dc`](https://github.com/es-shims/dunder-proto/commit/80152dc98155da4eb046d9f67a87ed96e8280a1d)
+- Only apps should have lockfiles [`03e6660`](https://github.com/es-shims/dunder-proto/commit/03e6660a1d70dc401f3e217a031475ec537243dd)
diff --git a/node_modules/dunder-proto/LICENSE b/node_modules/dunder-proto/LICENSE
new file mode 100644
index 0000000..34995e7
--- /dev/null
+++ b/node_modules/dunder-proto/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 ECMAScript Shims
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/dunder-proto/README.md b/node_modules/dunder-proto/README.md
new file mode 100644
index 0000000..44b80a2
--- /dev/null
+++ b/node_modules/dunder-proto/README.md
@@ -0,0 +1,54 @@
+# dunder-proto [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+If available, the `Object.prototype.__proto__` accessor and mutator, call-bound.
+
+## Getting started
+
+```sh
+npm install --save dunder-proto
+```
+
+## Usage/Examples
+
+```js
+const assert = require('assert');
+const getDunder = require('dunder-proto/get');
+const setDunder = require('dunder-proto/set');
+
+const obj = {};
+
+assert.equal('toString' in obj, true);
+assert.equal(getDunder(obj), Object.prototype);
+
+setDunder(obj, null);
+
+assert.equal('toString' in obj, false);
+assert.equal(getDunder(obj), null);
+```
+
+## Tests
+
+Clone the repo, `npm install`, and run `npm test`
+
+[package-url]: https://npmjs.org/package/dunder-proto
+[npm-version-svg]: https://versionbadg.es/es-shims/dunder-proto.svg
+[deps-svg]: https://david-dm.org/es-shims/dunder-proto.svg
+[deps-url]: https://david-dm.org/es-shims/dunder-proto
+[dev-deps-svg]: https://david-dm.org/es-shims/dunder-proto/dev-status.svg
+[dev-deps-url]: https://david-dm.org/es-shims/dunder-proto#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/dunder-proto.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/dunder-proto.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/dunder-proto.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=dunder-proto
+[codecov-image]: https://codecov.io/gh/es-shims/dunder-proto/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/es-shims/dunder-proto/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/es-shims/dunder-proto
+[actions-url]: https://github.com/es-shims/dunder-proto/actions
diff --git a/node_modules/dunder-proto/get.d.ts b/node_modules/dunder-proto/get.d.ts
new file mode 100644
index 0000000..c7e14d2
--- /dev/null
+++ b/node_modules/dunder-proto/get.d.ts
@@ -0,0 +1,5 @@
+declare function getDunderProto(target: {}): object | null;
+
+declare const x: false | typeof getDunderProto;
+
+export = x;
\ No newline at end of file
diff --git a/node_modules/dunder-proto/get.js b/node_modules/dunder-proto/get.js
new file mode 100644
index 0000000..45093df
--- /dev/null
+++ b/node_modules/dunder-proto/get.js
@@ -0,0 +1,30 @@
+'use strict';
+
+var callBind = require('call-bind-apply-helpers');
+var gOPD = require('gopd');
+
+var hasProtoAccessor;
+try {
+ // eslint-disable-next-line no-extra-parens, no-proto
+ hasProtoAccessor = /** @type {{ __proto__?: typeof Array.prototype }} */ ([]).__proto__ === Array.prototype;
+} catch (e) {
+ if (!e || typeof e !== 'object' || !('code' in e) || e.code !== 'ERR_PROTO_ACCESS') {
+ throw e;
+ }
+}
+
+// eslint-disable-next-line no-extra-parens
+var desc = !!hasProtoAccessor && gOPD && gOPD(Object.prototype, /** @type {keyof typeof Object.prototype} */ ('__proto__'));
+
+var $Object = Object;
+var $getPrototypeOf = $Object.getPrototypeOf;
+
+/** @type {import('./get')} */
+module.exports = desc && typeof desc.get === 'function'
+ ? callBind([desc.get])
+ : typeof $getPrototypeOf === 'function'
+ ? /** @type {import('./get')} */ function getDunder(value) {
+ // eslint-disable-next-line eqeqeq
+ return $getPrototypeOf(value == null ? value : $Object(value));
+ }
+ : false;
diff --git a/node_modules/dunder-proto/package.json b/node_modules/dunder-proto/package.json
new file mode 100644
index 0000000..04a4036
--- /dev/null
+++ b/node_modules/dunder-proto/package.json
@@ -0,0 +1,76 @@
+{
+ "name": "dunder-proto",
+ "version": "1.0.1",
+ "description": "If available, the `Object.prototype.__proto__` accessor and mutator, call-bound",
+ "main": false,
+ "exports": {
+ "./get": "./get.js",
+ "./set": "./set.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=.js,.mjs .",
+ "postlint": "tsc -p . && attw -P",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "npx npm@'>= 10.2' audit --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/es-shims/dunder-proto.git"
+ },
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/es-shims/dunder-proto/issues"
+ },
+ "homepage": "https://github.com/es-shims/dunder-proto#readme",
+ "dependencies": {
+ "call-bind-apply-helpers": "^1.0.1",
+ "es-errors": "^1.3.0",
+ "gopd": "^1.2.0"
+ },
+ "devDependencies": {
+ "@arethetypeswrong/cli": "^0.17.1",
+ "@ljharb/eslint-config": "^21.1.1",
+ "@ljharb/tsconfig": "^0.2.2",
+ "@types/tape": "^5.7.0",
+ "auto-changelog": "^2.5.0",
+ "encoding": "^0.1.13",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.9.0",
+ "typescript": "next"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/dunder-proto/set.d.ts b/node_modules/dunder-proto/set.d.ts
new file mode 100644
index 0000000..16bfdfe
--- /dev/null
+++ b/node_modules/dunder-proto/set.d.ts
@@ -0,0 +1,5 @@
+declare function setDunderProto(target: {}, proto: P): P;
+
+declare const x: false | typeof setDunderProto;
+
+export = x;
\ No newline at end of file
diff --git a/node_modules/dunder-proto/set.js b/node_modules/dunder-proto/set.js
new file mode 100644
index 0000000..6085b6e
--- /dev/null
+++ b/node_modules/dunder-proto/set.js
@@ -0,0 +1,35 @@
+'use strict';
+
+var callBind = require('call-bind-apply-helpers');
+var gOPD = require('gopd');
+var $TypeError = require('es-errors/type');
+
+/** @type {{ __proto__?: object | null }} */
+var obj = {};
+try {
+ obj.__proto__ = null; // eslint-disable-line no-proto
+} catch (e) {
+ if (!e || typeof e !== 'object' || !('code' in e) || e.code !== 'ERR_PROTO_ACCESS') {
+ throw e;
+ }
+}
+
+var hasProtoMutator = !('toString' in obj);
+
+// eslint-disable-next-line no-extra-parens
+var desc = gOPD && gOPD(Object.prototype, /** @type {keyof typeof Object.prototype} */ ('__proto__'));
+
+/** @type {import('./set')} */
+module.exports = hasProtoMutator && (
+// eslint-disable-next-line no-extra-parens
+ (!!desc && typeof desc.set === 'function' && /** @type {import('./set')} */ (callBind([desc.set])))
+ || /** @type {import('./set')} */ function setDunder(object, proto) {
+ // this is node v0.10 or older, which doesn't have Object.setPrototypeOf and has undeniable __proto__
+ if (object == null) { // eslint-disable-line eqeqeq
+ throw new $TypeError('set Object.prototype.__proto__ called on null or undefined');
+ }
+ // eslint-disable-next-line no-proto, no-param-reassign, no-extra-parens
+ /** @type {{ __proto__?: object | null }} */ (object).__proto__ = proto;
+ return proto;
+ }
+);
diff --git a/node_modules/dunder-proto/test/get.js b/node_modules/dunder-proto/test/get.js
new file mode 100644
index 0000000..253f183
--- /dev/null
+++ b/node_modules/dunder-proto/test/get.js
@@ -0,0 +1,34 @@
+'use strict';
+
+var test = require('tape');
+
+var getDunderProto = require('../get');
+
+test('getDunderProto', { skip: !getDunderProto }, function (t) {
+ if (!getDunderProto) {
+ throw 'should never happen; this is just for type narrowing'; // eslint-disable-line no-throw-literal
+ }
+
+ // @ts-expect-error
+ t['throws'](function () { getDunderProto(); }, TypeError, 'throws if no argument');
+ // @ts-expect-error
+ t['throws'](function () { getDunderProto(undefined); }, TypeError, 'throws with undefined');
+ // @ts-expect-error
+ t['throws'](function () { getDunderProto(null); }, TypeError, 'throws with null');
+
+ t.equal(getDunderProto({}), Object.prototype);
+ t.equal(getDunderProto([]), Array.prototype);
+ t.equal(getDunderProto(function () {}), Function.prototype);
+ t.equal(getDunderProto(/./g), RegExp.prototype);
+ t.equal(getDunderProto(42), Number.prototype);
+ t.equal(getDunderProto(true), Boolean.prototype);
+ t.equal(getDunderProto('foo'), String.prototype);
+
+ t.end();
+});
+
+test('no dunder proto', { skip: !!getDunderProto }, function (t) {
+ t.notOk('__proto__' in Object.prototype, 'no __proto__ in Object.prototype');
+
+ t.end();
+});
diff --git a/node_modules/dunder-proto/test/index.js b/node_modules/dunder-proto/test/index.js
new file mode 100644
index 0000000..08ff36f
--- /dev/null
+++ b/node_modules/dunder-proto/test/index.js
@@ -0,0 +1,4 @@
+'use strict';
+
+require('./get');
+require('./set');
diff --git a/node_modules/dunder-proto/test/set.js b/node_modules/dunder-proto/test/set.js
new file mode 100644
index 0000000..c3bfe4d
--- /dev/null
+++ b/node_modules/dunder-proto/test/set.js
@@ -0,0 +1,50 @@
+'use strict';
+
+var test = require('tape');
+
+var setDunderProto = require('../set');
+
+test('setDunderProto', { skip: !setDunderProto }, function (t) {
+ if (!setDunderProto) {
+ throw 'should never happen; this is just for type narrowing'; // eslint-disable-line no-throw-literal
+ }
+
+ // @ts-expect-error
+ t['throws'](function () { setDunderProto(); }, TypeError, 'throws if no arguments');
+ // @ts-expect-error
+ t['throws'](function () { setDunderProto(undefined); }, TypeError, 'throws with undefined and nothing');
+ // @ts-expect-error
+ t['throws'](function () { setDunderProto(undefined, undefined); }, TypeError, 'throws with undefined and undefined');
+ // @ts-expect-error
+ t['throws'](function () { setDunderProto(null); }, TypeError, 'throws with null and undefined');
+ // @ts-expect-error
+ t['throws'](function () { setDunderProto(null, undefined); }, TypeError, 'throws with null and undefined');
+
+ /** @type {{ inherited?: boolean }} */
+ var obj = {};
+ t.ok('toString' in obj, 'object initially has toString');
+
+ setDunderProto(obj, null);
+ t.notOk('toString' in obj, 'object no longer has toString');
+
+ t.notOk('inherited' in obj, 'object lacks inherited property');
+ setDunderProto(obj, { inherited: true });
+ t.equal(obj.inherited, true, 'object has inherited property');
+
+ t.end();
+});
+
+test('no dunder proto', { skip: !!setDunderProto }, function (t) {
+ if ('__proto__' in Object.prototype) {
+ t['throws'](
+ // @ts-expect-error
+ function () { ({}).__proto__ = null; }, // eslint-disable-line no-proto
+ Error,
+ 'throws when setting Object.prototype.__proto__'
+ );
+ } else {
+ t.notOk('__proto__' in Object.prototype, 'no __proto__ in Object.prototype');
+ }
+
+ t.end();
+});
diff --git a/node_modules/dunder-proto/tsconfig.json b/node_modules/dunder-proto/tsconfig.json
new file mode 100644
index 0000000..dabbe23
--- /dev/null
+++ b/node_modules/dunder-proto/tsconfig.json
@@ -0,0 +1,9 @@
+{
+ "extends": "@ljharb/tsconfig",
+ "compilerOptions": {
+ "target": "ES2021",
+ },
+ "exclude": [
+ "coverage",
+ ],
+}
diff --git a/node_modules/ecdsa-sig-formatter/CODEOWNERS b/node_modules/ecdsa-sig-formatter/CODEOWNERS
new file mode 100644
index 0000000..4451d3d
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/CODEOWNERS
@@ -0,0 +1 @@
+* @omsmith
diff --git a/node_modules/ecdsa-sig-formatter/LICENSE b/node_modules/ecdsa-sig-formatter/LICENSE
new file mode 100644
index 0000000..8754ed6
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/LICENSE
@@ -0,0 +1,201 @@
+Apache License
+ Version 2.0, January 2004
+ http://www.apache.org/licenses/
+
+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+ 1. Definitions.
+
+ "License" shall mean the terms and conditions for use, reproduction,
+ and distribution as defined by Sections 1 through 9 of this document.
+
+ "Licensor" shall mean the copyright owner or entity authorized by
+ the copyright owner that is granting the License.
+
+ "Legal Entity" shall mean the union of the acting entity and all
+ other entities that control, are controlled by, or are under common
+ control with that entity. For the purposes of this definition,
+ "control" means (i) the power, direct or indirect, to cause the
+ direction or management of such entity, whether by contract or
+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
+ outstanding shares, or (iii) beneficial ownership of such entity.
+
+ "You" (or "Your") shall mean an individual or Legal Entity
+ exercising permissions granted by this License.
+
+ "Source" form shall mean the preferred form for making modifications,
+ including but not limited to software source code, documentation
+ source, and configuration files.
+
+ "Object" form shall mean any form resulting from mechanical
+ transformation or translation of a Source form, including but
+ not limited to compiled object code, generated documentation,
+ and conversions to other media types.
+
+ "Work" shall mean the work of authorship, whether in Source or
+ Object form, made available under the License, as indicated by a
+ copyright notice that is included in or attached to the work
+ (an example is provided in the Appendix below).
+
+ "Derivative Works" shall mean any work, whether in Source or Object
+ form, that is based on (or derived from) the Work and for which the
+ editorial revisions, annotations, elaborations, or other modifications
+ represent, as a whole, an original work of authorship. For the purposes
+ of this License, Derivative Works shall not include works that remain
+ separable from, or merely link (or bind by name) to the interfaces of,
+ the Work and Derivative Works thereof.
+
+ "Contribution" shall mean any work of authorship, including
+ the original version of the Work and any modifications or additions
+ to that Work or Derivative Works thereof, that is intentionally
+ submitted to Licensor for inclusion in the Work by the copyright owner
+ or by an individual or Legal Entity authorized to submit on behalf of
+ the copyright owner. For the purposes of this definition, "submitted"
+ means any form of electronic, verbal, or written communication sent
+ to the Licensor or its representatives, including but not limited to
+ communication on electronic mailing lists, source code control systems,
+ and issue tracking systems that are managed by, or on behalf of, the
+ Licensor for the purpose of discussing and improving the Work, but
+ excluding communication that is conspicuously marked or otherwise
+ designated in writing by the copyright owner as "Not a Contribution."
+
+ "Contributor" shall mean Licensor and any individual or Legal Entity
+ on behalf of whom a Contribution has been received by Licensor and
+ subsequently incorporated within the Work.
+
+ 2. Grant of Copyright License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ copyright license to reproduce, prepare Derivative Works of,
+ publicly display, publicly perform, sublicense, and distribute the
+ Work and such Derivative Works in Source or Object form.
+
+ 3. Grant of Patent License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ (except as stated in this section) patent license to make, have made,
+ use, offer to sell, sell, import, and otherwise transfer the Work,
+ where such license applies only to those patent claims licensable
+ by such Contributor that are necessarily infringed by their
+ Contribution(s) alone or by combination of their Contribution(s)
+ with the Work to which such Contribution(s) was submitted. If You
+ institute patent litigation against any entity (including a
+ cross-claim or counterclaim in a lawsuit) alleging that the Work
+ or a Contribution incorporated within the Work constitutes direct
+ or contributory patent infringement, then any patent licenses
+ granted to You under this License for that Work shall terminate
+ as of the date such litigation is filed.
+
+ 4. Redistribution. You may reproduce and distribute copies of the
+ Work or Derivative Works thereof in any medium, with or without
+ modifications, and in Source or Object form, provided that You
+ meet the following conditions:
+
+ (a) You must give any other recipients of the Work or
+ Derivative Works a copy of this License; and
+
+ (b) You must cause any modified files to carry prominent notices
+ stating that You changed the files; and
+
+ (c) You must retain, in the Source form of any Derivative Works
+ that You distribute, all copyright, patent, trademark, and
+ attribution notices from the Source form of the Work,
+ excluding those notices that do not pertain to any part of
+ the Derivative Works; and
+
+ (d) If the Work includes a "NOTICE" text file as part of its
+ distribution, then any Derivative Works that You distribute must
+ include a readable copy of the attribution notices contained
+ within such NOTICE file, excluding those notices that do not
+ pertain to any part of the Derivative Works, in at least one
+ of the following places: within a NOTICE text file distributed
+ as part of the Derivative Works; within the Source form or
+ documentation, if provided along with the Derivative Works; or,
+ within a display generated by the Derivative Works, if and
+ wherever such third-party notices normally appear. The contents
+ of the NOTICE file are for informational purposes only and
+ do not modify the License. You may add Your own attribution
+ notices within Derivative Works that You distribute, alongside
+ or as an addendum to the NOTICE text from the Work, provided
+ that such additional attribution notices cannot be construed
+ as modifying the License.
+
+ You may add Your own copyright statement to Your modifications and
+ may provide additional or different license terms and conditions
+ for use, reproduction, or distribution of Your modifications, or
+ for any such Derivative Works as a whole, provided Your use,
+ reproduction, and distribution of the Work otherwise complies with
+ the conditions stated in this License.
+
+ 5. Submission of Contributions. Unless You explicitly state otherwise,
+ any Contribution intentionally submitted for inclusion in the Work
+ by You to the Licensor shall be under the terms and conditions of
+ this License, without any additional terms or conditions.
+ Notwithstanding the above, nothing herein shall supersede or modify
+ the terms of any separate license agreement you may have executed
+ with Licensor regarding such Contributions.
+
+ 6. Trademarks. This License does not grant permission to use the trade
+ names, trademarks, service marks, or product names of the Licensor,
+ except as required for reasonable and customary use in describing the
+ origin of the Work and reproducing the content of the NOTICE file.
+
+ 7. Disclaimer of Warranty. Unless required by applicable law or
+ agreed to in writing, Licensor provides the Work (and each
+ Contributor provides its Contributions) on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+ implied, including, without limitation, any warranties or conditions
+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+ PARTICULAR PURPOSE. You are solely responsible for determining the
+ appropriateness of using or redistributing the Work and assume any
+ risks associated with Your exercise of permissions under this License.
+
+ 8. Limitation of Liability. In no event and under no legal theory,
+ whether in tort (including negligence), contract, or otherwise,
+ unless required by applicable law (such as deliberate and grossly
+ negligent acts) or agreed to in writing, shall any Contributor be
+ liable to You for damages, including any direct, indirect, special,
+ incidental, or consequential damages of any character arising as a
+ result of this License or out of the use or inability to use the
+ Work (including but not limited to damages for loss of goodwill,
+ work stoppage, computer failure or malfunction, or any and all
+ other commercial damages or losses), even if such Contributor
+ has been advised of the possibility of such damages.
+
+ 9. Accepting Warranty or Additional Liability. While redistributing
+ the Work or Derivative Works thereof, You may choose to offer,
+ and charge a fee for, acceptance of support, warranty, indemnity,
+ or other liability obligations and/or rights consistent with this
+ License. However, in accepting such obligations, You may act only
+ on Your own behalf and on Your sole responsibility, not on behalf
+ of any other Contributor, and only if You agree to indemnify,
+ defend, and hold each Contributor harmless for any liability
+ incurred by, or claims asserted against, such Contributor by reason
+ of your accepting any such warranty or additional liability.
+
+ END OF TERMS AND CONDITIONS
+
+ APPENDIX: How to apply the Apache License to your work.
+
+ To apply the Apache License to your work, attach the following
+ boilerplate notice, with the fields enclosed by brackets "{}"
+ replaced with your own identifying information. (Don't include
+ the brackets!) The text should be enclosed in the appropriate
+ comment syntax for the file format. We also recommend that a
+ file or class name and description of purpose be included on the
+ same "printed page" as the copyright notice for easier
+ identification within third-party archives.
+
+ Copyright 2015 D2L Corporation
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
diff --git a/node_modules/ecdsa-sig-formatter/README.md b/node_modules/ecdsa-sig-formatter/README.md
new file mode 100644
index 0000000..daa95d6
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/README.md
@@ -0,0 +1,65 @@
+# ecdsa-sig-formatter
+
+[](https://travis-ci.org/Brightspace/node-ecdsa-sig-formatter) [](https://coveralls.io/r/Brightspace/node-ecdsa-sig-formatter)
+
+Translate between JOSE and ASN.1/DER encodings for ECDSA signatures
+
+## Install
+```sh
+npm install ecdsa-sig-formatter --save
+```
+
+## Usage
+```js
+var format = require('ecdsa-sig-formatter');
+
+var derSignature = '..'; // asn.1/DER encoded ecdsa signature
+
+var joseSignature = format.derToJose(derSignature);
+
+```
+
+### API
+
+---
+
+#### `.derToJose(Buffer|String signature, String alg)` -> `String`
+
+Convert the ASN.1/DER encoded signature to a JOSE-style concatenated signature.
+Returns a _base64 url_ encoded `String`.
+
+* If _signature_ is a `String`, it should be _base64_ encoded
+* _alg_ must be one of _ES256_, _ES384_ or _ES512_
+
+---
+
+#### `.joseToDer(Buffer|String signature, String alg)` -> `Buffer`
+
+Convert the JOSE-style concatenated signature to an ASN.1/DER encoded
+signature. Returns a `Buffer`
+
+* If _signature_ is a `String`, it should be _base64 url_ encoded
+* _alg_ must be one of _ES256_, _ES384_ or _ES512_
+
+## Contributing
+
+1. **Fork** the repository. Committing directly against this repository is
+ highly discouraged.
+
+2. Make your modifications in a branch, updating and writing new unit tests
+ as necessary in the `spec` directory.
+
+3. Ensure that all tests pass with `npm test`
+
+4. `rebase` your changes against master. *Do not merge*.
+
+5. Submit a pull request to this repository. Wait for tests to run and someone
+ to chime in.
+
+### Code Style
+
+This repository is configured with [EditorConfig][EditorConfig] and
+[ESLint][ESLint] rules.
+
+[EditorConfig]: http://editorconfig.org/
+[ESLint]: http://eslint.org
diff --git a/node_modules/ecdsa-sig-formatter/package.json b/node_modules/ecdsa-sig-formatter/package.json
new file mode 100644
index 0000000..6fb5ebf
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/package.json
@@ -0,0 +1,46 @@
+{
+ "name": "ecdsa-sig-formatter",
+ "version": "1.0.11",
+ "description": "Translate ECDSA signatures between ASN.1/DER and JOSE-style concatenation",
+ "main": "src/ecdsa-sig-formatter.js",
+ "scripts": {
+ "check-style": "eslint .",
+ "pretest": "npm run check-style",
+ "test": "istanbul cover --root src _mocha -- spec",
+ "report-cov": "cat ./coverage/lcov.info | coveralls"
+ },
+ "typings": "./src/ecdsa-sig-formatter.d.ts",
+ "repository": {
+ "type": "git",
+ "url": "git+ssh://git@github.com/Brightspace/node-ecdsa-sig-formatter.git"
+ },
+ "keywords": [
+ "ecdsa",
+ "der",
+ "asn.1",
+ "jwt",
+ "jwa",
+ "jsonwebtoken",
+ "jose"
+ ],
+ "author": "D2L Corporation",
+ "license": "Apache-2.0",
+ "bugs": {
+ "url": "https://github.com/Brightspace/node-ecdsa-sig-formatter/issues"
+ },
+ "homepage": "https://github.com/Brightspace/node-ecdsa-sig-formatter#readme",
+ "dependencies": {
+ "safe-buffer": "^5.0.1"
+ },
+ "devDependencies": {
+ "bench": "^0.3.6",
+ "chai": "^3.5.0",
+ "coveralls": "^2.11.9",
+ "eslint": "^2.12.0",
+ "eslint-config-brightspace": "^0.2.1",
+ "istanbul": "^0.4.3",
+ "jwk-to-pem": "^1.2.5",
+ "mocha": "^2.5.3",
+ "native-crypto": "^1.7.0"
+ }
+}
diff --git a/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts b/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts
new file mode 100644
index 0000000..9693aa0
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts
@@ -0,0 +1,17 @@
+///
+
+declare module "ecdsa-sig-formatter" {
+ /**
+ * Convert the ASN.1/DER encoded signature to a JOSE-style concatenated signature. Returns a base64 url encoded String.
+ * If signature is a String, it should be base64 encoded
+ * alg must be one of ES256, ES384 or ES512
+ */
+ export function derToJose(signature: Buffer | string, alg: string): string;
+
+ /**
+ * Convert the JOSE-style concatenated signature to an ASN.1/DER encoded signature. Returns a Buffer
+ * If signature is a String, it should be base64 url encoded
+ * alg must be one of ES256, ES384 or ES512
+ */
+ export function joseToDer(signature: Buffer | string, alg: string): Buffer
+}
diff --git a/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.js b/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.js
new file mode 100644
index 0000000..38eeb9b
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.js
@@ -0,0 +1,187 @@
+'use strict';
+
+var Buffer = require('safe-buffer').Buffer;
+
+var getParamBytesForAlg = require('./param-bytes-for-alg');
+
+var MAX_OCTET = 0x80,
+ CLASS_UNIVERSAL = 0,
+ PRIMITIVE_BIT = 0x20,
+ TAG_SEQ = 0x10,
+ TAG_INT = 0x02,
+ ENCODED_TAG_SEQ = (TAG_SEQ | PRIMITIVE_BIT) | (CLASS_UNIVERSAL << 6),
+ ENCODED_TAG_INT = TAG_INT | (CLASS_UNIVERSAL << 6);
+
+function base64Url(base64) {
+ return base64
+ .replace(/=/g, '')
+ .replace(/\+/g, '-')
+ .replace(/\//g, '_');
+}
+
+function signatureAsBuffer(signature) {
+ if (Buffer.isBuffer(signature)) {
+ return signature;
+ } else if ('string' === typeof signature) {
+ return Buffer.from(signature, 'base64');
+ }
+
+ throw new TypeError('ECDSA signature must be a Base64 string or a Buffer');
+}
+
+function derToJose(signature, alg) {
+ signature = signatureAsBuffer(signature);
+ var paramBytes = getParamBytesForAlg(alg);
+
+ // the DER encoded param should at most be the param size, plus a padding
+ // zero, since due to being a signed integer
+ var maxEncodedParamLength = paramBytes + 1;
+
+ var inputLength = signature.length;
+
+ var offset = 0;
+ if (signature[offset++] !== ENCODED_TAG_SEQ) {
+ throw new Error('Could not find expected "seq"');
+ }
+
+ var seqLength = signature[offset++];
+ if (seqLength === (MAX_OCTET | 1)) {
+ seqLength = signature[offset++];
+ }
+
+ if (inputLength - offset < seqLength) {
+ throw new Error('"seq" specified length of "' + seqLength + '", only "' + (inputLength - offset) + '" remaining');
+ }
+
+ if (signature[offset++] !== ENCODED_TAG_INT) {
+ throw new Error('Could not find expected "int" for "r"');
+ }
+
+ var rLength = signature[offset++];
+
+ if (inputLength - offset - 2 < rLength) {
+ throw new Error('"r" specified length of "' + rLength + '", only "' + (inputLength - offset - 2) + '" available');
+ }
+
+ if (maxEncodedParamLength < rLength) {
+ throw new Error('"r" specified length of "' + rLength + '", max of "' + maxEncodedParamLength + '" is acceptable');
+ }
+
+ var rOffset = offset;
+ offset += rLength;
+
+ if (signature[offset++] !== ENCODED_TAG_INT) {
+ throw new Error('Could not find expected "int" for "s"');
+ }
+
+ var sLength = signature[offset++];
+
+ if (inputLength - offset !== sLength) {
+ throw new Error('"s" specified length of "' + sLength + '", expected "' + (inputLength - offset) + '"');
+ }
+
+ if (maxEncodedParamLength < sLength) {
+ throw new Error('"s" specified length of "' + sLength + '", max of "' + maxEncodedParamLength + '" is acceptable');
+ }
+
+ var sOffset = offset;
+ offset += sLength;
+
+ if (offset !== inputLength) {
+ throw new Error('Expected to consume entire buffer, but "' + (inputLength - offset) + '" bytes remain');
+ }
+
+ var rPadding = paramBytes - rLength,
+ sPadding = paramBytes - sLength;
+
+ var dst = Buffer.allocUnsafe(rPadding + rLength + sPadding + sLength);
+
+ for (offset = 0; offset < rPadding; ++offset) {
+ dst[offset] = 0;
+ }
+ signature.copy(dst, offset, rOffset + Math.max(-rPadding, 0), rOffset + rLength);
+
+ offset = paramBytes;
+
+ for (var o = offset; offset < o + sPadding; ++offset) {
+ dst[offset] = 0;
+ }
+ signature.copy(dst, offset, sOffset + Math.max(-sPadding, 0), sOffset + sLength);
+
+ dst = dst.toString('base64');
+ dst = base64Url(dst);
+
+ return dst;
+}
+
+function countPadding(buf, start, stop) {
+ var padding = 0;
+ while (start + padding < stop && buf[start + padding] === 0) {
+ ++padding;
+ }
+
+ var needsSign = buf[start + padding] >= MAX_OCTET;
+ if (needsSign) {
+ --padding;
+ }
+
+ return padding;
+}
+
+function joseToDer(signature, alg) {
+ signature = signatureAsBuffer(signature);
+ var paramBytes = getParamBytesForAlg(alg);
+
+ var signatureBytes = signature.length;
+ if (signatureBytes !== paramBytes * 2) {
+ throw new TypeError('"' + alg + '" signatures must be "' + paramBytes * 2 + '" bytes, saw "' + signatureBytes + '"');
+ }
+
+ var rPadding = countPadding(signature, 0, paramBytes);
+ var sPadding = countPadding(signature, paramBytes, signature.length);
+ var rLength = paramBytes - rPadding;
+ var sLength = paramBytes - sPadding;
+
+ var rsBytes = 1 + 1 + rLength + 1 + 1 + sLength;
+
+ var shortLength = rsBytes < MAX_OCTET;
+
+ var dst = Buffer.allocUnsafe((shortLength ? 2 : 3) + rsBytes);
+
+ var offset = 0;
+ dst[offset++] = ENCODED_TAG_SEQ;
+ if (shortLength) {
+ // Bit 8 has value "0"
+ // bits 7-1 give the length.
+ dst[offset++] = rsBytes;
+ } else {
+ // Bit 8 of first octet has value "1"
+ // bits 7-1 give the number of additional length octets.
+ dst[offset++] = MAX_OCTET | 1;
+ // length, base 256
+ dst[offset++] = rsBytes & 0xff;
+ }
+ dst[offset++] = ENCODED_TAG_INT;
+ dst[offset++] = rLength;
+ if (rPadding < 0) {
+ dst[offset++] = 0;
+ offset += signature.copy(dst, offset, 0, paramBytes);
+ } else {
+ offset += signature.copy(dst, offset, rPadding, paramBytes);
+ }
+ dst[offset++] = ENCODED_TAG_INT;
+ dst[offset++] = sLength;
+ if (sPadding < 0) {
+ dst[offset++] = 0;
+ signature.copy(dst, offset, paramBytes);
+ } else {
+ signature.copy(dst, offset, paramBytes + sPadding);
+ }
+
+ return dst;
+}
+
+module.exports = {
+ derToJose: derToJose,
+ joseToDer: joseToDer
+};
diff --git a/node_modules/ecdsa-sig-formatter/src/param-bytes-for-alg.js b/node_modules/ecdsa-sig-formatter/src/param-bytes-for-alg.js
new file mode 100644
index 0000000..9fe67ac
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/src/param-bytes-for-alg.js
@@ -0,0 +1,23 @@
+'use strict';
+
+function getParamSize(keySize) {
+ var result = ((keySize / 8) | 0) + (keySize % 8 === 0 ? 0 : 1);
+ return result;
+}
+
+var paramBytesForAlg = {
+ ES256: getParamSize(256),
+ ES384: getParamSize(384),
+ ES512: getParamSize(521)
+};
+
+function getParamBytesForAlg(alg) {
+ var paramBytes = paramBytesForAlg[alg];
+ if (paramBytes) {
+ return paramBytes;
+ }
+
+ throw new Error('Unknown algorithm "' + alg + '"');
+}
+
+module.exports = getParamBytesForAlg;
diff --git a/node_modules/ee-first/LICENSE b/node_modules/ee-first/LICENSE
new file mode 100644
index 0000000..a7ae8ee
--- /dev/null
+++ b/node_modules/ee-first/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/ee-first/README.md b/node_modules/ee-first/README.md
new file mode 100644
index 0000000..cbd2478
--- /dev/null
+++ b/node_modules/ee-first/README.md
@@ -0,0 +1,80 @@
+# EE First
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Get the first event in a set of event emitters and event pairs,
+then clean up after itself.
+
+## Install
+
+```sh
+$ npm install ee-first
+```
+
+## API
+
+```js
+var first = require('ee-first')
+```
+
+### first(arr, listener)
+
+Invoke `listener` on the first event from the list specified in `arr`. `arr` is
+an array of arrays, with each array in the format `[ee, ...event]`. `listener`
+will be called only once, the first time any of the given events are emitted. If
+`error` is one of the listened events, then if that fires first, the `listener`
+will be given the `err` argument.
+
+The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the
+first argument emitted from an `error` event, if applicable; `ee` is the event
+emitter that fired; `event` is the string event name that fired; and `args` is an
+array of the arguments that were emitted on the event.
+
+```js
+var ee1 = new EventEmitter()
+var ee2 = new EventEmitter()
+
+first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+```
+
+#### .cancel()
+
+The group of listeners can be cancelled before being invoked and have all the event
+listeners removed from the underlying event emitters.
+
+```js
+var thunk = first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+
+// cancel and clean up
+thunk.cancel()
+```
+
+[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/ee-first
+[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square
+[github-url]: https://github.com/jonathanong/ee-first/tags
+[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square
+[travis-url]: https://travis-ci.org/jonathanong/ee-first
+[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master
+[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/ee-first
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/node_modules/ee-first/index.js b/node_modules/ee-first/index.js
new file mode 100644
index 0000000..501287c
--- /dev/null
+++ b/node_modules/ee-first/index.js
@@ -0,0 +1,95 @@
+/*!
+ * ee-first
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = first
+
+/**
+ * Get the first event in a set of event emitters and event pairs.
+ *
+ * @param {array} stuff
+ * @param {function} done
+ * @public
+ */
+
+function first(stuff, done) {
+ if (!Array.isArray(stuff))
+ throw new TypeError('arg must be an array of [ee, events...] arrays')
+
+ var cleanups = []
+
+ for (var i = 0; i < stuff.length; i++) {
+ var arr = stuff[i]
+
+ if (!Array.isArray(arr) || arr.length < 2)
+ throw new TypeError('each array member must be [ee, events...]')
+
+ var ee = arr[0]
+
+ for (var j = 1; j < arr.length; j++) {
+ var event = arr[j]
+ var fn = listener(event, callback)
+
+ // listen to the event
+ ee.on(event, fn)
+ // push this listener to the list of cleanups
+ cleanups.push({
+ ee: ee,
+ event: event,
+ fn: fn,
+ })
+ }
+ }
+
+ function callback() {
+ cleanup()
+ done.apply(null, arguments)
+ }
+
+ function cleanup() {
+ var x
+ for (var i = 0; i < cleanups.length; i++) {
+ x = cleanups[i]
+ x.ee.removeListener(x.event, x.fn)
+ }
+ }
+
+ function thunk(fn) {
+ done = fn
+ }
+
+ thunk.cancel = cleanup
+
+ return thunk
+}
+
+/**
+ * Create the event listener.
+ * @private
+ */
+
+function listener(event, done) {
+ return function onevent(arg1) {
+ var args = new Array(arguments.length)
+ var ee = this
+ var err = event === 'error'
+ ? arg1
+ : null
+
+ // copy args to prevent arguments escaping scope
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i]
+ }
+
+ done(err, ee, event, args)
+ }
+}
diff --git a/node_modules/ee-first/package.json b/node_modules/ee-first/package.json
new file mode 100644
index 0000000..b6d0b7d
--- /dev/null
+++ b/node_modules/ee-first/package.json
@@ -0,0 +1,29 @@
+{
+ "name": "ee-first",
+ "description": "return the first event in a set of ee/event pairs",
+ "version": "1.1.1",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com",
+ "twitter": "https://twitter.com/jongleberry"
+ },
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "repository": "jonathanong/ee-first",
+ "devDependencies": {
+ "istanbul": "0.3.9",
+ "mocha": "2.2.5"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/node_modules/encodeurl/LICENSE b/node_modules/encodeurl/LICENSE
new file mode 100644
index 0000000..8812229
--- /dev/null
+++ b/node_modules/encodeurl/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/encodeurl/README.md b/node_modules/encodeurl/README.md
new file mode 100644
index 0000000..3842493
--- /dev/null
+++ b/node_modules/encodeurl/README.md
@@ -0,0 +1,109 @@
+# Encode URL
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+## Installation
+
+```sh
+npm install encodeurl
+```
+
+## API
+
+```js
+var encodeUrl = require('encodeurl')
+```
+
+### encodeUrl(url)
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+This function accepts a URL and encodes all the non-URL code points (as UTF-8 byte sequences). It will not encode the "%" character unless it is not part of a valid sequence (`%20` will be left as-is, but `%foo` will be encoded as `%25foo`).
+
+This encode is meant to be "safe" and does not throw errors. It will try as hard as it can to properly encode the given URL, including replacing any raw, unpaired surrogate pairs with the Unicode replacement character prior to encoding.
+
+## Examples
+
+### Encode a URL containing user-controlled data
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+
+http.createServer(function onRequest (req, res) {
+ // get encoded form of inbound url
+ var url = encodeUrl(req.url)
+
+ // create html message
+ var body = 'Location ' + escapeHtml(url) + ' not found
'
+
+ // send a 404
+ res.statusCode = 404
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.end(body, 'utf-8')
+})
+```
+
+### Encode a URL for use in a header field
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+var url = require('url')
+
+http.createServer(function onRequest (req, res) {
+ // parse inbound url
+ var href = url.parse(req)
+
+ // set new host for redirect
+ href.host = 'localhost'
+ href.protocol = 'https:'
+ href.slashes = true
+
+ // create location header
+ var location = encodeUrl(url.format(href))
+
+ // create html message
+ var body = 'Redirecting to new site: ' + escapeHtml(location) + '
'
+
+ // send a 301
+ res.statusCode = 301
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.setHeader('Location', location)
+ res.end(body, 'utf-8')
+})
+```
+
+## Similarities
+
+This function is _similar_ to the intrinsic function `encodeURI`. However, it will not encode:
+
+* The `\`, `^`, or `|` characters
+* The `%` character when it's part of a valid sequence
+* `[` and `]` (for IPv6 hostnames)
+* Replaces raw, unpaired surrogate pairs with the Unicode replacement character
+
+As a result, the encoding aligns closely with the behavior in the [WHATWG URL specification][whatwg-url]. However, this package only encodes strings and does not do any URL parsing or formatting.
+
+It is expected that any output from `new URL(url)` will not change when used with this package, as the output has already been encoded. Additionally, if we were to encode before `new URL(url)`, we do not expect the before and after encoded formats to be parsed any differently.
+
+## Testing
+
+```sh
+$ npm test
+$ npm run lint
+```
+
+## References
+
+- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986]
+- [WHATWG URL Living Standard][whatwg-url]
+
+[rfc-3986]: https://tools.ietf.org/html/rfc3986
+[whatwg-url]: https://url.spec.whatwg.org/
+
+## License
+
+[MIT](LICENSE)
diff --git a/node_modules/encodeurl/index.js b/node_modules/encodeurl/index.js
new file mode 100644
index 0000000..a49ee5a
--- /dev/null
+++ b/node_modules/encodeurl/index.js
@@ -0,0 +1,60 @@
+/*!
+ * encodeurl
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = encodeUrl
+
+/**
+ * RegExp to match non-URL code points, *after* encoding (i.e. not including "%")
+ * and including invalid escape sequences.
+ * @private
+ */
+
+var ENCODE_CHARS_REGEXP = /(?:[^\x21\x23-\x3B\x3D\x3F-\x5F\x61-\x7A\x7C\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g
+
+/**
+ * RegExp to match unmatched surrogate pair.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g
+
+/**
+ * String to replace unmatched surrogate pair with.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2'
+
+/**
+ * Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+ *
+ * This function will take an already-encoded URL and encode all the non-URL
+ * code points. This function will not encode the "%" character unless it is
+ * not part of a valid sequence (`%20` will be left as-is, but `%foo` will
+ * be encoded as `%25foo`).
+ *
+ * This encode is meant to be "safe" and does not throw errors. It will try as
+ * hard as it can to properly encode the given URL, including replacing any raw,
+ * unpaired surrogate pairs with the Unicode replacement character prior to
+ * encoding.
+ *
+ * @param {string} url
+ * @return {string}
+ * @public
+ */
+
+function encodeUrl (url) {
+ return String(url)
+ .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE)
+ .replace(ENCODE_CHARS_REGEXP, encodeURI)
+}
diff --git a/node_modules/encodeurl/package.json b/node_modules/encodeurl/package.json
new file mode 100644
index 0000000..3133822
--- /dev/null
+++ b/node_modules/encodeurl/package.json
@@ -0,0 +1,40 @@
+{
+ "name": "encodeurl",
+ "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences",
+ "version": "2.0.0",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "encode",
+ "encodeurl",
+ "url"
+ ],
+ "repository": "pillarjs/encodeurl",
+ "devDependencies": {
+ "eslint": "5.11.1",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.14.0",
+ "eslint-plugin-node": "7.0.1",
+ "eslint-plugin-promise": "4.0.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "2.5.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/node_modules/es-define-property/.eslintrc b/node_modules/es-define-property/.eslintrc
new file mode 100644
index 0000000..46f3b12
--- /dev/null
+++ b/node_modules/es-define-property/.eslintrc
@@ -0,0 +1,13 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "new-cap": ["error", {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ },
+}
diff --git a/node_modules/es-define-property/.github/FUNDING.yml b/node_modules/es-define-property/.github/FUNDING.yml
new file mode 100644
index 0000000..4445451
--- /dev/null
+++ b/node_modules/es-define-property/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/es-define-property
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with a single custom sponsorship URL
diff --git a/node_modules/es-define-property/.nycrc b/node_modules/es-define-property/.nycrc
new file mode 100644
index 0000000..bdd626c
--- /dev/null
+++ b/node_modules/es-define-property/.nycrc
@@ -0,0 +1,9 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/es-define-property/CHANGELOG.md b/node_modules/es-define-property/CHANGELOG.md
new file mode 100644
index 0000000..5f60cc0
--- /dev/null
+++ b/node_modules/es-define-property/CHANGELOG.md
@@ -0,0 +1,29 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.0.1](https://github.com/ljharb/es-define-property/compare/v1.0.0...v1.0.1) - 2024-12-06
+
+### Commits
+
+- [types] use shared tsconfig [`954a663`](https://github.com/ljharb/es-define-property/commit/954a66360326e508a0e5daa4b07493d58f5e110e)
+- [actions] split out node 10-20, and 20+ [`3a8e84b`](https://github.com/ljharb/es-define-property/commit/3a8e84b23883f26ff37b3e82ff283834228e18c6)
+- [Dev Deps] update `@ljharb/eslint-config`, `@ljharb/tsconfig`, `@types/get-intrinsic`, `@types/tape`, `auto-changelog`, `gopd`, `tape` [`86ae27b`](https://github.com/ljharb/es-define-property/commit/86ae27bb8cc857b23885136fad9cbe965ae36612)
+- [Refactor] avoid using `get-intrinsic` [`02480c0`](https://github.com/ljharb/es-define-property/commit/02480c0353ef6118965282977c3864aff53d98b1)
+- [Tests] replace `aud` with `npm audit` [`f6093ff`](https://github.com/ljharb/es-define-property/commit/f6093ff74ab51c98015c2592cd393bd42478e773)
+- [Tests] configure testling [`7139e66`](https://github.com/ljharb/es-define-property/commit/7139e66959247a56086d9977359caef27c6849e7)
+- [Dev Deps] update `tape` [`b901b51`](https://github.com/ljharb/es-define-property/commit/b901b511a75e001a40ce1a59fef7d9ffcfc87482)
+- [Tests] fix types in tests [`469d269`](https://github.com/ljharb/es-define-property/commit/469d269fd141b1e773ec053a9fa35843493583e0)
+- [Dev Deps] add missing peer dep [`733acfb`](https://github.com/ljharb/es-define-property/commit/733acfb0c4c96edf337e470b89a25a5b3724c352)
+
+## v1.0.0 - 2024-02-12
+
+### Commits
+
+- Initial implementation, tests, readme, types [`3e154e1`](https://github.com/ljharb/es-define-property/commit/3e154e11a2fee09127220f5e503bf2c0a31dd480)
+- Initial commit [`07d98de`](https://github.com/ljharb/es-define-property/commit/07d98de34a4dc31ff5e83a37c0c3f49e0d85cd50)
+- npm init [`c4eb634`](https://github.com/ljharb/es-define-property/commit/c4eb6348b0d3886aac36cef34ad2ee0665ea6f3e)
+- Only apps should have lockfiles [`7af86ec`](https://github.com/ljharb/es-define-property/commit/7af86ec1d311ec0b17fdfe616a25f64276903856)
diff --git a/node_modules/es-define-property/LICENSE b/node_modules/es-define-property/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/es-define-property/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/es-define-property/README.md b/node_modules/es-define-property/README.md
new file mode 100644
index 0000000..9b291bd
--- /dev/null
+++ b/node_modules/es-define-property/README.md
@@ -0,0 +1,49 @@
+# es-define-property [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+`Object.defineProperty`, but not IE 8's broken one.
+
+## Example
+
+```js
+const assert = require('assert');
+
+const $defineProperty = require('es-define-property');
+
+if ($defineProperty) {
+ assert.equal($defineProperty, Object.defineProperty);
+} else if (Object.defineProperty) {
+ assert.equal($defineProperty, false, 'this is IE 8');
+} else {
+ assert.equal($defineProperty, false, 'this is an ES3 engine');
+}
+```
+
+## Tests
+Simply clone the repo, `npm install`, and run `npm test`
+
+## Security
+
+Please email [@ljharb](https://github.com/ljharb) or see https://tidelift.com/security if you have a potential security vulnerability to report.
+
+[package-url]: https://npmjs.org/package/es-define-property
+[npm-version-svg]: https://versionbadg.es/ljharb/es-define-property.svg
+[deps-svg]: https://david-dm.org/ljharb/es-define-property.svg
+[deps-url]: https://david-dm.org/ljharb/es-define-property
+[dev-deps-svg]: https://david-dm.org/ljharb/es-define-property/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/es-define-property#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/es-define-property.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/es-define-property.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/es-define-property.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=es-define-property
+[codecov-image]: https://codecov.io/gh/ljharb/es-define-property/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/es-define-property/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/es-define-property
+[actions-url]: https://github.com/ljharb/es-define-property/actions
diff --git a/node_modules/es-define-property/index.d.ts b/node_modules/es-define-property/index.d.ts
new file mode 100644
index 0000000..6012247
--- /dev/null
+++ b/node_modules/es-define-property/index.d.ts
@@ -0,0 +1,3 @@
+declare const defineProperty: false | typeof Object.defineProperty;
+
+export = defineProperty;
\ No newline at end of file
diff --git a/node_modules/es-define-property/index.js b/node_modules/es-define-property/index.js
new file mode 100644
index 0000000..e0a2925
--- /dev/null
+++ b/node_modules/es-define-property/index.js
@@ -0,0 +1,14 @@
+'use strict';
+
+/** @type {import('.')} */
+var $defineProperty = Object.defineProperty || false;
+if ($defineProperty) {
+ try {
+ $defineProperty({}, 'a', { value: 1 });
+ } catch (e) {
+ // IE 8 has a broken defineProperty
+ $defineProperty = false;
+ }
+}
+
+module.exports = $defineProperty;
diff --git a/node_modules/es-define-property/package.json b/node_modules/es-define-property/package.json
new file mode 100644
index 0000000..fbed187
--- /dev/null
+++ b/node_modules/es-define-property/package.json
@@ -0,0 +1,81 @@
+{
+ "name": "es-define-property",
+ "version": "1.0.1",
+ "description": "`Object.defineProperty`, but not IE 8's broken one.",
+ "main": "index.js",
+ "types": "./index.d.ts",
+ "exports": {
+ ".": "./index.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "tsc -p .",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "npx npm@'>= 10.2' audit --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/es-define-property.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "object",
+ "define",
+ "property",
+ "defineProperty",
+ "Object.defineProperty"
+ ],
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/es-define-property/issues"
+ },
+ "homepage": "https://github.com/ljharb/es-define-property#readme",
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.1",
+ "@ljharb/tsconfig": "^0.2.2",
+ "@types/gopd": "^1.0.3",
+ "@types/tape": "^5.6.5",
+ "auto-changelog": "^2.5.0",
+ "encoding": "^0.1.13",
+ "eslint": "^8.8.0",
+ "evalmd": "^0.0.19",
+ "gopd": "^1.2.0",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.9.0",
+ "typescript": "next"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ }
+}
diff --git a/node_modules/es-define-property/test/index.js b/node_modules/es-define-property/test/index.js
new file mode 100644
index 0000000..b4b4688
--- /dev/null
+++ b/node_modules/es-define-property/test/index.js
@@ -0,0 +1,56 @@
+'use strict';
+
+var $defineProperty = require('../');
+
+var test = require('tape');
+var gOPD = require('gopd');
+
+test('defineProperty: supported', { skip: !$defineProperty }, function (t) {
+ t.plan(4);
+
+ t.equal(typeof $defineProperty, 'function', 'defineProperty is supported');
+ if ($defineProperty && gOPD) { // this `if` check is just to shut TS up
+ /** @type {{ a: number, b?: number, c?: number }} */
+ var o = { a: 1 };
+
+ $defineProperty(o, 'b', { enumerable: true, value: 2 });
+ t.deepEqual(
+ gOPD(o, 'b'),
+ {
+ configurable: false,
+ enumerable: true,
+ value: 2,
+ writable: false
+ },
+ 'property descriptor is as expected'
+ );
+
+ $defineProperty(o, 'c', { enumerable: false, value: 3, writable: true });
+ t.deepEqual(
+ gOPD(o, 'c'),
+ {
+ configurable: false,
+ enumerable: false,
+ value: 3,
+ writable: true
+ },
+ 'property descriptor is as expected'
+ );
+ }
+
+ t.equal($defineProperty, Object.defineProperty, 'defineProperty is Object.defineProperty');
+
+ t.end();
+});
+
+test('defineProperty: not supported', { skip: !!$defineProperty }, function (t) {
+ t.notOk($defineProperty, 'defineProperty is not supported');
+
+ t.match(
+ typeof $defineProperty,
+ /^(?:undefined|boolean)$/,
+ '`typeof defineProperty` is `undefined` or `boolean`'
+ );
+
+ t.end();
+});
diff --git a/node_modules/es-define-property/tsconfig.json b/node_modules/es-define-property/tsconfig.json
new file mode 100644
index 0000000..5a49992
--- /dev/null
+++ b/node_modules/es-define-property/tsconfig.json
@@ -0,0 +1,10 @@
+{
+ "extends": "@ljharb/tsconfig",
+ "compilerOptions": {
+ "target": "es2022",
+ },
+ "exclude": [
+ "coverage",
+ "test/list-exports"
+ ],
+}
diff --git a/node_modules/es-errors/.eslintrc b/node_modules/es-errors/.eslintrc
new file mode 100644
index 0000000..3b5d9e9
--- /dev/null
+++ b/node_modules/es-errors/.eslintrc
@@ -0,0 +1,5 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+}
diff --git a/node_modules/es-errors/.github/FUNDING.yml b/node_modules/es-errors/.github/FUNDING.yml
new file mode 100644
index 0000000..f1b8805
--- /dev/null
+++ b/node_modules/es-errors/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/es-errors
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with a single custom sponsorship URL
diff --git a/node_modules/es-errors/CHANGELOG.md b/node_modules/es-errors/CHANGELOG.md
new file mode 100644
index 0000000..204a9e9
--- /dev/null
+++ b/node_modules/es-errors/CHANGELOG.md
@@ -0,0 +1,40 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.3.0](https://github.com/ljharb/es-errors/compare/v1.2.1...v1.3.0) - 2024-02-05
+
+### Commits
+
+- [New] add `EvalError` and `URIError` [`1927627`](https://github.com/ljharb/es-errors/commit/1927627ba68cb6c829d307231376c967db53acdf)
+
+## [v1.2.1](https://github.com/ljharb/es-errors/compare/v1.2.0...v1.2.1) - 2024-02-04
+
+### Commits
+
+- [Fix] add missing `exports` entry [`5bb5f28`](https://github.com/ljharb/es-errors/commit/5bb5f280f98922701109d6ebb82eea2257cecc7e)
+
+## [v1.2.0](https://github.com/ljharb/es-errors/compare/v1.1.0...v1.2.0) - 2024-02-04
+
+### Commits
+
+- [New] add `ReferenceError` [`6d8cf5b`](https://github.com/ljharb/es-errors/commit/6d8cf5bbb6f3f598d02cf6f30e468ba2caa8e143)
+
+## [v1.1.0](https://github.com/ljharb/es-errors/compare/v1.0.0...v1.1.0) - 2024-02-04
+
+### Commits
+
+- [New] add base Error [`2983ab6`](https://github.com/ljharb/es-errors/commit/2983ab65f7bc5441276cb021dc3aa03c78881698)
+
+## v1.0.0 - 2024-02-03
+
+### Commits
+
+- Initial implementation, tests, readme, type [`8f47631`](https://github.com/ljharb/es-errors/commit/8f476317e9ad76f40ad648081829b1a1a3a1288b)
+- Initial commit [`ea5d099`](https://github.com/ljharb/es-errors/commit/ea5d099ef18e550509ab9e2be000526afd81c385)
+- npm init [`6f5ebf9`](https://github.com/ljharb/es-errors/commit/6f5ebf9cead474dadd72b9e63dad315820a089ae)
+- Only apps should have lockfiles [`e1a0aeb`](https://github.com/ljharb/es-errors/commit/e1a0aeb7b80f5cfc56be54d6b2100e915d47def8)
+- [meta] add `sideEffects` flag [`a9c7d46`](https://github.com/ljharb/es-errors/commit/a9c7d460a492f1d8a241c836bc25a322a19cc043)
diff --git a/node_modules/es-errors/LICENSE b/node_modules/es-errors/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/es-errors/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/es-errors/README.md b/node_modules/es-errors/README.md
new file mode 100644
index 0000000..8dbfacf
--- /dev/null
+++ b/node_modules/es-errors/README.md
@@ -0,0 +1,55 @@
+# es-errors [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+A simple cache for a few of the JS Error constructors.
+
+## Example
+
+```js
+const assert = require('assert');
+
+const Base = require('es-errors');
+const Eval = require('es-errors/eval');
+const Range = require('es-errors/range');
+const Ref = require('es-errors/ref');
+const Syntax = require('es-errors/syntax');
+const Type = require('es-errors/type');
+const URI = require('es-errors/uri');
+
+assert.equal(Base, Error);
+assert.equal(Eval, EvalError);
+assert.equal(Range, RangeError);
+assert.equal(Ref, ReferenceError);
+assert.equal(Syntax, SyntaxError);
+assert.equal(Type, TypeError);
+assert.equal(URI, URIError);
+```
+
+## Tests
+Simply clone the repo, `npm install`, and run `npm test`
+
+## Security
+
+Please email [@ljharb](https://github.com/ljharb) or see https://tidelift.com/security if you have a potential security vulnerability to report.
+
+[package-url]: https://npmjs.org/package/es-errors
+[npm-version-svg]: https://versionbadg.es/ljharb/es-errors.svg
+[deps-svg]: https://david-dm.org/ljharb/es-errors.svg
+[deps-url]: https://david-dm.org/ljharb/es-errors
+[dev-deps-svg]: https://david-dm.org/ljharb/es-errors/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/es-errors#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/es-errors.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/es-errors.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/es-errors.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=es-errors
+[codecov-image]: https://codecov.io/gh/ljharb/es-errors/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/es-errors/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/es-errors
+[actions-url]: https://github.com/ljharb/es-errors/actions
diff --git a/node_modules/es-errors/eval.d.ts b/node_modules/es-errors/eval.d.ts
new file mode 100644
index 0000000..e4210e0
--- /dev/null
+++ b/node_modules/es-errors/eval.d.ts
@@ -0,0 +1,3 @@
+declare const EvalError: EvalErrorConstructor;
+
+export = EvalError;
diff --git a/node_modules/es-errors/eval.js b/node_modules/es-errors/eval.js
new file mode 100644
index 0000000..725ccb6
--- /dev/null
+++ b/node_modules/es-errors/eval.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./eval')} */
+module.exports = EvalError;
diff --git a/node_modules/es-errors/index.d.ts b/node_modules/es-errors/index.d.ts
new file mode 100644
index 0000000..69bdbc9
--- /dev/null
+++ b/node_modules/es-errors/index.d.ts
@@ -0,0 +1,3 @@
+declare const Error: ErrorConstructor;
+
+export = Error;
diff --git a/node_modules/es-errors/index.js b/node_modules/es-errors/index.js
new file mode 100644
index 0000000..cc0c521
--- /dev/null
+++ b/node_modules/es-errors/index.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('.')} */
+module.exports = Error;
diff --git a/node_modules/es-errors/package.json b/node_modules/es-errors/package.json
new file mode 100644
index 0000000..ff8c2a5
--- /dev/null
+++ b/node_modules/es-errors/package.json
@@ -0,0 +1,80 @@
+{
+ "name": "es-errors",
+ "version": "1.3.0",
+ "description": "A simple cache for a few of the JS Error constructors.",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./eval": "./eval.js",
+ "./range": "./range.js",
+ "./ref": "./ref.js",
+ "./syntax": "./syntax.js",
+ "./type": "./type.js",
+ "./uri": "./uri.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublishOnly": "safe-publish-latest",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "pretest": "npm run lint",
+ "test": "npm run tests-only",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "posttest": "aud --production",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "tsc -p . && eclint check $(git ls-files | xargs find 2> /dev/null | grep -vE 'node_modules|\\.git' | grep -v dist/)",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/es-errors.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "error",
+ "typeerror",
+ "syntaxerror",
+ "rangeerror"
+ ],
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/es-errors/issues"
+ },
+ "homepage": "https://github.com/ljharb/es-errors#readme",
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "@types/tape": "^5.6.4",
+ "aud": "^2.0.4",
+ "auto-changelog": "^2.4.0",
+ "eclint": "^2.8.1",
+ "eslint": "^8.8.0",
+ "evalmd": "^0.0.19",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.4",
+ "typescript": "next"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/es-errors/range.d.ts b/node_modules/es-errors/range.d.ts
new file mode 100644
index 0000000..3a12e86
--- /dev/null
+++ b/node_modules/es-errors/range.d.ts
@@ -0,0 +1,3 @@
+declare const RangeError: RangeErrorConstructor;
+
+export = RangeError;
diff --git a/node_modules/es-errors/range.js b/node_modules/es-errors/range.js
new file mode 100644
index 0000000..2044fe0
--- /dev/null
+++ b/node_modules/es-errors/range.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./range')} */
+module.exports = RangeError;
diff --git a/node_modules/es-errors/ref.d.ts b/node_modules/es-errors/ref.d.ts
new file mode 100644
index 0000000..a13107e
--- /dev/null
+++ b/node_modules/es-errors/ref.d.ts
@@ -0,0 +1,3 @@
+declare const ReferenceError: ReferenceErrorConstructor;
+
+export = ReferenceError;
diff --git a/node_modules/es-errors/ref.js b/node_modules/es-errors/ref.js
new file mode 100644
index 0000000..d7c430f
--- /dev/null
+++ b/node_modules/es-errors/ref.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./ref')} */
+module.exports = ReferenceError;
diff --git a/node_modules/es-errors/syntax.d.ts b/node_modules/es-errors/syntax.d.ts
new file mode 100644
index 0000000..6a0c53c
--- /dev/null
+++ b/node_modules/es-errors/syntax.d.ts
@@ -0,0 +1,3 @@
+declare const SyntaxError: SyntaxErrorConstructor;
+
+export = SyntaxError;
diff --git a/node_modules/es-errors/syntax.js b/node_modules/es-errors/syntax.js
new file mode 100644
index 0000000..5f5fdde
--- /dev/null
+++ b/node_modules/es-errors/syntax.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./syntax')} */
+module.exports = SyntaxError;
diff --git a/node_modules/es-errors/test/index.js b/node_modules/es-errors/test/index.js
new file mode 100644
index 0000000..1ff0277
--- /dev/null
+++ b/node_modules/es-errors/test/index.js
@@ -0,0 +1,19 @@
+'use strict';
+
+var test = require('tape');
+
+var E = require('../');
+var R = require('../range');
+var Ref = require('../ref');
+var S = require('../syntax');
+var T = require('../type');
+
+test('errors', function (t) {
+ t.equal(E, Error);
+ t.equal(R, RangeError);
+ t.equal(Ref, ReferenceError);
+ t.equal(S, SyntaxError);
+ t.equal(T, TypeError);
+
+ t.end();
+});
diff --git a/node_modules/es-errors/tsconfig.json b/node_modules/es-errors/tsconfig.json
new file mode 100644
index 0000000..99dfeb6
--- /dev/null
+++ b/node_modules/es-errors/tsconfig.json
@@ -0,0 +1,49 @@
+{
+ "compilerOptions": {
+ /* Visit https://aka.ms/tsconfig.json to read more about this file */
+
+ /* Projects */
+
+ /* Language and Environment */
+ "target": "es5", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */
+ // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */
+ // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */
+ "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */
+ // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */
+
+ /* Modules */
+ "module": "commonjs", /* Specify what module code is generated. */
+ // "rootDir": "./", /* Specify the root folder within your source files. */
+ // "moduleResolution": "node", /* Specify how TypeScript looks up a file from a given module specifier. */
+ // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */
+ // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */
+ // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */
+ // "typeRoots": ["types"], /* Specify multiple folders that act like `./node_modules/@types`. */
+ "resolveJsonModule": true, /* Enable importing .json files. */
+ // "allowArbitraryExtensions": true, /* Enable importing files with any extension, provided a declaration file is present. */
+
+ /* JavaScript Support */
+ "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the `checkJS` option to get errors from these files. */
+ "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */
+ "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from `node_modules`. Only applicable with `allowJs`. */
+
+ /* Emit */
+ "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */
+ "declarationMap": true, /* Create sourcemaps for d.ts files. */
+ "noEmit": true, /* Disable emitting files from a compilation. */
+
+ /* Interop Constraints */
+ "allowSyntheticDefaultImports": true, /* Allow `import x from y` when a module doesn't have a default export. */
+ "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables `allowSyntheticDefaultImports` for type compatibility. */
+ "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */
+
+ /* Type Checking */
+ "strict": true, /* Enable all strict type-checking options. */
+
+ /* Completeness */
+ // "skipLibCheck": true /* Skip type checking all .d.ts files. */
+ },
+ "exclude": [
+ "coverage",
+ ],
+}
diff --git a/node_modules/es-errors/type.d.ts b/node_modules/es-errors/type.d.ts
new file mode 100644
index 0000000..576fb51
--- /dev/null
+++ b/node_modules/es-errors/type.d.ts
@@ -0,0 +1,3 @@
+declare const TypeError: TypeErrorConstructor
+
+export = TypeError;
diff --git a/node_modules/es-errors/type.js b/node_modules/es-errors/type.js
new file mode 100644
index 0000000..9769e44
--- /dev/null
+++ b/node_modules/es-errors/type.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./type')} */
+module.exports = TypeError;
diff --git a/node_modules/es-errors/uri.d.ts b/node_modules/es-errors/uri.d.ts
new file mode 100644
index 0000000..c3261c9
--- /dev/null
+++ b/node_modules/es-errors/uri.d.ts
@@ -0,0 +1,3 @@
+declare const URIError: URIErrorConstructor;
+
+export = URIError;
diff --git a/node_modules/es-errors/uri.js b/node_modules/es-errors/uri.js
new file mode 100644
index 0000000..e9cd1c7
--- /dev/null
+++ b/node_modules/es-errors/uri.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./uri')} */
+module.exports = URIError;
diff --git a/node_modules/es-object-atoms/.eslintrc b/node_modules/es-object-atoms/.eslintrc
new file mode 100644
index 0000000..d90a1bc
--- /dev/null
+++ b/node_modules/es-object-atoms/.eslintrc
@@ -0,0 +1,16 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "eqeqeq": ["error", "allow-null"],
+ "id-length": "off",
+ "new-cap": ["error", {
+ "capIsNewExceptions": [
+ "RequireObjectCoercible",
+ "ToObject",
+ ],
+ }],
+ },
+}
diff --git a/node_modules/es-object-atoms/.github/FUNDING.yml b/node_modules/es-object-atoms/.github/FUNDING.yml
new file mode 100644
index 0000000..352bfda
--- /dev/null
+++ b/node_modules/es-object-atoms/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/es-object
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with a single custom sponsorship URL
diff --git a/node_modules/es-object-atoms/CHANGELOG.md b/node_modules/es-object-atoms/CHANGELOG.md
new file mode 100644
index 0000000..fdd2abe
--- /dev/null
+++ b/node_modules/es-object-atoms/CHANGELOG.md
@@ -0,0 +1,37 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.1.1](https://github.com/ljharb/es-object-atoms/compare/v1.1.0...v1.1.1) - 2025-01-14
+
+### Commits
+
+- [types] `ToObject`: improve types [`cfe8c8a`](https://github.com/ljharb/es-object-atoms/commit/cfe8c8a105c44820cb22e26f62d12ef0ad9715c8)
+
+## [v1.1.0](https://github.com/ljharb/es-object-atoms/compare/v1.0.1...v1.1.0) - 2025-01-14
+
+### Commits
+
+- [New] add `isObject` [`51e4042`](https://github.com/ljharb/es-object-atoms/commit/51e4042df722eb3165f40dc5f4bf33d0197ecb07)
+
+## [v1.0.1](https://github.com/ljharb/es-object-atoms/compare/v1.0.0...v1.0.1) - 2025-01-13
+
+### Commits
+
+- [Dev Deps] update `@ljharb/eslint-config`, `@ljharb/tsconfig`, `@types/tape`, `auto-changelog`, `tape` [`38ab9eb`](https://github.com/ljharb/es-object-atoms/commit/38ab9eb00b62c2f4668644f5e513d9b414ebd595)
+- [types] improve types [`7d1beb8`](https://github.com/ljharb/es-object-atoms/commit/7d1beb887958b78b6a728a210a1c8370ab7e2aa1)
+- [Tests] replace `aud` with `npm audit` [`25863ba`](https://github.com/ljharb/es-object-atoms/commit/25863baf99178f1d1ad33d1120498db28631907e)
+- [Dev Deps] add missing peer dep [`c012309`](https://github.com/ljharb/es-object-atoms/commit/c0123091287e6132d6f4240496340c427433df28)
+
+## v1.0.0 - 2024-03-16
+
+### Commits
+
+- Initial implementation, tests, readme, types [`f1499db`](https://github.com/ljharb/es-object-atoms/commit/f1499db7d3e1741e64979c61d645ab3137705e82)
+- Initial commit [`99eedc7`](https://github.com/ljharb/es-object-atoms/commit/99eedc7b5fde38a50a28d3c8b724706e3e4c5f6a)
+- [meta] rename repo [`fc851fa`](https://github.com/ljharb/es-object-atoms/commit/fc851fa70616d2d182aaf0bd02c2ed7084dea8fa)
+- npm init [`b909377`](https://github.com/ljharb/es-object-atoms/commit/b909377c50049bd0ec575562d20b0f9ebae8947f)
+- Only apps should have lockfiles [`7249edd`](https://github.com/ljharb/es-object-atoms/commit/7249edd2178c1b9ddfc66ffcc6d07fdf0d28efc1)
diff --git a/node_modules/es-object-atoms/LICENSE b/node_modules/es-object-atoms/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/es-object-atoms/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/es-object-atoms/README.md b/node_modules/es-object-atoms/README.md
new file mode 100644
index 0000000..447695b
--- /dev/null
+++ b/node_modules/es-object-atoms/README.md
@@ -0,0 +1,63 @@
+# es-object-atoms [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+ES Object-related atoms: Object, ToObject, RequireObjectCoercible.
+
+## Example
+
+```js
+const assert = require('assert');
+
+const $Object = require('es-object-atoms');
+const isObject = require('es-object-atoms/isObject');
+const ToObject = require('es-object-atoms/ToObject');
+const RequireObjectCoercible = require('es-object-atoms/RequireObjectCoercible');
+
+assert.equal($Object, Object);
+assert.throws(() => ToObject(null), TypeError);
+assert.throws(() => ToObject(undefined), TypeError);
+assert.throws(() => RequireObjectCoercible(null), TypeError);
+assert.throws(() => RequireObjectCoercible(undefined), TypeError);
+
+assert.equal(isObject(undefined), false);
+assert.equal(isObject(null), false);
+assert.equal(isObject({}), true);
+assert.equal(isObject([]), true);
+assert.equal(isObject(function () {}), true);
+
+assert.deepEqual(RequireObjectCoercible(true), true);
+assert.deepEqual(ToObject(true), Object(true));
+
+const obj = {};
+assert.equal(RequireObjectCoercible(obj), obj);
+assert.equal(ToObject(obj), obj);
+```
+
+## Tests
+Simply clone the repo, `npm install`, and run `npm test`
+
+## Security
+
+Please email [@ljharb](https://github.com/ljharb) or see https://tidelift.com/security if you have a potential security vulnerability to report.
+
+[package-url]: https://npmjs.org/package/es-object-atoms
+[npm-version-svg]: https://versionbadg.es/ljharb/es-object-atoms.svg
+[deps-svg]: https://david-dm.org/ljharb/es-object-atoms.svg
+[deps-url]: https://david-dm.org/ljharb/es-object-atoms
+[dev-deps-svg]: https://david-dm.org/ljharb/es-object-atoms/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/es-object-atoms#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/es-object-atoms.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/es-object-atoms.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/es-object.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=es-object-atoms
+[codecov-image]: https://codecov.io/gh/ljharb/es-object-atoms/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/es-object-atoms/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/es-object-atoms
+[actions-url]: https://github.com/ljharb/es-object-atoms/actions
diff --git a/node_modules/es-object-atoms/RequireObjectCoercible.d.ts b/node_modules/es-object-atoms/RequireObjectCoercible.d.ts
new file mode 100644
index 0000000..7e26c45
--- /dev/null
+++ b/node_modules/es-object-atoms/RequireObjectCoercible.d.ts
@@ -0,0 +1,3 @@
+declare function RequireObjectCoercible(value: T, optMessage?: string): T;
+
+export = RequireObjectCoercible;
diff --git a/node_modules/es-object-atoms/RequireObjectCoercible.js b/node_modules/es-object-atoms/RequireObjectCoercible.js
new file mode 100644
index 0000000..8e191c6
--- /dev/null
+++ b/node_modules/es-object-atoms/RequireObjectCoercible.js
@@ -0,0 +1,11 @@
+'use strict';
+
+var $TypeError = require('es-errors/type');
+
+/** @type {import('./RequireObjectCoercible')} */
+module.exports = function RequireObjectCoercible(value) {
+ if (value == null) {
+ throw new $TypeError((arguments.length > 0 && arguments[1]) || ('Cannot call method on ' + value));
+ }
+ return value;
+};
diff --git a/node_modules/es-object-atoms/ToObject.d.ts b/node_modules/es-object-atoms/ToObject.d.ts
new file mode 100644
index 0000000..d6dd302
--- /dev/null
+++ b/node_modules/es-object-atoms/ToObject.d.ts
@@ -0,0 +1,7 @@
+declare function ToObject(value: number): Number;
+declare function ToObject(value: boolean): Boolean;
+declare function ToObject(value: string): String;
+declare function ToObject(value: bigint): BigInt;
+declare function ToObject(value: T): T;
+
+export = ToObject;
diff --git a/node_modules/es-object-atoms/ToObject.js b/node_modules/es-object-atoms/ToObject.js
new file mode 100644
index 0000000..2b99a7d
--- /dev/null
+++ b/node_modules/es-object-atoms/ToObject.js
@@ -0,0 +1,10 @@
+'use strict';
+
+var $Object = require('./');
+var RequireObjectCoercible = require('./RequireObjectCoercible');
+
+/** @type {import('./ToObject')} */
+module.exports = function ToObject(value) {
+ RequireObjectCoercible(value);
+ return $Object(value);
+};
diff --git a/node_modules/es-object-atoms/index.d.ts b/node_modules/es-object-atoms/index.d.ts
new file mode 100644
index 0000000..8bdbfc8
--- /dev/null
+++ b/node_modules/es-object-atoms/index.d.ts
@@ -0,0 +1,3 @@
+declare const Object: ObjectConstructor;
+
+export = Object;
diff --git a/node_modules/es-object-atoms/index.js b/node_modules/es-object-atoms/index.js
new file mode 100644
index 0000000..1d33cef
--- /dev/null
+++ b/node_modules/es-object-atoms/index.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('.')} */
+module.exports = Object;
diff --git a/node_modules/es-object-atoms/isObject.d.ts b/node_modules/es-object-atoms/isObject.d.ts
new file mode 100644
index 0000000..43bee3b
--- /dev/null
+++ b/node_modules/es-object-atoms/isObject.d.ts
@@ -0,0 +1,3 @@
+declare function isObject(x: unknown): x is object;
+
+export = isObject;
diff --git a/node_modules/es-object-atoms/isObject.js b/node_modules/es-object-atoms/isObject.js
new file mode 100644
index 0000000..ec49bf1
--- /dev/null
+++ b/node_modules/es-object-atoms/isObject.js
@@ -0,0 +1,6 @@
+'use strict';
+
+/** @type {import('./isObject')} */
+module.exports = function isObject(x) {
+ return !!x && (typeof x === 'function' || typeof x === 'object');
+};
diff --git a/node_modules/es-object-atoms/package.json b/node_modules/es-object-atoms/package.json
new file mode 100644
index 0000000..f4cec71
--- /dev/null
+++ b/node_modules/es-object-atoms/package.json
@@ -0,0 +1,80 @@
+{
+ "name": "es-object-atoms",
+ "version": "1.1.1",
+ "description": "ES Object-related atoms: Object, ToObject, RequireObjectCoercible",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./RequireObjectCoercible": "./RequireObjectCoercible.js",
+ "./isObject": "./isObject.js",
+ "./ToObject": "./ToObject.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublishOnly": "safe-publish-latest",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "pretest": "npm run lint",
+ "test": "npm run tests-only",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "posttest": "npx npm@\">= 10.2\" audit --production",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "tsc -p . && eclint check $(git ls-files | xargs find 2> /dev/null | grep -vE 'node_modules|\\.git' | grep -v dist/)",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/es-object-atoms.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "object",
+ "toobject",
+ "coercible"
+ ],
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/es-object-atoms/issues"
+ },
+ "homepage": "https://github.com/ljharb/es-object-atoms#readme",
+ "dependencies": {
+ "es-errors": "^1.3.0"
+ },
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.1",
+ "@ljharb/tsconfig": "^0.2.3",
+ "@types/tape": "^5.8.1",
+ "auto-changelog": "^2.5.0",
+ "eclint": "^2.8.1",
+ "encoding": "^0.1.13",
+ "eslint": "^8.8.0",
+ "evalmd": "^0.0.19",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.9.0",
+ "typescript": "next"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/es-object-atoms/test/index.js b/node_modules/es-object-atoms/test/index.js
new file mode 100644
index 0000000..430b705
--- /dev/null
+++ b/node_modules/es-object-atoms/test/index.js
@@ -0,0 +1,38 @@
+'use strict';
+
+var test = require('tape');
+
+var $Object = require('../');
+var isObject = require('../isObject');
+var ToObject = require('../ToObject');
+var RequireObjectCoercible = require('..//RequireObjectCoercible');
+
+test('errors', function (t) {
+ t.equal($Object, Object);
+ // @ts-expect-error
+ t['throws'](function () { ToObject(null); }, TypeError);
+ // @ts-expect-error
+ t['throws'](function () { ToObject(undefined); }, TypeError);
+ // @ts-expect-error
+ t['throws'](function () { RequireObjectCoercible(null); }, TypeError);
+ // @ts-expect-error
+ t['throws'](function () { RequireObjectCoercible(undefined); }, TypeError);
+
+ t.deepEqual(RequireObjectCoercible(true), true);
+ t.deepEqual(ToObject(true), Object(true));
+ t.deepEqual(ToObject(42), Object(42));
+ var f = function () {};
+ t.equal(ToObject(f), f);
+
+ t.equal(isObject(undefined), false);
+ t.equal(isObject(null), false);
+ t.equal(isObject({}), true);
+ t.equal(isObject([]), true);
+ t.equal(isObject(function () {}), true);
+
+ var obj = {};
+ t.equal(RequireObjectCoercible(obj), obj);
+ t.equal(ToObject(obj), obj);
+
+ t.end();
+});
diff --git a/node_modules/es-object-atoms/tsconfig.json b/node_modules/es-object-atoms/tsconfig.json
new file mode 100644
index 0000000..1f73cb7
--- /dev/null
+++ b/node_modules/es-object-atoms/tsconfig.json
@@ -0,0 +1,6 @@
+{
+ "extends": "@ljharb/tsconfig",
+ "compilerOptions": {
+ "target": "es5",
+ },
+}
diff --git a/node_modules/escape-html/LICENSE b/node_modules/escape-html/LICENSE
new file mode 100644
index 0000000..2e70de9
--- /dev/null
+++ b/node_modules/escape-html/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2013 TJ Holowaychuk
+Copyright (c) 2015 Andreas Lubbe
+Copyright (c) 2015 Tiancheng "Timothy" Gu
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/escape-html/Readme.md b/node_modules/escape-html/Readme.md
new file mode 100644
index 0000000..653d9ea
--- /dev/null
+++ b/node_modules/escape-html/Readme.md
@@ -0,0 +1,43 @@
+
+# escape-html
+
+ Escape string for use in HTML
+
+## Example
+
+```js
+var escape = require('escape-html');
+var html = escape('foo & bar');
+// -> foo & bar
+```
+
+## Benchmark
+
+```
+$ npm run-script bench
+
+> escape-html@1.0.3 bench nodejs-escape-html
+> node benchmark/index.js
+
+
+ http_parser@1.0
+ node@0.10.33
+ v8@3.14.5.9
+ ares@1.9.0-DEV
+ uv@0.10.29
+ zlib@1.2.3
+ modules@11
+ openssl@1.0.1j
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled)
+ single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled)
+ many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled)
+```
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/node_modules/escape-html/index.js b/node_modules/escape-html/index.js
new file mode 100644
index 0000000..bf9e226
--- /dev/null
+++ b/node_modules/escape-html/index.js
@@ -0,0 +1,78 @@
+/*!
+ * escape-html
+ * Copyright(c) 2012-2013 TJ Holowaychuk
+ * Copyright(c) 2015 Andreas Lubbe
+ * Copyright(c) 2015 Tiancheng "Timothy" Gu
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var matchHtmlRegExp = /["'&<>]/;
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = escapeHtml;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @param {string} string The string to escape for inserting into HTML
+ * @return {string}
+ * @public
+ */
+
+function escapeHtml(string) {
+ var str = '' + string;
+ var match = matchHtmlRegExp.exec(str);
+
+ if (!match) {
+ return str;
+ }
+
+ var escape;
+ var html = '';
+ var index = 0;
+ var lastIndex = 0;
+
+ for (index = match.index; index < str.length; index++) {
+ switch (str.charCodeAt(index)) {
+ case 34: // "
+ escape = '"';
+ break;
+ case 38: // &
+ escape = '&';
+ break;
+ case 39: // '
+ escape = ''';
+ break;
+ case 60: // <
+ escape = '<';
+ break;
+ case 62: // >
+ escape = '>';
+ break;
+ default:
+ continue;
+ }
+
+ if (lastIndex !== index) {
+ html += str.substring(lastIndex, index);
+ }
+
+ lastIndex = index + 1;
+ html += escape;
+ }
+
+ return lastIndex !== index
+ ? html + str.substring(lastIndex, index)
+ : html;
+}
diff --git a/node_modules/escape-html/package.json b/node_modules/escape-html/package.json
new file mode 100644
index 0000000..57ec7bd
--- /dev/null
+++ b/node_modules/escape-html/package.json
@@ -0,0 +1,24 @@
+{
+ "name": "escape-html",
+ "description": "Escape string for use in HTML",
+ "version": "1.0.3",
+ "license": "MIT",
+ "keywords": [
+ "escape",
+ "html",
+ "utility"
+ ],
+ "repository": "component/escape-html",
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4"
+ },
+ "files": [
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "scripts": {
+ "bench": "node benchmark/index.js"
+ }
+}
diff --git a/node_modules/etag/HISTORY.md b/node_modules/etag/HISTORY.md
new file mode 100644
index 0000000..222b293
--- /dev/null
+++ b/node_modules/etag/HISTORY.md
@@ -0,0 +1,83 @@
+1.8.1 / 2017-09-12
+==================
+
+ * perf: replace regular expression with substring
+
+1.8.0 / 2017-02-18
+==================
+
+ * Use SHA1 instead of MD5 for ETag hashing
+ - Improves performance for larger entities
+ - Works with FIPS 140-2 OpenSSL configuration
+
+1.7.0 / 2015-06-08
+==================
+
+ * Always include entity length in ETags for hash length extensions
+ * Generate non-Stats ETags using MD5 only (no longer CRC32)
+ * Improve stat performance by removing hashing
+ * Remove base64 padding in ETags to shorten
+ * Use MD5 instead of MD4 in weak ETags over 1KB
+
+1.6.0 / 2015-05-10
+==================
+
+ * Improve support for JXcore
+ * Remove requirement of `atime` in the stats object
+ * Support "fake" stats objects in environments without `fs`
+
+1.5.1 / 2014-11-19
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.5.0 / 2014-10-14
+==================
+
+ * Improve string performance
+ * Slightly improve speed for weak ETags over 1KB
+
+1.4.0 / 2014-09-21
+==================
+
+ * Support "fake" stats objects
+ * Support Node.js 0.6
+
+1.3.1 / 2014-09-14
+==================
+
+ * Use the (new and improved) `crc` for crc32
+
+1.3.0 / 2014-08-29
+==================
+
+ * Default strings to strong ETags
+ * Improve speed for weak ETags over 1KB
+
+1.2.1 / 2014-08-29
+==================
+
+ * Use the (much faster) `buffer-crc32` for crc32
+
+1.2.0 / 2014-08-24
+==================
+
+ * Add support for file stat objects
+
+1.1.0 / 2014-08-24
+==================
+
+ * Add fast-path for empty entity
+ * Add weak ETag generation
+ * Shrink size of generated ETags
+
+1.0.1 / 2014-08-24
+==================
+
+ * Fix behavior of string containing Unicode
+
+1.0.0 / 2014-05-18
+==================
+
+ * Initial release
diff --git a/node_modules/etag/LICENSE b/node_modules/etag/LICENSE
new file mode 100644
index 0000000..cab251c
--- /dev/null
+++ b/node_modules/etag/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/etag/README.md b/node_modules/etag/README.md
new file mode 100644
index 0000000..09c2169
--- /dev/null
+++ b/node_modules/etag/README.md
@@ -0,0 +1,159 @@
+# etag
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create simple HTTP ETags
+
+This module generates HTTP ETags (as defined in RFC 7232) for use in
+HTTP responses.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install etag
+```
+
+## API
+
+
+
+```js
+var etag = require('etag')
+```
+
+### etag(entity, [options])
+
+Generate a strong ETag for the given entity. This should be the complete
+body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By
+default, a strong ETag is generated except for `fs.Stats`, which will
+generate a weak ETag (this can be overwritten by `options.weak`).
+
+
+
+```js
+res.setHeader('ETag', etag(body))
+```
+
+#### Options
+
+`etag` accepts these properties in the options object.
+
+##### weak
+
+Specifies if the generated ETag will include the weak validator mark (that
+is, the leading `W/`). The actual entity tag is the same. The default value
+is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> etag@1.8.1 bench nodejs-etag
+> node benchmark/index.js
+
+ http_parser@2.7.0
+ node@6.11.1
+ v8@5.1.281.103
+ uv@1.11.0
+ zlib@1.2.11
+ ares@1.10.1-DEV
+ icu@58.2
+ modules@48
+ openssl@1.0.2k
+
+> node benchmark/body0-100b.js
+
+ 100B body
+
+ 4 tests completed.
+
+ buffer - strong x 258,647 ops/sec ±1.07% (180 runs sampled)
+ buffer - weak x 263,812 ops/sec ±0.61% (184 runs sampled)
+ string - strong x 259,955 ops/sec ±1.19% (185 runs sampled)
+ string - weak x 264,356 ops/sec ±1.09% (184 runs sampled)
+
+> node benchmark/body1-1kb.js
+
+ 1KB body
+
+ 4 tests completed.
+
+ buffer - strong x 189,018 ops/sec ±1.12% (182 runs sampled)
+ buffer - weak x 190,586 ops/sec ±0.81% (186 runs sampled)
+ string - strong x 144,272 ops/sec ±0.96% (188 runs sampled)
+ string - weak x 145,380 ops/sec ±1.43% (187 runs sampled)
+
+> node benchmark/body2-5kb.js
+
+ 5KB body
+
+ 4 tests completed.
+
+ buffer - strong x 92,435 ops/sec ±0.42% (188 runs sampled)
+ buffer - weak x 92,373 ops/sec ±0.58% (189 runs sampled)
+ string - strong x 48,850 ops/sec ±0.56% (186 runs sampled)
+ string - weak x 49,380 ops/sec ±0.56% (190 runs sampled)
+
+> node benchmark/body3-10kb.js
+
+ 10KB body
+
+ 4 tests completed.
+
+ buffer - strong x 55,989 ops/sec ±0.93% (188 runs sampled)
+ buffer - weak x 56,148 ops/sec ±0.55% (190 runs sampled)
+ string - strong x 27,345 ops/sec ±0.43% (188 runs sampled)
+ string - weak x 27,496 ops/sec ±0.45% (190 runs sampled)
+
+> node benchmark/body4-100kb.js
+
+ 100KB body
+
+ 4 tests completed.
+
+ buffer - strong x 7,083 ops/sec ±0.22% (190 runs sampled)
+ buffer - weak x 7,115 ops/sec ±0.26% (191 runs sampled)
+ string - strong x 3,068 ops/sec ±0.34% (190 runs sampled)
+ string - weak x 3,096 ops/sec ±0.35% (190 runs sampled)
+
+> node benchmark/stats.js
+
+ stat
+
+ 4 tests completed.
+
+ real - strong x 871,642 ops/sec ±0.34% (189 runs sampled)
+ real - weak x 867,613 ops/sec ±0.39% (190 runs sampled)
+ fake - strong x 401,051 ops/sec ±0.40% (189 runs sampled)
+ fake - weak x 400,100 ops/sec ±0.47% (188 runs sampled)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/etag.svg
+[npm-url]: https://npmjs.org/package/etag
+[node-version-image]: https://img.shields.io/node/v/etag.svg
+[node-version-url]: https://nodejs.org/en/download/
+[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg
+[travis-url]: https://travis-ci.org/jshttp/etag
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/etag.svg
+[downloads-url]: https://npmjs.org/package/etag
diff --git a/node_modules/etag/index.js b/node_modules/etag/index.js
new file mode 100644
index 0000000..2a585c9
--- /dev/null
+++ b/node_modules/etag/index.js
@@ -0,0 +1,131 @@
+/*!
+ * etag
+ * Copyright(c) 2014-2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = etag
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var crypto = require('crypto')
+var Stats = require('fs').Stats
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var toString = Object.prototype.toString
+
+/**
+ * Generate an entity tag.
+ *
+ * @param {Buffer|string} entity
+ * @return {string}
+ * @private
+ */
+
+function entitytag (entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"'
+ }
+
+ // compute hash of entity
+ var hash = crypto
+ .createHash('sha1')
+ .update(entity, 'utf8')
+ .digest('base64')
+ .substring(0, 27)
+
+ // compute length of entity
+ var len = typeof entity === 'string'
+ ? Buffer.byteLength(entity, 'utf8')
+ : entity.length
+
+ return '"' + len.toString(16) + '-' + hash + '"'
+}
+
+/**
+ * Create a simple ETag.
+ *
+ * @param {string|Buffer|Stats} entity
+ * @param {object} [options]
+ * @param {boolean} [options.weak]
+ * @return {String}
+ * @public
+ */
+
+function etag (entity, options) {
+ if (entity == null) {
+ throw new TypeError('argument entity is required')
+ }
+
+ // support fs.Stats object
+ var isStats = isstats(entity)
+ var weak = options && typeof options.weak === 'boolean'
+ ? options.weak
+ : isStats
+
+ // validate argument
+ if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) {
+ throw new TypeError('argument entity must be string, Buffer, or fs.Stats')
+ }
+
+ // generate entity tag
+ var tag = isStats
+ ? stattag(entity)
+ : entitytag(entity)
+
+ return weak
+ ? 'W/' + tag
+ : tag
+}
+
+/**
+ * Determine if object is a Stats object.
+ *
+ * @param {object} obj
+ * @return {boolean}
+ * @api private
+ */
+
+function isstats (obj) {
+ // genuine fs.Stats
+ if (typeof Stats === 'function' && obj instanceof Stats) {
+ return true
+ }
+
+ // quack quack
+ return obj && typeof obj === 'object' &&
+ 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' &&
+ 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' &&
+ 'ino' in obj && typeof obj.ino === 'number' &&
+ 'size' in obj && typeof obj.size === 'number'
+}
+
+/**
+ * Generate a tag for a stat.
+ *
+ * @param {object} stat
+ * @return {string}
+ * @private
+ */
+
+function stattag (stat) {
+ var mtime = stat.mtime.getTime().toString(16)
+ var size = stat.size.toString(16)
+
+ return '"' + size + '-' + mtime + '"'
+}
diff --git a/node_modules/etag/package.json b/node_modules/etag/package.json
new file mode 100644
index 0000000..b06ab80
--- /dev/null
+++ b/node_modules/etag/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "etag",
+ "description": "Create simple HTTP ETags",
+ "version": "1.8.1",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "David Björklund "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "etag",
+ "http",
+ "res"
+ ],
+ "repository": "jshttp/etag",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-markdown": "1.0.0-beta.6",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "1.21.5",
+ "safe-buffer": "5.1.1",
+ "seedrandom": "2.4.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/node_modules/express/History.md b/node_modules/express/History.md
new file mode 100644
index 0000000..c234f52
--- /dev/null
+++ b/node_modules/express/History.md
@@ -0,0 +1,3656 @@
+4.21.2 / 2024-11-06
+==========
+
+ * deps: path-to-regexp@0.1.12
+ - Fix backtracking protection
+ * deps: path-to-regexp@0.1.11
+ - Throws an error on invalid path values
+
+4.21.1 / 2024-10-08
+==========
+
+ * Backported a fix for [CVE-2024-47764](https://nvd.nist.gov/vuln/detail/CVE-2024-47764)
+
+
+4.21.0 / 2024-09-11
+==========
+
+ * Deprecate `res.location("back")` and `res.redirect("back")` magic string
+ * deps: serve-static@1.16.2
+ * includes send@0.19.0
+ * deps: finalhandler@1.3.1
+ * deps: qs@6.13.0
+
+4.20.0 / 2024-09-10
+==========
+ * deps: serve-static@0.16.0
+ * Remove link renderization in html while redirecting
+ * deps: send@0.19.0
+ * Remove link renderization in html while redirecting
+ * deps: body-parser@0.6.0
+ * add `depth` option to customize the depth level in the parser
+ * IMPORTANT: The default `depth` level for parsing URL-encoded data is now `32` (previously was `Infinity`)
+ * Remove link renderization in html while using `res.redirect`
+ * deps: path-to-regexp@0.1.10
+ - Adds support for named matching groups in the routes using a regex
+ - Adds backtracking protection to parameters without regexes defined
+ * deps: encodeurl@~2.0.0
+ - Removes encoding of `\`, `|`, and `^` to align better with URL spec
+ * Deprecate passing `options.maxAge` and `options.expires` to `res.clearCookie`
+ - Will be ignored in v5, clearCookie will set a cookie with an expires in the past to instruct clients to delete the cookie
+
+4.19.2 / 2024-03-25
+==========
+
+ * Improved fix for open redirect allow list bypass
+
+4.19.1 / 2024-03-20
+==========
+
+ * Allow passing non-strings to res.location with new encoding handling checks
+
+4.19.0 / 2024-03-20
+==========
+
+ * Prevent open redirect allow list bypass due to encodeurl
+ * deps: cookie@0.6.0
+
+4.18.3 / 2024-02-29
+==========
+
+ * Fix routing requests without method
+ * deps: body-parser@1.20.2
+ - Fix strict json error message on Node.js 19+
+ - deps: content-type@~1.0.5
+ - deps: raw-body@2.5.2
+ * deps: cookie@0.6.0
+ - Add `partitioned` option
+
+4.18.2 / 2022-10-08
+===================
+
+ * Fix regression routing a large stack in a single route
+ * deps: body-parser@1.20.1
+ - deps: qs@6.11.0
+ - perf: remove unnecessary object clone
+ * deps: qs@6.11.0
+
+4.18.1 / 2022-04-29
+===================
+
+ * Fix hanging on large stack of sync routes
+
+4.18.0 / 2022-04-25
+===================
+
+ * Add "root" option to `res.download`
+ * Allow `options` without `filename` in `res.download`
+ * Deprecate string and non-integer arguments to `res.status`
+ * Fix behavior of `null`/`undefined` as `maxAge` in `res.cookie`
+ * Fix handling very large stacks of sync middleware
+ * Ignore `Object.prototype` values in settings through `app.set`/`app.get`
+ * Invoke `default` with same arguments as types in `res.format`
+ * Support proper 205 responses using `res.send`
+ * Use `http-errors` for `res.format` error
+ * deps: body-parser@1.20.0
+ - Fix error message for json parse whitespace in `strict`
+ - Fix internal error when inflated body exceeds limit
+ - Prevent loss of async hooks context
+ - Prevent hanging when request already read
+ - deps: depd@2.0.0
+ - deps: http-errors@2.0.0
+ - deps: on-finished@2.4.1
+ - deps: qs@6.10.3
+ - deps: raw-body@2.5.1
+ * deps: cookie@0.5.0
+ - Add `priority` option
+ - Fix `expires` option to reject invalid dates
+ * deps: depd@2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ * deps: finalhandler@1.2.0
+ - Remove set content headers that break response
+ - deps: on-finished@2.4.1
+ - deps: statuses@2.0.1
+ * deps: on-finished@2.4.1
+ - Prevent loss of async hooks context
+ * deps: qs@6.10.3
+ * deps: send@0.18.0
+ - Fix emitted 416 error missing headers property
+ - Limit the headers removed for 304 response
+ - deps: depd@2.0.0
+ - deps: destroy@1.2.0
+ - deps: http-errors@2.0.0
+ - deps: on-finished@2.4.1
+ - deps: statuses@2.0.1
+ * deps: serve-static@1.15.0
+ - deps: send@0.18.0
+ * deps: statuses@2.0.1
+ - Remove code 306
+ - Rename `425 Unordered Collection` to standard `425 Too Early`
+
+4.17.3 / 2022-02-16
+===================
+
+ * deps: accepts@~1.3.8
+ - deps: mime-types@~2.1.34
+ - deps: negotiator@0.6.3
+ * deps: body-parser@1.19.2
+ - deps: bytes@3.1.2
+ - deps: qs@6.9.7
+ - deps: raw-body@2.4.3
+ * deps: cookie@0.4.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * pref: remove unnecessary regexp for trust proxy
+
+4.17.2 / 2021-12-16
+===================
+
+ * Fix handling of `undefined` in `res.jsonp`
+ * Fix handling of `undefined` when `"json escape"` is enabled
+ * Fix incorrect middleware execution with unanchored `RegExp`s
+ * Fix `res.jsonp(obj, status)` deprecation message
+ * Fix typo in `res.is` JSDoc
+ * deps: body-parser@1.19.1
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ - deps: qs@6.9.6
+ - deps: raw-body@2.4.2
+ - deps: safe-buffer@5.2.1
+ - deps: type-is@~1.6.18
+ * deps: content-disposition@0.5.4
+ - deps: safe-buffer@5.2.1
+ * deps: cookie@0.4.1
+ - Fix `maxAge` option to reject invalid values
+ * deps: proxy-addr@~2.0.7
+ - Use `req.socket` over deprecated `req.connection`
+ - deps: forwarded@0.2.0
+ - deps: ipaddr.js@1.9.1
+ * deps: qs@6.9.6
+ * deps: safe-buffer@5.2.1
+ * deps: send@0.17.2
+ - deps: http-errors@1.8.1
+ - deps: ms@2.1.3
+ - pref: ignore empty http tokens
+ * deps: serve-static@1.14.2
+ - deps: send@0.17.2
+ * deps: setprototypeof@1.2.0
+
+4.17.1 / 2019-05-25
+===================
+
+ * Revert "Improve error message for `null`/`undefined` to `res.status`"
+
+4.17.0 / 2019-05-16
+===================
+
+ * Add `express.raw` to parse bodies into `Buffer`
+ * Add `express.text` to parse bodies into string
+ * Improve error message for non-strings to `res.sendFile`
+ * Improve error message for `null`/`undefined` to `res.status`
+ * Support multiple hosts in `X-Forwarded-Host`
+ * deps: accepts@~1.3.7
+ * deps: body-parser@1.19.0
+ - Add encoding MIK
+ - Add petabyte (`pb`) support
+ - Fix parsing array brackets after index
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ - deps: qs@6.7.0
+ - deps: raw-body@2.4.0
+ - deps: type-is@~1.6.17
+ * deps: content-disposition@0.5.3
+ * deps: cookie@0.4.0
+ - Add `SameSite=None` support
+ * deps: finalhandler@~1.1.2
+ - Set stricter `Content-Security-Policy` header
+ - deps: parseurl@~1.3.3
+ - deps: statuses@~1.5.0
+ * deps: parseurl@~1.3.3
+ * deps: proxy-addr@~2.0.5
+ - deps: ipaddr.js@1.9.0
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: range-parser@~1.2.1
+ * deps: send@0.17.1
+ - Set stricter CSP header in redirect & error responses
+ - deps: http-errors@~1.7.2
+ - deps: mime@1.6.0
+ - deps: ms@2.1.1
+ - deps: range-parser@~1.2.1
+ - deps: statuses@~1.5.0
+ - perf: remove redundant `path.normalize` call
+ * deps: serve-static@1.14.1
+ - Set stricter CSP header in redirect response
+ - deps: parseurl@~1.3.3
+ - deps: send@0.17.1
+ * deps: setprototypeof@1.1.1
+ * deps: statuses@~1.5.0
+ - Add `103 Early Hints`
+ * deps: type-is@~1.6.18
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+4.16.4 / 2018-10-10
+===================
+
+ * Fix issue where `"Request aborted"` may be logged in `res.sendfile`
+ * Fix JSDoc for `Router` constructor
+ * deps: body-parser@1.18.3
+ - Fix deprecation warnings on Node.js 10+
+ - Fix stack trace for strict json parse error
+ - deps: depd@~1.1.2
+ - deps: http-errors@~1.6.3
+ - deps: iconv-lite@0.4.23
+ - deps: qs@6.5.2
+ - deps: raw-body@2.3.3
+ - deps: type-is@~1.6.16
+ * deps: proxy-addr@~2.0.4
+ - deps: ipaddr.js@1.8.0
+ * deps: qs@6.5.2
+ * deps: safe-buffer@5.1.2
+
+4.16.3 / 2018-03-12
+===================
+
+ * deps: accepts@~1.3.5
+ - deps: mime-types@~2.1.18
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: encodeurl@~1.0.2
+ - Fix encoding `%` as last character
+ * deps: finalhandler@1.1.1
+ - Fix 404 output for bad / missing pathnames
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: proxy-addr@~2.0.3
+ - deps: ipaddr.js@1.6.0
+ * deps: send@0.16.2
+ - Fix incorrect end tag in default error & redirects
+ - deps: depd@~1.1.2
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: serve-static@1.13.2
+ - Fix incorrect end tag in redirects
+ - deps: encodeurl@~1.0.2
+ - deps: send@0.16.2
+ * deps: statuses@~1.4.0
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+4.16.2 / 2017-10-09
+===================
+
+ * Fix `TypeError` in `res.send` when given `Buffer` and `ETag` header set
+ * perf: skip parsing of entire `X-Forwarded-Proto` header
+
+4.16.1 / 2017-09-29
+===================
+
+ * deps: send@0.16.1
+ * deps: serve-static@1.13.1
+ - Fix regression when `root` is incorrectly set to a file
+ - deps: send@0.16.1
+
+4.16.0 / 2017-09-28
+===================
+
+ * Add `"json escape"` setting for `res.json` and `res.jsonp`
+ * Add `express.json` and `express.urlencoded` to parse bodies
+ * Add `options` argument to `res.download`
+ * Improve error message when autoloading invalid view engine
+ * Improve error messages when non-function provided as middleware
+ * Skip `Buffer` encoding when not generating ETag for small response
+ * Use `safe-buffer` for improved Buffer API
+ * deps: accepts@~1.3.4
+ - deps: mime-types@~2.1.16
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: etag@~1.8.1
+ - perf: replace regular expression with substring
+ * deps: finalhandler@1.1.0
+ - Use `res.headersSent` when available
+ * deps: parseurl@~1.3.2
+ - perf: reduce overhead for full URLs
+ - perf: unroll the "fast-path" `RegExp`
+ * deps: proxy-addr@~2.0.2
+ - Fix trimming leading / trailing OWS in `X-Forwarded-For`
+ - deps: forwarded@~0.1.2
+ - deps: ipaddr.js@1.5.2
+ - perf: reduce overhead when no `X-Forwarded-For` header
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: send@0.16.0
+ - Add 70 new types for file extensions
+ - Add `immutable` option
+ - Fix missing `